Merge branch '11554-merge-couchdb-1.1'

122 files changed, 8622 insertions, 1620 deletions

diff --git a/.gitignore b/.gitignore
index 1996aa9c..beafc50b 100644
--- a/.gitignore
+++ b/.gitignore
@@ -2,6 +2,9 @@
 *.so
 *.Tpo
 *.beam
+*~
+*.orig
+*.rej
 erl_crash.dump
 
 # building
diff --git a/apps/couch/AUTHORS b/apps/couch/AUTHORS
index b1a3559e..e0181c1d 100644
--- a/apps/couch/AUTHORS
+++ b/apps/couch/AUTHORS
@@ -15,6 +15,6 @@ documentation or developing software. Some of these people are:
  * Mark Hammond <mhammond@skippinet.com.au>
  * Benoît Chesneau <benoitc@apache.org>
  * Filipe Manana <fdmanana@apache.org>
- * Robert Newson <robert.newson@gmail.com>
+ * Robert Newson <rnewson@apache.org>
 
 For a list of other credits see the `THANKS` file.
diff --git a/apps/couch/CHANGES b/apps/couch/CHANGES
index fdfd31d2..54a2e03c 100644
--- a/apps/couch/CHANGES
+++ b/apps/couch/CHANGES
@@ -1,6 +1,66 @@
 Apache CouchDB CHANGES
 ======================
 
+Version 1.1.1
+-------------
+
+This version has not been released yet.
+
+Version 1.1.0
+-------------
+
+All CHANGES for 1.0.2 and 1.0.3 also apply to 1.1.0.
+
+HTTP Interface:
+
+ * Native SSL support.
+ * Added support for HTTP range requests for attachments.
+ * Added built-in filters for `_changes`: `_doc_ids` and `_design`.
+ * Added configuration option for TCP_NODELAY aka "Nagle".
+ * Allow POSTing arguments to `_changes`.
+ * Allow `keys` parameter for GET requests to views.
+ * Allow wildcards in vhosts definitions.
+ * More granular ETag support for views.
+ * More flexible URL rewriter.
+ * Added support for recognizing "Q values" and media parameters in
+   HTTP Accept headers.
+ * Validate doc ids that come from a PUT to a URL.
+
+Externals:
+
+ * Added OS Process module to manage daemons outside of CouchDB.
+ * Added HTTP Proxy handler for more scalable externals.
+
+Replicator:
+
+ * Added `_replicator` database to manage replications.
+ * Fixed issues when an endpoint is a remote database accessible via SSL.
+ * Added support for continuous by-doc-IDs replication.
+ * Fix issue where revision info was omitted when replicating attachments.
+ * Integrity of attachment replication is now verified by MD5.
+
+Storage System:
+
+ * Multiple micro-optimizations when reading data.
+
+View Server:
+
+ * Added CommonJS support to map functions.
+ * Added `stale=update_after` query option that triggers a view update after
+   returning a `stale=ok` response.
+ * Warn about empty result caused by `startkey` and `endkey` limiting.
+ * Built-in reduce function `_sum` now accepts lists of integers as input.
+ * Added view query aliases start_key, end_key, start_key_doc_id and
+   end_key_doc_id.
+
+Futon:
+
+ * Added a "change password"-feature to Futon.
+
+URL Rewriter & Vhosts:
+
+ * Fix for variable substituion
+
 Version 1.0.2
 -------------
 
diff --git a/apps/couch/INSTALL.Unix b/apps/couch/INSTALL.Unix
index 768e3846..720134d4 100644
--- a/apps/couch/INSTALL.Unix
+++ b/apps/couch/INSTALL.Unix
@@ -8,7 +8,7 @@ Dependencies
 
 You will need the following installed:
 
- * Erlang OTP (>=R12B5)       (http://erlang.org/)
+ * Erlang OTP (>=R13B2)       (http://erlang.org/)
  * ICU                        (http://icu.sourceforge.net/)
  * OpenSSL                    (http://www.openssl.org/)
  * Mozilla SpiderMonkey (1.8) (http://www.mozilla.org/js/spidermonkey/)
diff --git a/apps/couch/INSTALL.Windows b/apps/couch/INSTALL.Windows
index 5c4a9587..d2082734 100644
--- a/apps/couch/INSTALL.Windows
+++ b/apps/couch/INSTALL.Windows
@@ -8,7 +8,7 @@ Dependencies
 
 You will need the following installed:
 
- * Erlang OTP (>=R12B5)       (http://erlang.org/)
+ * Erlang OTP (=14B01)        (http://erlang.org/)
  * ICU                        (http://icu.sourceforge.net/)
  * OpenSSL                    (http://www.openssl.org/)
  * Mozilla SpiderMonkey (1.8) (http://www.mozilla.org/js/spidermonkey/)
@@ -50,12 +50,17 @@ You must check that:
 
     * The `which cl` command points to the Microsoft compiler.
 
-If you do not do this, the ones found in `/usr/bin` may be used instead.
+    * The `which mc` command points to the Microsoft message compiler.
+
+    * The `which mt` command points to the Microsoft manifest tool.
+
+If you do not do this, the build may fail due to Cygwin ones found in `/usr/bin`
+being used instead.
 
 Building Erlang
 ---------------
 
-You must include OpenSSL.
+You must include Win32 OpenSSL.
 
 However, you can skip the GUI tools by running:
 
@@ -89,7 +94,7 @@ Remember to use `/cygdrive/c/` instead of `c:/` as the directory prefix.
 
 To set up your path, run:
 
-    export PATH=$ERL_TOP/release/win32/erts-5.7.2/bin:$PATH
+    export PATH=$ERL_TOP/release/win32/erts-5.8.2/bin:$PATH
 
 If everything was successful, you should be ready to build CouchDB.
 
@@ -101,8 +106,8 @@ Building CouchDB
 Once you have satisfied the dependencies you should run:
 
     ./configure \
-        --with-js-include=/cygdrive/c/path_to_seamonkey_include \
-        --with-js-lib=/cygdrive/c/path_to_seamonkey_lib \
+        --with-js-include=/cygdrive/c/path_to_spidermonkey_include \
+        --with-js-lib=/cygdrive/c/path_to_spidermonkey_lib \
         --with-win32-icu-binaries=/cygdrive/c/path_to_icu_binaries_root \
         --with-erlang=$ERL_TOP/release/win32/usr/include \
         --with-win32-curl=/cygdrive/c/path/to/curl/root/directory \
@@ -145,4 +150,4 @@ To check that everything has worked, point your web browser to:
 
     http://127.0.0.1:5984/_utils/index.html
 
-From here you should run the test suite.
+From here you should run the test suite in either Firefox 3.6+ or Safari 4+.
diff --git a/apps/couch/NEWS b/apps/couch/NEWS
index 9550856e..97eb58e7 100644
--- a/apps/couch/NEWS
+++ b/apps/couch/NEWS
@@ -7,6 +7,36 @@ For details about backwards incompatible changes, see:
 
 Each release section notes when backwards incompatible changes have been made.
 
+Version 1.1.1
+-------------
+
+This version has not been released yet.
+
+Version 1.1.0
+-------------
+
+All NEWS for 1.0.2 also apply to 1.1.0.
+
+This release contains backwards incompatible changes.
+
+ * Native SSL support.
+ * Added support for HTTP range requests for attachments.
+ * Added built-in filters for `_changes`: `_doc_ids` and `_design`.
+ * Added configuration option for TCP_NODELAY aka "Nagle".
+ * Allow wildcards in vhosts definitions.
+ * More granular ETag support for views.
+ * More flexible URL rewriter.
+ * Added OS Process module to manage daemons outside of CouchDB.
+ * Added HTTP Proxy handler for more scalable externals.
+ * Added `_replicator` database to manage replications.
+ * Multiple micro-optimizations when reading data.
+ * Added CommonJS support to map functions.
+ * Added `stale=update_after` query option that triggers a view update after
+   returning a `stale=ok` response.
+ * More explicit error messages when it's not possible to access a file due
+   to lack of permissions.
+ * Added a "change password"-feature to Futon.
+
 Version 1.0.2
 -------------
 
@@ -166,7 +196,7 @@ Version 0.10.1
 Version 0.10.0
 --------------
 
-This release contains backwards incompatible changes, please see above for help.
+This release contains backwards incompatible changes.
 
  * General performance improvements.
  * View index generation speedups.
@@ -198,7 +228,7 @@ Version 0.9.1
 Version 0.9.0
 -------------
 
-This release contains backwards incompatible changes, please see above for help.
+This release contains backwards incompatible changes.
 
  * Modular configuration.
  * Performance enhancements for document and view access.
@@ -222,7 +252,7 @@ Version 0.8.1-incubating
 Version 0.8.0-incubating
 ------------------------
 
-This release contains backwards incompatible changes, please see above for help.
+This release contains backwards incompatible changes.
 
  * Changed core licensing to the Apache Software License 2.0.
  * Refactoring of the core view and storage engines.
diff --git a/apps/couch/NOTICE b/apps/couch/NOTICE
index d547e55f..4daa496f 100644
--- a/apps/couch/NOTICE
+++ b/apps/couch/NOTICE
@@ -17,6 +17,10 @@ This product also includes the following third-party components:
  * jQuery (http://jquery.com/)
 
    Copyright 2010, John Resig
+ 
+ * jQuery UI (http://jqueryui.com)
+
+   Copyright 2011, Paul Bakaus
 
  * json2.js (http://www.json.org/)
 
@@ -46,6 +50,6 @@ This product also includes the following third-party components:
 
    Copyright 1999, Masanao Izumo <iz@onicos.co.jp>
 
-* jspec.js (http://visionmedia.github.com/jspec/)
+ * jspec.js (http://visionmedia.github.com/jspec/)
 
   Copyright 2010 TJ Holowaychuk <tj@vision-media.ca>
diff --git a/apps/couch/THANKS b/apps/couch/THANKS
index 15072e2a..aae7991c 100644
--- a/apps/couch/THANKS
+++ b/apps/couch/THANKS
@@ -63,12 +63,23 @@ suggesting improvements or submitting changes. Some of these people are:
  * Paul Bonser <pib@paulbonser.com>
  * Caleb Land <caleb.land@gmail.com>
  * Juhani Ränkimies <juhani@juranki.com>
+ * Kev Jackson <foamdino@gmail.com>
+ * Jonathan D. Knezek <jdknezek@gmail.com>
+ * David Rose <doppler@gmail.com>
  * Lim Yue Chuan <shasderias@gmail.com>
  * David Davis <xantus@xantus.org>
+ * Klaus Trainer <klaus.trainer@web.de>
  * Dale Harvey <dale@arandomurl.com>
  * Juuso Väänänen <juuso@vaananen.org>
+ * Jeff Zellner <jeff.zellner@gmail.com>
  * Benjamin Young <byoung@bigbluehat.com>
  * Gabriel Farrell <gsf747@gmail.com>
  * Mike Leddy <mike@loop.com.br>
+ * Felix Hummel <apache@felixhummel.de>
+ * Tim Smith <tim@couchbase.com>
+ * Sam Bisbee <sam@sbisbee.com>
+ * Nathan Vander Wilt <natevw@yahoo.com>
+ * Caolan McMahon <caolan.mcmahon@googlemail.com>
+ 
 
 For a list of authors see the `AUTHORS` file.
diff --git a/apps/couch/include/couch_db.hrl b/apps/couch/include/couch_db.hrl
index 6b3d53a1..a96d5d4f 100644
--- a/apps/couch/include/couch_db.hrl
+++ b/apps/couch/include/couch_db.hrl
@@ -25,26 +25,9 @@
 
 -define(DEFAULT_ATTACHMENT_CONTENT_TYPE, <<"application/octet-stream">>).
 
--define(LOG_DEBUG(Format, Args),
-    case couch_log:debug_on() of
-        true ->
-            gen_event:sync_notify(error_logger,
-                {self(), couch_debug, erlang:get(nonce), {Format, Args}});
-        false -> ok
-    end).
-
--define(LOG_INFO(Format, Args),
-    case couch_log:info_on() of
-        true ->
-            gen_event:sync_notify(error_logger,
-                {self(), couch_info, erlang:get(nonce), {Format, Args}});
-        false -> ok
-    end).
-
--define(LOG_ERROR(Format, Args),
-    gen_event:sync_notify(error_logger,
-            {self(), couch_error, erlang:get(nonce), {Format, Args}})).
-
+-define(LOG_DEBUG(Format, Args), couch_log:debug(Format, Args)).
+-define(LOG_INFO(Format, Args), couch_log:info(Format, Args)).
+-define(LOG_ERROR(Format, Args), couch_log:error(Format, Args)).
 
 -record(rev_info,
     {
@@ -73,6 +56,7 @@
     {mochi_req,
     peer,
     method,
+    requested_path_parts,
     path_parts,
     db_url_handlers,
     user_ctx,
@@ -194,6 +178,7 @@
 
     view_type = nil,
     include_docs = false,
+    conflicts = false,
     stale = false,
     multi_get = false,
     callback = nil,
@@ -231,6 +216,7 @@
     def_lang,
     design_options=[],
     views,
+    lib,
     id_btree=nil,
     current_seq=0,
     purge_seq=0,
@@ -240,6 +226,8 @@
 
 -record(view,
     {id_num,
+    update_seq=0,
+    purge_seq=0,
     map_names=[],
     def,
     btree=nil,
@@ -287,7 +275,9 @@
     heartbeat,
     timeout,
     filter = "",
-    include_docs = false
+    include_docs = false,
+    conflicts = false,
+    db_open_options = []
 }).
 
 -record(proc, {
diff --git a/apps/couch/include/couch_js_functions.hrl b/apps/couch/include/couch_js_functions.hrl
new file mode 100644
index 00000000..d07eead5
--- /dev/null
+++ b/apps/couch/include/couch_js_functions.hrl
@@ -0,0 +1,238 @@
+% Licensed under the Apache License, Version 2.0 (the "License"); you may not
+% use this file except in compliance with the License.  You may obtain a copy of
+% the License at
+%
+%   http://www.apache.org/licenses/LICENSE-2.0
+%
+% Unless required by applicable law or agreed to in writing, software
+% distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
+% WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.  See the
+% License for the specific language governing permissions and limitations under
+% the License.
+
+-define(AUTH_DB_DOC_VALIDATE_FUNCTION, <<"
+    function(newDoc, oldDoc, userCtx) {
+        if (newDoc._deleted === true) {
+            // allow deletes by admins and matching users
+            // without checking the other fields
+            if ((userCtx.roles.indexOf('_admin') !== -1) ||
+                (userCtx.name == oldDoc.name)) {
+                return;
+            } else {
+                throw({forbidden: 'Only admins may delete other user docs.'});
+            }
+        }
+
+        if ((oldDoc && oldDoc.type !== 'user') || newDoc.type !== 'user') {
+            throw({forbidden : 'doc.type must be user'});
+        } // we only allow user docs for now
+
+        if (!newDoc.name) {
+            throw({forbidden: 'doc.name is required'});
+        }
+
+        if (newDoc.roles && !isArray(newDoc.roles)) {
+            throw({forbidden: 'doc.roles must be an array'});
+        }
+
+        if (newDoc._id !== ('org.couchdb.user:' + newDoc.name)) {
+            throw({
+                forbidden: 'Doc ID must be of the form org.couchdb.user:name'
+            });
+        }
+
+        if (oldDoc) { // validate all updates
+            if (oldDoc.name !== newDoc.name) {
+                throw({forbidden: 'Usernames can not be changed.'});
+            }
+        }
+
+        if (newDoc.password_sha && !newDoc.salt) {
+            throw({
+                forbidden: 'Users with password_sha must have a salt.' +
+                    'See /_utils/script/couch.js for example code.'
+            });
+        }
+
+        if (userCtx.roles.indexOf('_admin') === -1) {
+            if (oldDoc) { // validate non-admin updates
+                if (userCtx.name !== newDoc.name) {
+                    throw({
+                        forbidden: 'You may only update your own user document.'
+                    });
+                }
+                // validate role updates
+                var oldRoles = oldDoc.roles.sort();
+                var newRoles = newDoc.roles.sort();
+
+                if (oldRoles.length !== newRoles.length) {
+                    throw({forbidden: 'Only _admin may edit roles'});
+                }
+
+                for (var i = 0; i < oldRoles.length; i++) {
+                    if (oldRoles[i] !== newRoles[i]) {
+                        throw({forbidden: 'Only _admin may edit roles'});
+                    }
+                }
+            } else if (newDoc.roles.length > 0) {
+                throw({forbidden: 'Only _admin may set roles'});
+            }
+        }
+
+        // no system roles in users db
+        for (var i = 0; i < newDoc.roles.length; i++) {
+            if (newDoc.roles[i][0] === '_') {
+                throw({
+                    forbidden:
+                    'No system roles (starting with underscore) in users db.'
+                });
+            }
+        }
+
+        // no system names as names
+        if (newDoc.name[0] === '_') {
+            throw({forbidden: 'Username may not start with underscore.'});
+        }
+    }
+">>).
+
+
+-define(REP_DB_DOC_VALIDATE_FUN, <<"
+    function(newDoc, oldDoc, userCtx) {
+        function reportError(error_msg) {
+            log('Error writing document `' + newDoc._id +
+                '\\' to the replicator database: ' + error_msg);
+            throw({forbidden: error_msg});
+        }
+
+        function validateEndpoint(endpoint, fieldName) {
+            if ((typeof endpoint !== 'string') &&
+                ((typeof endpoint !== 'object') || (endpoint === null))) {
+
+                reportError('The `' + fieldName + '\\' property must exist' +
+                    ' and be either a string or an object.');
+            }
+
+            if (typeof endpoint === 'object') {
+                if ((typeof endpoint.url !== 'string') || !endpoint.url) {
+                    reportError('The url property must exist in the `' +
+                        fieldName + '\\' field and must be a non-empty string.');
+                }
+
+                if ((typeof endpoint.auth !== 'undefined') &&
+                    ((typeof endpoint.auth !== 'object') ||
+                        endpoint.auth === null)) {
+
+                    reportError('`' + fieldName +
+                        '.auth\\' must be a non-null object.');
+                }
+
+                if ((typeof endpoint.headers !== 'undefined') &&
+                    ((typeof endpoint.headers !== 'object') ||
+                        endpoint.headers === null)) {
+
+                    reportError('`' + fieldName +
+                        '.headers\\' must be a non-null object.');
+                }
+            }
+        }
+
+        var isReplicator = (userCtx.roles.indexOf('_replicator') >= 0);
+        var isAdmin = (userCtx.roles.indexOf('_admin') >= 0);
+
+        if (oldDoc && !newDoc._deleted && !isReplicator &&
+            (oldDoc._replication_state === 'triggered')) {
+            reportError('Only the replicator can edit replication documents ' +
+                'that are in the triggered state.');
+        }
+
+        if (!newDoc._deleted) {
+            validateEndpoint(newDoc.source, 'source');
+            validateEndpoint(newDoc.target, 'target');
+
+            if ((typeof newDoc.create_target !== 'undefined') &&
+                (typeof newDoc.create_target !== 'boolean')) {
+
+                reportError('The `create_target\\' field must be a boolean.');
+            }
+
+            if ((typeof newDoc.continuous !== 'undefined') &&
+                (typeof newDoc.continuous !== 'boolean')) {
+
+                reportError('The `continuous\\' field must be a boolean.');
+            }
+
+            if ((typeof newDoc.doc_ids !== 'undefined') &&
+                !isArray(newDoc.doc_ids)) {
+
+                reportError('The `doc_ids\\' field must be an array of strings.');
+            }
+
+            if ((typeof newDoc.filter !== 'undefined') &&
+                ((typeof newDoc.filter !== 'string') || !newDoc.filter)) {
+
+                reportError('The `filter\\' field must be a non-empty string.');
+            }
+
+            if ((typeof newDoc.query_params !== 'undefined') &&
+                ((typeof newDoc.query_params !== 'object') ||
+                    newDoc.query_params === null)) {
+
+                reportError('The `query_params\\' field must be an object.');
+            }
+
+            if (newDoc.user_ctx) {
+                var user_ctx = newDoc.user_ctx;
+
+                if ((typeof user_ctx !== 'object') || (user_ctx === null)) {
+                    reportError('The `user_ctx\\' property must be a ' +
+                        'non-null object.');
+                }
+
+                if (!(user_ctx.name === null ||
+                    (typeof user_ctx.name === 'undefined') ||
+                    ((typeof user_ctx.name === 'string') &&
+                        user_ctx.name.length > 0))) {
+
+                    reportError('The `user_ctx.name\\' property must be a ' +
+                        'non-empty string or null.');
+                }
+
+                if (!isAdmin && (user_ctx.name !== userCtx.name)) {
+                    reportError('The given `user_ctx.name\\' is not valid');
+                }
+
+                if (user_ctx.roles && !isArray(user_ctx.roles)) {
+                    reportError('The `user_ctx.roles\\' property must be ' +
+                        'an array of strings.');
+                }
+
+                if (!isAdmin && user_ctx.roles) {
+                    for (var i = 0; i < user_ctx.roles.length; i++) {
+                        var role = user_ctx.roles[i];
+
+                        if (typeof role !== 'string' || role.length === 0) {
+                            reportError('Roles must be non-empty strings.');
+                        }
+                        if (userCtx.roles.indexOf(role) === -1) {
+                            reportError('Invalid role (`' + role +
+                                '\\') in the `user_ctx\\'');
+                        }
+                    }
+                }
+            } else {
+                if (!isAdmin) {
+                    reportError('The `user_ctx\\' property is missing (it is ' +
+                       'optional for admins only).');
+                }
+            }
+        } else {
+            if (!isAdmin) {
+                if (!oldDoc.user_ctx || (oldDoc.user_ctx.name !== userCtx.name)) {
+                    reportError('Replication documents can only be deleted by ' +
+                        'admins or by the users who created them.');
+                }
+            }
+        }
+    }
+">>).
diff --git a/apps/couch/license.skip b/apps/couch/license.skip
index a7aa6ec3..151ccc08 100644
--- a/apps/couch/license.skip
+++ b/apps/couch/license.skip
@@ -66,6 +66,7 @@
 ^share/www/script/sha1.js
 ^share/www/script/base64.js
 ^share/www/script/test/lorem*
+^share/www/style/jquery-ui-1.8.11.custom.css
 ^src/Makefile
 ^src/Makefile.in
 ^src/couchdb/.*beam
@@ -92,6 +93,9 @@
 ^test/bench/Makefile
 ^test/bench/Makefile.in
 ^test/etap/.*beam
+^test/etap/.*\.o
+^test/etap/.deps/*
+^test/etap/test_cfg_register
 ^test/etap/Makefile
 ^test/etap/Makefile.in
 ^test/etap/temp.*
diff --git a/apps/couch/src/couch_btree.erl b/apps/couch/src/couch_btree.erl
index 2fcc8ae7..3f2e86d8 100644
--- a/apps/couch/src/couch_btree.erl
+++ b/apps/couch/src/couch_btree.erl
@@ -198,7 +198,7 @@ query_modify(Bt, LookupKeys, InsertValues, RemoveKeys) ->
     {ok, NewRoot, Bt3} = complete_root(Bt2, KeyPointers),
     {ok, QueryResults, Bt3#btree{root=NewRoot}}.
 
-% for ordering different operatations with the same key.
+% for ordering different operations with the same key.
 % fetch < remove < insert
 op_order(fetch) -> 1;
 op_order(remove) -> 2;
diff --git a/apps/couch/src/couch_changes.erl b/apps/couch/src/couch_changes.erl
index 196f2fd5..44d0ad46 100644
--- a/apps/couch/src/couch_changes.erl
+++ b/apps/couch/src/couch_changes.erl
@@ -17,17 +17,19 @@
     configure_filter/4, filter/2]).
 
 %% @spec handle_changes(#changes_args{}, #httpd{} | {json_req, {[any()]}}, #db{}) -> any()
-handle_changes(#changes_args{filter=Raw, style=Style}=Args1, Req, Db) ->
-    Args = Args1#changes_args{filter=make_filter_fun(Raw, Style, Req, Db)},
+handle_changes(#changes_args{style=Style}=Args1, Req, Db) ->
+    #changes_args{feed = Feed} = Args = Args1#changes_args{
+        filter = make_filter_fun(Args1#changes_args.filter, Style, Req, Db)
+    },
     StartSeq = case Args#changes_args.dir of
     rev ->
         couch_db:get_update_seq(Db);
     fwd ->
         Args#changes_args.since
     end,
-    if Args#changes_args.feed == "continuous" orelse
-        Args#changes_args.feed == "longpoll" ->
-        fun(Callback) ->
+    if Feed == "continuous" orelse Feed == "longpoll" ->
+        fun(CallbackAcc) ->
+            {Callback, UserAcc} = get_callback_acc(CallbackAcc),
             Self = self(),
             {ok, Notify} = couch_db_update_notifier:start_link(
                 fun({_, DbName}) when DbName == Db#db.name ->
@@ -36,12 +38,13 @@ handle_changes(#changes_args{filter=Raw, style=Style}=Args1, Req, Db) ->
                     ok
                 end
             ),
-            start_sending_changes(Callback, Args#changes_args.feed),
+            UserAcc2 = start_sending_changes(Callback, UserAcc, Feed),
             {Timeout, TimeoutFun} = get_changes_timeout(Args, Callback),
             try
                 keep_sending_changes(
                     Args,
                     Callback,
+                    UserAcc2,
                     Db,
                     StartSeq,
                     <<"">>,
@@ -50,37 +53,52 @@ handle_changes(#changes_args{filter=Raw, style=Style}=Args1, Req, Db) ->
                 )
             after
                 couch_db_update_notifier:stop(Notify),
-                get_rest_db_updated() % clean out any remaining update messages
+                get_rest_db_updated(ok) % clean out any remaining update messages
             end
         end;
     true ->
-        fun(Callback) ->
-            start_sending_changes(Callback, Args#changes_args.feed),
-            {ok, {_, LastSeq, _Prepend, _, _, _, _, _}} =
+        fun(CallbackAcc) ->
+            {Callback, UserAcc} = get_callback_acc(CallbackAcc),
+            UserAcc2 = start_sending_changes(Callback, UserAcc, Feed),
+            {ok, {_, LastSeq, _Prepend, _, _, UserAcc3, _, _, _, _}} =
                 send_changes(
                     Args#changes_args{feed="normal"},
                     Callback,
+                    UserAcc2,
                     Db,
                     StartSeq,
-                    <<"">>
+                    <<>>
                 ),
-            end_sending_changes(Callback, LastSeq, Args#changes_args.feed)
+            end_sending_changes(Callback, UserAcc3, LastSeq, Feed)
         end
     end.
 
+get_callback_acc({Callback, _UserAcc} = Pair) when is_function(Callback, 3) ->
+    Pair;
+get_callback_acc(Callback) when is_function(Callback, 2) ->
+    {fun(Ev, Data, _) -> Callback(Ev, Data) end, ok}.
+
 %% @spec make_filter_fun(string(), main_only|all_docs, #httpd{} | {json_req,
 %%      {[any()]}}, #db{}) -> fun()
-make_filter_fun(Filter, Style, Req, Db) when is_list(Filter) ->
-    case [?l2b(couch_httpd:unquote(X)) || X <- string:tokens(Filter, "/")] of
+make_filter_fun([$_ | _] = FilterName, Style, Req, Db) ->
+    builtin_filter_fun(FilterName, Style, Req, Db);
+make_filter_fun(FilterName, Style, Req, Db) ->
+    os_filter_fun(FilterName, Style, Req, Db).
+
+os_filter_fun(FilterName, Style, Req, Db) ->
+    case [list_to_binary(couch_httpd:unquote(Part))
+            || Part <- string:tokens(FilterName, "/")] of
     [] ->
-        make_filter_fun(nil, Style, Req, Db);
+        fun(_Db2, #doc_info{revs=Revs}) ->
+                builtin_results(Style, Revs)
+        end;
     [DName, FName] ->
         DesignId = <<"_design/", DName/binary>>,
         DDoc = couch_httpd_db:couch_doc_open(Db, DesignId, nil, []),
         % validate that the ddoc has the filter fun
         #doc{body={Props}} = DDoc,
         couch_util:get_nested_json_value({Props}, [<<"filters">>, FName]),
-        fun(DocInfo) ->
+        fun(Db2, DocInfo) ->
             DocInfos =
             case Style of
             main_only ->
@@ -89,10 +107,10 @@ make_filter_fun(Filter, Style, Req, Db) when is_list(Filter) ->
                 [DocInfo#doc_info{revs=[Rev]}|| Rev <- DocInfo#doc_info.revs]
             end,
             Docs = [Doc || {ok, Doc} <- [
-                    couch_db:open_doc(Db, DocInfo2, [deleted, conflicts])
+                    couch_db:open_doc(Db2, DocInfo2, [deleted, conflicts])
                         || DocInfo2 <- DocInfos]],
             {ok, Passes} = couch_query_servers:filter_docs(
-                Req, Db, DDoc, FName, Docs
+                Req, Db2, DDoc, FName, Docs
             ),
             [{[{<<"rev">>, couch_doc:rev_to_str({RevPos,RevId})}]}
                 || {Pass, #doc{revs={RevPos,[RevId|_]}}}
@@ -101,9 +119,50 @@ make_filter_fun(Filter, Style, Req, Db) when is_list(Filter) ->
     _Else ->
         throw({bad_request,
             "filter parameter must be of the form `designname/filtername`"})
+    end.
+
+builtin_filter_fun("_doc_ids", Style, {json_req, {Props}}, _Db) ->
+    filter_docids(couch_util:get_value(<<"doc_ids">>, Props), Style);
+builtin_filter_fun("_doc_ids", Style, #httpd{method='POST'}=Req, _Db) ->
+    {Props} = couch_httpd:json_body_obj(Req),
+    DocIds =  couch_util:get_value(<<"doc_ids">>, Props, nil),
+    filter_docids(DocIds, Style);
+builtin_filter_fun("_doc_ids", Style, #httpd{method='GET'}=Req, _Db) ->
+    DocIds = ?JSON_DECODE(couch_httpd:qs_value(Req, "doc_ids", "null")),
+    filter_docids(DocIds, Style);
+builtin_filter_fun("_design", Style, _Req, _Db) ->
+    filter_designdoc(Style);
+builtin_filter_fun(_FilterName, _Style, _Req, _Db) ->
+    throw({bad_request, "unknown builtin filter name"}).
+
+filter_docids(DocIds, Style) when is_list(DocIds)->
+    fun(_Db, #doc_info{id=DocId, revs=Revs}) ->
+            case lists:member(DocId, DocIds) of
+                true ->
+                    builtin_results(Style, Revs);
+                _ -> []
+            end
     end;
-make_filter_fun(_, Style, _, _) ->
-    fun(DI) -> ?MODULE:filter(DI, Style) end.
+filter_docids(_, _) ->
+    throw({bad_request, "`doc_ids` filter parameter is not a list."}).
+
+filter_designdoc(Style) ->
+    fun(_Db, #doc_info{id=DocId, revs=Revs}) ->
+            case DocId of
+            <<"_design", _/binary>> ->
+                    builtin_results(Style, Revs);
+                _ -> []
+            end
+    end.
+
+builtin_results(Style, [#rev_info{rev=Rev}|_]=Revs) ->
+    case Style of
+        main_only ->
+            [{[{<<"rev">>, couch_doc:rev_to_str(Rev)}]}];
+        all_docs ->
+            [{[{<<"rev">>, couch_doc:rev_to_str(R)}]}
+                || #rev_info{rev=R} <- Revs]
+    end.
 
 configure_filter(Filter, Style, Req, Db) when is_list(Filter) ->
     case [?l2b(couch_httpd:unquote(X)) || X <- string:tokens(Filter, "/")] of
@@ -118,6 +177,17 @@ configure_filter(Filter, Style, Req, Db) when is_list(Filter) ->
         #doc{body={Props}} = DDoc,
         couch_util:get_nested_json_value({Props}, [<<"filters">>, FName]),
         {custom, Style, {Db, JsonReq, DDoc, FName}};
+    [<<"_doc_ids">>] ->
+        DocIds = ?JSON_DECODE(couch_httpd:qs_value(Req, "doc_ids", "null")),
+        case is_list(DocIds) of
+            true -> ok;
+            false -> throw({bad_request, "`doc_ids` filter parameter is not a list."})
+        end,
+        {builtin, Style, {doc_ids, DocIds}};
+    [<<"_design">>] ->
+        {builtin, Style, design};
+    [<<"_", _/binary>>] ->
+        throw({bad_request, "unknown builtin filter name"});
     _Else ->
         throw({bad_request,
             "filter parameter must be of the form `designname/filtername`"})
@@ -132,7 +202,11 @@ filter(#doc_info{revs=Revs}, all_docs) ->
 filter(#doc_info{id=Id, revs=RevInfos}, {custom, main_only, Acc}) ->
     custom_filter(Id, [(hd(RevInfos))#rev_info.rev], Acc);
 filter(#doc_info{id=Id, revs=RevInfos}, {custom, all_docs, Acc}) ->
-    custom_filter(Id, [R || #rev_info{rev=R} <- RevInfos], Acc).
+    custom_filter(Id, [R || #rev_info{rev=R} <- RevInfos], Acc);
+filter(#doc_info{id=Id, revs=RevInfos}, {builtin, main_only, Acc}) ->
+    builtin_filter(Id, [(hd(RevInfos))#rev_info.rev], Acc);
+filter(#doc_info{id=Id, revs=RevInfos}, {builtin, all_docs, Acc}) ->
+    builtin_filter(Id, [R || #rev_info{rev=R} <- RevInfos], Acc).
 
 custom_filter(Id, Revs, {Db, JsonReq, DDoc, Filter}) ->
     {ok, Results} = fabric:open_revs(Db, Id, Revs, [deleted, conflicts]),
@@ -144,6 +218,21 @@ custom_filter(Id, Revs, {Db, JsonReq, DDoc, Filter}) ->
         || {Pass, #doc{revs={RevPos,[RevId|_]}}}
         <- lists:zip(Passes, Docs), Pass == true].
 
+builtin_filter(Id, Revs, design) ->
+    case Id of
+        <<"_design", _/binary>> ->
+            [{[{<<"rev">>, couch_doc:rev_to_str(Rev)}]} || Rev <- Revs];
+        _ ->
+            []
+    end;
+builtin_filter(Id, Revs, {doc_ids, DocIds}) ->
+    case lists:member(Id, DocIds) of
+        true ->
+            [{[{<<"rev">>, couch_doc:rev_to_str(Rev)}]} || Rev <- Revs];
+        false ->
+            []
+    end.
+
 get_changes_timeout(Args, Callback) ->
     #changes_args{
         heartbeat = Heartbeat,
@@ -157,28 +246,31 @@ get_changes_timeout(Args, Callback) ->
     undefined ->
         case Timeout of
         undefined ->
-            {DefaultTimeout, fun() -> stop end};
+            {DefaultTimeout, fun(UserAcc) -> {stop, UserAcc} end};
         infinity ->
-            {infinity, fun() -> stop end};
+            {infinity, fun(UserAcc) -> {stop, UserAcc} end};
         _ ->
-            {lists:min([DefaultTimeout, Timeout]), fun() -> stop end}
+            {lists:min([DefaultTimeout, Timeout]),
+                fun(UserAcc) -> {stop, UserAcc} end}
         end;
     true ->
-        {DefaultTimeout, fun() -> Callback(timeout, ResponseType), ok end};
+        {DefaultTimeout,
+            fun(UserAcc) -> {ok, Callback(timeout, ResponseType, UserAcc)} end};
     _ ->
         {lists:min([DefaultTimeout, Heartbeat]),
-            fun() -> Callback(timeout, ResponseType), ok end}
+            fun(UserAcc) -> {ok, Callback(timeout, ResponseType, UserAcc)} end}
     end.
 
-start_sending_changes(_Callback, "continuous") ->
-    ok;
-start_sending_changes(Callback, ResponseType) ->
-    Callback(start, ResponseType).
+start_sending_changes(_Callback, UserAcc, "continuous") ->
+    UserAcc;
+start_sending_changes(Callback, UserAcc, ResponseType) ->
+    Callback(start, ResponseType, UserAcc).
 
-send_changes(Args, Callback, Db, StartSeq, Prepend) ->
+send_changes(Args, Callback, UserAcc, Db, StartSeq, Prepend) ->
     #changes_args{
         style = Style,
         include_docs = IncludeDocs,
+        conflicts = Conflicts,
         limit = Limit,
         feed = ResponseType,
         dir = Dir,
@@ -190,33 +282,36 @@ send_changes(Args, Callback, Db, StartSeq, Prepend) ->
         StartSeq,
         fun changes_enumerator/2,
         [{dir, Dir}],
-        {Db, StartSeq, Prepend, FilterFun, Callback, ResponseType, Limit,
-            IncludeDocs}
+        {Db, StartSeq, Prepend, FilterFun, Callback, UserAcc, ResponseType,
+            Limit, IncludeDocs, Conflicts}
     ).
 
-keep_sending_changes(Args, Callback, Db, StartSeq, Prepend, Timeout,
+keep_sending_changes(Args, Callback, UserAcc, Db, StartSeq, Prepend, Timeout,
     TimeoutFun) ->
     #changes_args{
         feed = ResponseType,
-        limit = Limit
+        limit = Limit,
+        db_open_options = DbOptions
     } = Args,
     % ?LOG_INFO("send_changes start ~p",[StartSeq]),
-    {ok, {_, EndSeq, Prepend2, _, _, _, NewLimit, _}} = send_changes(
-        Args#changes_args{dir=fwd}, Callback, Db, StartSeq, Prepend
+    {ok, {_, EndSeq, Prepend2, _, _, UserAcc2, _, NewLimit, _, _}} = send_changes(
+        Args#changes_args{dir=fwd}, Callback, UserAcc, Db, StartSeq, Prepend
     ),
     % ?LOG_INFO("send_changes last ~p",[EndSeq]),
     couch_db:close(Db),
     if Limit > NewLimit, ResponseType == "longpoll" ->
-        end_sending_changes(Callback, EndSeq, ResponseType);
+        end_sending_changes(Callback, UserAcc2, EndSeq, ResponseType);
     true ->
-        case wait_db_updated(Timeout, TimeoutFun) of
-        updated ->
+        case wait_db_updated(Timeout, TimeoutFun, UserAcc2) of
+        {updated, UserAcc3} ->
             % ?LOG_INFO("wait_db_updated updated ~p",[{Db#db.name, EndSeq}]),
-            case couch_db:open(Db#db.name, [{user_ctx, Db#db.user_ctx}]) of
+            DbOptions1 = [{user_ctx, Db#db.user_ctx} | DbOptions],
+            case couch_db:open(Db#db.name, DbOptions1) of
             {ok, Db2} ->
                 keep_sending_changes(
                     Args#changes_args{limit=NewLimit},
                     Callback,
+                    UserAcc3,
                     Db2,
                     EndSeq,
                     Prepend2,
@@ -224,79 +319,96 @@ keep_sending_changes(Args, Callback, Db, StartSeq, Prepend, Timeout,
                     TimeoutFun
                 );
             _Else ->
-                end_sending_changes(Callback, EndSeq, ResponseType)
+                end_sending_changes(Callback, UserAcc2, EndSeq, ResponseType)
             end;
-        stop ->
+        {stop, UserAcc3} ->
             % ?LOG_INFO("wait_db_updated stop ~p",[{Db#db.name, EndSeq}]),
-            end_sending_changes(Callback, EndSeq, ResponseType)
+            end_sending_changes(Callback, UserAcc3, EndSeq, ResponseType)
         end
     end.
 
-end_sending_changes(Callback, EndSeq, ResponseType) ->
-    Callback({stop, EndSeq}, ResponseType).
+end_sending_changes(Callback, UserAcc, EndSeq, ResponseType) ->
+    Callback({stop, EndSeq}, ResponseType, UserAcc).
 
-changes_enumerator(DocInfo, {Db, _, _, FilterFun, Callback, "continuous",
-    Limit, IncludeDocs}) ->
+changes_enumerator(DocInfo, {Db, _, _, FilterFun, Callback, UserAcc,
+    "continuous", Limit, IncludeDocs, Conflicts}) ->
 
-    #doc_info{id=Id, high_seq=Seq, revs=[#rev_info{deleted=Del,rev=Rev}|_]}
-        = DocInfo,
-    Results0 = FilterFun(DocInfo),
+    #doc_info{high_seq = Seq} = DocInfo,
+    Results0 = FilterFun(Db, DocInfo),
     Results = [Result || Result <- Results0, Result /= null],
     Go = if Limit =< 1 -> stop; true -> ok end,
     case Results of
     [] ->
-        {Go, {Db, Seq, nil, FilterFun, Callback, "continuous", Limit,
-                IncludeDocs}
+        {Go, {Db, Seq, nil, FilterFun, Callback, UserAcc, "continuous", Limit,
+                IncludeDocs, Conflicts}
         };
     _ ->
-        ChangesRow = changes_row(Db, Seq, Id, Del, Results, Rev, IncludeDocs),
-        Callback({change, ChangesRow, <<"">>}, "continuous"),
-        {Go, {Db, Seq, nil, FilterFun, Callback, "continuous",  Limit - 1,
-                IncludeDocs}
+        ChangesRow = changes_row(Db, Results, DocInfo, IncludeDocs, Conflicts),
+        UserAcc2 = Callback({change, ChangesRow, <<>>}, "continuous", UserAcc),
+        {Go, {Db, Seq, nil, FilterFun, Callback, UserAcc2, "continuous",
+                Limit - 1, IncludeDocs, Conflicts}
         }
     end;
-changes_enumerator(DocInfo, {Db, _, Prepend, FilterFun, Callback, ResponseType,
-    Limit, IncludeDocs}) ->
+changes_enumerator(DocInfo, {Db, _, Prepend, FilterFun, Callback, UserAcc,
+    ResponseType, Limit, IncludeDocs, Conflicts}) ->
 
-    #doc_info{id=Id, high_seq=Seq, revs=[#rev_info{deleted=Del,rev=Rev}|_]}
-        = DocInfo,
-    Results0 = FilterFun(DocInfo),
+    #doc_info{high_seq = Seq} = DocInfo,
+    Results0 = FilterFun(Db, DocInfo),
     Results = [Result || Result <- Results0, Result /= null],
-    Go = if Limit =< 1 -> stop; true -> ok end,
+    Go = if (Limit =< 1) andalso Results =/= [] -> stop; true -> ok end,
     case Results of
     [] ->
-        {Go, {Db, Seq, Prepend, FilterFun, Callback, ResponseType, Limit,
-                IncludeDocs}
+        {Go, {Db, Seq, Prepend, FilterFun, Callback, UserAcc, ResponseType,
+                Limit, IncludeDocs, Conflicts}
         };
     _ ->
-        ChangesRow = changes_row(Db, Seq, Id, Del, Results, Rev, IncludeDocs),
-        Callback({change, ChangesRow, Prepend}, ResponseType),
-        {Go, {Db, Seq, <<",\n">>, FilterFun, Callback, ResponseType, Limit - 1,
-                IncludeDocs}
+        ChangesRow = changes_row(Db, Results, DocInfo, IncludeDocs, Conflicts),
+        UserAcc2 = Callback({change, ChangesRow, Prepend}, ResponseType, UserAcc),
+        {Go, {Db, Seq, <<",\n">>, FilterFun, Callback, UserAcc2, ResponseType,
+                Limit - 1, IncludeDocs, Conflicts}
         }
     end.
 
 
-changes_row(Db, Seq, Id, Del, Results, Rev, true) ->
-    {[{<<"seq">>, Seq}, {<<"id">>, Id}, {<<"changes">>, Results}] ++
-        deleted_item(Del) ++ couch_httpd_view:doc_member(Db, {Id, Rev})};
-changes_row(_, Seq, Id, Del, Results, _, false) ->
+changes_row(Db, Results, DocInfo, IncludeDoc, Conflicts) ->
+    #doc_info{
+        id = Id, high_seq = Seq, revs = [#rev_info{deleted = Del} | _]
+    } = DocInfo,
     {[{<<"seq">>, Seq}, {<<"id">>, Id}, {<<"changes">>, Results}] ++
-        deleted_item(Del)}.
+        deleted_item(Del) ++ case IncludeDoc of
+            true ->
+                Options = if Conflicts -> [conflicts]; true -> [] end,
+                couch_httpd_view:doc_member(Db, DocInfo, Options);
+            false ->
+                []
+        end}.
 
-deleted_item(true) -> [{deleted, true}];
+deleted_item(true) -> [{<<"deleted">>, true}];
 deleted_item(_) -> [].
 
 % waits for a db_updated msg, if there are multiple msgs, collects them.
-wait_db_updated(Timeout, TimeoutFun) ->
-    receive db_updated -> get_rest_db_updated()
+wait_db_updated(Timeout, TimeoutFun, UserAcc) ->
+    receive
+    db_updated ->
+        get_rest_db_updated(UserAcc)
     after Timeout ->
-        case TimeoutFun() of
-        ok -> wait_db_updated(Timeout, TimeoutFun);
-        stop -> stop
+        {Go, UserAcc2} = TimeoutFun(UserAcc),
+        case Go of
+        ok ->
+            wait_db_updated(Timeout, TimeoutFun, UserAcc2);
+        stop ->
+            {stop, UserAcc2}
         end
     end.
 
+get_rest_db_updated(UserAcc) ->
+    receive
+    db_updated ->
+        get_rest_db_updated(UserAcc)
+    after 0 ->
+        {updated, UserAcc}
+    end.
+
 get_rest_db_updated() ->
     receive db_updated -> get_rest_db_updated()
     after 0 -> updated
diff --git a/apps/couch/src/couch_config.erl b/apps/couch/src/couch_config.erl
index 73abdfd5..933bb5d5 100644
--- a/apps/couch/src/couch_config.erl
+++ b/apps/couch/src/couch_config.erl
@@ -93,15 +93,19 @@ register(Fun, Pid) ->
 
 init(IniFiles) ->
     ets:new(?MODULE, [named_table, set, protected]),
-    lists:map(fun(IniFile) ->
-        {ok, ParsedIniValues} = parse_ini_file(IniFile),
-        ets:insert(?MODULE, ParsedIniValues)
-    end, IniFiles),
-    WriteFile = case IniFiles of
-        [_|_] -> lists:last(IniFiles);
-        _ -> undefined
-    end,
-    {ok, #config{write_filename=WriteFile}}.
+    try
+        lists:map(fun(IniFile) ->
+            {ok, ParsedIniValues} = parse_ini_file(IniFile),
+            ets:insert(?MODULE, ParsedIniValues)
+        end, IniFiles),
+        WriteFile = case IniFiles of
+            [_|_] -> lists:last(IniFiles);
+            _ -> undefined
+        end,
+        {ok, #config{write_filename = WriteFile}}
+    catch _Tag:Error ->
+        {stop, Error}
+    end.
 
 
 terminate(_Reason, _State) ->
@@ -112,8 +116,7 @@ handle_call(all, _From, Config) ->
     Resp = lists:sort((ets:tab2list(?MODULE))),
     {reply, Resp, Config};
 handle_call({set, Sec, Key, Val, Persist}, _From, Config) ->
-    true = ets:insert(?MODULE, {{Sec, Key}, Val}),
-    case {Persist, Config#config.write_filename} of
+    Result = case {Persist, Config#config.write_filename} of
         {true, undefined} ->
             ok;
         {true, FileName} ->
@@ -121,9 +124,15 @@ handle_call({set, Sec, Key, Val, Persist}, _From, Config) ->
         _ ->
             ok
     end,
-    Event = {config_change, Sec, Key, Val, Persist},
-    gen_event:sync_notify(couch_config_event, Event),
-    {reply, ok, Config};
+    case Result of
+    ok ->
+        true = ets:insert(?MODULE, {{Sec, Key}, Val}),
+        Event = {config_change, Sec, Key, Val, Persist},
+        gen_event:sync_notify(couch_config_event, Event),
+        {reply, ok, Config};
+    _Error ->
+        {reply, Result, Config}
+    end;
 handle_call({delete, Sec, Key, Persist}, _From, Config) ->
     true = ets:delete(?MODULE, {Sec,Key}),
     case {Persist, Config#config.write_filename} of
@@ -158,6 +167,8 @@ parse_ini_file(IniFile) ->
     case file:read_file(IniFilename) of
         {ok, IniBin0} ->
             IniBin0;
+        {error, eacces} ->
+            throw({file_permission_error, IniFile});
         {error, enoent} ->
             Fmt = "Couldn't find server configuration file ~s.",
             Msg = ?l2b(io_lib:format(Fmt, [IniFilename])),
diff --git a/apps/couch/src/couch_config_writer.erl b/apps/couch/src/couch_config_writer.erl
index c8691d79..decd269a 100644
--- a/apps/couch/src/couch_config_writer.erl
+++ b/apps/couch/src/couch_config_writer.erl
@@ -35,7 +35,14 @@ save_to_file({{Section, Key}, Value}, File) ->
 
     NewLines = process_file_lines(Lines, [], SectionLine, Pattern, Key, Value),
     NewFileContents = reverse_and_add_newline(strip_empty_lines(NewLines), []),
-    ok = file:write_file(File, NewFileContents).
+    case file:write_file(File, NewFileContents) of
+    ok ->
+        ok;
+    {error, eacces} ->
+        {file_permission_error, File};
+    Error ->
+        Error
+    end.
 
 
 process_file_lines([Section|Rest], SeenLines, Section, Pattern, Key, Value) ->
diff --git a/apps/couch/src/couch_db.erl b/apps/couch/src/couch_db.erl
index dec6870f..96c49886 100644
--- a/apps/couch/src/couch_db.erl
+++ b/apps/couch/src/couch_db.erl
@@ -24,7 +24,7 @@
 -export([start_link/3,open_doc_int/3,ensure_full_commit/1,ensure_full_commit/2]).
 -export([set_security/2,get_security/1]).
 -export([changes_since/5,changes_since/6,read_doc/2,new_revid/1]).
--export([check_is_admin/1, check_is_reader/1, get_doc_count/1, load_validation_funs/1]).
+-export([check_is_admin/1, check_is_reader/1, get_doc_count/1]).
 -export([reopen/1, make_doc/5]).
 
 -include("couch_db.hrl").
@@ -779,6 +779,8 @@ update_docs(Db, Docs, Options, interactive_edit) ->
 % for the doc.
 make_first_doc_on_disk(_Db, _Id, _Pos, []) ->
     nil;
+make_first_doc_on_disk(Db, Id, Pos, [{_Rev, #doc{}} | RestPath]) ->
+    make_first_doc_on_disk(Db, Id, Pos-1, RestPath);
 make_first_doc_on_disk(Db, Id, Pos, [{_Rev, ?REV_MISSING}|RestPath]) ->
     make_first_doc_on_disk(Db, Id, Pos - 1, RestPath);
 make_first_doc_on_disk(Db, Id, Pos, [{_, #leaf{deleted=IsDel, ptr=Sp}} |_]=DocPath) ->
@@ -856,7 +858,7 @@ doc_flush_atts(Doc, Fd) ->
     Doc#doc{atts=[flush_att(Fd, Att) || Att <- Doc#doc.atts]}.
 
 check_md5(_NewSig, <<>>) -> ok;
-check_md5(Sig1, Sig2) when Sig1 == Sig2 -> ok;
+check_md5(Sig, Sig) -> ok;
 check_md5(_, _) -> throw(md5_mismatch).
 
 flush_att(Fd, #att{data={Fd0, _}}=Att) when Fd0 == Fd ->
@@ -967,10 +969,15 @@ with_stream(Fd, #att{md5=InMd5,type=Type,encoding=Enc}=Att, Fun) ->
 write_streamed_attachment(_Stream, _F, 0) ->
     ok;
 write_streamed_attachment(Stream, F, LenLeft) when LenLeft > 0 ->
-    Bin = F(),
+    Bin = read_next_chunk(F, LenLeft),
     ok = couch_stream:write(Stream, Bin),
     write_streamed_attachment(Stream, F, LenLeft - size(Bin)).
 
+read_next_chunk(F, _) when is_function(F, 0) ->
+    F();
+read_next_chunk(F, LenLeft) when is_function(F, 1) ->
+    F(lists:min([LenLeft, 16#2000])).
+
 enum_docs_since_reduce_to_count(Reds) ->
     couch_btree:final_reduce(
             fun couch_db_updater:btree_by_seq_reduce/2, Reds).
diff --git a/apps/couch/src/couch_db_updater.erl b/apps/couch/src/couch_db_updater.erl
index 138930f1..9bf52ee0 100644
--- a/apps/couch/src/couch_db_updater.erl
+++ b/apps/couch/src/couch_db_updater.erl
@@ -52,7 +52,7 @@ init({DbName, Filepath, Fd, Options}) ->
 
 
 terminate(_Reason, Db) ->
-    couch_file:close(Db#db.fd),
+    ok = couch_file:close(Db#db.fd),
     couch_util:shutdown_sync(Db#db.compactor_pid),
     couch_util:shutdown_sync(Db#db.fd),
     ok.
@@ -133,8 +133,9 @@ handle_call({purge_docs, IdRevs}, _From, Db) ->
 
     {DocInfoToUpdate, NewSeq} = lists:mapfoldl(
         fun(#full_doc_info{rev_tree=Tree}=FullInfo, SeqAcc) ->
-            Tree2 = couch_key_tree:map_leafs( fun(RevInfo) ->
-                    RevInfo#rev_info{seq=SeqAcc + 1}
+            Tree2 = couch_key_tree:map_leafs(
+                fun(_RevId, {IsDeleted, BodyPointer, _UpdateSeq}) ->
+                    {IsDeleted, BodyPointer, SeqAcc + 1}
                 end, Tree),
             {couch_doc:to_doc_info(FullInfo#full_doc_info{rev_tree=Tree2}),
                 SeqAcc + 1}
@@ -512,9 +513,9 @@ flush_trees(#db{fd=Fd,header=Header}=Db,
                 {ok, NewSummaryPointer} =
                 case Header#db_header.disk_version < 4 of
                 true ->
-                    couch_file:append_term(Fd, {Doc#doc.body, DiskAtts});
+                    {ok, _} = couch_file:append_term(Fd, {Doc#doc.body, DiskAtts});
                 false ->
-                    couch_file:append_term_md5(Fd, {Doc#doc.body, DiskAtts})
+                    {ok, _} = couch_file:append_term_md5(Fd, {Doc#doc.body, DiskAtts})
                 end,
                 #leaf{
                     deleted = IsDeleted,
@@ -666,10 +667,11 @@ update_docs_int(Db, DocsList, NonRepDocs, MergeConflicts, FullCommit) ->
 
     % Check if we just updated any design documents, and update the validation
     % funs if we did.
-    case [1 || <<"_design/",_/binary>> <- Ids] of
-    [] ->
+    case lists:any(
+        fun(<<"_design/", _/binary>>) -> true; (_) -> false end, Ids) of
+    false ->
         Db4 = Db3;
-    _ ->
+    true ->
         Db4 = refresh_validate_doc_funs(Db3)
     end,
 
@@ -687,7 +689,8 @@ compute_data_sizes([FullDocInfo | RestDocInfos], Acc) ->
 
 
 
-
+update_local_docs(Db, []) ->
+    {ok, Db};
 update_local_docs(#db{local_tree=Btree}=Db, Docs) ->
     Ids = [Id || {_Client, #doc{id=Id}} <- Docs],
     OldDocLookups = couch_btree:lookup(Btree, Ids),
diff --git a/apps/couch/src/couch_doc.erl b/apps/couch/src/couch_doc.erl
index 9f0dae45..33d7e3cf 100644
--- a/apps/couch/src/couch_doc.erl
+++ b/apps/couch/src/couch_doc.erl
@@ -13,11 +13,12 @@
 -module(couch_doc).
 
 -export([to_doc_info/1,to_doc_info_path/1,parse_rev/1,parse_revs/1,rev_to_str/1,revs_to_strs/1]).
--export([att_foldl/3,att_foldl_decode/3,get_validate_doc_fun/1]).
+-export([att_foldl/3,range_att_foldl/5,att_foldl_decode/3,get_validate_doc_fun/1]).
 -export([from_json_obj/1,to_json_obj/2,has_stubs/1, merge_stubs/2]).
 -export([validate_docid/1]).
 -export([doc_from_multi_part_stream/2]).
 -export([doc_to_multi_part_stream/5, len_doc_to_multi_part_stream/4]).
+-export([abort_multi_part_stream/1]).
 
 -include("couch_db.hrl").
 
@@ -87,8 +88,14 @@ to_json_attachments(Atts, OutputData, DataToFollow, ShowEncInfo) ->
         fun(#att{disk_len=DiskLen, att_len=AttLen, encoding=Enc}=Att) ->
             {Att#att.name, {[
                 {<<"content_type">>, Att#att.type},
-                {<<"revpos">>, Att#att.revpos}
-                ] ++
+                {<<"revpos">>, Att#att.revpos}] ++
+                case Att#att.md5 of
+                    <<>> ->
+                        [];
+                    Md5 ->
+                        EncodedMd5 = base64:encode(Md5),
+                        [{<<"digest">>, <<"md5-",EncodedMd5/binary>>}]
+                end ++
                 if not OutputData orelse Att#att.data == stub ->
                     [{<<"length">>, DiskLen}, {<<"stub">>, true}];
                 true ->
@@ -165,6 +172,10 @@ parse_revs([Rev | Rest]) ->
 
 
 validate_docid(Id) when is_binary(Id) ->
+    case couch_util:validate_utf8(Id) of
+        false -> throw({bad_request, <<"Document id must be valid UTF-8">>});
+        true -> ok
+    end,
     case Id of
     <<"_design/", _/binary>> -> ok;
     <<"_local/", _/binary>> -> ok;
@@ -195,6 +206,12 @@ transfer_fields([{<<"_rev">>, _Rev} | Rest], Doc) ->
 
 transfer_fields([{<<"_attachments">>, {JsonBins}} | Rest], Doc) ->
     Atts = lists:map(fun({Name, {BinProps}}) ->
+        Md5 = case couch_util:get_value(<<"digest">>, BinProps) of
+            <<"md5-",EncodedMd5/binary>> ->
+                base64:decode(EncodedMd5);
+            _ ->
+               <<>>
+        end,
         case couch_util:get_value(<<"stub">>, BinProps) of
         true ->
             Type = couch_util:get_value(<<"content_type">>, BinProps),
@@ -202,7 +219,7 @@ transfer_fields([{<<"_attachments">>, {JsonBins}} | Rest], Doc) ->
             DiskLen = couch_util:get_value(<<"length">>, BinProps),
             {Enc, EncLen} = att_encoding_info(BinProps),
             #att{name=Name, data=stub, type=Type, att_len=EncLen,
-                disk_len=DiskLen, encoding=Enc, revpos=RevPos};
+                disk_len=DiskLen, encoding=Enc, revpos=RevPos, md5=Md5};
         _ ->
             Type = couch_util:get_value(<<"content_type">>, BinProps,
                     ?DEFAULT_ATTACHMENT_CONTENT_TYPE),
@@ -212,7 +229,7 @@ transfer_fields([{<<"_attachments">>, {JsonBins}} | Rest], Doc) ->
                 DiskLen = couch_util:get_value(<<"length">>, BinProps),
                 {Enc, EncLen} = att_encoding_info(BinProps),
                 #att{name=Name, data=follows, type=Type, encoding=Enc,
-                    att_len=EncLen, disk_len=DiskLen, revpos=RevPos};
+                    att_len=EncLen, disk_len=DiskLen, revpos=RevPos, md5=Md5};
             _ ->
                 Value = couch_util:get_value(<<"data">>, BinProps),
                 Bin = base64:decode(Value),
@@ -252,6 +269,17 @@ transfer_fields([{<<"_conflicts">>, _} | Rest], Doc) ->
 transfer_fields([{<<"_deleted_conflicts">>, _} | Rest], Doc) ->
     transfer_fields(Rest, Doc);
 
+% special fields for replication documents
+transfer_fields([{<<"_replication_state">>, _} = Field | Rest],
+    #doc{body=Fields} = Doc) ->
+    transfer_fields(Rest, Doc#doc{body=[Field|Fields]});
+transfer_fields([{<<"_replication_state_time">>, _} = Field | Rest],
+    #doc{body=Fields} = Doc) ->
+    transfer_fields(Rest, Doc#doc{body=[Field|Fields]});
+transfer_fields([{<<"_replication_id">>, _} = Field | Rest],
+    #doc{body=Fields} = Doc) ->
+    transfer_fields(Rest, Doc#doc{body=[Field|Fields]});
+
 % unknown special field
 transfer_fields([{<<"_",Name/binary>>, _} | _], _) ->
     throw({doc_validation,
@@ -307,6 +335,9 @@ att_foldl(#att{data={Fd,Sp},md5=Md5}, Fun, Acc) ->
 att_foldl(#att{data=DataFun,att_len=Len}, Fun, Acc) when is_function(DataFun) ->
    fold_streamed_data(DataFun, Len, Fun, Acc).
 
+range_att_foldl(#att{data={Fd,Sp}}, From, To, Fun, Acc) ->
+   couch_stream:range_foldl(Fd, Sp, From, To, Fun, Acc).
+
 att_foldl_decode(#att{data={Fd,Sp},md5=Md5,encoding=Enc}, Fun, Acc) ->
     couch_stream:foldl_decode(Fd, Sp, Md5, Enc, Fun, Acc);
 att_foldl_decode(#att{data=Fun2,att_len=Len, encoding=identity}, Fun, Acc) ->
@@ -445,11 +476,13 @@ atts_to_mp([Att | RestAtts], Boundary, WriteFun,
 
 
 doc_from_multi_part_stream(ContentType, DataFun) ->
-    Self = self(),
+    Parent = self(),
     Parser = spawn_link(fun() ->
-        couch_httpd:parse_multipart_request(ContentType, DataFun,
-                fun(Next)-> mp_parse_doc(Next, []) end),
-        unlink(Self)
+        {<<"--">>, _, _} = couch_httpd:parse_multipart_request(
+            ContentType, DataFun,
+            fun(Next) -> mp_parse_doc(Next, []) end),
+        unlink(Parent),
+        Parent ! {self(), finished}
         end),
     Parser ! {get_doc_bytes, self()},
     receive
@@ -463,7 +496,11 @@ doc_from_multi_part_stream(ContentType, DataFun) ->
             (A) ->
                 A
             end, Doc#doc.atts),
-        {ok, Doc#doc{atts=Atts2}}
+        WaitFun = fun() ->
+            receive {Parser, finished} -> ok end,
+            erlang:put(mochiweb_request_recv, true)
+        end,
+        {ok, Doc#doc{atts=Atts2}, WaitFun, Parser}
     end.
 
 mp_parse_doc({headers, H}, []) ->
@@ -554,3 +591,20 @@ maybe_send_data({ChunkList, Offset, Counters, Waiting}) ->
             end
         end
     end.
+
+abort_multi_part_stream(Parser) ->
+    abort_multi_part_stream(Parser, erlang:monitor(process, Parser)).
+
+abort_multi_part_stream(Parser, MonRef) ->
+    case is_process_alive(Parser) of
+    true ->
+        Parser ! {get_bytes, self()},
+        receive
+        {bytes, _Bytes} ->
+             abort_multi_part_stream(Parser, MonRef);
+        {'DOWN', MonRef, _, _, _} ->
+             ok
+        end;
+    false ->
+        erlang:demonitor(MonRef, [flush])
+    end.
diff --git a/apps/couch/src/couch_event_sup.erl b/apps/couch/src/couch_event_sup.erl
index 6fd6963a..07c48790 100644
--- a/apps/couch/src/couch_event_sup.erl
+++ b/apps/couch/src/couch_event_sup.erl
@@ -50,8 +50,12 @@ stop(Pid) ->
     gen_server:cast(Pid, stop).
 
 init({EventMgr, EventHandler, Args}) ->
-    ok = gen_event:add_sup_handler(EventMgr, EventHandler, Args),
-    {ok, {EventMgr, EventHandler}}.
+    case gen_event:add_sup_handler(EventMgr, EventHandler, Args) of
+    ok ->
+        {ok, {EventMgr, EventHandler}};
+    {stop, Error} ->
+        {stop, Error}
+    end.
 
 terminate(_Reason, _State) ->
     ok.
diff --git a/apps/couch/src/couch_file.erl b/apps/couch/src/couch_file.erl
index 3e4f29fe..dfc1f822 100644
--- a/apps/couch/src/couch_file.erl
+++ b/apps/couch/src/couch_file.erl
@@ -53,7 +53,10 @@ open(Filepath, Options) ->
             {trap_exit, true} -> receive {'EXIT', Pid, _} -> ok end;
             {trap_exit, false} -> ok
             end,
-            Error
+            case Error of
+            {error, eacces} -> {file_permission_error, Filepath};
+            _ -> Error
+            end
         end;
     Error ->
         Error
@@ -161,7 +164,7 @@ truncate(Fd, Pos) ->
 
 sync(Filepath) when is_list(Filepath) ->
     {ok, Fd} = file:open(Filepath, [append, raw]),
-    try file:sync(Fd) after file:close(Fd) end;
+    try ok = file:sync(Fd) after ok = file:close(Fd) end;
 sync(Fd) ->
     gen_server:call(Fd, sync, infinity).
 
@@ -294,15 +297,23 @@ handle_call(close, _From, #file{fd=Fd}=File) ->
     {stop, normal, file:close(Fd), File#file{fd = nil}};
 
 handle_call({pread_iolist, Pos}, _From, File) ->
-    {LenIolist, NextPos} = read_raw_iolist_int(File, Pos, 4),
-    case iolist_to_binary(LenIolist) of
-    <<1:1/integer,Len:31/integer>> -> % an MD5-prefixed term
-        {Md5AndIoList, _} = read_raw_iolist_int(File, NextPos, Len+16),
-        {Md5, IoList} = extract_md5(Md5AndIoList),
+    {RawData, NextPos} = try
+        % up to 8Kbs of read ahead
+        read_raw_iolist_int(File, Pos, 2 * ?SIZE_BLOCK - (Pos rem ?SIZE_BLOCK))
+    catch
+    _:_ ->
+        read_raw_iolist_int(File, Pos, 4)
+    end,
+    <<Prefix:1/integer, Len:31/integer, RestRawData/binary>> =
+        iolist_to_binary(RawData),
+    case Prefix of
+    1 ->
+        {Md5, IoList} = extract_md5(
+            maybe_read_more_iolist(RestRawData, 16 + Len, NextPos, File)),
         {reply, {ok, IoList, Md5}, File};
-    <<0:1/integer,Len:31/integer>> ->
-        {Iolist, _} = read_raw_iolist_int(File, NextPos, Len),
-        {reply, {ok, Iolist, <<>>}, File}
+    0 ->
+        IoList = maybe_read_more_iolist(RestRawData, Len, NextPos, File),
+        {reply, {ok, IoList, <<>>}, File}
     end;
 handle_call({pread, Pos, Bytes}, _From, #file{fd=Fd,tail_append_begin=TailAppendBegin}=File) ->
     {ok, Bin} = file:pread(Fd, Pos, Bytes),
@@ -504,18 +515,36 @@ find_header(Fd, Block) ->
     end.
 
 load_header(Fd, Block) ->
-    {ok, <<1>>} = file:pread(Fd, Block*?SIZE_BLOCK, 1),
-    {ok, <<HeaderLen:32/integer>>} = file:pread(Fd, (Block*?SIZE_BLOCK) + 1, 4),
+    {ok, <<1, HeaderLen:32/integer, RestBlock/binary>>} =
+        file:pread(Fd, Block * ?SIZE_BLOCK, ?SIZE_BLOCK),
     TotalBytes = calculate_total_read_len(1, HeaderLen),
-    {ok, <<RawBin:TotalBytes/binary>>} =
-            file:pread(Fd, (Block*?SIZE_BLOCK) + 5, TotalBytes),
+    case TotalBytes > byte_size(RestBlock) of
+    false ->
+        <<RawBin:TotalBytes/binary, _/binary>> = RestBlock;
+    true ->
+        {ok, Missing} = file:pread(
+            Fd, (Block * ?SIZE_BLOCK) + 5 + byte_size(RestBlock),
+            TotalBytes - byte_size(RestBlock)),
+        RawBin = <<RestBlock/binary, Missing/binary>>
+    end,
     <<Md5Sig:16/binary, HeaderBin/binary>> =
         iolist_to_binary(remove_block_prefixes(1, RawBin)),
     Md5Sig = couch_util:md5(HeaderBin),
     {ok, HeaderBin}.
 
+maybe_read_more_iolist(Buffer, DataSize, _, _)
+    when DataSize =< byte_size(Buffer) ->
+    <<Data:DataSize/binary, _/binary>> = Buffer,
+    [Data];
+maybe_read_more_iolist(Buffer, DataSize, NextPos, File) ->
+    {Missing, _} =
+        read_raw_iolist_int(File, NextPos, DataSize - byte_size(Buffer)),
+    [Buffer, Missing].
+
 -spec read_raw_iolist_int(#file{}, Pos::non_neg_integer(), Len::non_neg_integer()) ->
     {Data::iolist(), CurPos::non_neg_integer()}.
+read_raw_iolist_int(Fd, {Pos, _Size}, Len) -> % 0110 UPGRADE CODE
+    read_raw_iolist_int(Fd, Pos, Len);
 read_raw_iolist_int(#file{fd=Fd, tail_append_begin=TAB}, Pos, Len) ->
     BlockOffset = Pos rem ?SIZE_BLOCK,
     TotalBytes = calculate_total_read_len(BlockOffset, Len),
diff --git a/apps/couch/src/couch_httpd.erl b/apps/couch/src/couch_httpd.erl
index 0d9abde6..8fb2687c 100644
--- a/apps/couch/src/couch_httpd.erl
+++ b/apps/couch/src/couch_httpd.erl
@@ -13,35 +13,50 @@
 -module(couch_httpd).
 -include("couch_db.hrl").
 
--export([start_link/0, stop/0, handle_request/7]).
+-export([start_link/0, start_link/1, stop/0, handle_request/5]).
 
--export([header_value/2,header_value/3,qs_value/2,qs_value/3,qs/1,path/1,absolute_uri/2,body_length/1]).
+-export([header_value/2,header_value/3,qs_value/2,qs_value/3,qs/1,qs_json_value/3]).
+-export([path/1,absolute_uri/2,body_length/1]).
 -export([verify_is_server_admin/1,unquote/1,quote/1,recv/2,recv_chunked/4,error_info/1]).
--export([make_fun_spec_strs/1, make_arity_1_fun/1]).
+-export([make_fun_spec_strs/1]).
+-export([make_arity_1_fun/1, make_arity_2_fun/1, make_arity_3_fun/1]).
 -export([parse_form/1,json_body/1,json_body_obj/1,body/1,doc_etag/1, make_etag/1, etag_respond/3]).
 -export([primary_header_value/2,partition/1,serve_file/3,serve_file/4, server_header/0]).
 -export([start_chunked_response/3,send_chunk/2,log_request/2]).
--export([start_response_length/4, send/2]).
+-export([start_response_length/4, start_response/3, send/2]).
 -export([start_json_response/2, start_json_response/3, end_json_response/1]).
 -export([send_response/4,send_method_not_allowed/2,send_error/4, send_redirect/2,send_chunked_error/2]).
 -export([send_json/2,send_json/3,send_json/4,last_chunk/1,parse_multipart_request/3]).
 -export([accepted_encodings/1,handle_request_int/5,validate_referer/1,validate_ctype/2]).
 
 start_link() ->
+    start_link(http).
+start_link(http) ->
+    Port = couch_config:get("httpd", "port", "5984"),
+    start_link(?MODULE, [{port, Port}]);
+start_link(https) ->
+    Port = couch_config:get("ssl", "port", "6984"),
+    CertFile = couch_config:get("ssl", "cert_file", nil),
+    KeyFile = couch_config:get("ssl", "key_file", nil),
+    Options = case CertFile /= nil andalso KeyFile /= nil of
+                  true ->
+                      [{port, Port},
+                       {ssl, true},
+                       {ssl_opts, [
+                             {certfile, CertFile},
+                             {keyfile, KeyFile}]}];
+                  false ->
+                      io:format("SSL enabled but PEM certificates are missing.", []),
+                      throw({error, missing_certs})
+              end,
+    start_link(https, Options).
+start_link(Name, Options) ->
     % read config and register for configuration changes
 
     % just stop if one of the config settings change. couch_server_sup
     % will restart us and then we will pick up the new settings.
 
     BindAddress = couch_config:get("httpd", "bind_address", any),
-    Port = couch_config:get("httpd", "port", "5984"),
-    MaxConnections = couch_config:get("httpd", "max_connections", "2048"),
-    VirtualHosts = couch_config:get("vhosts"),
-    VhostGlobals = re:split(
-        couch_config:get("httpd", "vhost_global_handlers", ""),
-        ", ?",
-        [{return, list}]
-    ),
     DefaultSpec = "{couch_httpd_db, handle_request}",
     DefaultFun = make_arity_1_fun(
         couch_config:get("httpd", "default_handler", DefaultSpec)
@@ -65,21 +80,28 @@ start_link() ->
     UrlHandlers = dict:from_list(UrlHandlersList),
     DbUrlHandlers = dict:from_list(DbUrlHandlersList),
     DesignUrlHandlers = dict:from_list(DesignUrlHandlersList),
+    {ok, ServerOptions} = couch_util:parse_term(
+        couch_config:get("httpd", "server_options", "[]")),
+    {ok, SocketOptions} = couch_util:parse_term(
+        couch_config:get("httpd", "socket_options", "[]")),
     Loop = fun(Req)->
+        case SocketOptions of
+        [] ->
+            ok;
+        _ ->
+            ok = mochiweb_socket:setopts(Req:get(socket), SocketOptions)
+        end,
         apply(?MODULE, handle_request, [
-            Req, DefaultFun, UrlHandlers, DbUrlHandlers, DesignUrlHandlers,
-                VirtualHosts, VhostGlobals
+            Req, DefaultFun, UrlHandlers, DbUrlHandlers, DesignUrlHandlers
         ])
     end,
 
     % and off we go
 
-    {ok, Pid} = case mochiweb_http:start([
+    {ok, Pid} = case mochiweb_http:start(Options ++ ServerOptions ++ [
         {loop, Loop},
-        {name, ?MODULE},
-        {ip, BindAddress},
-        {port, Port},
-        {max, MaxConnections}
+        {name, Name},
+        {ip, BindAddress}
     ]) of
     {ok, MochiPid} -> {ok, MochiPid};
     {error, Reason} ->
@@ -92,15 +114,19 @@ start_link() ->
             ?MODULE:stop();
         ("httpd", "port") ->
             ?MODULE:stop();
-        ("httpd", "max_connections") ->
-            ?MODULE:stop();
         ("httpd", "default_handler") ->
             ?MODULE:stop();
+        ("httpd", "server_options") ->
+            ?MODULE:stop();
+        ("httpd", "socket_options") ->
+            ?MODULE:stop();
         ("httpd_global_handlers", _) ->
             ?MODULE:stop();
         ("httpd_db_handlers", _) ->
             ?MODULE:stop();
         ("vhosts", _) ->
+            ?MODULE:stop();
+        ("ssl", _) ->
             ?MODULE:stop()
         end, Pid),
 
@@ -139,50 +165,13 @@ make_fun_spec_strs(SpecStr) ->
 stop() ->
     mochiweb_http:stop(?MODULE).
 
-%%
 
-% if there's a vhost definition that matches the request, redirect internally
-redirect_to_vhost(MochiReq, DefaultFun,
-    UrlHandlers, DbUrlHandlers, DesignUrlHandlers, VhostTarget) ->
-
-    Path = MochiReq:get(raw_path),
-    Target = VhostTarget ++ Path,
-    ?LOG_DEBUG("Vhost Target: '~p'~n", [Target]),
-    % build a new mochiweb request
-    MochiReq1 = mochiweb_request:new(MochiReq:get(socket),
-                                      MochiReq:get(method),
-                                      Target,
-                                      MochiReq:get(version),
-                                      MochiReq:get(headers)),
-    % cleanup, It force mochiweb to reparse raw uri.
-    MochiReq1:cleanup(),
+handle_request(MochiReq, DefaultFun, UrlHandlers, DbUrlHandlers, 
+    DesignUrlHandlers) ->
 
+    MochiReq1 = couch_httpd_vhost:match_vhost(MochiReq),
     handle_request_int(MochiReq1, DefaultFun,
-        UrlHandlers, DbUrlHandlers, DesignUrlHandlers).
-
-handle_request(MochiReq, DefaultFun,
-    UrlHandlers, DbUrlHandlers, DesignUrlHandlers, VirtualHosts, VhostGlobals) ->
-
-    % grab Host from Req
-    Vhost = MochiReq:get_header_value("Host"),
-
-    % find Vhost in config
-    case couch_util:get_value(Vhost, VirtualHosts) of
-    undefined -> % business as usual
-        handle_request_int(MochiReq, DefaultFun,
-            UrlHandlers, DbUrlHandlers, DesignUrlHandlers);
-    VhostTarget ->
-        case vhost_global(VhostGlobals, MochiReq) of
-        true ->% global handler for vhosts
-            handle_request_int(MochiReq, DefaultFun,
-                UrlHandlers, DbUrlHandlers, DesignUrlHandlers);
-        _Else ->
-            % do rewrite
-            redirect_to_vhost(MochiReq, DefaultFun,
-                UrlHandlers, DbUrlHandlers, DesignUrlHandlers, VhostTarget)
-        end
-    end.
-
+                UrlHandlers, DbUrlHandlers, DesignUrlHandlers).
 
 handle_request_int(MochiReq, DefaultFun,
             UrlHandlers, DbUrlHandlers, DesignUrlHandlers) ->
@@ -194,6 +183,14 @@ handle_request_int(MochiReq, DefaultFun,
     RawUri = MochiReq:get(raw_path),
     {"/" ++ Path, _, _} = mochiweb_util:urlsplit_path(RawUri),
 
+    Headers = MochiReq:get(headers), 
+
+    % get requested path
+    RequestedPath = case MochiReq:get_header_value("x-couchdb-vhost-path") of
+        undefined -> RawUri;
+        P -> P
+    end,
+    
     HandlerKey =
     case mochiweb_util:partition(Path, "/") of
     {"", "", ""} ->
@@ -201,10 +198,11 @@ handle_request_int(MochiReq, DefaultFun,
     {FirstPart, _, _} ->
         list_to_binary(FirstPart)
     end,
-    ?LOG_DEBUG("~p ~s ~p~nHeaders: ~p", [
+    ?LOG_DEBUG("~p ~s ~p from ~p~nHeaders: ~p", [
         MochiReq:get(method),
         RawUri,
         MochiReq:get(version),
+        MochiReq:get(peer),
         mochiweb_headers:to_list(MochiReq:get(headers))
     ]),
     
@@ -245,6 +243,8 @@ handle_request_int(MochiReq, DefaultFun,
         mochi_req = MochiReq,
         peer = MochiReq:get(peer),
         method = Method,
+        requested_path_parts = [list_to_binary(couch_httpd:unquote(Part))
+                || Part <- string:tokens(RequestedPath, "/")],
         path_parts = [list_to_binary(couch_httpd:unquote(Part))
                 || Part <- string:tokens(Path, "/")],
         db_url_handlers = DbUrlHandlers,
@@ -269,7 +269,7 @@ handle_request_int(MochiReq, DefaultFun,
         throw:{invalid_json, S} ->
             ?LOG_ERROR("attempted upload of invalid JSON (set log_level to debug to log it)", []),
             ?LOG_DEBUG("Invalid JSON: ~p",[S]),
-            send_error(HttpReq, {bad_request, "invalid UTF-8 JSON"});
+            send_error(HttpReq, {bad_request, io_lib:format("invalid UTF-8 JSON: ~p",[S])});
         throw:unacceptable_encoding ->
             ?LOG_ERROR("unsupported encoding method for the response", []),
             send_error(HttpReq, {not_acceptable, "unsupported encoding"});
@@ -326,18 +326,6 @@ authenticate_request(Response, _AuthSrcs) ->
 increment_method_stats(Method) ->
     couch_stats_collector:increment({httpd_request_methods, Method}).
 
-% if so, then it will not be rewritten, but will run as a normal couchdb request.
-% normally you'd use this for _uuids _utils and a few of the others you want to keep available on vhosts. You can also use it to make databases 'global'.
-vhost_global(VhostGlobals, MochiReq) ->
-    "/" ++ Path = MochiReq:get(path),
-    Front = case partition(Path) of
-    {"", "", ""} ->
-        "/"; % Special case the root url handler
-    {FirstPart, _, _} ->
-        FirstPart
-    end,
-    [true] == [true||V <- VhostGlobals, V == Front].
-
 validate_referer(Req) ->
     Host = host_for_request(Req),
     Referer = header_value(Req, "Referer", fail),
@@ -406,6 +394,14 @@ qs_value(Req, Key) ->
 qs_value(Req, Key, Default) ->
     couch_util:get_value(Key, qs(Req), Default).
 
+qs_json_value(Req, Key, Default) ->
+    case qs_value(Req, Key, Default) of
+    Default ->
+        Default;
+    Result ->
+        ?JSON_DECODE(Result)
+    end.
+
 qs(#httpd{mochi_req=MochiReq}) ->
     MochiReq:parse_qs().
 
@@ -430,15 +426,18 @@ absolute_uri(#httpd{mochi_req=MochiReq}=Req, Path) ->
     Host = host_for_request(Req),
     XSsl = couch_config:get("httpd", "x_forwarded_ssl", "X-Forwarded-Ssl"),
     Scheme = case MochiReq:get_header_value(XSsl) of
-        "on" -> "https";
-        _ ->
-            XProto = couch_config:get("httpd", "x_forwarded_proto", "X-Forwarded-Proto"),
-            case MochiReq:get_header_value(XProto) of
-                % Restrict to "https" and "http" schemes only
-                "https" -> "https";
-                _ -> "http"
-            end
-    end,
+                 "on" -> "https";
+                 _ ->
+                     XProto = couch_config:get("httpd", "x_forwarded_proto", "X-Forwarded-Proto"),
+                     case MochiReq:get_header_value(XProto) of
+                         %% Restrict to "https" and "http" schemes only
+                         "https" -> "https";
+                         _ -> case MochiReq:get(scheme) of
+                                  https -> "https";
+                                  http -> "http"
+                              end
+                     end
+             end,
     Scheme ++ "://" ++ Host ++ Path.
 
 unquote(UrlEncodedString) ->
@@ -545,6 +544,18 @@ start_response_length(#httpd{mochi_req=MochiReq}=Req, Code, Headers, Length) ->
     end,
     {ok, Resp}.
 
+start_response(#httpd{mochi_req=MochiReq}=Req, Code, Headers) ->
+    log_request(Req, Code),
+    couch_stats_collector:increment({httpd_status_cdes, Code}),
+    CookieHeader = couch_httpd_auth:cookie_auth_header(Req, Headers),
+    Headers2 = Headers ++ server_header() ++ CookieHeader,
+    Resp = MochiReq:start_response({Code, Headers2}),
+    case MochiReq:get(method) of
+        'HEAD' -> throw({http_head_abort, Resp});
+        _ -> ok
+    end,
+    {ok, Resp}.
+
 send(Resp, Data) ->
     Resp:send(Data),
     {ok, Resp}.
@@ -612,9 +623,7 @@ send_json(Req, Code, Headers, Value) ->
         {"Content-Type", negotiate_content_type(Req)},
         {"Cache-Control", "must-revalidate"}
     ],
-    Body = list_to_binary(
-        [start_jsonp(Req), ?JSON_ENCODE(Value), end_jsonp(), $\n]
-    ),
+    Body = [start_jsonp(Req), ?JSON_ENCODE(Value), end_jsonp(), $\n],
     send_response(Req, Code, DefaultHeaders ++ Headers, Body).
 
 start_json_response(Req, Code) ->
@@ -723,6 +732,8 @@ error_info(file_exists) ->
         "created, the file already exists.">>};
 error_info({bad_ctype, Reason}) ->
     {415, <<"bad_content_type">>, Reason};
+error_info(requested_range_not_satisfiable) ->
+    {416, <<"requested_range_not_satisfiable">>, <<"Requested range not satisfiable">>};
 error_info({error, illegal_database_name}) ->
     {400, <<"illegal_database_name">>, <<"Only lowercase characters (a-z), "
         "digits (0-9), and any of the characters _, $, (, ), +, -, and / "
@@ -753,31 +764,29 @@ error_headers(#httpd{mochi_req=MochiReq}=Req, Code, ErrorStr, ReasonStr) ->
                             % send the browser popup header no matter what if we are require_valid_user
                             {Code, [{"WWW-Authenticate", "Basic realm=\"server\""}]};
                         _False ->
-                            % if the accept header matches html, then do the redirect. else proceed as usual.
-                            Accepts = case MochiReq:get_header_value("Accept") of
-                            undefined ->
-                               % According to the HTTP 1.1 spec, if the Accept
-                               % header is missing, it means the client accepts
-                               % all media types.
-                               "html";
-                            Else ->
-                                Else
-                            end,
-                            case re:run(Accepts, "\\bhtml\\b",
-                                    [{capture, none}, caseless]) of
-                            nomatch ->
+                            case MochiReq:accepts_content_type("application/json") of
+                            true ->
                                 {Code, []};
-                            match ->
-                                AuthRedirectBin = ?l2b(AuthRedirect),
-                                % Redirect to the path the user requested, not
-                                % the one that is used internally.
-                                UrlReturnRaw = case MochiReq:get_header_value("x-couchdb-vhost-path") of
-                                    undefined -> MochiReq:get(path);
-                                    VHostPath -> VHostPath
-                                end,
-                                UrlReturn = ?l2b(couch_util:url_encode(UrlReturnRaw)),
-                                UrlReason = ?l2b(couch_util:url_encode(ReasonStr)),
-                                {302, [{"Location", couch_httpd:absolute_uri(Req, <<AuthRedirectBin/binary,"?return=",UrlReturn/binary,"&reason=",UrlReason/binary>>)}]}
+                            false ->
+                                case MochiReq:accepts_content_type("text/html") of
+                                true ->
+                                    % Redirect to the path the user requested, not
+                                    % the one that is used internally.
+                                    UrlReturnRaw = case MochiReq:get_header_value("x-couchdb-vhost-path") of
+                                    undefined ->
+                                        MochiReq:get(path);
+                                    VHostPath ->
+                                        VHostPath
+                                    end,
+                                    RedirectLocation = lists:flatten([
+                                        AuthRedirect,
+                                        "?return=", couch_util:url_encode(UrlReturnRaw),
+                                        "&reason=", couch_util:url_encode(ReasonStr)
+                                    ]),
+                                    {302, [{"Location", absolute_uri(Req, RedirectLocation)}]};
+                                false ->
+                                    {Code, []}
+                                end
                             end
                         end
                     end;
@@ -842,9 +851,8 @@ negotiate_content_type(#httpd{mochi_req=MochiReq}) ->
     end.
 
 server_header() ->
-    OTPVersion = "R" ++ integer_to_list(erlang:system_info(compat_rel)) ++ "B",
     [{"Server", "CouchDB/" ++ couch:version() ++
-                " (Erlang OTP/" ++ OTPVersion ++ ")"}].
+                " (Erlang OTP/" ++ erlang:system_info(otp_release) ++ ")"}].
 
 
 -record(mp, {boundary, buffer, data_fun, callback}).
diff --git a/apps/couch/src/couch_httpd_auth.erl b/apps/couch/src/couch_httpd_auth.erl
index 752fbef1..9f6ed18a 100644
--- a/apps/couch/src/couch_httpd_auth.erl
+++ b/apps/couch/src/couch_httpd_auth.erl
@@ -173,7 +173,7 @@ cookie_authentication_handler(#httpd{mochi_req=MochiReq}=Req) ->
         CurrentTime = make_cookie_time(),
         case couch_config:get("couch_httpd_auth", "secret", nil) of
         nil ->
-            ?LOG_ERROR("cookie auth secret is not set",[]),
+            ?LOG_DEBUG("cookie auth secret is not set",[]),
             Req;
         SecretStr ->
             Secret = ?l2b(SecretStr),
@@ -207,7 +207,7 @@ cookie_authentication_handler(#httpd{mochi_req=MochiReq}=Req) ->
     end.
 
 cookie_auth_header(#httpd{user_ctx=#user_ctx{name=null}}, _Headers) -> [];
-cookie_auth_header(#httpd{user_ctx=#user_ctx{name=User}, auth={Secret, true}}, Headers) ->
+cookie_auth_header(#httpd{user_ctx=#user_ctx{name=User}, auth={Secret, true}}=Req, Headers) ->
     % Note: we only set the AuthSession cookie if:
     %  * a valid AuthSession cookie has been received
     %  * we are outside a 10% timeout window
@@ -220,18 +220,18 @@ cookie_auth_header(#httpd{user_ctx=#user_ctx{name=User}, auth={Secret, true}}, H
     AuthSession = couch_util:get_value("AuthSession", Cookies),
     if AuthSession == undefined ->
         TimeStamp = make_cookie_time(),
-        [cookie_auth_cookie(?b2l(User), Secret, TimeStamp)];
+        [cookie_auth_cookie(Req, ?b2l(User), Secret, TimeStamp)];
     true ->
         []
     end;
 cookie_auth_header(_Req, _Headers) -> [].
 
-cookie_auth_cookie(User, Secret, TimeStamp) ->
+cookie_auth_cookie(Req, User, Secret, TimeStamp) ->
     SessionData = User ++ ":" ++ erlang:integer_to_list(TimeStamp, 16),
     Hash = crypto:sha_mac(Secret, SessionData),
     mochiweb_cookies:cookie("AuthSession",
         couch_util:encodeBase64Url(SessionData ++ ":" ++ ?b2l(Hash)),
-        [{path, "/"}, {http_only, true}]). % TODO add {secure, true} when SSL is detected
+        [{path, "/"}] ++ cookie_scheme(Req)).
 
 hash_password(Password, Salt) ->
     ?l2b(couch_util:to_hex(crypto:sha(<<Password/binary, Salt/binary>>))).
@@ -247,13 +247,17 @@ ensure_cookie_auth_secret() ->
 
 % session handlers
 % Login handler with user db
-% TODO this should also allow a JSON POST
 handle_session_req(#httpd{method='POST', mochi_req=MochiReq}=Req) ->
     ReqBody = MochiReq:recv_body(),
     Form = case MochiReq:get_primary_header_value("content-type") of
         % content type should be json
         "application/x-www-form-urlencoded" ++ _ ->
             mochiweb_util:parse_qs(ReqBody);
+        "application/json" ++ _ ->
+            {Pairs} = ?JSON_DECODE(ReqBody),
+            lists:map(fun({Key, Value}) ->
+              {?b2l(Key), ?b2l(Value)}
+            end, Pairs);
         _ ->
             []
     end,
@@ -272,7 +276,7 @@ handle_session_req(#httpd{method='POST', mochi_req=MochiReq}=Req) ->
             % setup the session cookie
             Secret = ?l2b(ensure_cookie_auth_secret()),
             CurrentTime = make_cookie_time(),
-            Cookie = cookie_auth_cookie(?b2l(UserName), <<Secret/binary, UserSalt/binary>>, CurrentTime),
+            Cookie = cookie_auth_cookie(Req, ?b2l(UserName), <<Secret/binary, UserSalt/binary>>, CurrentTime),
             % TODO document the "next" feature in Futon
             {Code, Headers} = case couch_httpd:qs_value(Req, "next", nil) of
                 nil ->
@@ -288,7 +292,7 @@ handle_session_req(#httpd{method='POST', mochi_req=MochiReq}=Req) ->
                 ]});
         _Else ->
             % clear the session
-            Cookie = mochiweb_cookies:cookie("AuthSession", "", [{path, "/"}, {http_only, true}]),
+            Cookie = mochiweb_cookies:cookie("AuthSession", "", [{path, "/"}] ++ cookie_scheme(Req)),
             send_json(Req, 401, [Cookie], {[{error, <<"unauthorized">>},{reason, <<"Name or password is incorrect.">>}]})
     end;
 % get user info
@@ -318,7 +322,7 @@ handle_session_req(#httpd{method='GET', user_ctx=UserCtx}=Req) ->
     end;
 % logout by deleting the session
 handle_session_req(#httpd{method='DELETE'}=Req) ->
-    Cookie = mochiweb_cookies:cookie("AuthSession", "", [{path, "/"}, {http_only, true}]),
+    Cookie = mochiweb_cookies:cookie("AuthSession", "", [{path, "/"}] ++ cookie_scheme(Req)),
     {Code, Headers} = case couch_httpd:qs_value(Req, "next", nil) of
         nil ->
             {200, [Cookie]};
@@ -347,3 +351,10 @@ to_int(Value) when is_integer(Value) ->
 make_cookie_time() ->
     {NowMS, NowS, _} = erlang:now(),
     NowMS * 1000000 + NowS.
+
+cookie_scheme(#httpd{mochi_req=MochiReq}) ->
+    [{http_only, true}] ++
+    case MochiReq:get(scheme) of
+        http -> [];
+        https -> [{secure, true}]
+    end.
diff --git a/apps/couch/src/couch_httpd_db.erl b/apps/couch/src/couch_httpd_db.erl
index 217a2d03..71204598 100644
--- a/apps/couch/src/couch_httpd_db.erl
+++ b/apps/couch/src/couch_httpd_db.erl
@@ -20,7 +20,7 @@
 
 -import(couch_httpd,
     [send_json/2,send_json/3,send_json/4,send_method_not_allowed/2,
-    start_json_response/2,start_json_response/3,
+    send_response/4,start_json_response/2,start_json_response/3,
     send_chunk/2,last_chunk/1,end_json_response/1,
     start_chunked_response/3, absolute_uri/2, send/2,
     start_response_length/4]).
@@ -55,7 +55,15 @@ handle_request(#httpd{path_parts=[DbName|RestParts],method=Method,
         do_db_req(Req, Handler)
     end.
 
+handle_changes_req(#httpd{method='POST'}=Req, Db) ->
+    couch_httpd:validate_ctype(Req, "application/json"),
+    handle_changes_req1(Req, Db);
 handle_changes_req(#httpd{method='GET'}=Req, Db) ->
+    handle_changes_req1(Req, Db);
+handle_changes_req(#httpd{path_parts=[_,<<"_changes">>]}=Req, _Db) ->
+    send_method_not_allowed(Req, "GET,HEAD,POST").
+
+handle_changes_req1(Req, Db) ->
     MakeCallback = fun(Resp) ->
         fun({change, Change, _}, "continuous") ->
             send_chunk(Resp, [?JSON_ENCODE(Change) | "\n"]);
@@ -106,13 +114,16 @@ handle_changes_req(#httpd{method='GET'}=Req, Db) ->
             FeedChangesFun(MakeCallback(Resp))
         end
     end,
-    couch_stats_collector:track_process_count(
+    couch_stats_collector:increment(
         {httpd, clients_requesting_changes}
     ),
-    WrapperFun(ChangesFun);
-
-handle_changes_req(#httpd{path_parts=[_,<<"_changes">>]}=Req, _Db) ->
-    send_method_not_allowed(Req, "GET,HEAD").
+    try
+        WrapperFun(ChangesFun)
+    after
+    couch_stats_collector:decrement(
+        {httpd, clients_requesting_changes}
+    )
+    end.
 
 handle_compact_req(#httpd{method='POST',path_parts=[DbName,_,Id|_]}=Req, Db) ->
     ok = couch_db:check_is_admin(Db),
@@ -353,9 +364,11 @@ db_req(#httpd{path_parts=[_,<<"_purge">>]}=Req, _Db) ->
     send_method_not_allowed(Req, "POST");
 
 db_req(#httpd{method='GET',path_parts=[_,<<"_all_docs">>]}=Req, Db) ->
-    all_docs_view(Req, Db, nil);
+    Keys = couch_httpd:qs_json_value(Req, "keys", nil),
+    all_docs_view(Req, Db, Keys);
 
 db_req(#httpd{method='POST',path_parts=[_,<<"_all_docs">>]}=Req, Db) ->
+    couch_httpd:validate_ctype(Req, "application/json"),
     {Fields} = couch_httpd:json_body_obj(Req),
     case couch_util:get_value(<<"keys">>, Fields, nil) of
     nil ->
@@ -497,12 +510,13 @@ all_docs_view(Req, Db, Keys) ->
         nil ->
             FoldlFun = couch_httpd_view:make_view_fold_fun(Req, QueryArgs, CurrentEtag, Db, UpdateSeq,
                 TotalRowCount, #view_fold_helper_funs{
-                    reduce_count = fun couch_db:enum_docs_reduce_to_count/1
+                    reduce_count = fun couch_db:enum_docs_reduce_to_count/1,
+                    send_row = fun all_docs_send_json_view_row/6
                 }),
             AdapterFun = fun(#full_doc_info{id=Id}=FullDocInfo, Offset, Acc) ->
                 case couch_doc:to_doc_info(FullDocInfo) of
-                #doc_info{revs=[#rev_info{deleted=false, rev=Rev}|_]} ->
-                    FoldlFun({{Id, Id}, {[{rev, couch_doc:rev_to_str(Rev)}]}}, Offset, Acc);
+                #doc_info{revs=[#rev_info{deleted=false}|_]} = DocInfo ->
+                    FoldlFun({{Id, Id}, DocInfo}, Offset, Acc);
                 #doc_info{revs=[#rev_info{deleted=true}|_]} ->
                     {ok, Acc}
                 end
@@ -514,7 +528,8 @@ all_docs_view(Req, Db, Keys) ->
         _ ->
             FoldlFun = couch_httpd_view:make_view_fold_fun(Req, QueryArgs, CurrentEtag, Db, UpdateSeq,
                 TotalRowCount, #view_fold_helper_funs{
-                    reduce_count = fun(Offset) -> Offset end
+                    reduce_count = fun(Offset) -> Offset end,
+                    send_row = fun all_docs_send_json_view_row/6
                 }),
             KeyFoldFun = case Dir of
             fwd ->
@@ -526,10 +541,8 @@ all_docs_view(Req, Db, Keys) ->
                 fun(Key, FoldAcc) ->
                     DocInfo = (catch couch_db:get_doc_info(Db, Key)),
                     Doc = case DocInfo of
-                    {ok, #doc_info{id=Id, revs=[#rev_info{deleted=false, rev=Rev}|_]}} ->
-                        {{Id, Id}, {[{rev, couch_doc:rev_to_str(Rev)}]}};
-                    {ok, #doc_info{id=Id, revs=[#rev_info{deleted=true, rev=Rev}|_]}} ->
-                        {{Id, Id}, {[{rev, couch_doc:rev_to_str(Rev)}, {deleted, true}]}};
+                    {ok, #doc_info{id = Id} = Di} ->
+                        {{Id, Id}, Di};
                     not_found ->
                         {{Key, error}, not_found};
                     _ ->
@@ -543,6 +556,33 @@ all_docs_view(Req, Db, Keys) ->
         end
     end).
 
+all_docs_send_json_view_row(Resp, Db, KV, IncludeDocs, Conflicts, RowFront) ->
+    JsonRow = all_docs_view_row_obj(Db, KV, IncludeDocs, Conflicts),
+    send_chunk(Resp, RowFront ++ ?JSON_ENCODE(JsonRow)),
+    {ok, ",\r\n"}.
+
+all_docs_view_row_obj(_Db, {{DocId, error}, Value}, _IncludeDocs, _Conflicts) ->
+    {[{key, DocId}, {error, Value}]};
+all_docs_view_row_obj(Db, {_KeyDocId, DocInfo}, true, Conflicts) ->
+    case DocInfo of
+    #doc_info{revs = [#rev_info{deleted = true} | _]} ->
+        {all_docs_row(DocInfo) ++ [{doc, null}]};
+    _ ->
+        {all_docs_row(DocInfo) ++ couch_httpd_view:doc_member(
+            Db, DocInfo, if Conflicts -> [conflicts]; true -> [] end)}
+    end;
+all_docs_view_row_obj(_Db, {_KeyDocId, DocInfo}, _IncludeDocs, _Conflicts) ->
+    {all_docs_row(DocInfo)}.
+
+all_docs_row(#doc_info{id = Id, revs = [RevInfo | _]}) ->
+    #rev_info{rev = Rev, deleted = Del} = RevInfo,
+    [ {id, Id}, {key, Id},
+        {value, {[{rev, couch_doc:rev_to_str(Rev)}] ++ case Del of
+            true -> [{deleted, true}];
+            false -> []
+            end}} ].
+
+
 db_doc_req(#httpd{method='DELETE'}=Req, Db, DocId) ->
     % check for the existence of the doc to handle the 404 case.
     couch_doc_open(Db, DocId, nil, []),
@@ -556,29 +596,26 @@ db_doc_req(#httpd{method='DELETE'}=Req, Db, DocId) ->
                     {[{<<"_rev">>, ?l2b(Rev)},{<<"_deleted">>,true}]}))
     end;
 
-db_doc_req(#httpd{method='GET'}=Req, Db, DocId) ->
+db_doc_req(#httpd{method = 'GET', mochi_req = MochiReq} = Req, Db, DocId) ->
     #doc_query_args{
         rev = Rev,
         open_revs = Revs,
-        options = Options,
+        options = Options1,
         atts_since = AttsSince
     } = parse_doc_query(Req),
+    Options = case AttsSince of
+    nil ->
+        Options1;
+    RevList when is_list(RevList) ->
+        [{atts_since, RevList}, attachments | Options1]
+    end,
     case Revs of
     [] ->
-        Options2 =
-        if AttsSince /= nil ->
-            [{atts_since, AttsSince}, attachments | Options];
-        true -> Options
-        end,
-        Doc = couch_doc_open(Db, DocId, Rev, Options2),
-        send_doc(Req, Doc, Options2);
+        Doc = couch_doc_open(Db, DocId, Rev, Options),
+        send_doc(Req, Doc, Options);
     _ ->
         {ok, Results} = couch_db:open_doc_revs(Db, DocId, Revs, Options),
-        AcceptedTypes = case couch_httpd:header_value(Req, "Accept") of
-            undefined       -> [];
-            AcceptHeader    -> string:tokens(AcceptHeader, ", ")
-        end,
-        case lists:member("multipart/mixed", AcceptedTypes) of
+        case MochiReq:accepts_content_type("multipart/mixed") of
         false ->
             {ok, Resp} = start_json_response(Req, 200),
             send_chunk(Resp, "["),
@@ -612,13 +649,12 @@ db_doc_req(#httpd{method='POST'}=Req, Db, DocId) ->
     couch_doc:validate_docid(DocId),
     couch_httpd:validate_ctype(Req, "multipart/form-data"),
     Form = couch_httpd:parse_form(Req),
-    case proplists:is_defined("_doc", Form) of
-    true ->
-        Json = ?JSON_DECODE(couch_util:get_value("_doc", Form)),
-        Doc = couch_doc_from_req(Req, DocId, Json);
-    false ->
-        Rev = couch_doc:parse_rev(list_to_binary(couch_util:get_value("_rev", Form))),
-        {ok, [{ok, Doc}]} = couch_db:open_doc_revs(Db, DocId, [Rev], [])
+    case couch_util:get_value("_doc", Form) of
+    undefined ->
+        Rev = couch_doc:parse_rev(couch_util:get_value("_rev", Form)),
+        {ok, [{ok, Doc}]} = couch_db:open_doc_revs(Db, DocId, [Rev], []);
+    Json ->
+        Doc = couch_doc_from_req(Req, DocId, ?JSON_DECODE(Json))
     end,
     UpdatedAtts = [
         #att{name=validate_attachment_name(Name),
@@ -656,10 +692,18 @@ db_doc_req(#httpd{method='PUT'}=Req, Db, DocId) ->
     RespHeaders = [{"Location", Loc}],
     case couch_util:to_list(couch_httpd:header_value(Req, "Content-Type")) of
     ("multipart/related;" ++ _) = ContentType ->
-        {ok, Doc0} = couch_doc:doc_from_multi_part_stream(ContentType,
-                fun() -> receive_request_data(Req) end),
+        {ok, Doc0, WaitFun, Parser} = couch_doc:doc_from_multi_part_stream(
+            ContentType, fun() -> receive_request_data(Req) end),
         Doc = couch_doc_from_req(Req, DocId, Doc0),
-        update_doc(Req, Db, DocId, Doc, RespHeaders, UpdateType);
+        try
+            Result = update_doc(Req, Db, DocId, Doc, RespHeaders, UpdateType),
+            WaitFun(),
+            Result
+        catch throw:Err ->
+            % Document rejected by a validate_doc_update function.
+            couch_doc:abort_multi_part_stream(Parser),
+            throw(Err)
+        end;
     _Else ->
         case couch_httpd:qs_value(Req, "batch") of
         "ok" ->
@@ -721,20 +765,17 @@ send_doc(Req, Doc, Options) ->
 
 send_doc_efficiently(Req, #doc{atts=[]}=Doc, Headers, Options) ->
         send_json(Req, 200, Headers, couch_doc:to_json_obj(Doc, Options));
-send_doc_efficiently(Req, #doc{atts=Atts}=Doc, Headers, Options) ->
+send_doc_efficiently(#httpd{mochi_req = MochiReq} = Req,
+    #doc{atts = Atts} = Doc, Headers, Options) ->
     case lists:member(attachments, Options) of
     true ->
-        AcceptedTypes = case couch_httpd:header_value(Req, "Accept") of
-            undefined       -> [];
-            AcceptHeader    -> string:tokens(AcceptHeader, ", ")
-        end,
-        case lists:member("multipart/related", AcceptedTypes) of
+        case MochiReq:accepts_content_type("multipart/related") of
         false ->
             send_json(Req, 200, Headers, couch_doc:to_json_obj(Doc, Options));
         true ->
             Boundary = couch_uuids:random(),
             JsonBytes = ?JSON_ENCODE(couch_doc:to_json_obj(Doc, 
-                    [attachments, follows|Options])),
+                    [attachments, follows, att_encoding_info | Options])),
             {ContentType, Len} = couch_doc:len_doc_to_multi_part_stream(
                     Boundary,JsonBytes, Atts, true),
             CType = {<<"Content-Type">>, ContentType},
@@ -776,9 +817,39 @@ send_docs_multipart(Req, Results, Options1) ->
     couch_httpd:send_chunk(Resp, <<"--">>),
     couch_httpd:last_chunk(Resp).
 
+send_ranges_multipart(Req, ContentType, Len, Att, Ranges) ->
+    Boundary = couch_uuids:random(),
+    CType = {"Content-Type",
+        "multipart/byteranges; boundary=\"" ++ ?b2l(Boundary) ++ "\""},
+    {ok, Resp} = start_chunked_response(Req, 206, [CType]),
+    couch_httpd:send_chunk(Resp, <<"--", Boundary/binary>>),
+    lists:foreach(fun({From, To}) ->
+        ContentRange = make_content_range(From, To, Len),
+        couch_httpd:send_chunk(Resp,
+            <<"\r\nContent-Type: ", ContentType/binary, "\r\n",
+            "Content-Range: ", ContentRange/binary, "\r\n",
+           "\r\n">>),
+        couch_doc:range_att_foldl(Att, From, To + 1,
+            fun(Seg, _) -> send_chunk(Resp, Seg) end, {ok, Resp}),
+        couch_httpd:send_chunk(Resp, <<"\r\n--", Boundary/binary>>)
+    end, Ranges),
+    couch_httpd:send_chunk(Resp, <<"--">>),
+    couch_httpd:last_chunk(Resp),
+    {ok, Resp}.
+
 receive_request_data(Req) ->
-    {couch_httpd:recv(Req, 0), fun() -> receive_request_data(Req) end}.
+    receive_request_data(Req, couch_httpd:body_length(Req)).
+
+receive_request_data(Req, LenLeft) when LenLeft > 0 ->
+    Len = erlang:min(4096, LenLeft),
+    Data = couch_httpd:recv(Req, Len),
+    {Data, fun() -> receive_request_data(Req, LenLeft - iolist_size(Data)) end};
+receive_request_data(_Req, _) ->
+    throw(<<"expected more data">>).
     
+make_content_range(From, To, Len) ->
+    ?l2b(io_lib:format("bytes ~B-~B/~B", [From, To, Len])).
+
 update_doc_result_to_json({{Id, Rev}, Error}) ->
         {_Code, Err, Msg} = couch_httpd:error_info(Error),
         {[{id, Id}, {rev, couch_doc:rev_to_str(Rev)},
@@ -863,7 +934,7 @@ couch_doc_open(Db, DocId, Rev, Options) ->
 
 % Attachment request handlers
 
-db_attachment_req(#httpd{method='GET'}=Req, Db, DocId, FileNameParts) ->
+db_attachment_req(#httpd{method='GET',mochi_req=MochiReq}=Req, Db, DocId, FileNameParts) ->
     FileName = list_to_binary(mochiweb_util:join(lists:map(fun binary_to_list/1, FileNameParts),"/")),
     #doc_query_args{
         rev=Rev,
@@ -881,16 +952,6 @@ db_attachment_req(#httpd{method='GET'}=Req, Db, DocId, FileNameParts) ->
            atom_to_list(Enc),
            couch_httpd:accepted_encodings(Req)
         ),
-        Headers = [
-            {"ETag", Etag},
-            {"Cache-Control", "must-revalidate"},
-            {"Content-Type", binary_to_list(Type)}
-        ] ++ case ReqAcceptsAttEnc of
-        true ->
-            [{"Content-Encoding", atom_to_list(Enc)}];
-        _ ->
-            []
-        end,
         Len = case {Enc, ReqAcceptsAttEnc} of
         {identity, _} ->
             % stored and served in identity form
@@ -910,6 +971,23 @@ db_attachment_req(#httpd{method='GET'}=Req, Db, DocId, FileNameParts) ->
             % header we'll fall back to a chunked response.
             undefined
         end,
+        Headers = [
+            {"ETag", Etag},
+            {"Cache-Control", "must-revalidate"},
+            {"Content-Type", binary_to_list(Type)}
+        ] ++ case ReqAcceptsAttEnc of
+        true when Enc =/= identity ->
+            % RFC 2616 says that the 'identify' encoding should not be used in
+            % the Content-Encoding header
+            [{"Content-Encoding", atom_to_list(Enc)}];
+        _ ->
+            []
+        end ++ case Enc of
+            identity ->
+                [{"Accept-Ranges", "bytes"}];
+            _ ->
+                [{"Accept-Ranges", "none"}]
+        end,
         AttFun = case ReqAcceptsAttEnc of
         false ->
             fun couch_doc:att_foldl_decode/3;
@@ -923,11 +1001,29 @@ db_attachment_req(#httpd{method='GET'}=Req, Db, DocId, FileNameParts) ->
                 case Len of
                 undefined ->
                     {ok, Resp} = start_chunked_response(Req, 200, Headers),
-                    AttFun(Att, fun(Seg, _) -> send_chunk(Resp, Seg) end, ok),
+                    AttFun(Att, fun(Seg, _) -> send_chunk(Resp, Seg) end, {ok, Resp}),
                     last_chunk(Resp);
                 _ ->
-                    {ok, Resp} = start_response_length(Req, 200, Headers, Len),
-                    AttFun(Att, fun(Seg, _) -> send(Resp, Seg) end, ok)
+                    Ranges = parse_ranges(MochiReq:get(range), Len),
+                    case {Enc, Ranges} of
+                        {identity, [{From, To}]} ->
+                            Headers1 = [{<<"Content-Range">>, make_content_range(From, To, Len)}]
+                                ++ Headers,
+                            {ok, Resp} = start_response_length(Req, 206, Headers1, To - From + 1),
+                            couch_doc:range_att_foldl(Att, From, To + 1,
+                                fun(Seg, _) -> send(Resp, Seg) end, {ok, Resp});
+                        {identity, Ranges} when is_list(Ranges) ->
+                            send_ranges_multipart(Req, Type, Len, Att, Ranges);
+                        _ ->
+                            Headers1 = Headers ++
+                                if Enc =:= identity orelse ReqAcceptsAttEnc =:= true ->
+                                    [{"Content-MD5", base64:encode(Att#att.md5)}];
+                                true ->
+                                    []
+                            end,
+                            {ok, Resp} = start_response_length(Req, 200, Headers1, Len),
+                            AttFun(Att, fun(Seg, _) -> send(Resp, Seg) end, {ok, Resp})
+                    end
                 end
             end
         )
@@ -982,9 +1078,7 @@ db_attachment_req(#httpd{method=Method,mochi_req=MochiReq}=Req, Db, DocId, FileN
                         end,
                         
                         
-                        fun() -> couch_httpd:recv(Req, 0) end;
-                    Length ->
-                        exit({length_not_integer, Length})
+                        fun(Size) -> couch_httpd:recv(Req, Size) end
                     end,
                 att_len = case couch_httpd:header_value(Req,"Content-Length") of
                     undefined ->
@@ -1049,6 +1143,25 @@ db_attachment_req(#httpd{method=Method,mochi_req=MochiReq}=Req, Db, DocId, FileN
 db_attachment_req(Req, _Db, _DocId, _FileNameParts) ->
     send_method_not_allowed(Req, "DELETE,GET,HEAD,PUT").
 
+parse_ranges(undefined, _Len) ->
+    undefined;
+parse_ranges(fail, _Len) ->
+    undefined;
+parse_ranges(Ranges, Len) ->
+    parse_ranges(Ranges, Len, []).
+
+parse_ranges([], _Len, Acc) ->
+    lists:reverse(Acc);
+parse_ranges([{From, To}|_], _Len, _Acc) when is_integer(From) andalso is_integer(To) andalso To < From ->
+    throw(requested_range_not_satisfiable);
+parse_ranges([{From, To}|Rest], Len, Acc) when is_integer(To) andalso To >= Len ->
+    parse_ranges([{From, Len-1}] ++ Rest, Len, Acc);
+parse_ranges([{none, To}|Rest], Len, Acc) ->
+    parse_ranges([{Len - To, Len - 1}] ++ Rest, Len, Acc);
+parse_ranges([{From, none}|Rest], Len, Acc) ->
+    parse_ranges([{From, Len - 1}] ++ Rest, Len, Acc);
+parse_ranges([{From,To}|Rest], Len, Acc) ->
+    parse_ranges(Rest, Len, [{From, To}] ++ Acc).
 
 get_md5_header(Req) ->
     ContentMD5 = couch_httpd:header_value(Req, "Content-MD5"),
@@ -1137,6 +1250,8 @@ parse_changes_query(Req) ->
             Args#changes_args{timeout=list_to_integer(Value)};
         {"include_docs", "true"} ->
             Args#changes_args{include_docs=true};
+        {"conflicts", "true"} ->
+            Args#changes_args{conflicts=true};
         {"filter", _} ->
             Args#changes_args{filter=Value};
         _Else -> % unknown key value pair, ignore.
@@ -1162,15 +1277,19 @@ extract_header_rev(Req, ExplicitRev) ->
 
 
 parse_copy_destination_header(Req) ->
-    Destination = couch_httpd:header_value(Req, "Destination"),
-    case re:run(Destination, "\\?", [{capture, none}]) of
-    nomatch ->
-        {list_to_binary(Destination), {0, []}};
-    match ->
-        [DocId, RevQs] = re:split(Destination, "\\?", [{return, list}]),
-        [_RevQueryKey, Rev] = re:split(RevQs, "=", [{return, list}]),
-        {Pos, RevId} = couch_doc:parse_rev(Rev),
-        {list_to_binary(DocId), {Pos, [RevId]}}
+    case couch_httpd:header_value(Req, "Destination") of
+        undefined ->
+            throw({bad_request, "Destination header in mandatory for COPY."});
+        Destination ->
+            case re:run(Destination, "\\?", [{capture, none}]) of
+                nomatch ->
+                    {list_to_binary(Destination), {0, []}};
+                match ->
+                    [DocId, RevQs] = re:split(Destination, "\\?", [{return, list}]),
+                    [_RevQueryKey, Rev] = re:split(RevQs, "=", [{return, list}]),
+                    {Pos, RevId} = couch_doc:parse_rev(Rev),
+                    {list_to_binary(DocId), {Pos, [RevId]}}
+            end
     end.
 
 validate_attachment_names(Doc) ->
@@ -1183,34 +1302,8 @@ validate_attachment_name(Name) when is_list(Name) ->
 validate_attachment_name(<<"_",_/binary>>) ->
     throw({bad_request, <<"Attachment name can't start with '_'">>});
 validate_attachment_name(Name) ->
-    case is_valid_utf8(Name) of
+    case couch_util:validate_utf8(Name) of
         true -> Name;
         false -> throw({bad_request, <<"Attachment name is not UTF-8 encoded">>})
     end.
 
-%% borrowed from mochijson2:json_bin_is_safe()
-is_valid_utf8(<<>>) ->
-    true;
-is_valid_utf8(<<C, Rest/binary>>) ->
-    case C of
-        $\" ->
-            false;
-        $\\ ->
-            false;
-        $\b ->
-            false;
-        $\f ->
-            false;
-        $\n ->
-            false;
-        $\r ->
-            false;
-        $\t ->
-            false;
-        C when C >= 0, C < $\s; C >= 16#7f, C =< 16#10FFFF ->
-            false;
-        C when C < 16#7f ->
-            is_valid_utf8(Rest);
-        _ ->
-            false
-    end.
diff --git a/apps/couch/src/couch_httpd_external.erl b/apps/couch/src/couch_httpd_external.erl
index 07202934..2e91fb50 100644
--- a/apps/couch/src/couch_httpd_external.erl
+++ b/apps/couch/src/couch_httpd_external.erl
@@ -56,6 +56,7 @@ process_external_req(HttpReq, Db, Name) ->
 json_req_obj(Req, Db) -> json_req_obj(Req, Db, null).
 json_req_obj(#httpd{mochi_req=Req,
                method=Method,
+               requested_path_parts=RequestedPath,
                path_parts=Path,
                req_body=ReqBody
             }, Db, DocId) ->
@@ -65,18 +66,23 @@ json_req_obj(#httpd{mochi_req=Req,
     end,
     ParsedForm = case Req:get_primary_header_value("content-type") of
         "application/x-www-form-urlencoded" ++ _ ->
-            mochiweb_util:parse_qs(Body);
+            case Body of
+            undefined -> [];
+            _ -> mochiweb_util:parse_qs(Body)
+            end;
         _ ->
             []
     end,
     Headers = Req:get(headers),
     Hlist = mochiweb_headers:to_list(Headers),
     {ok, Info} = couch_db:get_db_info(Db),
-    % add headers...
+    
+% add headers...
     {[{<<"info">>, {Info}},
         {<<"id">>, DocId},
         {<<"uuid">>, couch_uuids:new()},
         {<<"method">>, Method},
+        {<<"requested_path">>, RequestedPath},
         {<<"path">>, Path},
         {<<"query">>, json_query_keys(to_json_terms(Req:parse_qs()))},
         {<<"headers">>, to_json_terms(Hlist)},
@@ -84,7 +90,8 @@ json_req_obj(#httpd{mochi_req=Req,
         {<<"peer">>, ?l2b(Req:get(peer))},
         {<<"form">>, to_json_terms(ParsedForm)},
         {<<"cookie">>, to_json_terms(Req:parse_cookie())},
-        {<<"userCtx">>, couch_util:json_user_ctx(Db)}]}.
+        {<<"userCtx">>, couch_util:json_user_ctx(Db)},
+        {<<"secObj">>, couch_db:get_security(Db)}]}.
 
 to_json_terms(Data) ->
     to_json_terms(Data, []).
diff --git a/apps/couch/src/couch_httpd_misc_handlers.erl b/apps/couch/src/couch_httpd_misc_handlers.erl
index 7a149d11..15f0cad3 100644
--- a/apps/couch/src/couch_httpd_misc_handlers.erl
+++ b/apps/couch/src/couch_httpd_misc_handlers.erl
@@ -162,15 +162,6 @@ handle_config_req(#httpd{method='GET', path_parts=[_,Section]}=Req) ->
     KVs = [{list_to_binary(Key), list_to_binary(Value)}
             || {Key, Value} <- couch_config:get(Section)],
     send_json(Req, 200, {KVs});
-% PUT /_config/Section/Key
-% "value"
-handle_config_req(#httpd{method='PUT', path_parts=[_, Section, Key]}=Req) ->
-    ok = couch_httpd:verify_is_server_admin(Req),
-    Value = couch_httpd:json_body(Req),
-    Persist = couch_httpd:header_value(Req, "X-Couch-Persist") /= "false",
-    OldValue = couch_config:get(Section, Key, ""),
-    ok = couch_config:set(Section, Key, ?b2l(Value), Persist),
-    send_json(Req, 200, list_to_binary(OldValue));
 % GET /_config/Section/Key
 handle_config_req(#httpd{method='GET', path_parts=[_, Section, Key]}=Req) ->
     ok = couch_httpd:verify_is_server_admin(Req),
@@ -180,19 +171,86 @@ handle_config_req(#httpd{method='GET', path_parts=[_, Section, Key]}=Req) ->
     Value ->
         send_json(Req, 200, list_to_binary(Value))
     end;
-% DELETE /_config/Section/Key
-handle_config_req(#httpd{method='DELETE',path_parts=[_,Section,Key]}=Req) ->
+% PUT or DELETE /_config/Section/Key
+handle_config_req(#httpd{method=Method, path_parts=[_, Section, Key]}=Req)
+      when (Method == 'PUT') or (Method == 'DELETE') ->
     ok = couch_httpd:verify_is_server_admin(Req),
     Persist = couch_httpd:header_value(Req, "X-Couch-Persist") /= "false",
+    case couch_config:get(<<"httpd">>, <<"config_whitelist">>, null) of
+        null ->
+            % No whitelist; allow all changes.
+            handle_approved_config_req(Req, Persist);
+        WhitelistValue ->
+            % Provide a failsafe to protect against inadvertently locking
+            % onesself out of the config by supplying a syntactically-incorrect
+            % Erlang term. To intentionally lock down the whitelist, supply a
+            % well-formed list which does not include the whitelist config
+            % variable itself.
+            FallbackWhitelist = [{<<"httpd">>, <<"config_whitelist">>}],
+
+            Whitelist = case couch_util:parse_term(WhitelistValue) of
+                {ok, Value} when is_list(Value) ->
+                    Value;
+                {ok, _NonListValue} ->
+                    FallbackWhitelist;
+                {error, _} ->
+                    [{WhitelistSection, WhitelistKey}] = FallbackWhitelist,
+                    ?LOG_ERROR("Only whitelisting ~s/~s due to error parsing: ~p",
+                               [WhitelistSection, WhitelistKey, WhitelistValue]),
+                    FallbackWhitelist
+            end,
+
+            IsRequestedKeyVal = fun(Element) ->
+                case Element of
+                    {A, B} ->
+                        % For readability, tuples may be used instead of binaries
+                        % in the whitelist.
+                        case {couch_util:to_binary(A), couch_util:to_binary(B)} of
+                            {Section, Key} ->
+                                true;
+                            {Section, <<"*">>} ->
+                                true;
+                            _Else ->
+                                false
+                        end;
+                    _Else ->
+                        false
+                end
+            end,
+
+            case lists:any(IsRequestedKeyVal, Whitelist) of
+                true ->
+                    % Allow modifying this whitelisted variable.
+                    handle_approved_config_req(Req, Persist);
+                _NotWhitelisted ->
+                    % Disallow modifying this non-whitelisted variable.
+                    send_error(Req, 400, <<"modification_not_allowed">>,
+                               ?l2b("This config variable is read-only"))
+            end
+    end;
+handle_config_req(Req) ->
+    send_method_not_allowed(Req, "GET,PUT,DELETE").
+
+% PUT /_config/Section/Key
+% "value"
+handle_approved_config_req(#httpd{method='PUT', path_parts=[_, Section, Key]}=Req, Persist) ->
+    Value = couch_httpd:json_body(Req),
+    OldValue = couch_config:get(Section, Key, ""),
+    case couch_config:set(Section, Key, ?b2l(Value), Persist) of
+    ok ->
+    send_json(Req, 200, list_to_binary(OldValue));
+    Error ->
+        throw(Error)
+    end;
+% DELETE /_config/Section/Key
+handle_approved_config_req(#httpd{method='DELETE',path_parts=[_,Section,Key]}=Req, Persist) ->
     case couch_config:get(Section, Key, null) of
     null ->
         throw({not_found, unknown_config_value});
     OldValue ->
         couch_config:delete(Section, Key, Persist),
         send_json(Req, 200, list_to_binary(OldValue))
-    end;
-handle_config_req(Req) ->
-    send_method_not_allowed(Req, "GET,PUT,DELETE").
+    end.
 
 
 % httpd db handlers
diff --git a/apps/couch/src/couch_httpd_proxy.erl b/apps/couch/src/couch_httpd_proxy.erl
new file mode 100644
index 00000000..c196f72d
--- /dev/null
+++ b/apps/couch/src/couch_httpd_proxy.erl
@@ -0,0 +1,431 @@
+% Licensed under the Apache License, Version 2.0 (the "License"); you may not
+% use this file except in compliance with the License. You may obtain a copy of
+% the License at
+%
+%   http://www.apache.org/licenses/LICENSE-2.0
+%
+% Unless required by applicable law or agreed to in writing, software
+% distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
+% WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
+% License for the specific language governing permissions and limitations under
+% the License.
+-module(couch_httpd_proxy).
+
+-export([handle_proxy_req/2]).
+
+-include("couch_db.hrl").
+-include_lib("ibrowse/include/ibrowse.hrl").
+
+-define(TIMEOUT, infinity).
+-define(PKT_SIZE, 4096).
+
+
+handle_proxy_req(Req, ProxyDest) ->
+
+    %% Bug in Mochiweb?
+    %% Reported here: http://github.com/mochi/mochiweb/issues/issue/16
+    erase(mochiweb_request_body_length),
+
+    Method = get_method(Req),
+    Url = get_url(Req, ProxyDest),
+    Version = get_version(Req),
+    Headers = get_headers(Req),
+    Body = get_body(Req),
+    Options = [
+        {http_vsn, Version},
+        {headers_as_is, true},
+        {response_format, binary},
+        {stream_to, {self(), once}}
+    ],
+    case ibrowse:send_req(Url, Headers, Method, Body, Options, ?TIMEOUT) of
+        {ibrowse_req_id, ReqId} ->
+            stream_response(Req, ProxyDest, ReqId);
+        {error, Reason} ->
+            throw({error, Reason})
+    end.
+    
+
+get_method(#httpd{mochi_req=MochiReq}) ->
+    case MochiReq:get(method) of
+        Method when is_atom(Method) ->
+            list_to_atom(string:to_lower(atom_to_list(Method)));
+        Method when is_list(Method) ->
+            list_to_atom(string:to_lower(Method));
+        Method when is_binary(Method) ->
+            list_to_atom(string:to_lower(?b2l(Method)))
+    end.
+
+
+get_url(Req, ProxyDest) when is_binary(ProxyDest) ->
+    get_url(Req, ?b2l(ProxyDest));
+get_url(#httpd{mochi_req=MochiReq}=Req, ProxyDest) ->
+    BaseUrl = case mochiweb_util:partition(ProxyDest, "/") of
+        {[], "/", _} -> couch_httpd:absolute_uri(Req, ProxyDest);
+        _ -> ProxyDest
+    end,
+    ProxyPrefix = "/" ++ ?b2l(hd(Req#httpd.path_parts)),
+    RequestedPath = MochiReq:get(raw_path),
+    case mochiweb_util:partition(RequestedPath, ProxyPrefix) of
+        {[], ProxyPrefix, []} ->
+            BaseUrl;
+        {[], ProxyPrefix, [$/ | DestPath]} ->
+            remove_trailing_slash(BaseUrl) ++ "/" ++ DestPath;
+        {[], ProxyPrefix, DestPath} ->
+            remove_trailing_slash(BaseUrl) ++ "/" ++ DestPath;
+        _Else ->
+            throw({invalid_url_path, {ProxyPrefix, RequestedPath}})
+    end.
+
+get_version(#httpd{mochi_req=MochiReq}) ->
+    MochiReq:get(version).
+
+
+get_headers(#httpd{mochi_req=MochiReq}) ->
+    to_ibrowse_headers(mochiweb_headers:to_list(MochiReq:get(headers)), []).
+
+to_ibrowse_headers([], Acc) ->
+    lists:reverse(Acc);
+to_ibrowse_headers([{K, V} | Rest], Acc) when is_atom(K) ->
+    to_ibrowse_headers([{atom_to_list(K), V} | Rest], Acc);
+to_ibrowse_headers([{K, V} | Rest], Acc) when is_list(K) ->
+    case string:to_lower(K) of
+        "content-length" ->
+            to_ibrowse_headers(Rest, [{content_length, V} | Acc]);
+        % This appears to make ibrowse too smart.
+        %"transfer-encoding" ->
+        %    to_ibrowse_headers(Rest, [{transfer_encoding, V} | Acc]);
+        _ ->
+            to_ibrowse_headers(Rest, [{K, V} | Acc])
+    end.
+
+get_body(#httpd{method='GET'}) ->
+    fun() -> eof end;
+get_body(#httpd{method='HEAD'}) ->
+    fun() -> eof end;
+get_body(#httpd{method='DELETE'}) ->
+    fun() -> eof end;
+get_body(#httpd{mochi_req=MochiReq}) ->
+    case MochiReq:get(body_length) of
+        undefined ->
+            <<>>;
+        {unknown_transfer_encoding, Unknown} ->
+            exit({unknown_transfer_encoding, Unknown});
+        chunked ->
+            {fun stream_chunked_body/1, {init, MochiReq, 0}};
+        0 ->
+            <<>>;
+        Length when is_integer(Length) andalso Length > 0 ->
+            {fun stream_length_body/1, {init, MochiReq, Length}};
+        Length ->
+            exit({invalid_body_length, Length})
+    end.
+
+
+remove_trailing_slash(Url) ->
+    rem_slash(lists:reverse(Url)).
+
+rem_slash([]) ->
+    [];
+rem_slash([$\s | RevUrl]) ->
+    rem_slash(RevUrl);
+rem_slash([$\t | RevUrl]) ->
+    rem_slash(RevUrl);
+rem_slash([$\r | RevUrl]) ->
+    rem_slash(RevUrl);
+rem_slash([$\n | RevUrl]) ->
+    rem_slash(RevUrl);
+rem_slash([$/ | RevUrl]) ->
+    rem_slash(RevUrl);
+rem_slash(RevUrl) ->
+    lists:reverse(RevUrl).
+
+
+stream_chunked_body({init, MReq, 0}) ->
+    % First chunk, do expect-continue dance.
+    init_body_stream(MReq),
+    stream_chunked_body({stream, MReq, 0, [], ?PKT_SIZE});
+stream_chunked_body({stream, MReq, 0, Buf, BRem}) ->
+    % Finished a chunk, get next length. If next length
+    % is 0, its time to try and read trailers.
+    {CRem, Data} = read_chunk_length(MReq),
+    case CRem of
+        0 ->
+            BodyData = lists:reverse(Buf, Data),
+            {ok, BodyData, {trailers, MReq, [], ?PKT_SIZE}}; 
+        _ ->
+            stream_chunked_body(
+                {stream, MReq, CRem, [Data | Buf], BRem-size(Data)}
+            )
+    end;
+stream_chunked_body({stream, MReq, CRem, Buf, BRem}) when BRem =< 0 ->
+    % Time to empty our buffers to the upstream socket.
+    BodyData = lists:reverse(Buf),
+    {ok, BodyData, {stream, MReq, CRem, [], ?PKT_SIZE}};
+stream_chunked_body({stream, MReq, CRem, Buf, BRem}) ->
+    % Buffer some more data from the client.
+    Length = lists:min([CRem, BRem]),
+    Socket = MReq:get(socket),
+    NewState = case mochiweb_socket:recv(Socket, Length, ?TIMEOUT) of
+        {ok, Data} when size(Data) == CRem ->
+            case mochiweb_socket:recv(Socket, 2, ?TIMEOUT) of
+                {ok, <<"\r\n">>} ->
+                    {stream, MReq, 0, [<<"\r\n">>, Data | Buf], BRem-Length-2};
+                _ ->
+                    exit(normal)
+            end;
+        {ok, Data} ->
+            {stream, MReq, CRem-Length, [Data | Buf], BRem-Length};
+        _ ->
+            exit(normal)
+    end,
+    stream_chunked_body(NewState);
+stream_chunked_body({trailers, MReq, Buf, BRem}) when BRem =< 0 ->
+    % Empty our buffers and send data upstream.
+    BodyData = lists:reverse(Buf),
+    {ok, BodyData, {trailers, MReq, [], ?PKT_SIZE}};
+stream_chunked_body({trailers, MReq, Buf, BRem}) ->
+    % Read another trailer into the buffer or stop on an
+    % empty line.
+    Socket = MReq:get(socket),
+    mochiweb_socket:setopts(Socket, [{packet, line}]),
+    case mochiweb_socket:recv(Socket, 0, ?TIMEOUT) of
+        {ok, <<"\r\n">>} ->
+            mochiweb_socket:setopts(Socket, [{packet, raw}]),
+            BodyData = lists:reverse(Buf, <<"\r\n">>),
+            {ok, BodyData, eof};
+        {ok, Footer} ->
+            mochiweb_socket:setopts(Socket, [{packet, raw}]),
+            NewState = {trailers, MReq, [Footer | Buf], BRem-size(Footer)},
+            stream_chunked_body(NewState);
+        _ ->
+            exit(normal)
+    end;
+stream_chunked_body(eof) ->
+    % Tell ibrowse we're done sending data.
+    eof.
+
+
+stream_length_body({init, MochiReq, Length}) ->
+    % Do the expect-continue dance
+    init_body_stream(MochiReq),
+    stream_length_body({stream, MochiReq, Length});
+stream_length_body({stream, _MochiReq, 0}) ->
+    % Finished streaming.
+    eof;
+stream_length_body({stream, MochiReq, Length}) ->
+    BufLen = lists:min([Length, ?PKT_SIZE]),
+    case MochiReq:recv(BufLen) of
+        <<>> -> eof;
+        Bin -> {ok, Bin, {stream, MochiReq, Length-BufLen}}
+    end.
+
+
+init_body_stream(MochiReq) ->
+    Expect = case MochiReq:get_header_value("expect") of
+        undefined ->
+            undefined;
+        Value when is_list(Value) ->
+            string:to_lower(Value)
+    end,
+    case Expect of
+        "100-continue" ->
+            MochiReq:start_raw_response({100, gb_trees:empty()});
+        _Else ->
+            ok
+    end.
+
+
+read_chunk_length(MochiReq) ->
+    Socket = MochiReq:get(socket),
+    mochiweb_socket:setopts(Socket, [{packet, line}]),
+    case mochiweb_socket:recv(Socket, 0, ?TIMEOUT) of
+        {ok, Header} ->
+            mochiweb_socket:setopts(Socket, [{packet, raw}]),
+            Splitter = fun(C) ->
+                C =/= $\r andalso C =/= $\n andalso C =/= $\s
+            end,
+            {Hex, _Rest} = lists:splitwith(Splitter, ?b2l(Header)),
+            {mochihex:to_int(Hex), Header};
+        _ ->
+            exit(normal)
+    end.
+
+
+stream_response(Req, ProxyDest, ReqId) ->
+    receive
+        {ibrowse_async_headers, ReqId, "100", _} ->
+            % ibrowse doesn't handle 100 Continue responses which
+            % means we have to discard them so the proxy client
+            % doesn't get confused.
+            ibrowse:stream_next(ReqId),
+            stream_response(Req, ProxyDest, ReqId);
+        {ibrowse_async_headers, ReqId, Status, Headers} ->
+            {Source, Dest} = get_urls(Req, ProxyDest),
+            FixedHeaders = fix_headers(Source, Dest, Headers, []),
+            case body_length(FixedHeaders) of
+                chunked ->
+                    {ok, Resp} = couch_httpd:start_chunked_response(
+                        Req, list_to_integer(Status), FixedHeaders
+                    ),
+                    ibrowse:stream_next(ReqId),
+                    stream_chunked_response(Req, ReqId, Resp),
+                    {ok, Resp};
+                Length when is_integer(Length) ->
+                    {ok, Resp} = couch_httpd:start_response_length(
+                        Req, list_to_integer(Status), FixedHeaders, Length
+                    ),
+                    ibrowse:stream_next(ReqId),
+                    stream_length_response(Req, ReqId, Resp),
+                    {ok, Resp};
+                _ ->
+                    {ok, Resp} = couch_httpd:start_response(
+                        Req, list_to_integer(Status), FixedHeaders
+                    ),
+                    ibrowse:stream_next(ReqId),
+                    stream_length_response(Req, ReqId, Resp),
+                    % XXX: MochiWeb apparently doesn't look at the
+                    % response to see if it must force close the
+                    % connection. So we help it out here.
+                    erlang:put(mochiweb_request_force_close, true),
+                    {ok, Resp}
+            end
+    end.
+
+
+stream_chunked_response(Req, ReqId, Resp) ->
+    receive
+        {ibrowse_async_response, ReqId, {error, Reason}} ->
+            throw({error, Reason});
+        {ibrowse_async_response, ReqId, Chunk} ->
+            couch_httpd:send_chunk(Resp, Chunk),
+            ibrowse:stream_next(ReqId),
+            stream_chunked_response(Req, ReqId, Resp);
+        {ibrowse_async_response_end, ReqId} ->
+            couch_httpd:last_chunk(Resp)
+    end.
+
+
+stream_length_response(Req, ReqId, Resp) ->
+    receive
+        {ibrowse_async_response, ReqId, {error, Reason}} ->
+            throw({error, Reason});
+        {ibrowse_async_response, ReqId, Chunk} ->
+            couch_httpd:send(Resp, Chunk),
+            ibrowse:stream_next(ReqId),
+            stream_length_response(Req, ReqId, Resp);
+        {ibrowse_async_response_end, ReqId} ->
+            ok
+    end.
+
+
+get_urls(Req, ProxyDest) ->
+    SourceUrl = couch_httpd:absolute_uri(Req, "/" ++ hd(Req#httpd.path_parts)),
+    Source = parse_url(?b2l(iolist_to_binary(SourceUrl))),
+    case (catch parse_url(ProxyDest)) of
+        Dest when is_record(Dest, url) ->
+            {Source, Dest};
+        _ ->
+            DestUrl = couch_httpd:absolute_uri(Req, ProxyDest),
+            {Source, parse_url(DestUrl)}
+    end.
+
+
+fix_headers(_, _, [], Acc) ->
+    lists:reverse(Acc);
+fix_headers(Source, Dest, [{K, V} | Rest], Acc) ->
+    Fixed = case string:to_lower(K) of
+        "location" -> rewrite_location(Source, Dest, V);
+        "content-location" -> rewrite_location(Source, Dest, V);
+        "uri" -> rewrite_location(Source, Dest, V);
+        "destination" -> rewrite_location(Source, Dest, V);
+        "set-cookie" -> rewrite_cookie(Source, Dest, V);
+        _ -> V
+    end,
+    fix_headers(Source, Dest, Rest, [{K, Fixed} | Acc]).
+
+
+rewrite_location(Source, #url{host=Host, port=Port, protocol=Proto}, Url) ->
+    case (catch parse_url(Url)) of
+        #url{host=Host, port=Port, protocol=Proto} = Location ->
+            DestLoc = #url{
+                protocol=Source#url.protocol,
+                host=Source#url.host,
+                port=Source#url.port,
+                path=join_url_path(Source#url.path, Location#url.path)
+            },
+            url_to_url(DestLoc);
+        #url{} ->
+            Url;
+        _ ->
+            url_to_url(Source#url{path=join_url_path(Source#url.path, Url)})
+    end.
+
+
+rewrite_cookie(_Source, _Dest, Cookie) ->
+    Cookie.
+
+
+parse_url(Url) when is_binary(Url) ->
+    ibrowse_lib:parse_url(?b2l(Url));
+parse_url(Url) when is_list(Url) ->
+    ibrowse_lib:parse_url(?b2l(iolist_to_binary(Url))).
+
+
+join_url_path(Src, Dst) ->
+    Src2 = case lists:reverse(Src) of
+        "/" ++ RestSrc -> lists:reverse(RestSrc);
+        _ -> Src
+    end,
+    Dst2 = case Dst of
+        "/" ++ RestDst -> RestDst;
+        _ -> Dst
+    end,
+    Src2 ++ "/" ++ Dst2.
+
+
+url_to_url(#url{host=Host, port=Port, path=Path, protocol=Proto} = Url) ->
+    LPort = case {Proto, Port} of
+        {http, 80} -> "";
+        {https, 443} -> "";
+        _ -> ":" ++ integer_to_list(Port)
+    end,
+    LPath = case Path of
+        "/" ++ _RestPath -> Path;
+        _ -> "/" ++ Path
+    end,
+    HostPart = case Url#url.host_type of
+        ipv6_address ->
+            "[" ++ Host ++ "]";
+        _ ->
+            Host
+    end,
+    atom_to_list(Proto) ++ "://" ++ HostPart ++ LPort ++ LPath.
+
+
+body_length(Headers) ->
+    case is_chunked(Headers) of
+        true -> chunked;
+        _ -> content_length(Headers)
+    end.
+
+
+is_chunked([]) ->
+    false;
+is_chunked([{K, V} | Rest]) ->
+    case string:to_lower(K) of
+        "transfer-encoding" ->
+            string:to_lower(V) == "chunked";
+        _ ->
+            is_chunked(Rest)
+    end.
+
+content_length([]) ->
+    undefined;
+content_length([{K, V} | Rest]) ->
+    case string:to_lower(K) of
+        "content-length" ->
+            list_to_integer(V);
+        _ ->
+            content_length(Rest)
+    end.
+
diff --git a/apps/couch/src/couch_httpd_rewrite.erl b/apps/couch/src/couch_httpd_rewrite.erl
index 6c3d0e3c..8480c1e9 100644
--- a/apps/couch/src/couch_httpd_rewrite.erl
+++ b/apps/couch/src/couch_httpd_rewrite.erl
@@ -117,8 +117,7 @@ handle_rewrite_req(#httpd{
     % we are in a design handler
     DesignId = <<"_design/", DesignName/binary>>,
     Prefix = <<"/", DbName/binary, "/", DesignId/binary>>,
-    QueryList = couch_httpd:qs(Req),
-    QueryList1 = [{to_binding(K), V} || {K, V} <- QueryList],
+    QueryList = lists:map(fun decode_query_value/1, couch_httpd:qs(Req)),
 
     #doc{body={Props}} = DDoc,
 
@@ -133,10 +132,11 @@ handle_rewrite_req(#httpd{
         Rules ->
             % create dispatch list from rules
             DispatchList =  [make_rule(Rule) || {Rule} <- Rules],
+            Method1 = couch_util:to_binary(Method),
 
             %% get raw path by matching url to a rule.
-            RawPath = case try_bind_path(DispatchList, couch_util:to_binary(Method), PathParts,
-                                    QueryList1) of
+            RawPath = case try_bind_path(DispatchList, Method1, 
+                    PathParts, QueryList) of
                 no_dispatch_path ->
                     throw(not_found);
                 {NewPathParts, Bindings} ->
@@ -144,12 +144,13 @@ handle_rewrite_req(#httpd{
 
                     % build new path, reencode query args, eventually convert
                     % them to json
-                    Path = lists:append(
-                        string:join(Parts, [?SEPARATOR]),
-                        case Bindings of
-                            [] -> [];
-                            _ -> [$?, encode_query(Bindings)]
-                        end),
+                    Bindings1 = maybe_encode_bindings(Bindings),
+                    Path = binary_to_list(
+                        iolist_to_binary([
+                                string:join(Parts, [?SEPARATOR]),
+                                [["?", mochiweb_util:urlencode(Bindings1)] 
+                                    || Bindings1 =/= [] ]
+                            ])),
                     
                     % if path is relative detect it and rewrite path
                     case mochiweb_util:safe_relative_path(Path) of
@@ -196,7 +197,7 @@ quote_plus(X) ->
 try_bind_path([], _Method, _PathParts, _QueryList) ->
     no_dispatch_path;
 try_bind_path([Dispatch|Rest], Method, PathParts, QueryList) ->
-    [{PathParts1, Method1}, RedirectPath, QueryArgs] = Dispatch,
+    [{PathParts1, Method1}, RedirectPath, QueryArgs, Formats] = Dispatch,
     case bind_method(Method1, Method) of
         true ->
             case bind_path(PathParts1, PathParts, []) of
@@ -204,7 +205,8 @@ try_bind_path([Dispatch|Rest], Method, PathParts, QueryList) ->
                     Bindings1 = Bindings ++ QueryList,
                     % we parse query args from the rule and fill
                     % it eventually with bindings vars
-                    QueryArgs1 = make_query_list(QueryArgs, Bindings1, []),
+                    QueryArgs1 = make_query_list(QueryArgs, Bindings1,
+                        Formats, []),
                     % remove params in QueryLists1 that are already in
                     % QueryArgs1
                     Bindings2 = lists:foldl(fun({K, V}, Acc) ->
@@ -230,56 +232,79 @@ try_bind_path([Dispatch|Rest], Method, PathParts, QueryList) ->
 %% rewriting dynamically the quey list given as query member in
 %% rewrites. Each value is replaced by one binding or an argument
 %% passed in url.
-make_query_list([], _Bindings, Acc) ->
+make_query_list([], _Bindings, _Formats, Acc) ->
     Acc;
-make_query_list([{Key, {Value}}|Rest], Bindings, Acc) ->
-    Value1 = to_json({Value}),
-    make_query_list(Rest, Bindings, [{to_binding(Key), Value1}|Acc]);
-make_query_list([{Key, Value}|Rest], Bindings, Acc) when is_binary(Value) ->
-    Value1 = replace_var(Key, Value, Bindings),
-    make_query_list(Rest, Bindings, [{to_binding(Key), Value1}|Acc]);
-make_query_list([{Key, Value}|Rest], Bindings, Acc) when is_list(Value) ->
-    Value1 = replace_var(Key, Value, Bindings),
-    make_query_list(Rest, Bindings, [{to_binding(Key), Value1}|Acc]);
-make_query_list([{Key, Value}|Rest], Bindings, Acc) ->
-    make_query_list(Rest, Bindings, [{to_binding(Key), Value}|Acc]).
-
-replace_var(Key, Value, Bindings) ->
-    case Value of
-        <<":", Var/binary>> ->
-            get_var(Var, Bindings, Value);
-        _ when is_list(Value) ->
-            Value1 = lists:foldr(fun(V, Acc) ->
-                V1 = case V of
-                    <<":", VName/binary>> ->
-                        case get_var(VName, Bindings, V) of
-                            V2 when is_list(V2) ->
-                                iolist_to_binary(V2);
-                            V2 -> V2
-                        end;
-                    _ ->
-                        
-                        V
-                end,
-                [V1|Acc]
-            end, [], Value),
-            to_json(Value1);
-        _ when is_binary(Value) ->
-            Value;
-        _ ->
-            case Key of
-                <<"key">> -> to_json(Value);
-                <<"startkey">> -> to_json(Value);
-                <<"endkey">> -> to_json(Value);
-                _ ->
-                    lists:flatten(?JSON_ENCODE(Value))
-            end
+make_query_list([{Key, {Value}}|Rest], Bindings, Formats, Acc) ->
+    Value1 = {Value},
+    make_query_list(Rest, Bindings, Formats, [{to_binding(Key), Value1}|Acc]);
+make_query_list([{Key, Value}|Rest], Bindings, Formats, Acc) when is_binary(Value) ->
+    Value1 = replace_var(Value, Bindings, Formats),
+    make_query_list(Rest, Bindings, Formats, [{to_binding(Key), Value1}|Acc]);
+make_query_list([{Key, Value}|Rest], Bindings, Formats, Acc) when is_list(Value) ->
+    Value1 = replace_var(Value, Bindings, Formats),
+    make_query_list(Rest, Bindings, Formats, [{to_binding(Key), Value1}|Acc]);
+make_query_list([{Key, Value}|Rest], Bindings, Formats, Acc) ->
+    make_query_list(Rest, Bindings, Formats, [{to_binding(Key), Value}|Acc]).
+
+replace_var(<<"*">>=Value, Bindings, Formats) ->
+    get_var(Value, Bindings, Value, Formats);
+replace_var(<<":", Var/binary>> = Value, Bindings, Formats) ->
+    get_var(Var, Bindings, Value, Formats);
+replace_var(Value, _Bindings, _Formats) when is_binary(Value) ->
+    Value;
+replace_var(Value, Bindings, Formats) when is_list(Value) ->
+    lists:reverse(lists:foldl(fun
+                (<<":", Var/binary>>=Value1, Acc) ->
+                    [get_var(Var, Bindings, Value1, Formats)|Acc];
+                (Value1, Acc) ->
+                    [Value1|Acc]
+            end, [], Value));
+replace_var(Value, _Bindings, _Formats) ->
+    Value.
+                    
+maybe_json(Key, Value) ->
+    case lists:member(Key, [<<"key">>, <<"startkey">>, <<"start_key">>,
+                <<"endkey">>, <<"end_key">>, <<"keys">>]) of
+        true ->
+            ?JSON_ENCODE(Value);
+        false ->
+            Value
     end.
 
-
-get_var(VarName, Props, Default) ->
+get_var(VarName, Props, Default, Formats) ->
     VarName1 = to_binding(VarName),
-    couch_util:get_value(VarName1, Props, Default).
+    Val = couch_util:get_value(VarName1, Props, Default),
+    maybe_format(VarName, Val, Formats).
+
+maybe_format(VarName, Value, Formats) ->
+    case couch_util:get_value(VarName, Formats) of
+        undefined ->
+             Value;
+        Format ->
+            format(Format, Value)
+    end.
+
+format(<<"int">>, Value) when is_integer(Value) ->
+    Value;
+format(<<"int">>, Value) when is_binary(Value) ->
+    format(<<"int">>, ?b2l(Value));
+format(<<"int">>, Value) when is_list(Value) ->
+    case (catch list_to_integer(Value)) of
+        IntVal when is_integer(IntVal) ->
+            IntVal;
+        _ ->
+            Value
+    end;
+format(<<"bool">>, Value) when is_binary(Value) ->
+    format(<<"bool">>, ?b2l(Value));
+format(<<"bool">>, Value) when is_list(Value) ->
+    case string:to_lower(Value) of
+        "true" -> true;
+        "false" -> false;
+        _ -> Value
+    end;
+format(_Format, Value) ->
+   Value. 
 
 %% doc: build new patch from bindings. bindings are query args
 %% (+ dynamic query rewritten if needed) and bindings found in
@@ -295,7 +320,8 @@ make_new_path([?MATCH_ALL|_Rest], _Bindings, Remaining, Acc) ->
 make_new_path([{bind, P}|Rest], Bindings, Remaining, Acc) ->
     P2 = case couch_util:get_value({bind, P}, Bindings) of
         undefined -> << "undefined">>;
-        P1 -> P1
+        P1 -> 
+            iolist_to_binary(P1)
     end,
     make_new_path(Rest, Bindings, Remaining, [P2|Acc]);
 make_new_path([P|Rest], Bindings, Remaining, Acc) ->
@@ -306,7 +332,7 @@ make_new_path([P|Rest], Bindings, Remaining, Acc) ->
 %% method rule is '*', which is the default, all
 %% request method will bind. It allows us to make rules
 %% depending on HTTP method.
-bind_method(?MATCH_ALL, _Method) ->
+bind_method(?MATCH_ALL, _Method ) ->
     true;
 bind_method({bind, Method}, Method) ->
     true;
@@ -318,8 +344,8 @@ bind_method(_, _) ->
 %% to the current url by pattern matching
 bind_path([], [], Bindings) ->
     {ok, [], Bindings};
-bind_path([?MATCH_ALL], Rest, Bindings) when is_list(Rest) ->
-    {ok, Rest, Bindings};
+bind_path([?MATCH_ALL], [Match|_RestMatch]=Rest, Bindings) ->
+    {ok, Rest, [{?MATCH_ALL, Match}|Bindings]};
 bind_path(_, [], _) ->
     fail;
 bind_path([{bind, Token}|RestToken],[Match|RestMatch],Bindings) ->
@@ -372,7 +398,11 @@ make_rule(Rule) ->
         To ->
             parse_path(To)
         end,
-    [{FromParts, Method}, ToParts, QueryArgs].
+    Formats = case couch_util:get_value(<<"formats">>, Rule) of
+        undefined -> [];
+        {Fmts} -> Fmts
+    end,
+    [{FromParts, Method}, ToParts, QueryArgs, Formats].
 
 parse_path(Path) ->
     {ok, SlashRE} = re:compile(<<"\\/">>),
@@ -405,17 +435,25 @@ path_to_list([P|R], Acc, DotDotCount) ->
     end,
     path_to_list(R, [P1|Acc], DotDotCount).
 
-encode_query(Props) ->
-    Props1 = lists:foldl(fun ({{bind, K}, V}, Acc) ->
-        V1 = case is_list(V) orelse is_binary(V) of
-            true -> V;
-            false ->
-                % probably it's a number
-                quote_plus(V)
-        end,
-        [{K, V1} | Acc]
-    end, [], Props),
-    lists:flatten(mochiweb_util:urlencode(Props1)).
+maybe_encode_bindings([]) ->
+    [];
+maybe_encode_bindings(Props) -> 
+    lists:foldl(fun 
+            ({{bind, <<"*">>}, _V}, Acc) ->
+                Acc;
+            ({{bind, K}, V}, Acc) ->
+                V1 = iolist_to_binary(maybe_json(K, V)),
+                [{K, V1}|Acc]
+        end, [], Props).
+                
+decode_query_value({K,V}) ->
+    case lists:member(K, ["key", "startkey", "start_key",
+                "endkey", "end_key", "keys"]) of
+        true ->
+            {to_binding(K), ?JSON_DECODE(V)};
+        false ->
+            {to_binding(K), ?l2b(V)}
+    end.
 
 to_binding({bind, V}) ->
     {bind, V};
@@ -423,6 +461,3 @@ to_binding(V) when is_list(V) ->
     to_binding(?l2b(V));
 to_binding(V) ->
     {bind, V}.
-
-to_json(V) ->
-    iolist_to_binary(?JSON_ENCODE(V)).
diff --git a/apps/couch/src/couch_httpd_show.erl b/apps/couch/src/couch_httpd_show.erl
index d50ca83a..59f74e1c 100644
--- a/apps/couch/src/couch_httpd_show.erl
+++ b/apps/couch/src/couch_httpd_show.erl
@@ -153,12 +153,14 @@ send_doc_update_response(Req, Db, DDoc, UpdateName, Doc, DocId) ->
 % view-list request with view and list from same design doc.
 handle_view_list_req(#httpd{method='GET',
         path_parts=[_, _, DesignName, _, ListName, ViewName]}=Req, Db, DDoc) ->
-    handle_view_list(Req, Db, DDoc, ListName, {DesignName, ViewName}, nil);
+    Keys = couch_httpd:qs_json_value(Req, "keys", nil),
+    handle_view_list(Req, Db, DDoc, ListName, {DesignName, ViewName}, Keys);
 
 % view-list request with view and list from different design docs.
 handle_view_list_req(#httpd{method='GET',
         path_parts=[_, _, _, _, ListName, ViewDesignName, ViewName]}=Req, Db, DDoc) ->
-    handle_view_list(Req, Db, DDoc, ListName, {ViewDesignName, ViewName}, nil);
+    Keys = couch_httpd:qs_json_value(Req, "keys", nil),
+    handle_view_list(Req, Db, DDoc, ListName, {ViewDesignName, ViewName}, Keys);
 
 handle_view_list_req(#httpd{method='GET'}=Req, _Db, _DDoc) ->
     send_error(Req, 404, <<"list_error">>, <<"Invalid path.">>);
@@ -188,14 +190,14 @@ handle_view_list_req(Req, _Db, _DDoc) ->
 handle_view_list(Req, Db, DDoc, LName, {ViewDesignName, ViewName}, Keys) ->
     ViewDesignId = <<"_design/", ViewDesignName/binary>>,
     {ViewType, View, Group, QueryArgs} = couch_httpd_view:load_view(Req, Db, {ViewDesignId, ViewName}, Keys),
-    Etag = list_etag(Req, Db, Group, {couch_httpd:doc_etag(DDoc), Keys}),
+    Etag = list_etag(Req, Db, Group, View, {couch_httpd:doc_etag(DDoc), Keys}),
     couch_httpd:etag_respond(Req, Etag, fun() ->
             output_list(ViewType, Req, Db, DDoc, LName, View, QueryArgs, Etag, Keys, Group)
         end).
 
-list_etag(#httpd{user_ctx=UserCtx}=Req, Db, Group, More) ->
+list_etag(#httpd{user_ctx=UserCtx}=Req, Db, Group, View, More) ->
     Accept = couch_httpd:header_value(Req, "Accept"),
-    couch_httpd_view:view_group_etag(Group, Db, {More, Accept, UserCtx#user_ctx.roles}).
+    couch_httpd_view:view_etag(Db, Group, View, {More, Accept, UserCtx#user_ctx.roles}).
 
 output_list(map, Req, Db, DDoc, LName, View, QueryArgs, Etag, Keys, Group) ->
     output_map_list(Req, Db, DDoc, LName, View, QueryArgs, Etag, Keys, Group);
@@ -307,18 +309,20 @@ start_list_resp(QServer, LName, Req, Db, Head, Etag) ->
     {ok, Resp, ?b2l(?l2b(Chunks))}.
 
 make_map_send_row_fun(QueryServer) ->
-    fun(Resp, Db, Row, IncludeDocs, RowFront) ->
-        send_list_row(Resp, QueryServer, Db, Row, RowFront, IncludeDocs)
+    fun(Resp, Db, Row, IncludeDocs, Conflicts, RowFront) ->
+        send_list_row(
+            Resp, QueryServer, Db, Row, RowFront, IncludeDocs, Conflicts)
     end.
 
 make_reduce_send_row_fun(QueryServer, Db) ->
     fun(Resp, Row, RowFront) ->
-        send_list_row(Resp, QueryServer, Db, Row, RowFront, false)
+        send_list_row(Resp, QueryServer, Db, Row, RowFront, false, false)
     end.
 
-send_list_row(Resp, QueryServer, Db, Row, RowFront, IncludeDoc) ->
+send_list_row(Resp, QueryServer, Db, Row, RowFront, IncludeDoc, Conflicts) ->
     try
-        [Go,Chunks] = prompt_list_row(QueryServer, Db, Row, IncludeDoc),
+        [Go,Chunks] = prompt_list_row(
+            QueryServer, Db, Row, IncludeDoc, Conflicts),
         Chunk = RowFront ++ ?b2l(?l2b(Chunks)),
         send_non_empty_chunk(Resp, Chunk),
         case Go of
@@ -334,11 +338,12 @@ send_list_row(Resp, QueryServer, Db, Row, RowFront, IncludeDoc) ->
     end.
 
 
-prompt_list_row({Proc, _DDocId}, Db, {{Key, DocId}, Value}, IncludeDoc) ->
-    JsonRow = couch_httpd_view:view_row_obj(Db, {{Key, DocId}, Value}, IncludeDoc),
+prompt_list_row({Proc, _DDocId}, Db, {{_Key, _DocId}, _} = Kv,
+                IncludeDoc, Conflicts) ->
+    JsonRow = couch_httpd_view:view_row_obj(Db, Kv, IncludeDoc, Conflicts),
     couch_query_servers:proc_prompt(Proc, [<<"list_row">>, JsonRow]);
 
-prompt_list_row({Proc, _DDocId}, _, {Key, Value}, _IncludeDoc) ->
+prompt_list_row({Proc, _DDocId}, _, {Key, Value}, _IncludeDoc, _Conflicts) ->
     JsonRow = {[{key, Key}, {value, Value}]},
     couch_query_servers:proc_prompt(Proc, [<<"list_row">>, JsonRow]).
 
diff --git a/apps/couch/src/couch_httpd_vhost.erl b/apps/couch/src/couch_httpd_vhost.erl
new file mode 100644
index 00000000..9bfb5951
--- /dev/null
+++ b/apps/couch/src/couch_httpd_vhost.erl
@@ -0,0 +1,403 @@
+% Licensed under the Apache License, Version 2.0 (the "License"); you may not
+% use this file except in compliance with the License. You may obtain a copy of
+% the License at
+%
+%   http://www.apache.org/licenses/LICENSE-2.0
+%
+% Unless required by applicable law or agreed to in writing, software
+% distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
+% WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
+% License for the specific language governing permissions and limitations under
+% the License.
+
+
+
+-module(couch_httpd_vhost).
+-behaviour(gen_server).
+
+-export([start_link/0, init/1, handle_call/3, handle_info/2, handle_cast/2]).
+-export([code_change/3, terminate/2]).
+-export([match_vhost/1, urlsplit_netloc/2]).
+-export([redirect_to_vhost/2]).
+
+-include("couch_db.hrl").
+
+-define(SEPARATOR, $\/).
+-define(MATCH_ALL, {bind, '*'}).
+
+-record(vhosts, {
+    vhost_globals,
+    vhosts = [],
+    vhost_fun
+}).
+
+
+%% doc the vhost manager.
+%% This gen_server keep state of vhosts added to the ini and try to
+%% match the Host header (or forwarded) against rules built against
+%% vhost list. 
+%%
+%% Declaration of vhosts take place in the configuration file :
+%%
+%% [vhosts]
+%% example.com = /example
+%% *.example.com = /example
+%%
+%% The first line will rewrite the rquest to display the content of the
+%% example database. This rule works only if the Host header is
+%% 'example.com' and won't work for CNAMEs. Second rule on the other hand
+%% match all CNAMES to example db. So www.example.com or db.example.com
+%% will work.
+%%
+%% The wildcard ('*') should always be the last in the cnames:
+%%
+%%      "*.db.example.com = /"  will match all cname on top of db
+%% examples to the root of the machine.
+%%
+%% 
+%% Rewriting Hosts to path
+%% -----------------------
+%%
+%% Like in the _rewrite handler you could match some variable and use
+%them to create the target path. Some examples:
+%%
+%%    [vhosts]
+%%    *.example.com = /*
+%%    :dbname.example.com = /:dbname
+%%    :ddocname.:dbname.example.com = /:dbname/_design/:ddocname/_rewrite
+%%
+%% First rule pass wildcard as dbname, second do the same but use a
+%% variable name and the third one allows you to use any app with
+%% @ddocname in any db with @dbname .
+%%
+%% You could also change the default function to handle request by
+%% changing the setting `redirect_vhost_handler` in `httpd` section of
+%% the Ini:
+%%
+%%    [httpd]
+%%    redirect_vhost_handler = {Module, Fun}
+%%
+%% The function take 2 args : the mochiweb request object and the target
+%%% path. 
+
+start_link() -> 
+    gen_server:start_link({local, ?MODULE}, ?MODULE, [], []).
+
+%% @doc Try to find a rule matching current Host heade. some rule is
+%% found it rewrite the Mochiweb Request else it return current Request.
+match_vhost(MochiReq) ->
+    {ok, MochiReq1} = gen_server:call(couch_httpd_vhost, {match_vhost,
+            MochiReq}),
+
+    MochiReq1.
+
+
+%% --------------------
+%% gen_server functions
+%% --------------------
+
+init(_) ->
+    process_flag(trap_exit, true),
+
+    % init state
+    VHosts = make_vhosts(),
+    VHostGlobals = re:split(
+        couch_config:get("httpd", "vhost_global_handlers", ""),
+        ", ?",
+        [{return, list}]
+    ),
+    
+    % Set vhost fun
+    DefaultVHostFun = "{couch_httpd_vhost, redirect_to_vhost}",
+    VHostFun = couch_httpd:make_arity_2_fun(
+        couch_config:get("httpd", "redirect_vhost_handler", DefaultVHostFun)
+    ),
+    
+
+    Self = self(),
+    % register for changes in vhosts section
+    ok = couch_config:register(
+        fun("vhosts") ->
+            ok = gen_server:call(Self, vhosts_changed, infinity)
+        end
+    ),
+    
+    % register for changes in vhost_global_handlers key
+    ok = couch_config:register(
+        fun("httpd", "vhost_global_handlers") ->
+            ok = gen_server:call(Self, vhosts_global_changed, infinity)
+        end
+    ),
+
+    ok = couch_config:register(
+        fun("httpd", "redirect_vhost_handler") ->
+            ok = gen_server:call(Self, fun_changed, infinity)
+        end
+    ),
+
+    {ok, #vhosts{
+        vhost_globals = VHostGlobals,
+        vhosts = VHosts,
+        vhost_fun = VHostFun}
+    }.
+
+
+handle_call({match_vhost, MochiReq}, _From, State) ->
+    #vhosts{
+        vhost_globals = VHostGlobals,
+        vhosts = VHosts,
+        vhost_fun = Fun
+    } = State,
+
+    {"/" ++ VPath, Query, Fragment} = mochiweb_util:urlsplit_path(MochiReq:get(raw_path)),
+    VPathParts =  string:tokens(VPath, "/"),
+
+    XHost = couch_config:get("httpd", "x_forwarded_host", "X-Forwarded-Host"),
+    VHost = case MochiReq:get_header_value(XHost) of
+        undefined ->
+            case MochiReq:get_header_value("Host") of
+                undefined -> [];
+                Value1 -> Value1
+            end;
+        Value -> Value
+    end,
+    {VHostParts, VhostPort} = split_host_port(VHost),
+    FinalMochiReq = case try_bind_vhost(VHosts, lists:reverse(VHostParts),
+            VhostPort, VPathParts) of
+        no_vhost_matched -> MochiReq;
+        {VhostTarget, NewPath} ->
+            case vhost_global(VHostGlobals, MochiReq) of
+                true ->
+                    MochiReq;
+                _Else ->
+                    NewPath1 = mochiweb_util:urlunsplit_path({NewPath, Query,
+                                          Fragment}),
+                    MochiReq1 = mochiweb_request:new(MochiReq:get(socket),
+                                      MochiReq:get(method),
+                                      NewPath1,
+                                      MochiReq:get(version),
+                                      MochiReq:get(headers)),
+                    Fun(MochiReq1, VhostTarget)
+            end
+    end,
+    {reply, {ok, FinalMochiReq}, State}; 
+        
+% update vhosts
+handle_call(vhosts_changed, _From, State) ->
+    {reply, ok, State#vhosts{vhosts= make_vhosts()}};
+
+
+% update vhosts_globals
+handle_call(vhosts_global_changed, _From, State) ->
+    VHostGlobals = re:split(
+        couch_config:get("httpd", "vhost_global_handlers", ""),
+        ", ?",
+        [{return, list}]
+    ),
+    {reply, ok, State#vhosts{vhost_globals=VHostGlobals}};
+% change fun
+handle_call(fun_changed, _From, State) ->
+    DefaultVHostFun = "{couch_httpd_vhosts, redirect_to_vhost}",
+    VHostFun = couch_httpd:make_arity_2_fun(
+        couch_config:get("httpd", "redirect_vhost_handler", DefaultVHostFun)
+    ),
+    {reply, ok, State#vhosts{vhost_fun=VHostFun}}.
+
+handle_cast(_Msg, State) ->
+    {noreply, State}.
+
+handle_info(_Msg, State) ->
+    {noreply, State}.
+
+terminate(_Reason, _State) ->
+    ok.
+
+code_change(_OldVsn, State, _Extra) ->
+    {ok, State}.
+
+
+
+% default redirect vhost handler 
+
+redirect_to_vhost(MochiReq, VhostTarget) ->
+    Path = MochiReq:get(raw_path),
+    Target = VhostTarget ++ Path,
+
+    ?LOG_DEBUG("Vhost Target: '~p'~n", [Target]),
+    
+    Headers = mochiweb_headers:enter("x-couchdb-vhost-path", Path, 
+        MochiReq:get(headers)),
+
+    % build a new mochiweb request
+    MochiReq1 = mochiweb_request:new(MochiReq:get(socket),
+                                      MochiReq:get(method),
+                                      Target,
+                                      MochiReq:get(version),
+                                      Headers),
+    % cleanup, It force mochiweb to reparse raw uri.
+    MochiReq1:cleanup(),
+
+    MochiReq1.
+
+%% if so, then it will not be rewritten, but will run as a normal couchdb request.
+%* normally you'd use this for _uuids _utils and a few of the others you want to 
+%% keep available on vhosts. You can also use it to make databases 'global'.
+vhost_global( VhostGlobals, MochiReq) ->
+    RawUri = MochiReq:get(raw_path),
+    {"/" ++ Path, _, _} = mochiweb_util:urlsplit_path(RawUri),
+
+    Front = case couch_httpd:partition(Path) of
+    {"", "", ""} ->
+        "/"; % Special case the root url handler
+    {FirstPart, _, _} ->
+        FirstPart
+    end,
+    [true] == [true||V <- VhostGlobals, V == Front].
+
+%% bind host
+%% first it try to bind the port then the hostname.
+try_bind_vhost([], _HostParts, _Port, _PathParts) ->
+    no_vhost_matched;
+try_bind_vhost([VhostSpec|Rest], HostParts, Port, PathParts) ->
+    {{VHostParts, VPort, VPath}, Path} = VhostSpec,
+    case bind_port(VPort, Port) of
+        ok -> 
+            case bind_vhost(lists:reverse(VHostParts), HostParts, []) of
+                {ok, Bindings, Remainings} ->
+                    case bind_path(VPath, PathParts) of
+                        {ok, PathParts1} ->
+                            Path1 = make_target(Path, Bindings, Remainings, []),
+                            {make_path(Path1), make_path(PathParts1)};
+                        fail -> 
+                            try_bind_vhost(Rest, HostParts, Port,
+                                PathParts)
+                    end;
+                fail -> try_bind_vhost(Rest, HostParts, Port, PathParts)
+            end;
+        fail ->  try_bind_vhost(Rest, HostParts, Port, PathParts)
+    end.
+
+%% doc: build new patch from bindings. bindings are query args
+%% (+ dynamic query rewritten if needed) and bindings found in
+%% bind_path step. 
+%% TODO: merge code wit rewrite. But we need to make sure we are
+%% in string here.
+make_target([], _Bindings, _Remaining, Acc) ->
+    lists:reverse(Acc);
+make_target([?MATCH_ALL], _Bindings, Remaining, Acc) ->
+    Acc1 = lists:reverse(Acc) ++ Remaining,
+    Acc1;
+make_target([?MATCH_ALL|_Rest], _Bindings, Remaining, Acc) ->
+    Acc1 = lists:reverse(Acc) ++ Remaining,
+    Acc1;
+make_target([{bind, P}|Rest], Bindings, Remaining, Acc) ->
+    P2 = case couch_util:get_value({bind, P}, Bindings) of
+        undefined ->  "undefined";
+        P1 -> P1
+    end,
+    make_target(Rest, Bindings, Remaining, [P2|Acc]);
+make_target([P|Rest], Bindings, Remaining, Acc) ->
+    make_target(Rest, Bindings, Remaining, [P|Acc]).
+
+%% bind port
+bind_port(Port, Port) -> ok;
+bind_port('*', _) -> ok;
+bind_port(_,_) -> fail.
+
+%% bind bhost
+bind_vhost([],[], Bindings) -> {ok, Bindings, []};
+bind_vhost([?MATCH_ALL], [], _Bindings) -> fail;
+bind_vhost([?MATCH_ALL], Rest, Bindings) -> {ok, Bindings, Rest};
+bind_vhost([], _HostParts, _Bindings) -> fail;
+bind_vhost([{bind, Token}|Rest], [Match|RestHost], Bindings) -> 
+    bind_vhost(Rest, RestHost, [{{bind, Token}, Match}|Bindings]);
+bind_vhost([Cname|Rest], [Cname|RestHost], Bindings) ->
+    bind_vhost(Rest, RestHost, Bindings);
+bind_vhost(_, _, _) -> fail.
+
+%% bind path
+bind_path([], PathParts) ->
+    {ok, PathParts};
+bind_path(_VPathParts, []) ->
+    fail;
+bind_path([Path|VRest],[Path|Rest]) ->
+   bind_path(VRest, Rest);
+bind_path(_, _) ->
+    fail.
+
+% utilities
+
+
+%% create vhost list from ini
+make_vhosts() ->
+    Vhosts = lists:foldl(fun({Vhost, Path}, Acc) ->
+                    [{parse_vhost(Vhost), split_path(Path)}|Acc]
+            end, [], couch_config:get("vhosts")),
+    lists:reverse(lists:usort(Vhosts)).
+
+parse_vhost(Vhost) ->
+    case urlsplit_netloc(Vhost, []) of
+        {[], Path} ->
+            {make_spec("*", []), '*', Path};
+        {HostPort, []} ->
+            {H, P} = split_host_port(HostPort),
+            H1 = make_spec(H, []),
+            {H1, P, []};
+        {HostPort, Path} ->
+            {H, P} = split_host_port(HostPort),
+            H1 = make_spec(H, []),
+            {H1, P, string:tokens(Path, "/")}
+    end.
+            
+
+split_host_port(HostAsString) ->
+    case string:rchr(HostAsString, $:) of
+        0 ->
+            {split_host(HostAsString), '*'};
+        N ->
+            HostPart = string:substr(HostAsString, 1, N-1), 
+            case (catch erlang:list_to_integer(HostAsString, N+1,
+                        length(HostAsString))) of
+                {'EXIT', _} ->
+                    {split_host(HostAsString), '*'};
+                Port ->
+                    {split_host(HostPart), Port}
+            end
+    end.
+
+split_host(HostAsString) ->
+    string:tokens(HostAsString, "\.").
+
+split_path(Path) ->
+    make_spec(string:tokens(Path, "/"), []).
+
+
+make_spec([], Acc) ->
+    lists:reverse(Acc);
+make_spec([""|R], Acc) ->
+    make_spec(R, Acc);
+make_spec(["*"|R], Acc) ->
+    make_spec(R, [?MATCH_ALL|Acc]);
+make_spec([P|R], Acc) ->
+    P1 = parse_var(P),
+    make_spec(R, [P1|Acc]).
+
+
+parse_var(P) ->
+    case P of 
+        ":" ++ Var ->
+            {bind, Var};
+        _ -> P
+    end.
+
+
+% mochiweb doesn't export it.
+urlsplit_netloc("", Acc) ->
+    {lists:reverse(Acc), ""};
+urlsplit_netloc(Rest=[C | _], Acc) when C =:= $/; C =:= $?; C =:= $# ->
+    {lists:reverse(Acc), Rest};
+urlsplit_netloc([C | Rest], Acc) ->
+    urlsplit_netloc(Rest, [C | Acc]).
+
+make_path(Parts) ->
+     "/" ++ string:join(Parts,[?SEPARATOR]).
diff --git a/apps/couch/src/couch_httpd_view.erl b/apps/couch/src/couch_httpd_view.erl
index cb387d1b..b71fc2c6 100644
--- a/apps/couch/src/couch_httpd_view.erl
+++ b/apps/couch/src/couch_httpd_view.erl
@@ -15,10 +15,10 @@
 
 -export([handle_view_req/3,handle_temp_view_req/2]).
 
--export([get_stale_type/1, get_reduce_type/1, parse_view_params/3]).
--export([make_view_fold_fun/7, finish_view_fold/4, finish_view_fold/5, view_row_obj/3]).
--export([view_group_etag/2, view_group_etag/3, make_reduce_fold_funs/6]).
--export([design_doc_view/5, parse_bool_param/1, doc_member/2]).
+-export([parse_view_params/3]).
+-export([make_view_fold_fun/7, finish_view_fold/4, finish_view_fold/5, view_row_obj/4]).
+-export([view_etag/3, view_etag/4, make_reduce_fold_funs/6]).
+-export([design_doc_view/5, parse_bool_param/1, doc_member/3]).
 -export([make_key_options/1, load_view/4]).
 
 -import(couch_httpd,
@@ -57,7 +57,8 @@ design_doc_view(Req, Db, DName, ViewName, Keys) ->
 
 handle_view_req(#httpd{method='GET',
         path_parts=[_, _, DName, _, ViewName]}=Req, Db, _DDoc) ->
-    design_doc_view(Req, Db, DName, ViewName, nil);
+    Keys = couch_httpd:qs_json_value(Req, "keys", nil),
+    design_doc_view(Req, Db, DName, ViewName, Keys);
 
 handle_view_req(#httpd{method='POST',
         path_parts=[_, _, DName, _, ViewName]}=Req, Db, _DDoc) ->
@@ -113,7 +114,7 @@ output_map_view(Req, View, Group, Db, QueryArgs, nil) ->
         limit = Limit,
         skip = SkipCount
     } = QueryArgs,
-    CurrentEtag = view_group_etag(Group, Db),
+    CurrentEtag = view_etag(Db, Group, View),
     couch_httpd:etag_respond(Req, CurrentEtag, fun() ->
         {ok, RowCount} = couch_view:get_row_count(View),
         FoldlFun = make_view_fold_fun(Req, QueryArgs, CurrentEtag, Db, Group#group.current_seq, RowCount, #view_fold_helper_funs{reduce_count=fun couch_view:reduce_to_count/1}),
@@ -129,7 +130,7 @@ output_map_view(Req, View, Group, Db, QueryArgs, Keys) ->
         limit = Limit,
         skip = SkipCount
     } = QueryArgs,
-    CurrentEtag = view_group_etag(Group, Db, Keys),
+    CurrentEtag = view_etag(Db, Group, View, Keys),
     couch_httpd:etag_respond(Req, CurrentEtag, fun() ->
         {ok, RowCount} = couch_view:get_row_count(View),
         FoldAccInit = {Limit, SkipCount, undefined, []},
@@ -154,7 +155,7 @@ output_reduce_view(Req, Db, View, Group, QueryArgs, nil) ->
         skip = Skip,
         group_level = GroupLevel
     } = QueryArgs,
-    CurrentEtag = view_group_etag(Group, Db),
+    CurrentEtag = view_etag(Db, Group, View),
     couch_httpd:etag_respond(Req, CurrentEtag, fun() ->
         {ok, GroupRowsFun, RespFun} = make_reduce_fold_funs(Req, GroupLevel,
                 QueryArgs, CurrentEtag, Group#group.current_seq,
@@ -172,7 +173,7 @@ output_reduce_view(Req, Db, View, Group, QueryArgs, Keys) ->
         skip = Skip,
         group_level = GroupLevel
     } = QueryArgs,
-    CurrentEtag = view_group_etag(Group, Db, Keys),
+    CurrentEtag = view_etag(Db, Group, View, Keys),
     couch_httpd:etag_respond(Req, CurrentEtag, fun() ->
         {ok, GroupRowsFun, RespFun} = make_reduce_fold_funs(Req, GroupLevel,
                 QueryArgs, CurrentEtag, Group#group.current_seq,
@@ -246,7 +247,7 @@ parse_view_params(Req, Keys, ViewType) ->
     QueryArgs = lists:foldl(fun({K, V}, Args2) ->
         validate_view_query(K, V, Args2)
     end, Args, lists:reverse(QueryParams)), % Reverse to match QS order.
-
+    warn_on_empty_key_range(QueryArgs),
     GroupLevel = QueryArgs#view_query_args.group_level,
     case {ViewType, GroupLevel, IsMultiGet} of
     {reduce, exact, true} ->
@@ -268,22 +269,37 @@ parse_view_param("", _) ->
 parse_view_param("key", Value) ->
     JsonKey = ?JSON_DECODE(Value),
     [{start_key, JsonKey}, {end_key, JsonKey}];
+% TODO: maybe deprecate startkey_docid
 parse_view_param("startkey_docid", Value) ->
     [{start_docid, ?l2b(Value)}];
+parse_view_param("start_key_doc_id", Value) ->
+    [{start_docid, ?l2b(Value)}];
+% TODO: maybe deprecate endkey_docid
 parse_view_param("endkey_docid", Value) ->
     [{end_docid, ?l2b(Value)}];
+parse_view_param("end_key_doc_id", Value) ->
+    [{end_docid, ?l2b(Value)}];
+% TODO: maybe deprecate startkey
 parse_view_param("startkey", Value) ->
     [{start_key, ?JSON_DECODE(Value)}];
+parse_view_param("start_key", Value) ->
+    [{start_key, ?JSON_DECODE(Value)}];
+% TODO: maybe deprecate endkey
 parse_view_param("endkey", Value) ->
     [{end_key, ?JSON_DECODE(Value)}];
+parse_view_param("end_key", Value) ->
+    [{end_key, ?JSON_DECODE(Value)}];
 parse_view_param("limit", Value) ->
     [{limit, parse_positive_int_param(Value)}];
 parse_view_param("count", _Value) ->
     throw({query_parse_error, <<"Query parameter 'count' is now 'limit'.">>});
 parse_view_param("stale", "ok") ->
     [{stale, ok}];
+parse_view_param("stale", "update_after") ->
+    [{stale, update_after}];
 parse_view_param("stale", _Value) ->
-    throw({query_parse_error, <<"stale only available as stale=ok">>});
+    throw({query_parse_error,
+            <<"stale only available as stale=ok or as stale=update_after">>});
 parse_view_param("update", _Value) ->
     throw({query_parse_error, <<"update=false is now stale=ok">>});
 parse_view_param("descending", Value) ->
@@ -303,6 +319,8 @@ parse_view_param("reduce", Value) ->
     [{reduce, parse_bool_param(Value)}];
 parse_view_param("include_docs", Value) ->
     [{include_docs, parse_bool_param(Value)}];
+parse_view_param("conflicts", Value) ->
+    [{conflicts, parse_bool_param(Value)}];
 parse_view_param("list", Value) ->
     [{list, ?l2b(Value)}];
 parse_view_param("callback", _) ->
@@ -310,6 +328,26 @@ parse_view_param("callback", _) ->
 parse_view_param(Key, Value) ->
     [{extra, {Key, Value}}].
 
+warn_on_empty_key_range(#view_query_args{start_key=undefined}) ->
+    ok;
+warn_on_empty_key_range(#view_query_args{end_key=undefined}) ->
+    ok;
+warn_on_empty_key_range(#view_query_args{start_key=A, end_key=A}) ->
+    ok;
+warn_on_empty_key_range(#view_query_args{
+    start_key=StartKey, end_key=EndKey, direction=Dir}) ->
+    case {Dir, couch_view:less_json(StartKey, EndKey)} of
+        {fwd, false} ->
+            throw({query_parse_error,
+            <<"No rows can match your key range, reverse your ",
+                "start_key and end_key or set descending=true">>});
+        {rev, true} ->
+            throw({query_parse_error,
+            <<"No rows can match your key range, reverse your ",
+                "start_key and end_key or set descending=false">>});
+        _ -> ok
+    end.
+
 validate_view_query(start_key, Value, Args) ->
     case Args#view_query_args.multi_get of
     true ->
@@ -336,6 +374,10 @@ validate_view_query(limit, Value, Args) ->
     Args#view_query_args{limit=Value};
 validate_view_query(list, Value, Args) ->
     Args#view_query_args{list=Value};
+validate_view_query(stale, ok, Args) ->
+    Args#view_query_args{stale=ok};
+validate_view_query(stale, update_after, Args) ->
+    Args#view_query_args{stale=update_after};
 validate_view_query(stale, _, Args) ->
     Args;
 validate_view_query(descending, true, Args) ->
@@ -387,6 +429,15 @@ validate_view_query(include_docs, true, Args) ->
 % Use the view_query_args record's default value
 validate_view_query(include_docs, _Value, Args) ->
     Args;
+validate_view_query(conflicts, true, Args) ->
+    case Args#view_query_args.view_type of
+    reduce ->
+        Msg = <<"Query parameter `conflicts` "
+                "is invalid for reduce views.">>,
+        throw({query_parse_error, Msg});
+    _ ->
+        Args#view_query_args{conflicts = true}
+    end;
 validate_view_query(extra, _Value, Args) ->
     Args.
 
@@ -398,7 +449,8 @@ make_view_fold_fun(Req, QueryArgs, Etag, Db, UpdateSeq, TotalViewCount, HelperFu
     } = apply_default_helper_funs(HelperFuns),
 
     #view_query_args{
-        include_docs = IncludeDocs
+        include_docs = IncludeDocs,
+        conflicts = Conflicts
     } = QueryArgs,
     
     fun({{Key, DocId}, Value}, OffsetReds,
@@ -416,12 +468,12 @@ make_view_fold_fun(Req, QueryArgs, Etag, Db, UpdateSeq, TotalViewCount, HelperFu
             {ok, Resp2, RowFunAcc0} = StartRespFun(Req, Etag,
                 TotalViewCount, Offset, RowFunAcc, UpdateSeq),
             {Go, RowFunAcc2} = SendRowFun(Resp2, Db, {{Key, DocId}, Value},
-                IncludeDocs, RowFunAcc0),
+                IncludeDocs, Conflicts, RowFunAcc0),
             {Go, {AccLimit - 1, 0, Resp2, RowFunAcc2}};
         {AccLimit, _, Resp} when (AccLimit > 0) ->
             % rendering all other rows
             {Go, RowFunAcc2} = SendRowFun(Resp, Db, {{Key, DocId}, Value},
-                IncludeDocs, RowFunAcc),
+                IncludeDocs, Conflicts, RowFunAcc),
             {Go, {AccLimit - 1, 0, Resp, RowFunAcc2}}
         end
     end.
@@ -497,7 +549,7 @@ apply_default_helper_funs(
     end,
 
     SendRow2 = case SendRow of
-    undefined -> fun send_json_view_row/5;
+    undefined -> fun send_json_view_row/6;
     _ -> SendRow
     end,
 
@@ -570,8 +622,8 @@ json_view_start_resp(Req, Etag, TotalViewCount, Offset, _Acc, UpdateSeq) ->
     end,
     {ok, Resp, BeginBody}.
 
-send_json_view_row(Resp, Db, {{Key, DocId}, Value}, IncludeDocs, RowFront) ->
-    JsonObj = view_row_obj(Db, {{Key, DocId}, Value}, IncludeDocs),
+send_json_view_row(Resp, Db, Kv, IncludeDocs, Conflicts, RowFront) ->
+    JsonObj = view_row_obj(Db, Kv, IncludeDocs, Conflicts),
     send_chunk(Resp, RowFront ++  ?JSON_ENCODE(JsonObj)),
     {ok, ",\r\n"}.
 
@@ -588,22 +640,21 @@ send_json_reduce_row(Resp, {Key, Value}, RowFront) ->
     send_chunk(Resp, RowFront ++ ?JSON_ENCODE({[{key, Key}, {value, Value}]})),
     {ok, ",\r\n"}.
 
-view_group_etag(Group, Db) ->
-    view_group_etag(Group, Db, nil).
+view_etag(Db, Group, View) ->
+    view_etag(Db, Group, View, nil).
 
-view_group_etag(#group{sig=Sig,current_seq=CurrentSeq}, _Db, Extra) ->
-    % ?LOG_ERROR("Group ~p",[Group]),
-    % This is not as granular as it could be.
-    % If there are updates to the db that do not effect the view index,
-    % they will change the Etag. For more granular Etags we'd need to keep
-    % track of the last Db seq that caused an index change.
-    couch_httpd:make_etag({Sig, CurrentSeq, Extra}).
+view_etag(Db, Group, {reduce, _, _, View}, Extra) ->
+    view_etag(Db, Group, View, Extra);
+view_etag(Db, Group, {temp_reduce, View}, Extra) ->
+    view_etag(Db, Group, View, Extra);
+view_etag(_Db, #group{sig=Sig}, #view{update_seq=UpdateSeq, purge_seq=PurgeSeq}, Extra) ->
+    couch_httpd:make_etag({Sig, UpdateSeq, PurgeSeq, Extra}).
 
 % the view row has an error
-view_row_obj(_Db, {{Key, error}, Value}, _IncludeDocs) ->
+view_row_obj(_Db, {{Key, error}, Value}, _IncludeDocs, _Conflicts) ->
     {[{key, Key}, {error, Value}]};
 % include docs in the view output
-view_row_obj(Db, {{Key, DocId}, {Props}}, true) ->
+view_row_obj(Db, {{Key, DocId}, {Props}}, true, Conflicts) ->
     Rev = case couch_util:get_value(<<"_rev">>, Props) of
     undefined ->
         nil;
@@ -611,19 +662,29 @@ view_row_obj(Db, {{Key, DocId}, {Props}}, true) ->
         couch_doc:parse_rev(Rev0)
     end,
     IncludeId = couch_util:get_value(<<"_id">>, Props, DocId),
-    view_row_with_doc(Db, {{Key, DocId}, {Props}}, {IncludeId, Rev});
-view_row_obj(Db, {{Key, DocId}, Value}, true) ->
-    view_row_with_doc(Db, {{Key, DocId}, Value}, {DocId, nil});
+    view_row_with_doc(Db, {{Key, DocId}, {Props}}, {IncludeId, Rev}, Conflicts);
+view_row_obj(Db, {{Key, DocId}, Value}, true, Conflicts) ->
+    view_row_with_doc(Db, {{Key, DocId}, Value}, {DocId, nil}, Conflicts);
 % the normal case for rendering a view row
-view_row_obj(_Db, {{Key, DocId}, Value}, _IncludeDocs) ->
+view_row_obj(_Db, {{Key, DocId}, Value}, _IncludeDocs, _Conflicts) ->
     {[{id, DocId}, {key, Key}, {value, Value}]}.
 
-view_row_with_doc(Db, {{Key, DocId}, Value}, IdRev) ->
-    {[{id, DocId}, {key, Key}, {value, Value}] ++ doc_member(Db, IdRev)}.
+view_row_with_doc(Db, {{Key, DocId}, Value}, IdRev, Conflicts) ->
+    {[{id, DocId}, {key, Key}, {value, Value}] ++
+        doc_member(Db, IdRev, if Conflicts -> [conflicts]; true -> [] end)}.
 
-doc_member(Db, {DocId, Rev}) ->
+doc_member(Db, #doc_info{id = Id, revs = [#rev_info{rev = Rev} | _]} = Info,
+        Options) ->
+    ?LOG_DEBUG("Include Doc: ~p ~p", [Id, Rev]),
+    case couch_db:open_doc(Db, Info, [deleted | Options]) of
+    {ok, Doc} ->
+        [{doc, couch_doc:to_json_obj(Doc, [])}];
+    _ ->
+        [{doc, null}]
+    end;
+doc_member(Db, {DocId, Rev}, Options) ->
     ?LOG_DEBUG("Include Doc: ~p ~p", [DocId, Rev]),
-    case (catch couch_httpd_db:couch_doc_open(Db, DocId, Rev, [])) of
+    case (catch couch_httpd_db:couch_doc_open(Db, DocId, Rev, Options)) of
     #doc{} = Doc ->
         JsonDoc = couch_doc:to_json_obj(Doc, []),
         [{doc, JsonDoc}];
diff --git a/apps/couch/src/couch_js_functions.hrl b/apps/couch/src/couch_js_functions.hrl
deleted file mode 100644
index 32573a90..00000000
--- a/apps/couch/src/couch_js_functions.hrl
+++ /dev/null
@@ -1,97 +0,0 @@
-% Licensed under the Apache License, Version 2.0 (the "License"); you may not
-% use this file except in compliance with the License.  You may obtain a copy of
-% the License at
-%
-%   http://www.apache.org/licenses/LICENSE-2.0
-%
-% Unless required by applicable law or agreed to in writing, software
-% distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
-% WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.  See the
-% License for the specific language governing permissions and limitations under
-% the License.
-
--define(AUTH_DB_DOC_VALIDATE_FUNCTION, <<"
-    function(newDoc, oldDoc, userCtx) {
-        if (newDoc._deleted === true) {
-            // allow deletes by admins and matching users
-            // without checking the other fields
-            if ((userCtx.roles.indexOf('_admin') !== -1) ||
-                (userCtx.name == oldDoc.name)) {
-                return;
-            } else {
-                throw({forbidden: 'Only admins may delete other user docs.'});
-            }
-        }
-
-        if ((oldDoc && oldDoc.type !== 'user') || newDoc.type !== 'user') {
-            throw({forbidden : 'doc.type must be user'});
-        } // we only allow user docs for now
-
-        if (!newDoc.name) {
-            throw({forbidden: 'doc.name is required'});
-        }
-
-        if (newDoc.roles && !isArray(newDoc.roles)) {
-            throw({forbidden: 'doc.roles must be an array'});
-        }
-
-        if (newDoc._id !== ('org.couchdb.user:' + newDoc.name)) {
-            throw({
-                forbidden: 'Doc ID must be of the form org.couchdb.user:name'
-            });
-        }
-
-        if (oldDoc) { // validate all updates
-            if (oldDoc.name !== newDoc.name) {
-                throw({forbidden: 'Usernames can not be changed.'});
-            }
-        }
-
-        if (newDoc.password_sha && !newDoc.salt) {
-            throw({
-                forbidden: 'Users with password_sha must have a salt.' +
-                    'See /_utils/script/couch.js for example code.'
-            });
-        }
-
-        if (userCtx.roles.indexOf('_admin') === -1) {
-            if (oldDoc) { // validate non-admin updates
-                if (userCtx.name !== newDoc.name) {
-                    throw({
-                        forbidden: 'You may only update your own user document.'
-                    });
-                }
-                // validate role updates
-                var oldRoles = oldDoc.roles.sort();
-                var newRoles = newDoc.roles.sort();
-
-                if (oldRoles.length !== newRoles.length) {
-                    throw({forbidden: 'Only _admin may edit roles'});
-                }
-
-                for (var i = 0; i < oldRoles.length; i++) {
-                    if (oldRoles[i] !== newRoles[i]) {
-                        throw({forbidden: 'Only _admin may edit roles'});
-                    }
-                }
-            } else if (newDoc.roles.length > 0) {
-                throw({forbidden: 'Only _admin may set roles'});
-            }
-        }
-
-        // no system roles in users db
-        for (var i = 0; i < newDoc.roles.length; i++) {
-            if (newDoc.roles[i][0] === '_') {
-                throw({
-                    forbidden:
-                    'No system roles (starting with underscore) in users db.'
-                });
-            }
-        }
-
-        // no system names as names
-        if (newDoc.name[0] === '_') {
-            throw({forbidden: 'Username may not start with underscore.'});
-        }
-    }
-">>).
diff --git a/apps/couch/src/couch_key_tree.erl b/apps/couch/src/couch_key_tree.erl
index 8b574309..2f3c6abf 100644
--- a/apps/couch/src/couch_key_tree.erl
+++ b/apps/couch/src/couch_key_tree.erl
@@ -10,6 +10,41 @@
 % License for the specific language governing permissions and limitations under
 % the License.
 
+%% @doc Data structure used to represent document edit histories.
+
+%% A key tree is used to represent the edit history of a document. Each node of
+%% the tree represents a particular version. Relations between nodes represent
+%% the order that these edits were applied. For instance, a set of three edits
+%% would produce a tree of versions A->B->C indicating that edit C was based on
+%% version B which was in turn based on A. In a world without replication (and
+%% no ability to disable MVCC checks), all histories would be forced to be
+%% linear lists of edits due to constraints imposed by MVCC (ie, new edits must
+%% be based on the current version). However, we have replication, so we must
+%% deal with not so easy cases, which lead to trees.
+%%
+%% Consider a document in state A. This doc is replicated to a second node. We
+%% then edit the document on each node leaving it in two different states, B
+%% and C. We now have two key trees, A->B and A->C. When we go to replicate a
+%% second time, the key tree must combine these two trees which gives us
+%% A->(B|C). This is how conflicts are introduced. In terms of the key tree, we
+%% say that we have two leaves (B and C) that are not deleted. The presense of
+%% the multiple leaves indicate conflict. To remove a conflict, one of the
+%% edits (B or C) can be deleted, which results in, A->(B|C->D) where D is an
+%% edit that is specially marked with the a deleted=true flag.
+%%
+%% What makes this a bit more complicated is that there is a limit to the
+%% number of revisions kept, specified in couch_db.hrl (default is 1000). When
+%% this limit is exceeded only the last 1000 are kept. This comes in to play
+%% when branches are merged. The comparison has to begin at the same place in
+%% the branches. A revision id is of the form N-XXXXXXX where N is the current
+%% revision. So each path will have a start number, calculated in
+%% couch_doc:to_path using the formula N - length(RevIds) + 1 So, .eg. if a doc
+%% was edit 1003 times this start number would be 4, indicating that 3
+%% revisions were truncated.
+%%
+%% This comes into play in @see merge_at/3 which recursively walks down one
+%% tree or the other until they begin at the same revision.
+
 -module(couch_key_tree).
 
 -export([merge/3, find_missing/2, get_key_leafs/2,
@@ -32,6 +67,9 @@ merge(Paths, Path, Depth) ->
     {Merged, Conflicts} = merge(Paths, Path),
     {stem(Merged, Depth), Conflicts}.
 
+%% @doc Merge a path with an existing list of paths, returning a new list of
+%% paths. A return of conflicts indicates a new conflict was discovered in this
+%% merge. Conflicts may already exist in the original list of paths.
 -spec merge([path()], path()) -> {[path()], conflicts | no_conflicts}.
 merge(Paths, Path) ->
     {ok, Merged, HasConflicts} = merge_one(Paths, Path, [], false),
@@ -44,8 +82,8 @@ merge(Paths, Path) ->
     end,
     {lists:sort(Merged), Conflicts}.
 
--spec merge_one(Original::[path()], Inserted::path(), [path()], bool()) ->
-    {ok, Merged::[path()], NewConflicts::bool()}.
+-spec merge_one(Original::[path()], Inserted::path(), [path()], boolean()) ->
+    {ok, Merged::[path()], NewConflicts::boolean()}.
 merge_one([], Insert, OutAcc, ConflictsAcc) ->
     {ok, [Insert | OutAcc], ConflictsAcc};
 merge_one([{Start, Tree}|Rest], {StartInsert, TreeInsert}, Acc, HasConflicts) ->
@@ -59,7 +97,7 @@ merge_one([{Start, Tree}|Rest], {StartInsert, TreeInsert}, Acc, HasConflicts) ->
     end.
 
 -spec merge_at(tree(), Place::integer(), tree()) ->
-    {ok, Merged::tree(), HasConflicts::bool()} | no.
+    {ok, Merged::tree(), HasConflicts::boolean()} | no.
 merge_at(_Ours, _Place, []) ->
     no;
 merge_at([], _Place, _Insert) ->
@@ -70,6 +108,7 @@ merge_at([{Key, Value, SubTree}|Sibs], Place, InsertTree) when Place > 0 ->
     {ok, Merged, Conflicts} ->
         {ok, [{Key, Value, Merged} | Sibs], Conflicts};
     no ->
+        % first branch didn't merge, move to next branch
         case merge_at(Sibs, Place, InsertTree) of
         {ok, Merged, Conflicts} ->
             {ok, [{Key, Value, SubTree} | Merged], Conflicts};
@@ -85,9 +124,9 @@ merge_at(OurTree, Place, [{Key, Value, SubTree}]) when Place < 0 ->
     no ->
         no
     end;
-merge_at([{Key, Value, SubTree}|Sibs], 0, [{Key, _Value, InsertSubTree}]) ->
+merge_at([{Key, V1, SubTree}|Sibs], 0, [{Key, V2, InsertSubTree}]) ->
     {Merged, Conflicts} = merge_simple(SubTree, InsertSubTree),
-    {ok, [{Key, Value, Merged} | Sibs], Conflicts};
+    {ok, [{Key, value_pref(V1, V2), Merged} | Sibs], Conflicts};
 merge_at([{OurKey, _, _} | _], 0, [{Key, _, _}]) when OurKey > Key ->
     % siblings keys are ordered, no point in continuing
     no;
@@ -101,21 +140,23 @@ merge_at([Tree | Sibs], 0, InsertTree) ->
 
 % key tree functions
 
--spec merge_simple(tree(), tree()) -> {Merged::tree(), NewConflicts::bool()}.
+-spec merge_simple(tree(), tree()) -> {Merged::tree(), NewConflicts::boolean()}.
 merge_simple([], B) ->
     {B, false};
 merge_simple(A, []) ->
     {A, false};
-merge_simple([{Key, Value, SubA} | NextA], [{Key, _, SubB} | NextB]) ->
+merge_simple([{Key, V1, SubA} | NextA], [{Key, V2, SubB} | NextB]) ->
     {MergedSubTree, Conflict1} = merge_simple(SubA, SubB),
     {MergedNextTree, Conflict2} = merge_simple(NextA, NextB),
+    Value = value_pref(V1, V2),
     {[{Key, Value, MergedSubTree} | MergedNextTree], Conflict1 or Conflict2};
 merge_simple([{A, _, _} = Tree | Next], [{B, _, _} | _] = Insert) when A < B ->
-    {Merged, _} = merge_simple(Next, Insert),
-    {[Tree | Merged], true};
+    {Merged, Conflict} = merge_simple(Next, Insert),
+    % if Merged has more branches than the input we added a new conflict
+    {[Tree | Merged], Conflict orelse (length(Merged) > length(Next))};
 merge_simple(Ours, [Tree | Next]) ->
-    {Merged, _} = merge_simple(Ours, Next),
-    {[Tree | Merged], true}.
+    {Merged, Conflict} = merge_simple(Ours, Next),
+    {[Tree | Merged], Conflict orelse (length(Merged) > length(Next))}.
 
 find_missing(_Tree, []) ->
     [];
@@ -160,14 +201,18 @@ remove_leafs(Trees, Keys) ->
     % filter out any that are in the keys list.
     {FilteredPaths, RemovedKeys} = filter_leafs(Paths, Keys, [], []),
 
+    SortedPaths = lists:sort(
+        [{Pos + 1 - length(Path), Path} || {Pos, Path} <- FilteredPaths]
+    ),
+
     % convert paths back to trees
     NewTree = lists:foldl(
-        fun({PathPos, Path},TreeAcc) ->
+        fun({StartPos, Path},TreeAcc) ->
             [SingleTree] = lists:foldl(
                 fun({K,V},NewTreeAcc) -> [{K,V,NewTreeAcc}] end, [], Path),
-            {NewTrees, _} = merge(TreeAcc, {PathPos + 1 - length(Path), SingleTree}),
+            {NewTrees, _} = merge(TreeAcc, {StartPos, SingleTree}),
             NewTrees
-        end, [], FilteredPaths),
+        end, [], SortedPaths),
     {NewTree, RemovedKeys}.
 
 
@@ -364,19 +409,35 @@ map_leafs_simple(Fun, Pos, [{Key, Value, SubTree} | RestTree]) ->
 
 
 stem(Trees, Limit) ->
-    % flatten each branch in a tree into a tree path
-    Paths = get_all_leafs_full(Trees),
-
-    Paths2 = [{Pos, lists:sublist(Path, Limit)} || {Pos, Path} <- Paths],
+    % flatten each branch in a tree into a tree path, sort by starting rev #
+    Paths = lists:sort(lists:map(fun({Pos, Path}) ->
+        StemmedPath = lists:sublist(Path, Limit),
+        {Pos + 1 - length(StemmedPath), StemmedPath}
+    end, get_all_leafs_full(Trees))),
 
     % convert paths back to trees
     lists:foldl(
-        fun({PathPos, Path},TreeAcc) ->
+        fun({StartPos, Path},TreeAcc) ->
             [SingleTree] = lists:foldl(
                 fun({K,V},NewTreeAcc) -> [{K,V,NewTreeAcc}] end, [], Path),
-            {NewTrees, _} = merge(TreeAcc, {PathPos + 1 - length(Path), SingleTree}),
+            {NewTrees, _} = merge(TreeAcc, {StartPos, SingleTree}),
             NewTrees
-        end, [], Paths2).
+        end, [], Paths).
+
+
+value_pref(Tuple, _) when is_tuple(Tuple),
+        (tuple_size(Tuple) == 3 orelse tuple_size(Tuple) == 4) ->
+    Tuple;
+value_pref(_, Tuple) when is_tuple(Tuple),
+        (tuple_size(Tuple) == 3 orelse tuple_size(Tuple) == 4) ->
+    Tuple;
+value_pref(?REV_MISSING, Other) ->
+    Other;
+value_pref(Other, ?REV_MISSING) ->
+    Other;
+value_pref(Last, _) ->
+    Last.
+
 
 % Tests moved to test/etap/06?-*.t
 
diff --git a/apps/couch/src/couch_log.erl b/apps/couch/src/couch_log.erl
index 80ce0600..9bac7450 100644
--- a/apps/couch/src/couch_log.erl
+++ b/apps/couch/src/couch_log.erl
@@ -14,6 +14,7 @@
 -behaviour(gen_event).
 
 -export([start_link/0,stop/0]).
+-export([debug/2, info/2, error/2]).
 -export([debug_on/0,info_on/0,get_level/0,get_level_integer/0, set_level/1]).
 -export([init/1, handle_event/2, terminate/2, code_change/3, handle_info/2, handle_call/2]).
 -export([read/2]).
@@ -23,6 +24,29 @@
 -define(LEVEL_DEBUG, 1).
 -define(LEVEL_TMI, 0).
 
+debug(Format, Args) ->
+    case debug_on() of
+    false ->
+        ok;
+    true ->
+        {ConsoleMsg, FileMsg} = get_log_messages(self(), debug, Format, Args),
+        gen_event:sync_notify(error_logger, {couch_debug, ConsoleMsg, FileMsg})
+    end.
+
+info(Format, Args) ->
+    case info_on() of
+    false ->
+        ok;
+    true ->
+        {ConsoleMsg, FileMsg} = get_log_messages(self(), info, Format, Args),
+        gen_event:sync_notify(error_logger, {couch_info, ConsoleMsg, FileMsg})
+    end.
+
+error(Format, Args) ->
+    {ConsoleMsg, FileMsg} = get_log_messages(self(), error, Format, Args),
+    gen_event:sync_notify(error_logger, {couch_error, ConsoleMsg, FileMsg}).
+
+
 level_integer(error)    -> ?LEVEL_ERROR;
 level_integer(info)     -> ?LEVEL_INFO;
 level_integer(debug)    -> ?LEVEL_DEBUG;
@@ -65,8 +89,14 @@ init([]) ->
     end,
     ets:insert(?MODULE, {level, Level}),
 
-    {ok, Fd} = file:open(Filename, [append]),
-    {ok, {Fd, Level, Sasl}}.
+    case file:open(Filename, [append]) of
+    {ok, Fd} ->
+        {ok, {Fd, Level, Sasl}};
+    {error, eacces} ->
+        {stop, {file_permission_error, Filename}};
+    Error ->
+        {stop, Error}
+    end.
 
 debug_on() ->
     get_level_integer() =< ?LEVEL_DEBUG.
@@ -90,29 +120,32 @@ get_level_integer() ->
 set_level_integer(Int) ->
     gen_event:call(error_logger, couch_log, {set_level_integer, Int}).
 
-handle_event({Pid, couch_error, Id, {Format, Args}}, {Fd, _, _}=State) ->
-    log(Fd, Pid, error, Id, Format, Args),
+handle_event({couch_error, ConMsg, FileMsg}, {Fd, _LogLevel, _Sasl}=State) ->
+    log(Fd, ConMsg, FileMsg),
     {ok, State};
-handle_event({Pid, couch_info, Id, {Format, Args}}, {Fd, LogLevel, _Sasl}=State)
+handle_event({couch_info, ConMsg, FileMsg}, {Fd, LogLevel, _Sasl}=State)
 when LogLevel =< ?LEVEL_INFO ->
-    log(Fd, Pid, info, Id, Format, Args),
+    log(Fd, ConMsg, FileMsg),
     {ok, State};
-handle_event({Pid, couch_debug, Id, {Format, Args}}, {Fd, LogLevel, _Sasl}=State)
+handle_event({couch_debug, ConMsg, FileMsg}, {Fd, LogLevel, _Sasl}=State)
 when LogLevel =< ?LEVEL_DEBUG ->
-    log(Fd, Pid, debug, Id, Format, Args),
+    log(Fd, ConMsg, FileMsg),
     {ok, State};
 handle_event({error_report, _, {Pid, _, _}}=Event, {Fd, _LogLevel, Sasl}=State)
 when Sasl =/= false ->
-    log(Fd, Pid, error, undefined, "~p", [Event]),
+    {ConMsg, FileMsg} = get_log_messages(Pid, error, "~p", [Event]),
+    log(Fd, ConMsg, FileMsg),
     {ok, State};
 handle_event({error, _, {Pid, Format, Args}}, {Fd, _LogLevel, Sasl}=State)
 when Sasl =/= false ->
-    log(Fd, Pid, error, undefined, Format, Args),
+    {ConMsg, FileMsg} = get_log_messages(Pid, error, Format, Args),
+    log(Fd, ConMsg, FileMsg),
     {ok, State};
 handle_event({_, _, {Pid, _, _}}=Event, {Fd, LogLevel, _Sasl}=State)
 when LogLevel =< ?LEVEL_TMI ->
     % log every remaining event if tmi!
-    log(Fd, Pid, tmi, undefined, "~p", [Event]),
+    {ConMsg, FileMsg} = get_log_messages(Pid, tmi, "~p", [Event]),
+    log(Fd, ConMsg, FileMsg),
     {ok, State};
 handle_event(_Event, State) ->
     {ok, State}.
@@ -130,19 +163,23 @@ code_change(_OldVsn, State, _Extra) ->
 terminate(_Arg, {Fd, _LoggingLevel, _Sasl}) ->
     file:close(Fd).
 
-log(Fd, Pid, Level, undefined, Format, Args) ->
-    log(Fd, Pid, Level, "--------", Format, Args);
-log(Fd, Pid, Level, Id, Format, Args) ->
-    Msg = io_lib:format(Format, Args),
-    ok = io:format("[~s] [~p] [~s] ~s~n", [Level, Pid, Id, Msg]),
-    Msg2 = re:replace(lists:flatten(Msg),"\\r\\n|\\r|\\n", "\r\n",
-        [global, {return, list}]),
-    ok = io:format(Fd, "[~s] [~s] [~p] [~s] ~s\r~n\r~n",
-        [httpd_util:rfc1123_date(), Level, Pid, Id, Msg2]).
+log(Fd, ConsoleMsg, FileMsg) ->
+    ok = io:put_chars(ConsoleMsg),
+    ok = io:put_chars(Fd, FileMsg).
+
+get_log_messages(Pid, Level, Format, Args) ->
+    Nonce = case erlang:get(nonce) of
+        undefined -> "--------";
+        Else -> Else
+    end,
+    ConsoleMsg = unicode:characters_to_binary(io_lib:format(
+        "[~s] [~p] [~s] " ++ Format ++ "~n", [Level, Pid, Nonce | Args])),
+    FileMsg = ["[", httpd_util:rfc1123_date(), "] ", ConsoleMsg],
+    {ConsoleMsg, iolist_to_binary(FileMsg)}.
 
 read(Bytes, Offset) ->
     LogFileName = couch_config:get("log", "file"),
-    LogFileSize = couch_util:file_read_size(LogFileName),
+    LogFileSize = filelib:file_size(LogFileName),
 
     {ok, Fd} = file:open(LogFileName, [read]),
     Start = lists:max([LogFileSize - Bytes, 0]) + Offset,
diff --git a/apps/couch/src/couch_os_daemons.erl b/apps/couch/src/couch_os_daemons.erl
new file mode 100644
index 00000000..d03f550c
--- /dev/null
+++ b/apps/couch/src/couch_os_daemons.erl
@@ -0,0 +1,364 @@
+% Licensed under the Apache License, Version 2.0 (the "License"); you may not
+% use this file except in compliance with the License. You may obtain a copy of
+% the License at
+%
+%   http://www.apache.org/licenses/LICENSE-2.0
+%
+% Unless required by applicable law or agreed to in writing, software
+% distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
+% WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
+% License for the specific language governing permissions and limitations under
+% the License.
+-module(couch_os_daemons).
+-behaviour(gen_server).
+
+-export([start_link/0, info/0, info/1, config_change/2]).
+
+-export([init/1, terminate/2, code_change/3]).
+-export([handle_call/3, handle_cast/2, handle_info/2]).
+
+-include("couch_db.hrl").
+
+-record(daemon, {
+    port,
+    name,
+    cmd,
+    kill,
+    status=running,
+    cfg_patterns=[],
+    errors=[],
+    buf=[]
+}).
+
+-define(PORT_OPTIONS, [stream, {line, 1024}, binary, exit_status, hide]).
+-define(TIMEOUT, 5000).
+
+start_link() ->
+    gen_server:start_link({local, ?MODULE}, ?MODULE, [], []).
+
+info() ->
+    info([]).
+
+info(Options) ->
+    gen_server:call(?MODULE, {daemon_info, Options}).
+
+config_change(Section, Key) ->
+    gen_server:cast(?MODULE, {config_change, Section, Key}).
+
+init(_) ->
+    process_flag(trap_exit, true),
+    ok = couch_config:register(fun couch_os_daemons:config_change/2),
+    Table = ets:new(?MODULE, [protected, set, {keypos, #daemon.port}]),
+    reload_daemons(Table),
+    {ok, Table}.
+
+terminate(_Reason, Table) ->
+    [stop_port(D) || D <- ets:tab2list(Table)],
+    ok.
+
+handle_call({daemon_info, Options}, _From, Table) when is_list(Options) ->
+    case lists:member(table, Options) of
+        true ->
+            {reply, {ok, ets:tab2list(Table)}, Table};
+        _ ->
+            {reply, {ok, Table}, Table}
+    end;
+handle_call(Msg, From, Table) ->
+    ?LOG_ERROR("Unknown call message to ~p from ~p: ~p", [?MODULE, From, Msg]),
+    {stop, error, Table}.
+
+handle_cast({config_change, Sect, Key}, Table) ->
+    restart_daemons(Table, Sect, Key),
+    case Sect of
+        "os_daemons" -> reload_daemons(Table);
+        _ -> ok
+    end,
+    {noreply, Table};
+handle_cast(stop, Table) ->
+    {stop, normal, Table};
+handle_cast(Msg, Table) ->
+    ?LOG_ERROR("Unknown cast message to ~p: ~p", [?MODULE, Msg]),
+    {stop, error, Table}.
+
+handle_info({'EXIT', Port, Reason}, Table) ->
+    case ets:lookup(Table, Port) of
+        [] ->
+            ?LOG_INFO("Port ~p exited after stopping: ~p~n", [Port, Reason]);
+        [#daemon{status=stopping}] ->
+            true = ets:delete(Table, Port);
+        [#daemon{name=Name, status=restarting}=D] ->
+            ?LOG_INFO("Daemon ~P restarting after config change.", [Name]),
+            true = ets:delete(Table, Port),
+            {ok, Port2} = start_port(D#daemon.cmd),
+            true = ets:insert(Table, D#daemon{
+                port=Port2, status=running, kill=undefined, buf=[]
+            });
+        [#daemon{name=Name, status=halted}] ->
+            ?LOG_ERROR("Halted daemon process: ~p", [Name]);
+        [D] ->
+            ?LOG_ERROR("Invalid port state at exit: ~p", [D])
+    end,
+    {noreply, Table};
+handle_info({Port, closed}, Table) ->
+    handle_info({Port, {exit_status, closed}}, Table);
+handle_info({Port, {exit_status, Status}}, Table) ->
+    case ets:lookup(Table, Port) of
+        [] ->
+            ?LOG_ERROR("Unknown port ~p exiting ~p", [Port, Status]),
+            {stop, {error, unknown_port_died, Status}, Table};
+        [#daemon{name=Name, status=restarting}=D] ->
+            ?LOG_INFO("Daemon ~P restarting after config change.", [Name]),
+            true = ets:delete(Table, Port),
+            {ok, Port2} = start_port(D#daemon.cmd),
+            true = ets:insert(Table, D#daemon{
+                port=Port2, status=running, kill=undefined, buf=[]
+            }),
+            {noreply, Table};
+        [#daemon{status=stopping}=D] ->
+            % The configuration changed and this daemon is no
+            % longer needed.
+            ?LOG_DEBUG("Port ~p shut down.", [D#daemon.name]),
+            true = ets:delete(Table, Port),
+            {noreply, Table};
+        [D] ->
+            % Port died for unknown reason. Check to see if it's
+            % died too many times or if we should boot it back up.
+            case should_halt([now() | D#daemon.errors]) of
+                {true, _} ->
+                    % Halting the process. We won't try and reboot
+                    % until the configuration changes.
+                    Fmt = "Daemon ~p halted with exit_status ~p",
+                    ?LOG_ERROR(Fmt, [D#daemon.name, Status]),
+                    D2 = D#daemon{status=halted, errors=nil, buf=nil},
+                    true = ets:insert(Table, D2),
+                    {noreply, Table};
+                {false, Errors} ->
+                    % We're guessing it was a random error, this daemon
+                    % has behaved so we'll give it another chance.
+                    Fmt = "Daemon ~p is being rebooted after exit_status ~p",
+                    ?LOG_INFO(Fmt, [D#daemon.name, Status]),
+                    true = ets:delete(Table, Port),
+                    {ok, Port2} = start_port(D#daemon.cmd),
+                    true = ets:insert(Table, D#daemon{
+                        port=Port2, status=running, kill=undefined,
+                                                errors=Errors, buf=[]
+                    }),
+                    {noreply, Table}
+            end;
+        _Else ->
+            throw(error)
+    end;
+handle_info({Port, {data, {noeol, Data}}}, Table) ->
+    [#daemon{buf=Buf}=D] = ets:lookup(Table, Port),
+    true = ets:insert(Table, D#daemon{buf=[Data | Buf]}),
+    {noreply, Table};
+handle_info({Port, {data, {eol, Data}}}, Table) ->
+    [#daemon{buf=Buf}=D] = ets:lookup(Table, Port),
+    Line = lists:reverse(Buf, Data),
+    % The first line echoed back is the kill command
+    % for when we go to get rid of the port. Lines after
+    % that are considered part of the stdio API.
+    case D#daemon.kill of
+        undefined ->
+            true = ets:insert(Table, D#daemon{kill=?b2l(Line), buf=[]});
+        _Else ->
+            D2 = case (catch ?JSON_DECODE(Line)) of
+                {invalid_json, Rejected} ->
+                    ?LOG_ERROR("Ignoring OS daemon request: ~p", [Rejected]),
+                    D;
+                JSON ->
+                    {ok, D3} = handle_port_message(D, JSON),
+                    D3
+            end,
+            true = ets:insert(Table, D2#daemon{buf=[]})
+    end,
+    {noreply, Table};
+handle_info({Port, Error}, Table) ->
+    ?LOG_ERROR("Unexpectd message from port ~p: ~p", [Port, Error]),
+    stop_port(Port),
+    [D] = ets:lookup(Table, Port),
+    true = ets:insert(Table, D#daemon{status=restarting, buf=nil}),
+    {noreply, Table};
+handle_info(Msg, Table) ->
+    ?LOG_ERROR("Unexpected info message to ~p: ~p", [?MODULE, Msg]),
+    {stop, error, Table}.
+
+code_change(_OldVsn, State, _Extra) ->
+    {ok, State}.
+
+% Internal API
+
+%
+% Port management helpers
+%
+
+start_port(Command) ->
+    PrivDir = couch_util:priv_dir(),
+    Spawnkiller = filename:join(PrivDir, "couchspawnkillable"),
+    Port = open_port({spawn, Spawnkiller ++ " " ++ Command}, ?PORT_OPTIONS),
+    {ok, Port}.
+
+
+stop_port(#daemon{port=Port, kill=undefined}=D) ->
+    ?LOG_ERROR("Stopping daemon without a kill command: ~p", [D#daemon.name]),
+    catch port_close(Port);
+stop_port(#daemon{port=Port}=D) ->
+    ?LOG_DEBUG("Stopping daemon: ~p", [D#daemon.name]),
+    os:cmd(D#daemon.kill),
+    catch port_close(Port).
+
+
+handle_port_message(#daemon{port=Port}=Daemon, [<<"get">>, Section]) ->
+    KVs = couch_config:get(Section),
+    Data = lists:map(fun({K, V}) -> {?l2b(K), ?l2b(V)} end, KVs),
+    Json = iolist_to_binary(?JSON_ENCODE({Data})),
+    port_command(Port, <<Json/binary, "\n">>),
+    {ok, Daemon};
+handle_port_message(#daemon{port=Port}=Daemon, [<<"get">>, Section, Key]) ->
+    Value = case couch_config:get(Section, Key, null) of
+        null -> null;
+        String -> ?l2b(String)
+    end,
+    Json = iolist_to_binary(?JSON_ENCODE(Value)),
+    port_command(Port, <<Json/binary, "\n">>),
+    {ok, Daemon};
+handle_port_message(Daemon, [<<"register">>, Sec]) when is_binary(Sec) ->
+    Patterns = lists:usort(Daemon#daemon.cfg_patterns ++ [{?b2l(Sec)}]),
+    {ok, Daemon#daemon{cfg_patterns=Patterns}};
+handle_port_message(Daemon, [<<"register">>, Sec, Key])
+                        when is_binary(Sec) andalso is_binary(Key) ->
+    Pattern = {?b2l(Sec), ?b2l(Key)},
+    Patterns = lists:usort(Daemon#daemon.cfg_patterns ++ [Pattern]),
+    {ok, Daemon#daemon{cfg_patterns=Patterns}};
+handle_port_message(#daemon{name=Name}=Daemon, [<<"log">>, Msg]) ->
+    handle_log_message(Name, Msg, <<"info">>),
+    {ok, Daemon};
+handle_port_message(#daemon{name=Name}=Daemon, [<<"log">>, Msg, {Opts}]) ->
+    Level = couch_util:get_value(<<"level">>, Opts, <<"info">>),
+    handle_log_message(Name, Msg, Level),
+    {ok, Daemon};
+handle_port_message(#daemon{name=Name}=Daemon, Else) ->
+    ?LOG_ERROR("Daemon ~p made invalid request: ~p", [Name, Else]),
+    {ok, Daemon}.
+
+
+handle_log_message(Name, Msg, _Level) when not is_binary(Msg) ->
+    ?LOG_ERROR("Invalid log message from daemon ~p: ~p", [Name, Msg]);
+handle_log_message(Name, Msg, <<"debug">>) ->
+    ?LOG_DEBUG("Daemon ~p :: ~s", [Name, ?b2l(Msg)]);
+handle_log_message(Name, Msg, <<"info">>) ->
+    ?LOG_INFO("Daemon ~p :: ~s", [Name, ?b2l(Msg)]);
+handle_log_message(Name, Msg, <<"error">>) ->
+    ?LOG_ERROR("Daemon: ~p :: ~s", [Name, ?b2l(Msg)]);
+handle_log_message(Name, Msg, Level) ->
+    ?LOG_ERROR("Invalid log level from daemon: ~p", [Level]),
+    ?LOG_INFO("Daemon: ~p :: ~s", [Name, ?b2l(Msg)]).
+
+%
+% Daemon management helpers
+%
+
+reload_daemons(Table) ->
+    % List of daemons we want to have running.
+    Configured = lists:sort(couch_config:get("os_daemons")),
+    
+    % Remove records for daemons that were halted.
+    MSpecHalted = #daemon{name='$1', cmd='$2', status=halted, _='_'},
+    Halted = lists:sort([{N, C} || [N, C] <- ets:match(Table, MSpecHalted)]),
+    ok = stop_os_daemons(Table, find_to_stop(Configured, Halted, [])),
+    
+    % Stop daemons that are running
+    % Start newly configured daemons
+    MSpecRunning = #daemon{name='$1', cmd='$2', status=running, _='_'},
+    Running = lists:sort([{N, C} || [N, C] <- ets:match(Table, MSpecRunning)]),
+    ok = stop_os_daemons(Table, find_to_stop(Configured, Running, [])),
+    ok = boot_os_daemons(Table, find_to_boot(Configured, Running, [])),
+    ok.
+
+
+restart_daemons(Table, Sect, Key) ->
+    restart_daemons(Table, Sect, Key, ets:first(Table)).
+
+restart_daemons(_, _, _, '$end_of_table') ->
+    ok;
+restart_daemons(Table, Sect, Key, Port) ->
+    [D] = ets:lookup(Table, Port),
+    HasSect = lists:member({Sect}, D#daemon.cfg_patterns),
+    HasKey = lists:member({Sect, Key}, D#daemon.cfg_patterns),
+    case HasSect or HasKey of
+        true ->
+            stop_port(D),
+            D2 = D#daemon{status=restarting, buf=nil},
+            true = ets:insert(Table, D2);
+        _ ->
+            ok
+    end,
+    restart_daemons(Table, Sect, Key, ets:next(Table, Port)).
+    
+
+stop_os_daemons(_Table, []) ->
+    ok;
+stop_os_daemons(Table, [{Name, Cmd} | Rest]) ->
+    [[Port]] = ets:match(Table, #daemon{port='$1', name=Name, cmd=Cmd, _='_'}),
+    [D] = ets:lookup(Table, Port),
+    case D#daemon.status of
+        halted ->
+            ets:delete(Table, Port);
+        _ ->
+            stop_port(D),
+            D2 = D#daemon{status=stopping, errors=nil, buf=nil},
+            true = ets:insert(Table, D2)
+    end,
+    stop_os_daemons(Table, Rest).
+    
+boot_os_daemons(_Table, []) ->
+    ok;
+boot_os_daemons(Table, [{Name, Cmd} | Rest]) ->
+    {ok, Port} = start_port(Cmd),
+    true = ets:insert(Table, #daemon{port=Port, name=Name, cmd=Cmd}),
+    boot_os_daemons(Table, Rest).
+    
+% Elements unique to the configured set need to be booted.
+find_to_boot([], _Rest, Acc) ->
+    % Nothing else configured.
+    Acc;
+find_to_boot([D | R1], [D | R2], Acc) ->
+    % Elements are equal, daemon already running.
+    find_to_boot(R1, R2, Acc);
+find_to_boot([D1 | R1], [D2 | _]=A2, Acc) when D1 < D2 ->
+    find_to_boot(R1, A2, [D1 | Acc]);
+find_to_boot(A1, [_ | R2], Acc) ->
+    find_to_boot(A1, R2, Acc);
+find_to_boot(Rest, [], Acc) ->
+    % No more candidates for already running. Boot all.
+    Rest ++ Acc.
+
+% Elements unique to the running set need to be killed.
+find_to_stop([], Rest, Acc) ->
+    % The rest haven't been found, so they must all
+    % be ready to die.
+    Rest ++ Acc;
+find_to_stop([D | R1], [D | R2], Acc) ->
+    % Elements are equal, daemon already running.
+    find_to_stop(R1, R2, Acc);
+find_to_stop([D1 | R1], [D2 | _]=A2, Acc) when D1 < D2 ->
+    find_to_stop(R1, A2, Acc);
+find_to_stop(A1, [D2 | R2], Acc) ->
+    find_to_stop(A1, R2, [D2 | Acc]);
+find_to_stop(_, [], Acc) ->
+    % No more running daemons to worry about.
+    Acc.
+
+should_halt(Errors) ->
+    RetryTimeCfg = couch_config:get("os_daemon_settings", "retry_time", "5"),
+    RetryTime = list_to_integer(RetryTimeCfg),
+
+    Now = now(),
+    RecentErrors = lists:filter(fun(Time) ->
+        timer:now_diff(Now, Time) =< RetryTime * 1000000
+    end, Errors),
+
+    RetryCfg = couch_config:get("os_daemon_settings", "max_retries", "3"),
+    Retries = list_to_integer(RetryCfg),
+
+    {length(RecentErrors) >= Retries, RecentErrors}.
diff --git a/apps/couch/src/couch_proc_manager.erl b/apps/couch/src/couch_proc_manager.erl
index 509da9ba..438f7973 100644
--- a/apps/couch/src/couch_proc_manager.erl
+++ b/apps/couch/src/couch_proc_manager.erl
@@ -150,7 +150,7 @@ make_proc(Pid, Lang, Mod) ->
     {ok, Proc}.
 
 get_query_server_config() ->
-    Limit = couch_config:get("query_server_config", "reduce_limit", "true"),
+    Limit = couch_config:get("query_server_config", <<"reduce_limit">>, "true"),
     {[{<<"reduce_limit">>, list_to_atom(Limit)}]}.
 
 proc_with_ddoc(DDoc, DDocKey, Procs) ->
diff --git a/apps/couch/src/couch_query_servers.erl b/apps/couch/src/couch_query_servers.erl
index 58540660..be7c465b 100644
--- a/apps/couch/src/couch_query_servers.erl
+++ b/apps/couch/src/couch_query_servers.erl
@@ -12,7 +12,7 @@
 
 -module(couch_query_servers).
 
--export([start_doc_map/2, map_docs/2, stop_doc_map/1]).
+-export([start_doc_map/3, map_docs/2, stop_doc_map/1]).
 -export([reduce/3, rereduce/3,validate_doc_update/5]).
 -export([filter_docs/5]).
 
@@ -23,8 +23,13 @@
 
 -include("couch_db.hrl").
 
-start_doc_map(Lang, Functions) ->
+start_doc_map(Lang, Functions, Lib) ->
     Proc = get_os_process(Lang),
+    case Lib of
+    {[]} -> ok;
+    Lib ->
+        true = proc_prompt(Proc, [<<"add_lib">>, Lib])
+    end,
     lists:foreach(fun(FunctionSource) ->
         true = proc_prompt(Proc, [<<"add_fun">>, FunctionSource])
     end, Functions),
@@ -137,18 +142,35 @@ builtin_reduce(Re, [<<"_stats",_/binary>>|BuiltinReds], KVs, Acc) ->
 
 builtin_sum_rows(KVs) ->
     lists:foldl(fun
-        ([_Key, Value], Acc) when is_number(Value) ->
+        ([_Key, Value], Acc) when is_number(Value), is_number(Acc) ->
             Acc + Value;
+        ([_Key, Value], Acc) when is_list(Value), is_list(Acc) ->
+            sum_terms(Acc, Value);
+        ([_Key, Value], Acc) when is_number(Value), is_list(Acc) ->
+            sum_terms(Acc, [Value]);
+        ([_Key, Value], Acc) when is_list(Value), is_number(Acc) ->
+            sum_terms([Acc], Value);
         (_Else, _Acc) ->
-            throw({invalid_value, <<"builtin _sum function requires map values to be numbers">>})
+            throw({invalid_value, <<"builtin _sum function requires map values to be numbers or lists of numbers">>})
     end, 0, KVs).
 
+sum_terms([], []) ->
+    [];
+sum_terms([_|_]=Xs, []) ->
+    Xs;
+sum_terms([], [_|_]=Ys) ->
+    Ys;
+sum_terms([X|Xs], [Y|Ys]) when is_number(X), is_number(Y) ->
+    [X+Y | sum_terms(Xs,Ys)];
+sum_terms(_, _) ->
+    throw({invalid_value, <<"builtin _sum function requires map values to be numbers or lists of numbers">>}).
+
 builtin_stats(_, []) ->
     {[{sum,0}, {count,0}, {min,0}, {max,0}, {sumsqr,0}]};
 
 builtin_stats(reduce, [[_,First]|Rest]) when is_number(First) ->
     Stats = lists:foldl(fun([_K,V], {S,C,Mi,Ma,Sq}) when is_number(V) ->
-        {S+V, C+1, erlang:min(Mi,V), erlang:max(Ma,V), Sq+(V*V)};
+        {S+V, C+1, lists:min([Mi, V]), lists:max([Ma, V]), Sq+(V*V)};
     (_, _) ->
         throw({invalid_value,
             <<"builtin _stats function requires map values to be numbers">>})
@@ -160,7 +182,7 @@ builtin_stats(rereduce, [[_,First]|Rest]) ->
     {[{sum,Sum0}, {count,Cnt0}, {min,Min0}, {max,Max0}, {sumsqr,Sqr0}]} = First,
     Stats = lists:foldl(fun([_K,Red], {S,C,Mi,Ma,Sq}) ->
         {[{sum,Sum}, {count,Cnt}, {min,Min}, {max,Max}, {sumsqr,Sqr}]} = Red,
-        {Sum+S, Cnt+C, erlang:min(Min,Mi), erlang:max(Max,Ma), Sqr+Sq}
+        {Sum+S, Cnt+C, lists:min([Min, Mi]), lists:max([Max, Ma]), Sqr+Sq}
     end, {Sum0,Cnt0,Min0,Max0,Sqr0}, Rest),
     {Sum, Cnt, Min, Max, Sqr} = Stats,
     {[{sum,Sum}, {count,Cnt}, {min,Min}, {max,Max}, {sumsqr,Sqr}]}.
diff --git a/apps/couch/src/couch_ref_counter.erl b/apps/couch/src/couch_ref_counter.erl
index 5a111ab6..a774f469 100644
--- a/apps/couch/src/couch_ref_counter.erl
+++ b/apps/couch/src/couch_ref_counter.erl
@@ -24,14 +24,14 @@ drop(RefCounterPid) ->
     drop(RefCounterPid, self()).
 
 drop(RefCounterPid, Pid) ->
-    gen_server:call(RefCounterPid, {drop, Pid}).
+    gen_server:call(RefCounterPid, {drop, Pid}, infinity).
 
 
 add(RefCounterPid) ->
     add(RefCounterPid, self()).
 
 add(RefCounterPid, Pid) ->
-    gen_server:call(RefCounterPid, {add, Pid}).
+    gen_server:call(RefCounterPid, {add, Pid}, infinity).
 
 count(RefCounterPid) ->
     gen_server:call(RefCounterPid, count).
diff --git a/apps/couch/src/couch_rep.erl b/apps/couch/src/couch_rep.erl
index c804b49d..2d011aab 100644
--- a/apps/couch/src/couch_rep.erl
+++ b/apps/couch/src/couch_rep.erl
@@ -15,9 +15,14 @@
 -export([init/1, handle_call/3, handle_cast/2, handle_info/2, terminate/2,
     code_change/3]).
 
--export([replicate/2, checkpoint/1]).
+-export([replicate/2, replicate/3, checkpoint/1]).
+-export([make_replication_id/2]).
+-export([start_replication/4, end_replication/1, get_result/4]).
 
 -include("couch_db.hrl").
+-include_lib("ibrowse/include/ibrowse.hrl").
+
+-define(REP_ID_VERSION, 2).
 
 -record(state, {
     changes_feed,
@@ -47,7 +52,6 @@
     committed_seq = 0,
 
     stats = nil,
-    doc_ids = nil,
     source_db_update_notifier = nil,
     target_db_update_notifier = nil
 }).
@@ -61,40 +65,55 @@ replicate(Source, Target) when is_binary(Source), is_binary(Target) ->
     replicate({[{<<"source">>, Source}, {<<"target">>, Target}]}, #user_ctx{});
 
 %% function handling POST to _replicate
-replicate({Props}=PostBody, UserCtx) ->
-    {BaseId, Extension} = make_replication_id(PostBody, UserCtx),
-    Replicator = {BaseId ++ Extension,
-        {gen_server, start_link, [?MODULE, [BaseId, PostBody, UserCtx], []]},
-        temporary,
-        1,
-        worker,
-        [?MODULE]
-    },
+replicate(PostBody, UserCtx) ->
+    replicate(PostBody, UserCtx, couch_replication_manager).
 
+replicate({Props}=PostBody, UserCtx, Module) ->
+    RepId = make_replication_id(PostBody, UserCtx),
     case couch_util:get_value(<<"cancel">>, Props, false) of
     true ->
- case supervisor:terminate_child(couch_rep_sup, BaseId ++ Extension) of
-        {error, not_found} ->
-     {error, not_found};
-        ok ->
-     ok = supervisor:delete_child(couch_rep_sup, BaseId ++ Extension),
-            {ok, {cancelled, ?l2b(BaseId)}}
- end;
+        end_replication(RepId);
     false ->
-        Server = start_replication_server(Replicator),
+        Server = start_replication(PostBody, RepId, UserCtx, Module),
+        get_result(Server, RepId, PostBody, UserCtx)
+    end.
 
-        case couch_util:get_value(<<"continuous">>, Props, false) of
-        true ->
-            {ok, {continuous, ?l2b(BaseId)}};
-        false ->
-            get_result(Server, PostBody, UserCtx)
+end_replication({BaseId, Extension}) ->
+    RepId = BaseId ++ Extension,
+    case supervisor:terminate_child(couch_rep_sup, RepId) of
+    {error, not_found} = R ->
+        R;
+    ok ->
+        case supervisor:delete_child(couch_rep_sup, RepId) of
+            ok ->
+                {ok, {cancelled, ?l2b(BaseId)}};
+            {error, not_found} ->
+                {ok, {cancelled, ?l2b(BaseId)}};
+            {error, _} = Error ->
+                Error
         end
     end.
 
+start_replication(RepDoc, {BaseId, Extension} = RepId, UserCtx, Module) ->
+    Replicator = {
+        BaseId ++ Extension,
+        {gen_server, start_link,
+            [?MODULE, [RepId, RepDoc, UserCtx, Module], []]},
+        temporary,
+        1,
+        worker,
+        [?MODULE]
+    },
+    start_replication_server(Replicator).
+
 checkpoint(Server) ->
     gen_server:cast(Server, do_checkpoint).
 
-get_result(Server, PostBody, UserCtx) ->
+get_result(Server, {BaseId, _Extension}, {Props} = PostBody, UserCtx) ->
+        case couch_util:get_value(<<"continuous">>, Props, false) of
+        true ->
+            {ok, {continuous, ?l2b(BaseId)}};
+        false ->
     try gen_server:call(Server, get_result, infinity) of
     retry -> replicate(PostBody, UserCtx);
     Else -> Else
@@ -105,6 +124,7 @@ get_result(Server, PostBody, UserCtx) ->
     exit:{normal, {gen_server, call, [Server, get_result , infinity]}} ->
         %% we made the call during terminate
         replicate(PostBody, UserCtx)
+        end
     end.
 
 init(InitArgs) ->
@@ -115,13 +135,12 @@ init(InitArgs) ->
         {stop, Error}
     end.
 
-do_init([RepId, {PostProps}, UserCtx] = InitArgs) ->
+do_init([{BaseId, _Ext} = RepId, {PostProps}, UserCtx, Module] = InitArgs) ->
     process_flag(trap_exit, true),
 
     SourceProps = couch_util:get_value(<<"source">>, PostProps),
     TargetProps = couch_util:get_value(<<"target">>, PostProps),
 
-    DocIds = couch_util:get_value(<<"doc_ids">>, PostProps, nil),
     Continuous = couch_util:get_value(<<"continuous">>, PostProps, false),
     CreateTarget = couch_util:get_value(<<"create_target">>, PostProps, false),
 
@@ -133,29 +152,8 @@ do_init([RepId, {PostProps}, UserCtx] = InitArgs) ->
     SourceInfo = dbinfo(Source),
     TargetInfo = dbinfo(Target),
 
-    case DocIds of
-    List when is_list(List) ->
-        % Fast replication using only a list of doc IDs to replicate.
-        % Replication sessions, checkpoints and logs are not created
-        % since the update sequence number of the source DB is not used
-        % for determining which documents are copied into the target DB.
-        SourceLog = nil,
-        TargetLog = nil,
-
-        StartSeq = nil,
-        History = nil,
-
-        ChangesFeed = nil,
-        MissingRevs = nil,
-
-        {ok, Reader} =
-        couch_rep_reader:start_link(self(), Source, DocIds, PostProps);
-
-    _ ->
-        % Replication using the _changes API (DB sequence update numbers).
-        SourceLog = open_replication_log(Source, RepId),
-        TargetLog = open_replication_log(Target, RepId),
-    
+    [SourceLog, TargetLog] = find_replication_logs(
+        [Source, Target], BaseId, {PostProps}, UserCtx),
         {StartSeq, History} = compare_replication_logs(SourceLog, TargetLog),
 
         {ok, ChangesFeed} =
@@ -163,9 +161,7 @@ do_init([RepId, {PostProps}, UserCtx] = InitArgs) ->
         {ok, MissingRevs} =
         couch_rep_missing_revs:start_link(self(), Target, ChangesFeed, PostProps),
         {ok, Reader} =
-        couch_rep_reader:start_link(self(), Source, MissingRevs, PostProps)
-    end,
-
+        couch_rep_reader:start_link(self(), Source, MissingRevs, PostProps),
     {ok, Writer} =
     couch_rep_writer:start_link(self(), Target, Reader, PostProps),
 
@@ -176,10 +172,12 @@ do_init([RepId, {PostProps}, UserCtx] = InitArgs) ->
     ets:insert(Stats, {docs_written, 0}),
     ets:insert(Stats, {doc_write_failures, 0}),
 
-    {ShortId, _} = lists:split(6, RepId),
+    {ShortId, _} = lists:split(6, BaseId),
     couch_task_status:add_task("Replication", io_lib:format("~s: ~s -> ~s",
         [ShortId, dbname(Source), dbname(Target)]), "Starting"),
 
+    Module:replication_started(RepId),
+
     State = #state{
         changes_feed = ChangesFeed,
         missing_revs = MissingRevs,
@@ -202,7 +200,6 @@ do_init([RepId, {PostProps}, UserCtx] = InitArgs) ->
         rep_starttime = httpd_util:rfc1123_date(),
         src_starttime = couch_util:get_value(instance_start_time, SourceInfo),
         tgt_starttime = couch_util:get_value(instance_start_time, TargetInfo),
-        doc_ids = DocIds,
         source_db_update_notifier = source_db_update_notifier(Source),
         target_db_update_notifier = target_db_update_notifier(Target)
     },
@@ -274,24 +271,24 @@ handle_info({'EXIT', _Pid, {Err, Reason}}, State) when Err == source_error;
 handle_info({'EXIT', _Pid, Reason}, State) ->
     {stop, Reason, State}.
 
-terminate(normal, #state{checkpoint_scheduled=nil} = State) ->
-    do_terminate(State);
+terminate(normal, #state{checkpoint_scheduled=nil, init_args=[RepId, _, _, Module]} = State) ->
+    do_terminate(State),
+    Module:replication_completed(RepId);
     
-terminate(normal, State) ->
+terminate(normal, #state{init_args=[RepId, _, _, Module]} = State) ->
     timer:cancel(State#state.checkpoint_scheduled),
-    do_terminate(do_checkpoint(State));
+    do_terminate(do_checkpoint(State)),
+    Module:replication_completed(RepId);
 
-terminate(Reason, State) ->
-    #state{
-        listeners = Listeners,
-        source = Source,
-        target = Target,
-        stats = Stats
-    } = State,
+terminate(shutdown, #state{listeners = Listeners} = State) ->
+    % continuous replication stopped
+    [gen_server:reply(L, {ok, stopped}) || L <- Listeners],
+    terminate_cleanup(State);
+
+terminate(Reason, #state{listeners = Listeners, init_args=[RepId, _, _, Module]} = State) ->
     [gen_server:reply(L, {error, Reason}) || L <- Listeners],
-    ets:delete(Stats),
-    close_db(Target),
-    close_db(Source).
+    terminate_cleanup(State),
+    Module:replication_error(RepId, Reason).
 
 code_change(_OldVsn, State, _Extra) ->
     {ok, State}.
@@ -321,7 +318,14 @@ start_replication_server(Replicator) ->
             throw({db_not_found, <<"could not open ", DbUrl/binary>>});
         {error, {unauthorized, DbUrl}} ->
             throw({unauthorized,
-                <<"unauthorized to access database ", DbUrl/binary>>})
+                <<"unauthorized to access or create database ", DbUrl/binary>>});
+        {error, {'EXIT', {badarg,
+            [{erlang, apply, [gen_server, start_link, undefined]} | _]}}} ->
+            % Clause to deal with a change in the supervisor module introduced
+            % in R14B02. For more details consult the thread at:
+            %     http://erlang.org/pipermail/erlang-bugs/2011-March/002273.html
+            _ = supervisor:delete_child(couch_rep_sup, RepId),
+            start_replication_server(Replicator)
         end;
     {error, {already_started, Pid}} ->
         ?LOG_DEBUG("replication ~p already running at ~p", [RepId, Pid]),
@@ -330,7 +334,7 @@ start_replication_server(Replicator) ->
         throw({db_not_found, <<"could not open ", DbUrl/binary>>});
     {error, {{unauthorized, DbUrl}, _}} ->
         throw({unauthorized,
-            <<"unauthorized to access database ", DbUrl/binary>>})
+            <<"unauthorized to access or create database ", DbUrl/binary>>})
     end.
 
 compare_replication_logs(SrcDoc, TgtDoc) ->
@@ -390,30 +394,11 @@ dbname(#db{name = Name}) ->
 
 dbinfo(#http_db{} = Db) ->
     {DbProps} = couch_rep_httpc:request(Db),
-    [{list_to_existing_atom(?b2l(K)), V} || {K,V} <- DbProps];
+    [{couch_util:to_existing_atom(K), V} || {K,V} <- DbProps];
 dbinfo(Db) ->
     {ok, Info} = couch_db:get_db_info(Db),
     Info.
 
-do_terminate(#state{doc_ids=DocIds} = State) when is_list(DocIds) ->
-    #state{
-        listeners = Listeners,
-        rep_starttime = ReplicationStartTime,
-        stats = Stats
-    } = State,
-
-    RepByDocsJson = {[
-        {<<"start_time">>, ?l2b(ReplicationStartTime)},
-        {<<"end_time">>, ?l2b(httpd_util:rfc1123_date())},
-        {<<"docs_read">>, ets:lookup_element(Stats, docs_read, 2)},
-        {<<"docs_written">>, ets:lookup_element(Stats, docs_written, 2)},
-        {<<"doc_write_failures">>,
-            ets:lookup_element(Stats, doc_write_failures, 2)}
-    ]},
-
-    terminate_cleanup(State),
-    [gen_server:reply(L, {ok, RepByDocsJson}) || L <- lists:reverse(Listeners)];
-
 do_terminate(State) ->
     #state{
         checkpoint_history = CheckpointHistory,
@@ -475,7 +460,7 @@ has_session_id(SessionId, [{Props} | Rest]) ->
         has_session_id(SessionId, Rest)
     end.
 
-maybe_append_options(Options, Props) ->
+maybe_append_options(Options, {Props}) ->
     lists:foldl(fun(Option, Acc) ->
         Acc ++
         case couch_util:get_value(Option, Props, false) of
@@ -486,13 +471,39 @@ maybe_append_options(Options, Props) ->
         end
     end, [], Options).
 
-make_replication_id({Props}, UserCtx) ->
-    %% funky algorithm to preserve backwards compatibility
+make_replication_id(RepProps, UserCtx) ->
+    BaseId = make_replication_id(RepProps, UserCtx, ?REP_ID_VERSION),
+    Extension = maybe_append_options(
+                  [<<"continuous">>, <<"create_target">>], RepProps),
+    {BaseId, Extension}.
+
+% Versioned clauses for generating replication ids
+% If a change is made to how replications are identified
+% add a new clause and increase ?REP_ID_VERSION at the top
+make_replication_id({Props}, UserCtx, 2) ->
+    {ok, HostName} = inet:gethostname(),
+    Port = case (catch mochiweb_socket_server:get(couch_httpd, port)) of
+    P when is_number(P) ->
+        P;
+    _ ->
+        % On restart we might be called before the couch_httpd process is
+        % started.
+        % TODO: we might be under an SSL socket server only, or both under
+        % SSL and a non-SSL socket.
+        % ... mochiweb_socket_server:get(https, port)
+        list_to_integer(couch_config:get("httpd", "port", "5984"))
+    end,
+    Src = get_rep_endpoint(UserCtx, couch_util:get_value(<<"source">>, Props)),
+    Tgt = get_rep_endpoint(UserCtx, couch_util:get_value(<<"target">>, Props)),
+    maybe_append_filters({Props}, [HostName, Port, Src, Tgt], UserCtx);
+make_replication_id({Props}, UserCtx, 1) ->
     {ok, HostName} = inet:gethostname(),
-    % Port = mochiweb_socket_server:get(couch_httpd, port),
     Src = get_rep_endpoint(UserCtx, couch_util:get_value(<<"source">>, Props)),
     Tgt = get_rep_endpoint(UserCtx, couch_util:get_value(<<"target">>, Props)),
-    Base = [HostName, Src, Tgt] ++
+    maybe_append_filters({Props}, [HostName, Src, Tgt], UserCtx).
+
+maybe_append_filters({Props}, Base, UserCtx) ->
+    Base2 = Base ++ 
         case couch_util:get_value(<<"filter">>, Props) of
         undefined ->
             case couch_util:get_value(<<"doc_ids">>, Props) of
@@ -502,11 +513,47 @@ make_replication_id({Props}, UserCtx) ->
                 [DocIds]
             end;
         Filter ->
-            [Filter, couch_util:get_value(<<"query_params">>, Props, {[]})]
+            [filter_code(Filter, Props, UserCtx),
+                couch_util:get_value(<<"query_params">>, Props, {[]})]
         end,
-    Extension = maybe_append_options(
-        [<<"continuous">>, <<"create_target">>], Props),
-    {couch_util:to_hex(couch_util:md5(term_to_binary(Base))), Extension}.
+    couch_util:to_hex(couch_util:md5(term_to_binary(Base2))).
+
+filter_code(Filter, Props, UserCtx) ->
+    {DDocName, FilterName} =
+    case re:run(Filter, "(.*?)/(.*)", [{capture, [1, 2], binary}]) of
+    {match, [DDocName0, FilterName0]} ->
+        {DDocName0, FilterName0};
+    _ ->
+        throw({error, <<"Invalid filter. Must match `ddocname/filtername`.">>})
+    end,
+    ProxyParams = parse_proxy_params(
+        couch_util:get_value(<<"proxy">>, Props, [])),
+    DbName = couch_util:get_value(<<"source">>, Props),
+    Source = try
+        open_db(DbName, UserCtx, ProxyParams)
+    catch
+    _Tag:DbError ->
+        DbErrorMsg = io_lib:format("Could not open source database `~s`: ~s",
+           [couch_util:url_strip_password(DbName), couch_util:to_binary(DbError)]),
+        throw({error, iolist_to_binary(DbErrorMsg)})
+    end,
+    try
+        Body = case (catch open_doc(Source, <<"_design/", DDocName/binary>>)) of
+        {ok, #doc{body = Body0}} ->
+            Body0;
+        DocError ->
+            DocErrorMsg = io_lib:format(
+                "Couldn't open document `_design/~s` from source "
+                "database `~s`: ~s",
+                [dbname(Source), DDocName, couch_util:to_binary(DocError)]),
+            throw({error, iolist_to_binary(DocErrorMsg)})
+        end,
+        Code = couch_util:get_nested_json_value(
+            Body, [<<"filters">>, FilterName]),
+        re:replace(Code, "^\s*(.*?)\s*$", "\\1", [{return, binary}])
+    after
+        close_db(Source)
+    end.
 
 maybe_add_trailing_slash(Url) ->
     re:replace(Url, "[^/]$", "&/", [{return, list}]).
@@ -528,27 +575,54 @@ get_rep_endpoint(_UserCtx, <<"https://",_/binary>>=Url) ->
 get_rep_endpoint(UserCtx, <<DbName/binary>>) ->
     {local, DbName, UserCtx}.
 
-open_replication_log(#http_db{}=Db, RepId) ->
-    DocId = ?LOCAL_DOC_PREFIX ++ RepId,
-    Req = Db#http_db{resource=couch_util:url_encode(DocId)},
+find_replication_logs(DbList, RepId, RepProps, UserCtx) ->
+    LogId = ?l2b(?LOCAL_DOC_PREFIX ++ RepId),
+    fold_replication_logs(DbList, ?REP_ID_VERSION,
+        LogId, LogId, RepProps, UserCtx, []).
+
+% Accumulate the replication logs
+% Falls back to older log document ids and migrates them
+fold_replication_logs([], _Vsn, _LogId, _NewId, _RepProps, _UserCtx, Acc) ->
+    lists:reverse(Acc);
+fold_replication_logs([Db|Rest]=Dbs, Vsn, LogId, NewId,
+        RepProps, UserCtx, Acc) ->
+    case open_replication_log(Db, LogId) of
+    {error, not_found} when Vsn > 1 ->
+        OldRepId = make_replication_id(RepProps, UserCtx, Vsn - 1),
+        fold_replication_logs(Dbs, Vsn - 1,
+            ?l2b(?LOCAL_DOC_PREFIX ++ OldRepId), NewId, RepProps, UserCtx, Acc);
+    {error, not_found} ->
+        fold_replication_logs(Rest, ?REP_ID_VERSION, NewId, NewId,
+            RepProps, UserCtx, [#doc{id=NewId}|Acc]);
+    {ok, Doc} when LogId =:= NewId ->
+        fold_replication_logs(Rest, ?REP_ID_VERSION, NewId, NewId,
+            RepProps, UserCtx, [Doc|Acc]);
+    {ok, Doc} ->
+        MigratedLog = #doc{id=NewId,body=Doc#doc.body},
+        fold_replication_logs(Rest, ?REP_ID_VERSION, NewId, NewId,
+            RepProps, UserCtx, [MigratedLog|Acc])
+    end.
+
+open_replication_log(Db, DocId) ->
+    case open_doc(Db, DocId) of
+    {ok, Doc} ->
+        ?LOG_DEBUG("found a replication log for ~s", [dbname(Db)]),
+        {ok, Doc};
+    _ ->
+        ?LOG_DEBUG("didn't find a replication log for ~s", [dbname(Db)]),
+        {error, not_found}
+    end.
+
+open_doc(#http_db{} = Db, DocId) ->
+    Req = Db#http_db{resource = couch_util:encode_doc_id(DocId)},
     case couch_rep_httpc:request(Req) of
     {[{<<"error">>, _}, {<<"reason">>, _}]} ->
-        ?LOG_DEBUG("didn't find a replication log for ~s", [Db#http_db.url]),
-        #doc{id=?l2b(DocId)};
+        {error, not_found};
     Doc ->
-        ?LOG_DEBUG("found a replication log for ~s", [Db#http_db.url]),
-        couch_doc:from_json_obj(Doc)
+        {ok, couch_doc:from_json_obj(Doc)}
     end;
-open_replication_log(Db, RepId) ->
-    DocId = ?l2b(?LOCAL_DOC_PREFIX ++ RepId),
-    case couch_db:open_doc(Db, DocId, []) of
-    {ok, Doc} ->
-        ?LOG_DEBUG("found a replication log for ~s", [Db#db.name]),
-        Doc;
-    _ ->
-        ?LOG_DEBUG("didn't find a replication log for ~s", [Db#db.name]),
-        #doc{id=DocId}
-    end.
+open_doc(Db, DocId) ->
+    couch_db:open_doc(Db, DocId).
 
 open_db(Props, UserCtx, ProxyParams) ->
     open_db(Props, UserCtx, ProxyParams, false).
@@ -575,18 +649,18 @@ open_db(<<"https://",_/binary>>=Url, _, ProxyParams, CreateTarget) ->
     open_db({[{<<"url">>,Url}]}, [], ProxyParams, CreateTarget);
 open_db(<<DbName/binary>>, UserCtx, _ProxyParams, CreateTarget) ->
     try
-        case CreateTarget of
-        true ->
-            ok = couch_httpd:verify_is_server_admin(UserCtx),
-            couch_server:create(DbName, [{user_ctx, UserCtx}]);
+    case CreateTarget of
+    true ->
+        ok = couch_httpd:verify_is_server_admin(UserCtx),
+        couch_server:create(DbName, [{user_ctx, UserCtx}]);
         false ->
             ok
-        end,
+    end,
 
-        case couch_db:open(DbName, [{user_ctx, UserCtx}]) of
-        {ok, Db} ->
-            couch_db:monitor(Db),
-            Db;
+    case couch_db:open(DbName, [{user_ctx, UserCtx}]) of
+    {ok, Db} ->
+        couch_db:monitor(Db),
+        Db;
         {not_found, no_db_file} ->
             throw({db_not_found, DbName})
         end
@@ -619,32 +693,54 @@ do_checkpoint(State) ->
         rep_starttime = ReplicationStartTime,
         src_starttime = SrcInstanceStartTime,
         tgt_starttime = TgtInstanceStartTime,
-        stats = Stats
+        stats = Stats,
+        init_args = [_RepId, {RepDoc} | _]
     } = State,
     case commit_to_both(Source, Target, NewSeqNum) of
     {SrcInstanceStartTime, TgtInstanceStartTime} ->
         ?LOG_INFO("recording a checkpoint for ~s -> ~s at source update_seq ~p",
             [dbname(Source), dbname(Target), NewSeqNum]),
+        EndTime = ?l2b(httpd_util:rfc1123_date()),
+        StartTime = ?l2b(ReplicationStartTime),
+        DocsRead = ets:lookup_element(Stats, docs_read, 2),
+        DocsWritten = ets:lookup_element(Stats, docs_written, 2),
+        DocWriteFailures = ets:lookup_element(Stats, doc_write_failures, 2),
         NewHistoryEntry = {[
             {<<"session_id">>, SessionId},
-            {<<"start_time">>, list_to_binary(ReplicationStartTime)},
-            {<<"end_time">>, list_to_binary(httpd_util:rfc1123_date())},
+            {<<"start_time">>, StartTime},
+            {<<"end_time">>, EndTime},
             {<<"start_last_seq">>, StartSeqNum},
             {<<"end_last_seq">>, NewSeqNum},
             {<<"recorded_seq">>, NewSeqNum},
             {<<"missing_checked">>, ets:lookup_element(Stats, total_revs, 2)},
             {<<"missing_found">>, ets:lookup_element(Stats, missing_revs, 2)},
-            {<<"docs_read">>, ets:lookup_element(Stats, docs_read, 2)},
-            {<<"docs_written">>, ets:lookup_element(Stats, docs_written, 2)},
-            {<<"doc_write_failures">>,
-                ets:lookup_element(Stats, doc_write_failures, 2)}
+            {<<"docs_read">>, DocsRead},
+            {<<"docs_written">>, DocsWritten},
+            {<<"doc_write_failures">>, DocWriteFailures}
         ]},
-        % limit history to 50 entries
-        NewRepHistory = {[
+        BaseHistory = [
             {<<"session_id">>, SessionId},
             {<<"source_last_seq">>, NewSeqNum},
-            {<<"history">>, lists:sublist([NewHistoryEntry | OldHistory], 50)}
-        ]},
+            {<<"replication_id_version">>, ?REP_ID_VERSION}
+        ] ++ case couch_util:get_value(<<"doc_ids">>, RepDoc) of
+        undefined ->
+            [];
+        DocIds when is_list(DocIds) ->
+            % backwards compatibility with the result of a replication by
+            % doc IDs in versions 0.11.x and 1.0.x
+            [
+                {<<"start_time">>, StartTime},
+                {<<"end_time">>, EndTime},
+                {<<"docs_read">>, DocsRead},
+                {<<"docs_written">>, DocsWritten},
+                {<<"doc_write_failures">>, DocWriteFailures}
+            ]
+        end,
+        % limit history to 50 entries
+        NewRepHistory = {
+            BaseHistory ++
+            [{<<"history">>, lists:sublist([NewHistoryEntry | OldHistory], 50)}]
+        },
 
         try
         {SrcRevPos,SrcRevId} =
@@ -760,9 +856,9 @@ ensure_full_commit(Source, RequiredSeq) ->
         InstanceStartTime
     end.
 
-update_local_doc(#http_db{} = Db, #doc{id=DocId} = Doc) ->
+update_local_doc(#http_db{} = Db, Doc) ->
     Req = Db#http_db{
-        resource = couch_util:url_encode(DocId),
+        resource = couch_util:encode_doc_id(Doc),
         method = put,
         body = couch_doc:to_json_obj(Doc, [attachments]),
         headers = [{"x-couch-full-commit", "false"} | Db#http_db.headers]
@@ -787,9 +883,13 @@ parse_proxy_params(ProxyUrl) when is_binary(ProxyUrl) ->
 parse_proxy_params([]) ->
     [];
 parse_proxy_params(ProxyUrl) ->
-    {url, _, Base, Port, User, Passwd, _Path, _Proto} =
-        ibrowse_lib:parse_url(ProxyUrl),
-    [{proxy_host, Base}, {proxy_port, Port}] ++
+    #url{
+        host = Host,
+        port = Port,
+        username = User,
+        password = Passwd
+    } = ibrowse_lib:parse_url(ProxyUrl),
+    [{proxy_host, Host}, {proxy_port, Port}] ++
         case is_list(User) andalso is_list(Passwd) of
         false ->
             [];
diff --git a/apps/couch/src/couch_rep_att.erl b/apps/couch/src/couch_rep_att.erl
index 72c723e8..9988c5db 100644
--- a/apps/couch/src/couch_rep_att.erl
+++ b/apps/couch/src/couch_rep_att.erl
@@ -105,8 +105,7 @@ validate_headers(_Req, 200, Headers) ->
     MochiHeaders = mochiweb_headers:make(Headers),
     {ok, mochiweb_headers:get_value("Content-Encoding", MochiHeaders)};
 validate_headers(Req, Code, Headers) when Code > 299, Code < 400 ->
-    Url = couch_rep_httpc:redirect_url(Headers, Req#http_db.url),
-    NewReq = couch_rep_httpc:redirected_request(Req, Url),
+    NewReq = couch_rep_httpc:redirected_request(Code, Headers, Req),
     {ibrowse_req_id, ReqId} = couch_rep_httpc:request(NewReq),
     receive {ibrowse_async_headers, ReqId, NewCode, NewHeaders} ->
         {ok, Encoding} = validate_headers(NewReq, list_to_integer(NewCode),
diff --git a/apps/couch/src/couch_rep_changes_feed.erl b/apps/couch/src/couch_rep_changes_feed.erl
index 032f62a3..36fe82aa 100644
--- a/apps/couch/src/couch_rep_changes_feed.erl
+++ b/apps/couch/src/couch_rep_changes_feed.erl
@@ -18,6 +18,7 @@
 -export([start_link/4, next/1, stop/1]).
 
 -define(BUFFER_SIZE, 1000).
+-define(DOC_IDS_FILTER_NAME, "_doc_ids").
 
 -include("couch_db.hrl").
 -include_lib("ibrowse/include/ibrowse.hrl").
@@ -33,9 +34,15 @@
     count = 0,
     partial_chunk = <<>>,
     reply_to = nil,
-    rows = queue:new()
+    rows = queue:new(),
+    doc_ids = nil
 }).
 
+-import(couch_util, [
+    get_value/2,
+    get_value/3
+]).
+
 start_link(Parent, Source, StartSeq, PostProps) ->
     gen_server:start_link(?MODULE, [Parent, Source, StartSeq, PostProps], []).
 
@@ -46,9 +53,9 @@ stop(Server) ->
     catch gen_server:call(Server, stop),
     ok.
 
-init([Parent, #http_db{}=Source, Since, PostProps]) ->
+init([Parent, #http_db{headers = Headers0} = Source, Since, PostProps]) ->
     process_flag(trap_exit, true),
-    Feed = case couch_util:get_value(<<"continuous">>, PostProps, false) of
+    Feed = case get_value(<<"continuous">>, PostProps, false) of
     false ->
         normal;
     true ->
@@ -60,51 +67,59 @@ init([Parent, #http_db{}=Source, Since, PostProps]) ->
         {"since", Since},
         {"feed", Feed}
     ],
-    QS = case couch_util:get_value(<<"filter">>, PostProps) of
+    {QS, Method, Body, Headers} = case get_value(<<"doc_ids">>, PostProps) of
     undefined ->
-        BaseQS;
-    FilterName ->
-        {Params} = couch_util:get_value(<<"query_params">>, PostProps, {[]}),
-        lists:foldr(
-            fun({K, V}, QSAcc) ->
-                Ks = couch_util:to_list(K),
-                case proplists:is_defined(Ks, QSAcc) of
-                true ->
-                    QSAcc;
-                false ->
-                    [{Ks, V} | QSAcc]
-                end
-            end,
-            [{"filter", FilterName} | BaseQS],
-            Params
-        )
+        {maybe_add_filter_qs_params(PostProps, BaseQS), get, nil, Headers0};
+    DocIds when is_list(DocIds) ->
+        Headers1 = [{"Content-Type", "application/json"} | Headers0],
+        QS1 = [{"filter", ?l2b(?DOC_IDS_FILTER_NAME)} | BaseQS],
+        {QS1, post, {[{<<"doc_ids">>, DocIds}]}, Headers1}
     end,
     Pid = couch_rep_httpc:spawn_link_worker_process(Source),
     Req = Source#http_db{
+        method = Method,
+        body = Body,
         resource = "_changes",
         qs = QS,
         conn = Pid,
         options = [{stream_to, {self(), once}}] ++
                 lists:keydelete(inactivity_timeout, 1, Source#http_db.options),
-        headers = Source#http_db.headers -- [{"Accept-Encoding", "gzip"}]
+        headers = Headers -- [{"Accept-Encoding", "gzip"}]
     },
     {ibrowse_req_id, ReqId} = couch_rep_httpc:request(Req),
     Args = [Parent, Req, Since, PostProps],
+    State = #state{
+        conn = Pid,
+        last_seq = Since,
+        reqid = ReqId,
+        init_args = Args,
+        doc_ids = get_value(<<"doc_ids">>, PostProps, nil)
+    },
 
     receive
     {ibrowse_async_headers, ReqId, "200", _} ->
         ibrowse:stream_next(ReqId),
-        {ok, #state{conn=Pid, last_seq=Since, reqid=ReqId, init_args=Args}};
-    {ibrowse_async_headers, ReqId, Code, Hdrs} when Code=="301"; Code=="302" ->
-        stop_link_worker(Pid),
-        Url2 = couch_rep_httpc:redirect_url(Hdrs, Req#http_db.url),
-        Req2 = couch_rep_httpc:redirected_request(Req, Url2),
-        Pid2 = couch_rep_httpc:spawn_link_worker_process(Req2),
-        Req3 = Req2#http_db{conn = Pid2},
-        {ibrowse_req_id, ReqId2} = couch_rep_httpc:request(Req3),
-        Args2 = [Parent, Req3, Since, PostProps],
-        receive {ibrowse_async_headers, ReqId2, "200", _} ->
-            {ok, #state{conn=Pid2, last_seq=Since, reqid=ReqId2, init_args=Args2}}
+        {ok, State};
+    {ibrowse_async_headers, ReqId, Code, Hdrs}
+            when Code =:= "301"; Code =:= "302"; Code =:= "303" ->
+        {ReqId2, Req2} = redirect_req(Req, Code, Hdrs),
+        receive
+        {ibrowse_async_headers, ReqId2, "200", _} ->
+            {ok, State#state{
+                conn = Req2#http_db.conn,
+                reqid = ReqId2,
+                init_args = [Parent, Req2, Since, PostProps]}};
+        {ibrowse_async_headers, ReqId2, "405", _} when Method =:= post ->
+            {ReqId3, Req3} = req_no_builtin_doc_ids(Req2, ReqId2),
+            receive
+            {ibrowse_async_headers, ReqId3, "200", _} ->
+                {ok, State#state{
+                    conn = Req3#http_db.conn,
+                    reqid = ReqId3,
+                    init_args = [Parent, Req3, Since, PostProps]}}
+            after 30000 ->
+                {stop, changes_timeout}
+            end
         after 30000 ->
             {stop, changes_timeout}
         end;
@@ -113,7 +128,30 @@ init([Parent, #http_db{}=Source, Since, PostProps]) ->
         ?LOG_INFO("source doesn't have _changes, trying _all_docs_by_seq", []),
         Self = self(),
         BySeqPid = spawn_link(fun() -> by_seq_loop(Self, Source, Since) end),
-        {ok, #state{last_seq=Since, changes_loop=BySeqPid, init_args=Args}};
+        {ok, State#state{changes_loop = BySeqPid}};
+    {ibrowse_async_headers, ReqId, "405", _}  when Method =:= post ->
+        {ReqId2, Req2} = req_no_builtin_doc_ids(Req, ReqId),
+        receive
+        {ibrowse_async_headers, ReqId2, "200", _} ->
+            {ok, State#state{
+                conn = Req2#http_db.conn,
+                reqid = ReqId2,
+                init_args = [Parent, Req2, Since, PostProps]}};
+        {ibrowse_async_headers, ReqId, Code, Hdrs}
+            when Code =:= "301"; Code =:= "302"; Code =:= "303" ->
+            {ReqId3, Req3} = redirect_req(Req2, Code, Hdrs),
+            receive
+            {ibrowse_async_headers, ReqId3, "200", _} ->
+                {ok, State#state{
+                    conn = Req3#http_db.conn,
+                    reqid = ReqId3,
+                    init_args = [Parent, Req3, Since, PostProps]}}
+            after 30000 ->
+                {stop, changes_timeout}
+            end
+        after 30000 ->
+            {stop, changes_timeout}
+        end;
     {ibrowse_async_headers, ReqId, Code, _} ->
         {stop, {changes_error_code, list_to_integer(Code)}}
     after 10000 ->
@@ -123,11 +161,17 @@ init([Parent, #http_db{}=Source, Since, PostProps]) ->
 init([_Parent, Source, Since, PostProps] = InitArgs) ->
     process_flag(trap_exit, true),
     Server = self(),
+    Filter = case get_value(<<"doc_ids">>, PostProps) of
+    undefined ->
+        ?b2l(get_value(<<"filter">>, PostProps, <<>>));
+    DocIds when is_list(DocIds) ->
+        ?DOC_IDS_FILTER_NAME
+    end,
     ChangesArgs = #changes_args{
         style = all_docs,
         since = Since,
-        filter = ?b2l(couch_util:get_value(<<"filter">>, PostProps, <<>>)),
-        feed = case couch_util:get_value(<<"continuous">>, PostProps, false) of
+        filter = Filter,
+        feed = case get_value(<<"continuous">>, PostProps, false) of
             true ->
                 "continuous";
             false ->
@@ -138,7 +182,7 @@ init([_Parent, Source, Since, PostProps] = InitArgs) ->
     ChangesPid = spawn_link(fun() ->
         ChangesFeedFun = couch_changes:handle_changes(
             ChangesArgs,
-            {json_req, filter_json_req(Source, PostProps)},
+            {json_req, filter_json_req(Filter, Source, PostProps)},
             Source
         ),
         ChangesFeedFun(fun({change, Change, _}, _) ->
@@ -149,29 +193,49 @@ init([_Parent, Source, Since, PostProps] = InitArgs) ->
     end),
     {ok, #state{changes_loop=ChangesPid, init_args=InitArgs}}.
 
-filter_json_req(Db, PostProps) ->
-    case couch_util:get_value(<<"filter">>, PostProps) of
+maybe_add_filter_qs_params(PostProps, BaseQS) ->
+    case get_value(<<"filter">>, PostProps) of
     undefined ->
-        {[]};
+        BaseQS;
     FilterName ->
-        {Query} = couch_util:get_value(<<"query_params">>, PostProps, {[]}),
-        {ok, Info} = couch_db:get_db_info(Db),
-        % simulate a request to db_name/_changes
-        {[
-            {<<"info">>, {Info}},
-            {<<"id">>, null},
-            {<<"method">>, 'GET'},
-            {<<"path">>, [couch_db:name(Db), <<"_changes">>]},
-            {<<"query">>, {[{<<"filter">>, FilterName} | Query]}},
-            {<<"headers">>, []},
-            {<<"body">>, []},
-            {<<"peer">>, <<"replicator">>},
-            {<<"form">>, []},
-            {<<"cookie">>, []},
-            {<<"userCtx">>, couch_util:json_user_ctx(Db)}
-       ]}
+        {Params} = get_value(<<"query_params">>, PostProps, {[]}),
+        lists:foldr(
+            fun({K, V}, QSAcc) ->
+                Ks = couch_util:to_list(K),
+                case proplists:is_defined(Ks, QSAcc) of
+                true ->
+                    QSAcc;
+                false ->
+                    [{Ks, V} | QSAcc]
+                end
+            end,
+            [{"filter", FilterName} | BaseQS],
+            Params
+        )
     end.
 
+filter_json_req([], _Db, _PostProps) ->
+    {[]};
+filter_json_req(?DOC_IDS_FILTER_NAME, _Db, PostProps) ->
+    {[{<<"doc_ids">>, get_value(<<"doc_ids">>, PostProps)}]};
+filter_json_req(FilterName, Db, PostProps) ->
+    {Query} = get_value(<<"query_params">>, PostProps, {[]}),
+    {ok, Info} = couch_db:get_db_info(Db),
+    % simulate a request to db_name/_changes
+    {[
+        {<<"info">>, {Info}},
+        {<<"id">>, null},
+        {<<"method">>, 'GET'},
+        {<<"path">>, [couch_db:name(Db), <<"_changes">>]},
+        {<<"query">>, {[{<<"filter">>, FilterName} | Query]}},
+        {<<"headers">>, []},
+        {<<"body">>, []},
+        {<<"peer">>, <<"replicator">>},
+        {<<"form">>, []},
+        {<<"cookie">>, []},
+        {<<"userCtx">>, couch_util:json_user_ctx(Db)}
+    ]}.
+
 handle_call({add_change, Row}, From, State) ->
     handle_add_change(Row, From, State);
 
@@ -191,6 +255,10 @@ handle_info({ibrowse_async_response, Id, {error, sel_conn_closed}},
         #state{reqid=Id}=State) ->
     handle_retry(State);
 
+handle_info({ibrowse_async_response, Id, {error, connection_closed}},
+        #state{reqid=Id}=State) ->
+    handle_retry(State);
+
 handle_info({ibrowse_async_response, Id, {error,E}}, #state{reqid=Id}=State) ->
     {stop, {error, E}, State};
 
@@ -240,12 +308,9 @@ code_change(_OldVsn, State, _Extra) ->
 %internal funs
 
 handle_add_change(Row, From, #state{reply_to=nil} = State) ->
-    #state{
-        count = Count,
-        rows = Rows
-    } = State,
-    NewState = State#state{count=Count+1, rows=queue:in(Row,Rows)},
-    if Count < ?BUFFER_SIZE ->
+    {Rows2, Count2} = queue_changes_row(Row, State),
+    NewState = State#state{count = Count2, rows = Rows2},
+    if Count2 =< ?BUFFER_SIZE ->
         {reply, ok, NewState};
     true ->
         {noreply, NewState#state{changes_from=From}}
@@ -274,11 +339,10 @@ handle_headers(200, _, State) ->
     maybe_stream_next(State),
     {noreply, State};
 handle_headers(Code, Hdrs, #state{init_args = InitArgs} = State)
-        when Code =:= 301 ; Code =:= 302 ->
+        when Code =:= 301 ; Code =:= 302 ; Code =:= 303 ->
     stop_link_worker(State#state.conn),
-    [Parent, #http_db{url = Url1} = Source, Since, PostProps] = InitArgs,
-    Url = couch_rep_httpc:redirect_url(Hdrs, Url1),
-    Source2 = couch_rep_httpc:redirected_request(Source, Url),
+    [Parent, Source, Since, PostProps] = InitArgs,
+    Source2 = couch_rep_httpc:redirected_request(Code, Hdrs, Source),
     Pid2 = couch_rep_httpc:spawn_link_worker_process(Source2),
     Source3 = Source2#http_db{conn = Pid2},
     {ibrowse_req_id, ReqId} = couch_rep_httpc:request(Source3),
@@ -298,21 +362,17 @@ handle_messages([<<"]">>, <<"\"last_seq\":", _/binary>>], State) ->
     handle_feed_completion(State);
 handle_messages([<<"{\"last_seq\":", _/binary>>], State) ->
     handle_feed_completion(State);
-handle_messages([Chunk|Rest], State) ->
-    #state{
-        count = Count,
-        partial_chunk = Partial,
-        rows = Rows
-    } = State,
+handle_messages([Chunk|Rest], #state{partial_chunk = Partial} = State) ->
     NewState = try
         Row = {Props} = decode_row(<<Partial/binary, Chunk/binary>>),
         case State of
         #state{reply_to=nil} ->
+            {Rows2, Count2} = queue_changes_row(Row, State),
             State#state{
-                count = Count+1,
                 last_seq = couch_util:get_value(<<"seq">>, Props),
                 partial_chunk = <<>>,
-                rows=queue:in(Row,Rows)
+                rows = Rows2,
+                count = Count2
             };
         #state{count=0, reply_to=From}->
             gen_server:reply(From, [Row]),
@@ -400,3 +460,44 @@ stop_link_worker(Conn) when is_pid(Conn) ->
     catch ibrowse:stop_worker_process(Conn);
 stop_link_worker(_) ->
     ok.
+
+redirect_req(#http_db{conn = WorkerPid} = Req, Code, Headers) ->
+    stop_link_worker(WorkerPid),
+    Req2 = couch_rep_httpc:redirected_request(Code, Headers, Req),
+    WorkerPid2 = couch_rep_httpc:spawn_link_worker_process(Req2),
+    Req3 = Req2#http_db{conn = WorkerPid2},
+    {ibrowse_req_id, ReqId} = couch_rep_httpc:request(Req3),
+    {ReqId, Req3}.
+
+req_no_builtin_doc_ids(#http_db{conn = WorkerPid, qs = QS} = Req, ReqId) ->
+    % CouchDB versions prior to 1.1.0 don't have the builtin filter _doc_ids
+    % and don't allow POSTing to /database/_changes
+    purge_req_messages(ReqId),
+    stop_link_worker(WorkerPid),
+    Req2 = Req#http_db{method = get, qs = lists:keydelete("filter", 1, QS)},
+    WorkerPid2 = couch_rep_httpc:spawn_link_worker_process(Req2),
+    Req3 = Req2#http_db{conn = WorkerPid2},
+    {ibrowse_req_id, ReqId2} = couch_rep_httpc:request(Req3),
+    {ReqId2, Req3}.
+
+purge_req_messages(ReqId) ->
+    ibrowse:stream_next(ReqId),
+    receive
+    {ibrowse_async_response, ReqId, {error, _}} ->
+        ok;
+    {ibrowse_async_response, ReqId, _Data} ->
+        purge_req_messages(ReqId);
+    {ibrowse_async_response_end, ReqId} ->
+        ok
+    end.
+
+queue_changes_row(Row, #state{doc_ids = nil, count = Count, rows = Rows}) ->
+    {queue:in(Row, Rows), Count + 1};
+queue_changes_row({RowProps} = Row,
+    #state{doc_ids = Ids, count = Count, rows = Rows}) ->
+    case lists:member(get_value(<<"id">>, RowProps), Ids) of
+    true ->
+        {queue:in(Row, Rows), Count + 1};
+    false ->
+        {Rows, Count}
+    end.
diff --git a/apps/couch/src/couch_rep_httpc.erl b/apps/couch/src/couch_rep_httpc.erl
index 8153fdcf..e22c8f81 100644
--- a/apps/couch/src/couch_rep_httpc.erl
+++ b/apps/couch/src/couch_rep_httpc.erl
@@ -14,8 +14,9 @@
 -include("couch_db.hrl").
 -include_lib("ibrowse/include/ibrowse.hrl").
 
--export([db_exists/1, db_exists/2, full_url/1, request/1, redirected_request/2,
-    redirect_url/2, spawn_worker_process/1, spawn_link_worker_process/1]).
+-export([db_exists/1, db_exists/2]).
+-export([full_url/1, request/1, redirected_request/3]).
+-export([spawn_worker_process/1, spawn_link_worker_process/1]).
 -export([ssl_options/1]).
 
 request(#http_db{} = Req) ->
@@ -100,6 +101,9 @@ db_exists(Req, CanonicalUrl, CreateDB) ->
     {ok, "302", RespHeaders, _} ->
         RedirectUrl = redirect_url(RespHeaders, Req#http_db.url),
         db_exists(Req#http_db{url = RedirectUrl}, CanonicalUrl);
+    {ok, "303", RespHeaders, _} ->
+        RedirectUrl = redirect_url(RespHeaders, Req#http_db.url),
+        db_exists(Req#http_db{method = get, url = RedirectUrl}, CanonicalUrl);
     {ok, "401", _, _} ->
         throw({unauthorized, ?l2b(Url)});
     Error ->
@@ -123,15 +127,24 @@ config_http(Url) ->
 redirect_url(RespHeaders, OrigUrl) ->
     MochiHeaders = mochiweb_headers:make(RespHeaders),
     RedUrl = mochiweb_headers:get_value("Location", MochiHeaders),
-    {url, _, Base, Port, _, _, Path, Proto} = ibrowse_lib:parse_url(RedUrl),
-    {url, _, _, _, User, Passwd, _, _} = ibrowse_lib:parse_url(OrigUrl),
+    #url{
+        host = Host, host_type = HostType, port = Port,
+        path = Path, protocol = Proto
+    } = ibrowse_lib:parse_url(RedUrl),
+    #url{username = User, password = Passwd} = ibrowse_lib:parse_url(OrigUrl),
     Creds = case is_list(User) andalso is_list(Passwd) of
     true ->
         User ++ ":" ++ Passwd ++ "@";
     false ->
         []
     end,
-    atom_to_list(Proto) ++ "://" ++ Creds ++ Base ++ ":" ++
+    HostPart = case HostType of
+    ipv6_address ->
+        "[" ++ Host ++ "]";
+    _ ->
+        Host
+    end,
+    atom_to_list(Proto) ++ "://" ++ Creds ++ HostPart ++ ":" ++
         integer_to_list(Port) ++ Path.
 
 full_url(#http_db{url=Url} = Req) when is_binary(Url) ->
@@ -154,9 +167,8 @@ process_response({ok, Status, Headers, Body}, Req) ->
     Code = list_to_integer(Status),
     if Code =:= 200; Code =:= 201 ->
         ?JSON_DECODE(maybe_decompress(Headers, Body));
-    Code =:= 301; Code =:= 302 ->
-        RedirectUrl = redirect_url(Headers, Req#http_db.url),
-        do_request(redirected_request(Req, RedirectUrl));
+    Code =:= 301; Code =:= 302 ; Code =:= 303 ->
+        do_request(redirected_request(Code, Headers, Req));
     Code =:= 409 ->
         throw(conflict);
     Code >= 400, Code < 500 ->
@@ -205,16 +217,26 @@ process_response({error, Reason}, Req) ->
         do_request(Req#http_db{retries = Retries-1, pause = 2*Pause})
     end.
 
-redirected_request(Req, RedirectUrl) ->
+redirected_request(Code, Headers, Req) ->
+    RedirectUrl = redirect_url(Headers, Req#http_db.url),
     {Base, QStr, _} = mochiweb_util:urlsplit_path(RedirectUrl),
     QS = mochiweb_util:parse_qs(QStr),
-    Hdrs = case couch_util:get_value(<<"oauth">>, Req#http_db.auth) of
+    ReqHeaders = case couch_util:get_value(<<"oauth">>, Req#http_db.auth) of
     undefined ->
         Req#http_db.headers;
     _Else ->
         lists:keydelete("Authorization", 1, Req#http_db.headers)
     end,
-    Req#http_db{url=Base, resource="", qs=QS, headers=Hdrs}.
+    Req#http_db{
+        method = case couch_util:to_integer(Code) of
+            303 -> get;
+            _ -> Req#http_db.method
+            end,
+        url = Base,
+        resource = "",
+        qs = QS,
+        headers = ReqHeaders
+    }.
 
 spawn_worker_process(Req) ->
     Url = ibrowse_lib:parse_url(Req#http_db.url),
diff --git a/apps/couch/src/couch_rep_reader.erl b/apps/couch/src/couch_rep_reader.erl
index a7ae45a8..0d344e5c 100644
--- a/apps/couch/src/couch_rep_reader.erl
+++ b/apps/couch/src/couch_rep_reader.erl
@@ -17,7 +17,7 @@
 
 -export([start_link/4, next/1]).
 
--import(couch_util, [url_encode/1]).
+-import(couch_util, [encode_doc_id/1]).
 
 -define (BUFFER_SIZE, 1000).
 -define (MAX_CONCURRENT_REQUESTS, 100).
@@ -40,26 +40,17 @@
     opened_seqs = []
 }).
 
-start_link(Parent, Source, MissingRevs_or_DocIds, PostProps) ->
-    gen_server:start_link(
-        ?MODULE, [Parent, Source, MissingRevs_or_DocIds, PostProps], []
-    ).
+start_link(Parent, Source, MissingRevs, PostProps) ->
+    gen_server:start_link(?MODULE, [Parent, Source, MissingRevs, PostProps], []).
 
 next(Pid) ->
     gen_server:call(Pid, next_docs, infinity).
 
-init([Parent, Source, MissingRevs_or_DocIds, _PostProps]) ->
+init([Parent, Source, MissingRevs, _PostProps]) ->
     process_flag(trap_exit, true),
     Self = self(),
     ReaderLoop = spawn_link(
-        fun() -> reader_loop(Self, Parent, Source, MissingRevs_or_DocIds) end
-    ),
-    MissingRevs = case MissingRevs_or_DocIds of
-    Pid when is_pid(Pid) ->
-        Pid;
-    _ListDocIds ->
-        nil
-    end,
+        fun() -> reader_loop(Self, Parent, Source, MissingRevs) end),
     State = #state{
         parent = Parent,
         source = Source,
@@ -175,8 +166,6 @@ handle_reader_loop_complete(#state{monitor_count=0} = State) ->
 handle_reader_loop_complete(State) ->
     {noreply, State#state{complete = waiting_on_monitors}}.
 
-calculate_new_high_seq(#state{missing_revs=nil}) ->
-    nil;
 calculate_new_high_seq(#state{requested_seqs=[], opened_seqs=[Open|_]}) ->
     Open;
 calculate_new_high_seq(#state{requested_seqs=[Req|_], opened_seqs=[Open|_]})
@@ -188,9 +177,9 @@ calculate_new_high_seq(State) ->
     hd(State#state.opened_seqs).
 
 split_revlist(Rev, {[CurrentAcc|Rest], BaseLength, Length}) ->
-    case Length+size(Rev) > 8192 of
+    case Length+size(Rev)+3 > 8192 of
     false ->
-        {[[Rev|CurrentAcc] | Rest], BaseLength, Length+size(Rev)};
+        {[[Rev|CurrentAcc] | Rest], BaseLength, Length+size(Rev)+3};
     true ->
         {[[Rev],CurrentAcc|Rest], BaseLength, BaseLength}
     end.
@@ -201,8 +190,6 @@ split_revlist(Rev, {[CurrentAcc|Rest], BaseLength, Length}) ->
 % opened seqs greater than the smallest outstanding request.  I believe its the
 % minimal set of info needed to correctly calculate which seqs have been
 % replicated (because remote docs can be opened out-of-order) -- APK
-update_sequence_lists(_Seq, #state{missing_revs=nil} = State) ->
-    State;
 update_sequence_lists(Seq, State) ->
     Requested = lists:delete(Seq, State#state.requested_seqs),
     AllOpened = lists:merge([Seq], State#state.opened_seqs),
@@ -226,8 +213,8 @@ open_doc_revs(#http_db{url = Url} = DbS, DocId, Revs) ->
     %% all this logic just splits up revision lists that are too long for
     %% MochiWeb into multiple requests
     BaseQS = [{revs,true}, {latest,true}, {att_encoding_info,true}],
-    BaseReq = DbS#http_db{resource=url_encode(DocId), qs=BaseQS},
-    BaseLength = length(couch_rep_httpc:full_url(BaseReq)) + 11, % &open_revs=
+    BaseReq = DbS#http_db{resource=encode_doc_id(DocId), qs=BaseQS},
+    BaseLength = length(couch_rep_httpc:full_url(BaseReq) ++ "&open_revs=[]"),
 
     {RevLists, _, _} = lists:foldl(fun split_revlist/2,
         {[[]], BaseLength, BaseLength}, couch_doc:revs_to_strs(Revs)),
@@ -253,45 +240,6 @@ open_doc_revs(#http_db{url = Url} = DbS, DocId, Revs) ->
     end,
     lists:reverse(lists:foldl(Transform, [], JsonResults)).
 
-open_doc(#http_db{url = Url} = DbS, DocId) ->
-    % get latest rev of the doc
-    Req = DbS#http_db{
-        resource=url_encode(DocId),
-        qs=[{att_encoding_info, true}]
-    },
-    {Props} = Json = couch_rep_httpc:request(Req),
-    case couch_util:get_value(<<"_id">>, Props) of
-    Id when is_binary(Id) ->
-        #doc{id=Id, revs=Rev, atts=Atts} = Doc = couch_doc:from_json_obj(Json),
-        [Doc#doc{
-            atts=[couch_rep_att:convert_stub(A, {DbS,Id,Rev}) || A <- Atts]
-        }];
-    undefined ->
-        Err = couch_util:get_value(<<"error">>, Props, ?JSON_ENCODE(Json)),
-        ?LOG_ERROR("Replicator: error accessing doc ~s at ~s, reason: ~s",
-            [DocId, couch_util:url_strip_password(Url), Err]),
-        []
-    end.
-
-reader_loop(ReaderServer, Parent, Source1, DocIds) when is_list(DocIds) ->
-    case Source1 of
-    #http_db{} ->
-        [gen_server:call(ReaderServer, {open_remote_doc, Id, nil, nil},
-            infinity) || Id <- DocIds];
-    _LocalDb ->
-        {ok, Source} = gen_server:call(Parent, get_source_db, infinity),
-        Docs = lists:foldr(fun(Id, Acc) ->
-            case couch_db:open_doc(Source, Id) of
-            {ok, Doc} ->
-                [Doc | Acc];
-            _ ->
-                Acc
-            end
-        end, [], DocIds),
-        gen_server:call(ReaderServer, {add_docs, nil, Docs}, infinity)
-    end,
-    exit(complete);
-    
 reader_loop(ReaderServer, Parent, Source, MissingRevsServer) ->
     case couch_rep_missing_revs:next(MissingRevsServer) of
     complete ->
@@ -326,8 +274,6 @@ maybe_reopen_db(#db{update_seq=OldSeq} = Db, HighSeq) when HighSeq > OldSeq ->
 maybe_reopen_db(Db, _HighSeq) ->
     Db.
 
-spawn_document_request(Source, Id, nil, nil) ->
-    spawn_document_request(Source, Id);
 spawn_document_request(Source, Id, Seq, Revs) ->
     Server = self(),
     SpawnFun = fun() ->
@@ -335,11 +281,3 @@ spawn_document_request(Source, Id, Seq, Revs) ->
         gen_server:call(Server, {add_docs, Seq, Results}, infinity)
     end,
     spawn_monitor(SpawnFun).
-
-spawn_document_request(Source, Id) ->
-    Server = self(),
-    SpawnFun = fun() ->
-        Results = open_doc(Source, Id),
-        gen_server:call(Server, {add_docs, nil, Results}, infinity)
-    end,
-    spawn_monitor(SpawnFun).
diff --git a/apps/couch/src/couch_rep_writer.erl b/apps/couch/src/couch_rep_writer.erl
index cf98ccfb..2b722e8e 100644
--- a/apps/couch/src/couch_rep_writer.erl
+++ b/apps/couch/src/couch_rep_writer.erl
@@ -21,8 +21,6 @@ start_link(Parent, _Target, Reader, _PostProps) ->
 
 writer_loop(Parent, Reader) ->
     case couch_rep_reader:next(Reader) of
-    {complete, nil} ->
-        ok;
     {complete, FinalSeq} ->
         Parent ! {writer_checkpoint, FinalSeq},
         ok;
@@ -41,12 +39,7 @@ writer_loop(Parent, Reader) ->
             ?LOG_DEBUG("writer failed to write an attachment ~p", [Err]),
             exit({attachment_request_failed, Err, Docs})
         end,
-        case HighSeq of
-        nil ->
-            ok;
-        _SeqNumber ->
-            Parent ! {writer_checkpoint, HighSeq}
-        end,
+        Parent ! {writer_checkpoint, HighSeq},
         couch_rep_att:cleanup(),
         couch_util:should_flush(),
         writer_loop(Parent, Reader)
@@ -71,7 +64,7 @@ write_bulk_docs(_Db, []) ->
     [];
 write_bulk_docs(#http_db{headers = Headers} = Db, Docs) ->
     JsonDocs = [
-        couch_doc:to_json_obj(Doc, [revs, att_gzip_length]) || Doc <- Docs
+        couch_doc:to_json_obj(Doc, [revs]) || Doc <- Docs
     ],
     Request = Db#http_db{
         resource = "_bulk_docs",
@@ -91,7 +84,7 @@ write_multi_part_doc(#http_db{headers=Headers} = Db, #doc{atts=Atts} = Doc) ->
     JsonBytes = ?JSON_ENCODE(
         couch_doc:to_json_obj(
             Doc,
-            [follows, att_encoding_info, attachments]
+            [follows, att_encoding_info, attachments, revs]
         )
     ),
     Boundary = couch_uuids:random(),
@@ -120,7 +113,7 @@ write_multi_part_doc(#http_db{headers=Headers} = Db, #doc{atts=Atts} = Doc) ->
         end
     end,
     Request = Db#http_db{
-        resource = couch_util:url_encode(Doc#doc.id),
+        resource = couch_util:encode_doc_id(Doc),
         method = put,
         qs = [{new_edits, false}],
         body = {BodyFun, nil},
@@ -148,7 +141,8 @@ streamer_fun(Boundary, JsonBytes, Atts) ->
     {start, From} ->
         % better use a brand new queue, to ensure there's no garbage from
         % a previous (failed) iteration
-        {ok, DataQueue} = couch_work_queue:new(1024 * 1024, 1000),
+        {ok, DataQueue} = couch_work_queue:new(
+            [{max_size, 1024 * 1024}, {max_items, 1000}]),
         From ! {queue, DataQueue},
         couch_doc:doc_to_multi_part_stream(
             Boundary,
diff --git a/apps/couch/src/couch_replication_manager.erl b/apps/couch/src/couch_replication_manager.erl
new file mode 100644
index 00000000..3f7cc27c
--- /dev/null
+++ b/apps/couch/src/couch_replication_manager.erl
@@ -0,0 +1,629 @@
+% Licensed under the Apache License, Version 2.0 (the "License"); you may not
+% use this file except in compliance with the License. You may obtain a copy of
+% the License at
+%
+%   http://www.apache.org/licenses/LICENSE-2.0
+%
+% Unless required by applicable law or agreed to in writing, software
+% distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
+% WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
+% License for the specific language governing permissions and limitations under
+% the License.
+
+-module(couch_replication_manager).
+-behaviour(gen_server).
+
+% public API
+-export([replication_started/1, replication_completed/1, replication_error/2]).
+
+% gen_server callbacks
+-export([start_link/0, init/1, handle_call/3, handle_info/2, handle_cast/2]).
+-export([code_change/3, terminate/2]).
+
+-include("couch_db.hrl").
+-include("couch_js_functions.hrl").
+
+-define(DOC_TO_REP, couch_rep_doc_id_to_rep_id).
+-define(REP_TO_STATE, couch_rep_id_to_rep_state).
+-define(INITIAL_WAIT, 2.5). % seconds
+-define(MAX_WAIT, 600).     % seconds
+
+-record(state, {
+    changes_feed_loop = nil,
+    db_notifier = nil,
+    rep_db_name = nil,
+    rep_start_pids = [],
+    max_retries
+}).
+
+-record(rep_state, {
+    doc_id,
+    user_ctx,
+    doc,
+    starting,
+    retries_left,
+    max_retries,
+    wait = ?INITIAL_WAIT
+}).
+
+-import(couch_util, [
+    get_value/2,
+    get_value/3,
+    to_binary/1
+]).
+
+
+start_link() ->
+    gen_server:start_link({local, ?MODULE}, ?MODULE, [], []).
+
+
+replication_started({BaseId, _} = RepId) ->
+    case rep_state(RepId) of
+    nil ->
+        ok;
+    #rep_state{doc_id = DocId} ->
+        update_rep_doc(DocId, [
+            {<<"_replication_state">>, <<"triggered">>},
+            {<<"_replication_id">>, ?l2b(BaseId)}]),
+        ok = gen_server:call(?MODULE, {rep_started, RepId}, infinity),
+        ?LOG_INFO("Document `~s` triggered replication `~s`",
+            [DocId, pp_rep_id(RepId)])
+    end.
+
+
+replication_completed(RepId) ->
+    case rep_state(RepId) of
+    nil ->
+        ok;
+    #rep_state{doc_id = DocId} ->
+        update_rep_doc(DocId, [{<<"_replication_state">>, <<"completed">>}]),
+        ok = gen_server:call(?MODULE, {rep_complete, RepId}, infinity),
+        ?LOG_INFO("Replication `~s` finished (triggered by document `~s`)",
+            [pp_rep_id(RepId), DocId])
+    end.
+
+
+replication_error({BaseId, _} = RepId, Error) ->
+    case rep_state(RepId) of
+    nil ->
+        ok;
+    #rep_state{doc_id = DocId} ->
+        % TODO: maybe add error reason to replication document
+        update_rep_doc(DocId, [
+            {<<"_replication_state">>, <<"error">>},
+            {<<"_replication_id">>, ?l2b(BaseId)}]),
+        ok = gen_server:call(?MODULE, {rep_error, RepId, Error}, infinity)
+    end.
+
+
+init(_) ->
+    process_flag(trap_exit, true),
+    ?DOC_TO_REP = ets:new(?DOC_TO_REP, [named_table, set, protected]),
+    ?REP_TO_STATE = ets:new(?REP_TO_STATE, [named_table, set, protected]),
+    Server = self(),
+    ok = couch_config:register(
+        fun("replicator", "db", NewName) ->
+            ok = gen_server:cast(Server, {rep_db_changed, ?l2b(NewName)});
+        ("replicator", "max_replication_retry_count", V) ->
+            ok = gen_server:cast(Server, {set_max_retries, retries_value(V)})
+        end
+    ),
+    {Loop, RepDbName} = changes_feed_loop(),
+    {ok, #state{
+        changes_feed_loop = Loop,
+        rep_db_name = RepDbName,
+        db_notifier = db_update_notifier(),
+        max_retries = retries_value(
+            couch_config:get("replicator", "max_replication_retry_count", "10"))
+    }}.
+
+
+handle_call({rep_db_update, {ChangeProps} = Change}, _From, State) ->
+    NewState = try
+        process_update(State, Change)
+    catch
+    _Tag:Error ->
+        {RepProps} = get_value(doc, ChangeProps),
+        DocId = get_value(<<"_id">>, RepProps),
+        rep_db_update_error(Error, DocId),
+        State
+    end,
+    {reply, ok, NewState};
+
+handle_call({rep_started, RepId}, _From, State) ->
+    case rep_state(RepId) of
+    nil ->
+        ok;
+    RepState ->
+        NewRepState = RepState#rep_state{
+            starting = false,
+            retries_left = State#state.max_retries,
+            max_retries = State#state.max_retries,
+            wait = ?INITIAL_WAIT
+        },
+        true = ets:insert(?REP_TO_STATE, {RepId, NewRepState})
+    end,
+    {reply, ok, State};
+
+handle_call({rep_complete, RepId}, _From, State) ->
+    true = ets:delete(?REP_TO_STATE, RepId),
+    {reply, ok, State};
+
+handle_call({rep_error, RepId, Error}, _From, State) ->
+    {reply, ok, replication_error(State, RepId, Error)};
+
+handle_call(Msg, From, State) ->
+    ?LOG_ERROR("Replication manager received unexpected call ~p from ~p",
+        [Msg, From]),
+    {stop, {error, {unexpected_call, Msg}}, State}.
+
+
+handle_cast({rep_db_changed, NewName}, #state{rep_db_name = NewName} = State) ->
+    {noreply, State};
+
+handle_cast({rep_db_changed, _NewName}, State) ->
+    {noreply, restart(State)};
+
+handle_cast({rep_db_created, NewName}, #state{rep_db_name = NewName} = State) ->
+    {noreply, State};
+
+handle_cast({rep_db_created, _NewName}, State) ->
+    {noreply, restart(State)};
+
+handle_cast({set_max_retries, MaxRetries}, State) ->
+    {noreply, State#state{max_retries = MaxRetries}};
+
+handle_cast(Msg, State) ->
+    ?LOG_ERROR("Replication manager received unexpected cast ~p", [Msg]),
+    {stop, {error, {unexpected_cast, Msg}}, State}.
+
+
+handle_info({'EXIT', From, normal}, #state{changes_feed_loop = From} = State) ->
+    % replicator DB deleted
+    {noreply, State#state{changes_feed_loop = nil, rep_db_name = nil}};
+
+handle_info({'EXIT', From, Reason}, #state{db_notifier = From} = State) ->
+    ?LOG_ERROR("Database update notifier died. Reason: ~p", [Reason]),
+    {stop, {db_update_notifier_died, Reason}, State};
+
+handle_info({'EXIT', From, normal}, #state{rep_start_pids = Pids} = State) ->
+    % one of the replication start processes terminated successfully
+    {noreply, State#state{rep_start_pids = Pids -- [From]}};
+
+handle_info({'DOWN', _Ref, _, _, _}, State) ->
+    % From a db monitor created by a replication process. Ignore.
+    {noreply, State};
+
+handle_info(Msg, State) ->
+    ?LOG_ERROR("Replication manager received unexpected message ~p", [Msg]),
+    {stop, {unexpected_msg, Msg}, State}.
+
+
+terminate(_Reason, State) ->
+    #state{
+        rep_start_pids = StartPids,
+        changes_feed_loop = Loop,
+        db_notifier = Notifier
+    } = State,
+    stop_all_replications(),
+    lists:foreach(
+        fun(Pid) ->
+            catch unlink(Pid),
+            catch exit(Pid, stop)
+        end,
+        [Loop | StartPids]),
+    true = ets:delete(?REP_TO_STATE),
+    true = ets:delete(?DOC_TO_REP),
+    couch_db_update_notifier:stop(Notifier).
+
+
+code_change(_OldVsn, State, _Extra) ->
+    {ok, State}.
+
+
+changes_feed_loop() ->
+    {ok, RepDb} = ensure_rep_db_exists(),
+    Server = self(),
+    Pid = spawn_link(
+        fun() ->
+            ChangesFeedFun = couch_changes:handle_changes(
+                #changes_args{
+                    include_docs = true,
+                    feed = "continuous",
+                    timeout = infinity,
+                    db_open_options = [sys_db]
+                },
+                {json_req, null},
+                RepDb
+            ),
+            ChangesFeedFun(
+                fun({change, Change, _}, _) ->
+                    case has_valid_rep_id(Change) of
+                    true ->
+                        ok = gen_server:call(
+                            Server, {rep_db_update, Change}, infinity);
+                    false ->
+                        ok
+                    end;
+                (_, _) ->
+                    ok
+                end
+            )
+        end
+    ),
+    couch_db:close(RepDb),
+    {Pid, couch_db:name(RepDb)}.
+
+
+has_valid_rep_id({Change}) ->
+    has_valid_rep_id(get_value(<<"id">>, Change));
+has_valid_rep_id(<<?DESIGN_DOC_PREFIX, _Rest/binary>>) ->
+    false;
+has_valid_rep_id(_Else) ->
+    true.
+
+
+db_update_notifier() ->
+    Server = self(),
+    {ok, Notifier} = couch_db_update_notifier:start_link(
+        fun({created, DbName}) ->
+            case ?l2b(couch_config:get("replicator", "db", "_replicator")) of
+            DbName ->
+                ok = gen_server:cast(Server, {rep_db_created, DbName});
+            _ ->
+                ok
+            end;
+        (_) ->
+            % no need to handle the 'deleted' event - the changes feed loop
+            % dies when the database is deleted
+            ok
+        end
+    ),
+    Notifier.
+
+
+restart(#state{changes_feed_loop = Loop, rep_start_pids = StartPids} = State) ->
+    stop_all_replications(),
+    lists:foreach(
+        fun(Pid) ->
+            catch unlink(Pid),
+            catch exit(Pid, rep_db_changed)
+        end,
+        [Loop | StartPids]),
+    {NewLoop, NewRepDbName} = changes_feed_loop(),
+    State#state{
+        changes_feed_loop = NewLoop,
+        rep_db_name = NewRepDbName,
+        rep_start_pids = []
+    }.
+
+
+process_update(State, {Change}) ->
+    {RepProps} = JsonRepDoc = get_value(doc, Change),
+    DocId = get_value(<<"_id">>, RepProps),
+    case get_value(<<"deleted">>, Change, false) of
+    true ->
+        rep_doc_deleted(DocId),
+        State;
+    false ->
+        case get_value(<<"_replication_state">>, RepProps) of
+        undefined ->
+            maybe_start_replication(State, DocId, JsonRepDoc);
+        <<"triggered">> ->
+            maybe_start_replication(State, DocId, JsonRepDoc);
+        <<"completed">> ->
+            replication_complete(DocId),
+            State;
+        <<"error">> ->
+            case ets:lookup(?DOC_TO_REP, DocId) of
+            [] ->
+                maybe_start_replication(State, DocId, JsonRepDoc);
+            _ ->
+                State
+            end
+        end
+    end.
+
+
+rep_db_update_error(Error, DocId) ->
+    case Error of
+    {bad_rep_doc, Reason} ->
+        ok;
+    _ ->
+        Reason = to_binary(Error)
+    end,
+    ?LOG_ERROR("Replication manager, error processing document `~s`: ~s",
+        [DocId, Reason]),
+    update_rep_doc(DocId, [{<<"_replication_state">>, <<"error">>}]).
+
+
+rep_user_ctx({RepDoc}) ->
+    case get_value(<<"user_ctx">>, RepDoc) of
+    undefined ->
+        #user_ctx{};
+    {UserCtx} ->
+        #user_ctx{
+            name = get_value(<<"name">>, UserCtx, null),
+            roles = get_value(<<"roles">>, UserCtx, [])
+        }
+    end.
+
+
+maybe_start_replication(State, DocId, RepDoc) ->
+    UserCtx = rep_user_ctx(RepDoc),
+    {BaseId, _} = RepId = make_rep_id(RepDoc, UserCtx),
+    case rep_state(RepId) of
+    nil ->
+        RepState = #rep_state{
+            doc_id = DocId,
+            user_ctx = UserCtx,
+            doc = RepDoc,
+            starting = true,
+            retries_left = State#state.max_retries,
+            max_retries = State#state.max_retries
+        },
+        true = ets:insert(?REP_TO_STATE, {RepId, RepState}),
+        true = ets:insert(?DOC_TO_REP, {DocId, RepId}),
+        ?LOG_INFO("Attempting to start replication `~s` (document `~s`).",
+            [pp_rep_id(RepId), DocId]),
+        Server = self(),
+        Pid = spawn_link(fun() ->
+            start_replication(Server, RepDoc, RepId, UserCtx, 0)
+        end),
+        State#state{rep_start_pids = [Pid | State#state.rep_start_pids]};
+    #rep_state{doc_id = DocId} ->
+        State;
+    #rep_state{starting = false, doc_id = OtherDocId} ->
+        ?LOG_INFO("The replication specified by the document `~s` was already"
+            " triggered by the document `~s`", [DocId, OtherDocId]),
+        maybe_tag_rep_doc(DocId, RepDoc, ?l2b(BaseId)),
+        State;
+    #rep_state{starting = true, doc_id = OtherDocId} ->
+        ?LOG_INFO("The replication specified by the document `~s` is already"
+            " being triggered by the document `~s`", [DocId, OtherDocId]),
+        maybe_tag_rep_doc(DocId, RepDoc, ?l2b(BaseId)),
+        State
+    end.
+
+
+make_rep_id(RepDoc, UserCtx) ->
+    try
+        couch_rep:make_replication_id(RepDoc, UserCtx)
+    catch
+    throw:{error, Reason} ->
+        throw({bad_rep_doc, Reason});
+    Tag:Err ->
+        throw({bad_rep_doc, to_binary({Tag, Err})})
+    end.
+
+
+maybe_tag_rep_doc(DocId, {RepProps}, RepId) ->
+    case get_value(<<"_replication_id">>, RepProps) of
+    RepId ->
+        ok;
+    _ ->
+        update_rep_doc(DocId, [{<<"_replication_id">>, RepId}])
+    end.
+
+
+start_replication(Server, RepDoc, RepId, UserCtx, Wait) ->
+    ok = timer:sleep(Wait * 1000),
+    case (catch couch_rep:start_replication(RepDoc, RepId, UserCtx, ?MODULE)) of
+    Pid when is_pid(Pid) ->
+        ok = gen_server:call(Server, {rep_started, RepId}, infinity),
+        couch_rep:get_result(Pid, RepId, RepDoc, UserCtx);
+    Error ->
+        replication_error(RepId, Error)
+    end.
+
+
+replication_complete(DocId) ->
+    case ets:lookup(?DOC_TO_REP, DocId) of
+    [{DocId, RepId}] ->
+        case rep_state(RepId) of
+        nil ->
+            couch_rep:end_replication(RepId);
+        #rep_state{} ->
+            ok
+        end,
+        true = ets:delete(?DOC_TO_REP, DocId);
+    _ ->
+        ok
+    end.
+
+
+rep_doc_deleted(DocId) ->
+    case ets:lookup(?DOC_TO_REP, DocId) of
+    [{DocId, RepId}] ->
+        couch_rep:end_replication(RepId),
+        true = ets:delete(?REP_TO_STATE, RepId),
+        true = ets:delete(?DOC_TO_REP, DocId),
+        ?LOG_INFO("Stopped replication `~s` because replication document `~s`"
+            " was deleted", [pp_rep_id(RepId), DocId]);
+    [] ->
+        ok
+    end.
+
+
+replication_error(State, RepId, Error) ->
+    case rep_state(RepId) of
+    nil ->
+        State;
+    RepState ->
+        maybe_retry_replication(RepId, RepState, Error, State)
+    end.
+
+maybe_retry_replication(RepId, #rep_state{retries_left = 0} = RepState, Error, State) ->
+    #rep_state{
+        doc_id = DocId,
+        max_retries = MaxRetries
+    } = RepState,
+    couch_rep:end_replication(RepId),
+    true = ets:delete(?REP_TO_STATE, RepId),
+    true = ets:delete(?DOC_TO_REP, DocId),
+    ?LOG_ERROR("Error in replication `~s` (triggered by document `~s`): ~s"
+        "~nReached maximum retry attempts (~p).",
+        [pp_rep_id(RepId), DocId, to_binary(error_reason(Error)), MaxRetries]),
+    State;
+
+maybe_retry_replication(RepId, RepState, Error, State) ->
+    #rep_state{
+        doc_id = DocId,
+        user_ctx = UserCtx,
+        doc = RepDoc
+    } = RepState,
+    #rep_state{wait = Wait} = NewRepState = state_after_error(RepState),
+    true = ets:insert(?REP_TO_STATE, {RepId, NewRepState}),
+    ?LOG_ERROR("Error in replication `~s` (triggered by document `~s`): ~s"
+        "~nRestarting replication in ~p seconds.",
+        [pp_rep_id(RepId), DocId, to_binary(error_reason(Error)), Wait]),
+    Server = self(),
+    Pid = spawn_link(fun() ->
+        start_replication(Server, RepDoc, RepId, UserCtx, Wait)
+    end),
+    State#state{rep_start_pids = [Pid | State#state.rep_start_pids]}.
+
+
+stop_all_replications() ->
+    ?LOG_INFO("Stopping all ongoing replications because the replicator"
+        " database was deleted or changed", []),
+    ets:foldl(
+        fun({_, RepId}, _) ->
+            couch_rep:end_replication(RepId)
+        end,
+        ok, ?DOC_TO_REP),
+    true = ets:delete_all_objects(?REP_TO_STATE),
+    true = ets:delete_all_objects(?DOC_TO_REP).
+
+
+update_rep_doc(RepDocId, KVs) ->
+    {ok, RepDb} = ensure_rep_db_exists(),
+    try
+        case couch_db:open_doc(RepDb, RepDocId, []) of
+        {ok, LatestRepDoc} ->
+            update_rep_doc(RepDb, LatestRepDoc, KVs);
+        _ ->
+            ok
+        end
+    catch throw:conflict ->
+        % Shouldn't happen, as by default only the role _replicator can
+        % update replication documents.
+        ?LOG_ERROR("Conflict error when updating replication document `~s`."
+            " Retrying.", [RepDocId]),
+        ok = timer:sleep(5),
+        update_rep_doc(RepDocId, KVs)
+    after
+        couch_db:close(RepDb)
+    end.
+
+update_rep_doc(RepDb, #doc{body = {RepDocBody}} = RepDoc, KVs) ->
+    NewRepDocBody = lists:foldl(
+        fun({<<"_replication_state">> = K, State} = KV, Body) ->
+                case get_value(K, Body) of
+                State ->
+                    Body;
+                _ ->
+                    Body1 = lists:keystore(K, 1, Body, KV),
+                    lists:keystore(
+                        <<"_replication_state_time">>, 1, Body1,
+                        {<<"_replication_state_time">>, timestamp()})
+                end;
+            ({K, _V} = KV, Body) ->
+                lists:keystore(K, 1, Body, KV)
+        end,
+        RepDocBody, KVs),
+    case NewRepDocBody of
+    RepDocBody ->
+        ok;
+    _ ->
+        % Might not succeed - when the replication doc is deleted right
+        % before this update (not an error, ignore).
+        couch_db:update_doc(RepDb, RepDoc#doc{body = {NewRepDocBody}}, [])
+    end.
+
+
+% RFC3339 timestamps.
+% Note: doesn't include the time seconds fraction (RFC3339 says it's optional).
+timestamp() ->
+    {{Year, Month, Day}, {Hour, Min, Sec}} = calendar:now_to_local_time(now()),
+    UTime = erlang:universaltime(),
+    LocalTime = calendar:universal_time_to_local_time(UTime),
+    DiffSecs = calendar:datetime_to_gregorian_seconds(LocalTime) -
+        calendar:datetime_to_gregorian_seconds(UTime),
+    zone(DiffSecs div 3600, (DiffSecs rem 3600) div 60),
+    iolist_to_binary(
+        io_lib:format("~4..0w-~2..0w-~2..0wT~2..0w:~2..0w:~2..0w~s",
+            [Year, Month, Day, Hour, Min, Sec,
+                zone(DiffSecs div 3600, (DiffSecs rem 3600) div 60)])).
+
+zone(Hr, Min) when Hr >= 0, Min >= 0 ->
+    io_lib:format("+~2..0w:~2..0w", [Hr, Min]);
+zone(Hr, Min) ->
+    io_lib:format("-~2..0w:~2..0w", [abs(Hr), abs(Min)]).
+
+
+ensure_rep_db_exists() ->
+    DbName = ?l2b(couch_config:get("replicator", "db", "_replicator")),
+    Opts = [
+        {user_ctx, #user_ctx{roles=[<<"_admin">>, <<"_replicator">>]}},
+        sys_db
+    ],
+    case couch_db:open(DbName, Opts) of
+    {ok, Db} ->
+        Db;
+    _Error ->
+        {ok, Db} = couch_db:create(DbName, Opts)
+    end,
+    ok = ensure_rep_ddoc_exists(Db, <<"_design/_replicator">>),
+    {ok, Db}.
+
+
+ensure_rep_ddoc_exists(RepDb, DDocID) ->
+    case couch_db:open_doc(RepDb, DDocID, []) of
+    {ok, _Doc} ->
+        ok;
+    _ ->
+        DDoc = couch_doc:from_json_obj({[
+            {<<"_id">>, DDocID},
+            {<<"language">>, <<"javascript">>},
+            {<<"validate_doc_update">>, ?REP_DB_DOC_VALIDATE_FUN}
+        ]}),
+        {ok, _Rev} = couch_db:update_doc(RepDb, DDoc, [])
+    end,
+    ok.
+
+
+% pretty-print replication id
+pp_rep_id({Base, Extension}) ->
+    Base ++ Extension.
+
+
+rep_state(RepId) ->
+    case ets:lookup(?REP_TO_STATE, RepId) of
+    [{RepId, RepState}] ->
+        RepState;
+    [] ->
+        nil
+    end.
+
+
+error_reason({error, Reason}) ->
+    Reason;
+error_reason(Reason) ->
+    Reason.
+
+
+retries_value("infinity") ->
+    infinity;
+retries_value(Value) ->
+    list_to_integer(Value).
+
+
+state_after_error(#rep_state{retries_left = Left, wait = Wait} = State) ->
+    Wait2 = erlang:min(trunc(Wait * 2), ?MAX_WAIT),
+    case Left of
+    infinity ->
+        State#rep_state{wait = Wait2};
+    _ ->
+        State#rep_state{retries_left = Left - 1, wait = Wait2}
+    end.
diff --git a/apps/couch/src/couch_server.erl b/apps/couch/src/couch_server.erl
index 4252a035..cfe0b5fc 100644
--- a/apps/couch/src/couch_server.erl
+++ b/apps/couch/src/couch_server.erl
@@ -80,6 +80,7 @@ check_dbname(#server{dbname_regexp=RegExp}, DbName) ->
     nomatch ->
         case DbName of
             "_users" -> ok;
+            "_replicator" -> ok;
             _Else ->
                 {error, illegal_database_name}
             end;
@@ -173,7 +174,7 @@ all_databases(Prefix) ->
             end,
             [list_to_binary(filename:rootname(RelativeFilename, ".couch")) | AccIn]
         end, []),
-    {ok, Filenames}.
+    {ok, lists:usort(Filenames)}.
 
 
 maybe_close_lru_db(#server{dbs_open=NumOpen, max_dbs_open=MaxOpen}=Server)
diff --git a/apps/couch/src/couch_server_sup.erl b/apps/couch/src/couch_server_sup.erl
index 6f6ca61a..726e397f 100644
--- a/apps/couch/src/couch_server_sup.erl
+++ b/apps/couch/src/couch_server_sup.erl
@@ -104,16 +104,23 @@ start_server(IniFiles) ->
     unlink(ConfigPid),
 
     Ip = couch_config:get("httpd", "bind_address"),
-    Port = mochiweb_socket_server:get(couch_httpd, port),
     io:format("Apache CouchDB has started. Time to relax.~n"),
-
-    ?LOG_INFO("Apache CouchDB has started on http://~s:~w/", [Ip, Port]),
-    
+    Uris = [get_uri(Name, Ip) || Name <- [couch_httpd, https]],
+    [begin
+        case Uri of
+            undefined -> ok;
+            Uri -> ?LOG_INFO("Apache CouchDB has started on ~s", [Uri])
+        end
+    end
+    || Uri <- Uris],
     case couch_config:get("couchdb", "uri_file", null) of 
     null -> ok;
     UriFile ->
-        Line = io_lib:format("http://~s:~w/~n", [Ip, Port]),
-        file:write_file(UriFile, Line)
+        Lines = [begin case Uri of
+            undefined -> [];
+            Uri -> io_lib:format("~s~n", [Uri])
+            end end || Uri <- Uris],
+        ok = file:write_file(UriFile, Lines)
     end,
 
     {ok, Pid}.
@@ -127,3 +134,22 @@ config_change("couchdb", "util_driver_dir") ->
 
 init(ChildSpecs) ->
     {ok, ChildSpecs}.
+
+get_uri(Name, Ip) ->
+    case get_port(Name) of
+        undefined ->
+            undefined;
+        Port ->
+            io_lib:format("~s://~s:~w/", [get_scheme(Name), Ip, Port])
+    end.
+
+get_scheme(couch_httpd) -> "http";
+get_scheme(https) -> "https".
+
+get_port(Name) ->
+    try
+        mochiweb_socket_server:get(Name, port)
+    catch
+        exit:{noproc, _}->
+            undefined
+    end.
diff --git a/apps/couch/src/couch_stream.erl b/apps/couch/src/couch_stream.erl
index 04c17770..60af1c2b 100644
--- a/apps/couch/src/couch_stream.erl
+++ b/apps/couch/src/couch_stream.erl
@@ -24,7 +24,7 @@
 
 -define(DEFAULT_STREAM_CHUNK, 16#00100000). % 1 meg chunks when streaming data
 
--export([open/1, open/3, close/1, write/2, foldl/4, foldl/5, foldl_decode/6,
+-export([open/1, open/3, close/1, write/2, foldl/4, foldl/5, range_foldl/6, foldl_decode/6,
         old_foldl/5,old_copy_to_new_stream/4]).
 -export([copy_to_new_stream/3,old_read_term/2]).
 -export([init/1, terminate/2, handle_call/3]).
@@ -112,22 +112,60 @@ foldl_decode(Fd, PosList, Md5, Enc, Fun, Acc) ->
 foldl(_Fd, [], Md5, Md5Acc, _Fun, Acc) ->
     Md5 = couch_util:md5_final(Md5Acc),
     Acc;
+foldl(Fd, [{Pos, _Size}], Md5, Md5Acc, Fun, Acc) -> % 0110 UPGRADE CODE
+    foldl(Fd, [Pos], Md5, Md5Acc, Fun, Acc);
 foldl(Fd, [Pos], Md5, Md5Acc, Fun, Acc) ->
     {ok, Bin} = couch_file:pread_iolist(Fd, Pos),
     Md5 = couch_util:md5_final(couch_util:md5_update(Md5Acc, Bin)),
     Fun(Bin, Acc);
+foldl(Fd, [{Pos, _Size}|Rest], Md5, Md5Acc, Fun, Acc) ->
+    foldl(Fd, [Pos|Rest], Md5, Md5Acc, Fun, Acc);
 foldl(Fd, [Pos|Rest], Md5, Md5Acc, Fun, Acc) ->
     {ok, Bin} = couch_file:pread_iolist(Fd, Pos),
     foldl(Fd, Rest, Md5, couch_util:md5_update(Md5Acc, Bin), Fun, Fun(Bin, Acc)).
 
+range_foldl(Fd, PosList, From, To, Fun, Acc) ->
+    range_foldl(Fd, PosList, From, To, 0, Fun, Acc).
+
+range_foldl(_Fd, _PosList, _From, To, Off, _Fun, Acc) when Off >= To ->
+    Acc;
+range_foldl(Fd, [Pos|Rest], From, To, Off, Fun, Acc) when is_integer(Pos) -> % old-style attachment
+    {ok, Bin} = couch_file:pread_iolist(Fd, Pos),
+    range_foldl(Fd, [{Pos, iolist_size(Bin)}] ++ Rest, From, To, Off, Fun, Acc);
+range_foldl(Fd, [{_Pos, Size}|Rest], From, To, Off, Fun, Acc) when From > Off + Size ->
+    range_foldl(Fd, Rest, From, To, Off + Size, Fun, Acc);
+range_foldl(Fd, [{Pos, Size}|Rest], From, To, Off, Fun, Acc) ->
+    {ok, Bin} = couch_file:pread_iolist(Fd, Pos),
+    Bin1 = if
+        From =< Off andalso To >= Off + Size -> Bin; %% the whole block is covered
+        true ->
+            PrefixLen = clip(From - Off, 0, Size),
+            PostfixLen = clip(Off + Size - To, 0, Size),
+            MatchLen = Size - PrefixLen - PostfixLen,
+            <<_Prefix:PrefixLen/binary,Match:MatchLen/binary,_Postfix:PostfixLen/binary>> = iolist_to_binary(Bin),
+            Match
+    end,
+    range_foldl(Fd, Rest, From, To, Off + Size, Fun, Fun(Bin1, Acc)).
+
+clip(Value, Lo, Hi) ->
+    if
+        Value < Lo -> Lo;
+        Value > Hi -> Hi;
+        true -> Value
+    end.
+
 foldl_decode(_DecFun, _Fd, [], Md5, Md5Acc, _Fun, Acc) ->
     Md5 = couch_util:md5_final(Md5Acc),
     Acc;
+foldl_decode(DecFun, Fd, [{Pos, _Size}], Md5, Md5Acc, Fun, Acc) ->
+    foldl_decode(DecFun, Fd, [Pos], Md5, Md5Acc, Fun, Acc);
 foldl_decode(DecFun, Fd, [Pos], Md5, Md5Acc, Fun, Acc) ->
     {ok, EncBin} = couch_file:pread_iolist(Fd, Pos),
     Md5 = couch_util:md5_final(couch_util:md5_update(Md5Acc, EncBin)),
     Bin = DecFun(EncBin),
     Fun(Bin, Acc);
+foldl_decode(DecFun, Fd, [{Pos, _Size}|Rest], Md5, Md5Acc, Fun, Acc) ->
+    foldl_decode(DecFun, Fd, [Pos|Rest], Md5, Md5Acc, Fun, Acc);
 foldl_decode(DecFun, Fd, [Pos|Rest], Md5, Md5Acc, Fun, Acc) ->
     {ok, EncBin} = couch_file:pread_iolist(Fd, Pos),
     Bin = DecFun(EncBin),
@@ -227,7 +265,7 @@ handle_call({write, Bin}, _From, Stream) ->
             {ok, Pos} = couch_file:append_binary(Fd, WriteBin2),
             WrittenLen2 = WrittenLen + iolist_size(WriteBin2),
             Md5_2 = couch_util:md5_update(Md5, WriteBin2),
-            Written2 = [Pos|Written]
+            Written2 = [{Pos, iolist_size(WriteBin2)}|Written]
         end,
 
         {reply, ok, Stream#stream{
@@ -265,7 +303,7 @@ handle_call(close, _From, Stream) ->
         {lists:reverse(Written), WrittenLen, IdenLen, Md5Final, IdenMd5Final};
     _ ->
         {ok, Pos} = couch_file:append_binary(Fd, WriteBin2),
-        StreamInfo = lists:reverse(Written, [Pos]),
+        StreamInfo = lists:reverse(Written, [{Pos, iolist_size(WriteBin2)}]),
         StreamLen = WrittenLen + iolist_size(WriteBin2),
         {StreamInfo, StreamLen, IdenLen, Md5Final, IdenMd5Final}
     end,
diff --git a/apps/couch/src/couch_util.erl b/apps/couch/src/couch_util.erl
index a7de6994..839f5956 100644
--- a/apps/couch/src/couch_util.erl
+++ b/apps/couch/src/couch_util.erl
@@ -15,10 +15,10 @@
 -export([priv_dir/0, start_driver/1, normpath/1]).
 -export([should_flush/0, should_flush/1, to_existing_atom/1]).
 -export([rand32/0, implode/2, collate/2, collate/3]).
--export([abs_pathname/1,abs_pathname/2, trim/1, ascii_lower/1]).
+-export([abs_pathname/1,abs_pathname/2, trim/1]).
 -export([encodeBase64Url/1, decodeBase64Url/1]).
--export([to_hex/1, parse_term/1, dict_find/3]).
--export([file_read_size/1, get_nested_json_value/2, json_user_ctx/1]).
+-export([validate_utf8/1, to_hex/1, parse_term/1, dict_find/3]).
+-export([get_nested_json_value/2, json_user_ctx/1]).
 -export([proplist_apply_field/2, json_apply_field/2]).
 -export([to_binary/1, to_integer/1, to_list/1, url_encode/1]).
 -export([json_encode/1, json_decode/1]).
@@ -28,9 +28,9 @@
 -export([md5/1, md5_init/0, md5_update/2, md5_final/1]).
 -export([reorder_results/2]).
 -export([url_strip_password/1]).
+-export([encode_doc_id/1]).
 
 -include("couch_db.hrl").
--include_lib("kernel/include/file.hrl").
 
 % arbitrarily chosen amount of memory to use before flushing to disk
 -define(FLUSH_MAX_MEM, 10000000).
@@ -107,6 +107,37 @@ simple_call(Pid, Message) ->
         erlang:demonitor(MRef, [flush])
     end.
 
+validate_utf8(Data) when is_list(Data) ->
+    validate_utf8(?l2b(Data));
+validate_utf8(Bin) when is_binary(Bin) ->
+    validate_utf8_fast(Bin, 0).
+
+validate_utf8_fast(B, O) ->
+    case B of
+        <<_:O/binary>> ->
+            true;
+        <<_:O/binary, C1, _/binary>> when
+                C1 < 128 ->
+            validate_utf8_fast(B, 1 + O);
+        <<_:O/binary, C1, C2, _/binary>> when
+                C1 >= 194, C1 =< 223,
+                C2 >= 128, C2 =< 191 ->
+            validate_utf8_fast(B, 2 + O);
+        <<_:O/binary, C1, C2, C3, _/binary>> when
+                C1 >= 224, C1 =< 239,
+                C2 >= 128, C2 =< 191,
+                C3 >= 128, C3 =< 191 ->
+            validate_utf8_fast(B, 3 + O);
+        <<_:O/binary, C1, C2, C3, C4, _/binary>> when
+                C1 >= 240, C1 =< 244,
+                C2 >= 128, C2 =< 191,
+                C3 >= 128, C3 =< 191,
+                C4 >= 128, C4 =< 191 ->
+            validate_utf8_fast(B, 4 + O);
+        _ ->
+            false
+    end.
+
 to_hex([]) ->
     [];
 to_hex(Bin) when is_binary(Bin) ->
@@ -204,18 +235,6 @@ separate_cmd_args(" " ++ Rest, CmdAcc) ->
 separate_cmd_args([Char|Rest], CmdAcc) ->
     separate_cmd_args(Rest, [Char | CmdAcc]).
 
-% lowercases string bytes that are the ascii characters A-Z.
-% All other characters/bytes are ignored.
-ascii_lower(String) ->
-    ascii_lower(String, []).
-
-ascii_lower([], Acc) ->
-    lists:reverse(Acc);
-ascii_lower([Char | RestString], Acc) when Char >= $A, Char =< $B ->
-    ascii_lower(RestString, [Char + ($a-$A) | Acc]);
-ascii_lower([Char | RestString], Acc) ->
-    ascii_lower(RestString, [Char | Acc]).
-
 % Is a character whitespace?
 is_whitespace($\s) -> true;
 is_whitespace($\t) -> true;
@@ -315,14 +334,6 @@ dict_find(Key, Dict, DefaultValue) ->
         DefaultValue
     end.
 
-
-file_read_size(FileName) ->
-    case file:read_file_info(FileName) of
-        {ok, FileInfo} ->
-            FileInfo#file_info.size;
-        Error -> Error
-    end.
-
 to_binary(V) when is_binary(V) ->
     V;
 to_binary(V) when is_list(V) ->
@@ -413,19 +424,14 @@ compressible_att_type(MimeType) when is_binary(MimeType) ->
 compressible_att_type(MimeType) ->
     TypeExpList = re:split(
         couch_config:get("attachments", "compressible_types", ""),
-        ", ?",
+        "\\s*,\\s*",
         [{return, list}]
     ),
     lists:any(
         fun(TypeExp) ->
             Regexp = ["^\\s*", re:replace(TypeExp, "\\*", ".*"),
                 "(?:\\s*;.*?)?\\s*", $$],
-            case re:run(MimeType, Regexp, [caseless]) of
-            {match, _} ->
-                true;
-            _ ->
-                false
-            end
+            re:run(MimeType, Regexp, [caseless]) =/= nomatch
         end,
         [T || T <- TypeExpList, T /= []]
     ).
@@ -459,3 +465,14 @@ url_strip_password(Url) ->
         "http(s)?://([^:]+):[^@]+@(.*)$",
         "http\\1://\\2:*****@\\3",
         [{return, list}]).
+
+encode_doc_id(#doc{id = Id}) ->
+    encode_doc_id(Id);
+encode_doc_id(Id) when is_list(Id) ->
+    encode_doc_id(?l2b(Id));
+encode_doc_id(<<"_design/", Rest/binary>>) ->
+    "_design/" ++ url_encode(Rest);
+encode_doc_id(<<"_local/", Rest/binary>>) ->
+    "_local/" ++ url_encode(Rest);
+encode_doc_id(Id) ->
+    url_encode(Id).
diff --git a/apps/couch/src/couch_view.erl b/apps/couch/src/couch_view.erl
index 6093d69d..05174245 100644
--- a/apps/couch/src/couch_view.erl
+++ b/apps/couch/src/couch_view.erl
@@ -55,11 +55,22 @@ get_group_server(DbName, GroupId) ->
 get_group(Db, GroupId, Stale) ->
     MinUpdateSeq = case Stale of
     ok -> 0;
+    update_after -> 0;
     _Else -> couch_db:get_update_seq(Db)
     end,
-    couch_view_group:request_group(
-            get_group_server(couch_db:name(Db), GroupId),
-            MinUpdateSeq).
+    GroupPid = get_group_server(couch_db:name(Db), GroupId),
+    Result = couch_view_group:request_group(GroupPid, MinUpdateSeq),
+    case Stale of
+    update_after ->
+        % best effort, process might die
+        spawn(fun() ->
+            LastSeq = couch_db:get_update_seq(Db),
+            couch_view_group:request_group(GroupPid, LastSeq)
+        end);
+    _ ->
+        ok
+    end,
+    Result.
 
 get_temp_group(Db, Language, DesignOptions, MapSrc, RedSrc) ->
     couch_view_group:request_group(
@@ -82,13 +93,18 @@ cleanup_index_files(Db) ->
 
     FileList = list_index_files(Db),
 
-    % regex that matches all ddocs
-    RegExp = "("++ string:join(Sigs, "|") ++")",
+    DeleteFiles =
+    if length(Sigs) =:= 0 ->
+        FileList;
+    true ->
+        % regex that matches all ddocs
+        RegExp = "("++ string:join(Sigs, "|") ++")",
 
     % filter out the ones in use
-    DeleteFiles = [FilePath
-           || FilePath <- FileList,
-              re:run(FilePath, RegExp, [{capture, none}]) =:= nomatch],
+        [FilePath || FilePath <- FileList,
+            re:run(FilePath, RegExp, [{capture, none}]) =:= nomatch]
+    end,
+
     % delete unused files
     ?LOG_DEBUG("deleting unused view index files: ~p",[DeleteFiles]),
     RootDir = couch_config:get("couchdb", "view_index_dir"),
@@ -277,36 +293,42 @@ terminate(_Reason, _Srv) ->
     ok.
 
 
-handle_call({get_group_server, DbName,
-    #group{name=GroupId,sig=Sig}=Group}, _From, #server{root_dir=Root}=Server) ->
+handle_call({get_group_server, DbName, #group{sig=Sig}=Group}, From,
+    #server{root_dir=Root}=Server) ->
     case ets:lookup(group_servers_by_sig, {DbName, Sig}) of
     [] ->
-        ?LOG_DEBUG("Spawning new group server for view group ~s in database ~s.",
-            [GroupId, DbName]),
-        case (catch couch_view_group:start_link({Root, DbName, Group})) of
-        {ok, NewPid} ->
-            add_to_ets(NewPid, DbName, Sig),
-            {reply, {ok, NewPid}, Server};
-        {error, invalid_view_seq} ->
-            do_reset_indexes(DbName, Root),
-            case (catch couch_view_group:start_link({Root, DbName, Group})) of
-            {ok, NewPid} ->
-                add_to_ets(NewPid, DbName, Sig),
-                {reply, {ok, NewPid}, Server};
-            Error ->
-                {reply, Error, Server}
-            end;
-        Error ->
-            {reply, Error, Server}
-        end;
+        spawn_monitor(fun() -> new_group(Root, DbName, Group) end),
+        ets:insert(group_servers_by_sig, {{DbName, Sig}, [From]}),
+        {noreply, Server};
+    [{_, WaitList}] when is_list(WaitList) ->
+        ets:insert(group_servers_by_sig, {{DbName, Sig}, [From | WaitList]}),
+        {noreply, Server};
     [{_, ExistingPid}] ->
         {reply, {ok, ExistingPid}, Server}
-    end.
+    end;
+
+handle_call({reset_indexes, DbName}, _From, #server{root_dir=Root}=Server) ->
+    do_reset_indexes(DbName, Root),
+    {reply, ok, Server}.
 
 handle_cast({reset_indexes, DbName}, #server{root_dir=Root}=Server) ->
     do_reset_indexes(DbName, Root),
     {noreply, Server}.
 
+new_group(Root, DbName, #group{name=GroupId, sig=Sig} = Group) ->
+    ?LOG_DEBUG("Spawning new group server for view group ~s in database ~s.",
+        [GroupId, DbName]),
+    case (catch couch_view_group:start_link({Root, DbName, Group})) of
+    {ok, NewPid} ->
+        unlink(NewPid),
+        exit({DbName, Sig, {ok, NewPid}});
+    {error, invalid_view_seq} ->
+        ok = gen_server:call(couch_view, {reset_indexes, DbName}),
+        new_group(Root, DbName, Group);
+    Error ->
+        exit({DbName, Sig, Error})
+    end.
+
 do_reset_indexes(DbName, Root) ->
     % shutdown all the updaters and clear the files, the db got changed
     Names = ets:lookup(couch_groups_by_db, DbName),
@@ -333,6 +355,15 @@ handle_info({'EXIT', FromPid, Reason}, Server) ->
     [{_, {DbName, GroupId}}] ->
         delete_from_ets(FromPid, DbName, GroupId)
     end,
+    {noreply, Server};
+
+handle_info({'DOWN', _, _, _, {DbName, Sig, Reply}}, Server) ->
+    [{_, WaitList}] = ets:lookup(group_servers_by_sig, {DbName, Sig}),
+    [gen_server:reply(From, Reply) || From <- WaitList],
+    case Reply of {ok, NewPid} ->
+        link(NewPid),
+        add_to_ets(NewPid, DbName, Sig);
+     _ -> ok end,
     {noreply, Server}.
 
 config_change("couchdb", "view_index_dir") ->
diff --git a/apps/couch/src/couch_view_compactor.erl b/apps/couch/src/couch_view_compactor.erl
index 38f63f66..69aaff00 100644
--- a/apps/couch/src/couch_view_compactor.erl
+++ b/apps/couch/src/couch_view_compactor.erl
@@ -55,8 +55,10 @@ compact_group(Group, EmptyGroup) ->
 
     Fun = fun({DocId, _ViewIdKeys} = KV, {Bt, Acc, TotalCopied, LastId}) ->
         if DocId =:= LastId -> % COUCHDB-999
-            Msg = "Duplicates of ~s detected in ~s ~s - rebuild required",
-            exit(io_lib:format(Msg, [DocId, DbName, GroupId]));
+            ?LOG_ERROR("Duplicates of document `~s` detected in view group `~s`"
+                ", database `~s` - view rebuild, from scratch, is required",
+                [DocId, GroupId, DbName]),
+            exit({view_duplicated_id, DocId});
         true -> ok end,
         if TotalCopied rem 10000 =:= 0 ->
             couch_task_status:update("Copied ~p of ~p Ids (~p%)",
diff --git a/apps/couch/src/couch_view_group.erl b/apps/couch/src/couch_view_group.erl
index 9aa6cd8d..11cb4c60 100644
--- a/apps/couch/src/couch_view_group.erl
+++ b/apps/couch/src/couch_view_group.erl
@@ -90,7 +90,7 @@ init({{_, DbName, _} = InitArgs, ReturnPid, Ref}) ->
         _ ->
             try couch_db:monitor(Db) after couch_db:close(Db) end,
             {ok, #group_state{
-                    db_name= DbName,
+                    db_name=DbName,
                     init_args=InitArgs,
                     group=Group#group{dbname=DbName},
                     ref_counter=erlang:monitor(process,Fd)}}
@@ -395,11 +395,15 @@ prepare_group({RootDir, DbName, #group{sig=Sig}=Group}, ForceReset)->
 
 get_index_header_data(#group{current_seq=Seq, purge_seq=PurgeSeq,
             id_btree=IdBtree,views=Views}) ->
-    ViewStates = [couch_btree:get_state(Btree) || #view{btree=Btree} <- Views],
-    #index_header{seq=Seq,
-            purge_seq=PurgeSeq,
-            id_btree_state=couch_btree:get_state(IdBtree),
-            view_states=ViewStates}.
+    ViewStates = [
+        {couch_btree:get_state(V#view.btree), V#view.update_seq, V#view.purge_seq} || V <- Views
+    ],
+    #index_header{
+        seq=Seq,
+        purge_seq=PurgeSeq,
+        id_btree_state=couch_btree:get_state(IdBtree),
+        view_states=ViewStates
+    }.
 
 hex_sig(GroupSig) ->
     couch_util:to_hex(?b2l(GroupSig)).
@@ -440,7 +444,7 @@ open_temp_group(DbName, Language, DesignOptions, MapSrc, RedSrc) ->
             reduce_funs= if RedSrc==[] -> []; true -> [{<<"_temp">>, RedSrc}] end,
             options=DesignOptions},
         couch_db:close(Db),
-        {ok, set_view_sig(#group{name = <<"_temp">>, views=[View],
+        {ok, set_view_sig(#group{name = <<"_temp">>,lib={[]}, views=[View],
             def_lang=Language, design_options=DesignOptions})};
     Error ->
         Error
@@ -448,9 +452,40 @@ open_temp_group(DbName, Language, DesignOptions, MapSrc, RedSrc) ->
 
 set_view_sig(#group{
             views=Views,
+            lib={[]},
+            def_lang=Language,
+            design_options=DesignOptions}=G) ->
+    ViewInfo = [old_view_format(V) || V <- Views],
+    G#group{sig=couch_util:md5(term_to_binary({ViewInfo, Language, DesignOptions}))};
+set_view_sig(#group{
+            views=Views,
+            lib=Lib,
             def_lang=Language,
             design_options=DesignOptions}=G) ->
-    G#group{sig=couch_util:md5(term_to_binary({Views, Language, DesignOptions}))}.
+    ViewInfo = [old_view_format(V) || V <- Views],
+    G#group{sig=couch_util:md5(term_to_binary({ViewInfo, Language, DesignOptions, sort_lib(Lib)}))}.
+
+% Use the old view record format so group sig's don't change
+old_view_format(View) ->
+    {
+        view,
+        View#view.id_num,
+        View#view.map_names,
+        View#view.def,
+        View#view.btree,
+        View#view.reduce_funs,
+        View#view.options
+    }.
+
+sort_lib({Lib}) ->
+    sort_lib(Lib, []).
+sort_lib([], LAcc) ->
+    lists:keysort(1, LAcc);
+sort_lib([{LName, {LObj}}|Rest], LAcc) ->
+    LSorted = sort_lib(LObj, []), % descend into nested object
+    sort_lib(Rest, [{LName, LSorted}|LAcc]);
+sort_lib([{LName, LCode}|Rest], LAcc) ->
+    sort_lib(Rest, [{LName, LCode}|LAcc]).
 
 open_db_group(DbName, GroupId) ->
     {Pid, Ref} = spawn_monitor(fun() ->
@@ -509,52 +544,44 @@ design_doc_to_view_group(#doc{id=Id,body={Fields}}) ->
     Language = couch_util:get_value(<<"language">>, Fields, <<"javascript">>),
     {DesignOptions} = couch_util:get_value(<<"options">>, Fields, {[]}),
     {RawViews} = couch_util:get_value(<<"views">>, Fields, {[]}),
+    Lib = couch_util:get_value(<<"lib">>, RawViews, {[]}),
     % add the views to a dictionary object, with the map source as the key
     DictBySrc =
     lists:foldl(
         fun({Name, {MRFuns}}, DictBySrcAcc) ->
-            MapSrc = couch_util:get_value(<<"map">>, MRFuns),
-            RedSrc = couch_util:get_value(<<"reduce">>, MRFuns, null),
-            {ViewOptions} = couch_util:get_value(<<"options">>, MRFuns, {[]}),
-            View =
-            case dict:find({MapSrc, ViewOptions}, DictBySrcAcc) of
-                {ok, View0} -> View0;
-                error -> #view{def=MapSrc, options=ViewOptions} % create new view object
-            end,
-            View2 =
-            if RedSrc == null ->
-                View#view{map_names=[Name|View#view.map_names]};
-            true ->
-                View#view{reduce_funs=[{Name,RedSrc}|View#view.reduce_funs]}
-            end,
-            dict:store({MapSrc, ViewOptions}, View2, DictBySrcAcc)
+            case couch_util:get_value(<<"map">>, MRFuns) of
+            undefined -> DictBySrcAcc;
+            MapSrc ->
+                RedSrc = couch_util:get_value(<<"reduce">>, MRFuns, null),
+                {ViewOptions} = couch_util:get_value(<<"options">>, MRFuns, {[]}),
+                View =
+                case dict:find({MapSrc, ViewOptions}, DictBySrcAcc) of
+                    {ok, View0} -> View0;
+                    error -> #view{def=MapSrc, options=ViewOptions} % create new view object
+                end,
+                View2 =
+                if RedSrc == null ->
+                    View#view{map_names=[Name|View#view.map_names]};
+                true ->
+                    View#view{reduce_funs=[{Name,RedSrc}|View#view.reduce_funs]}
+                end,
+                dict:store({MapSrc, ViewOptions}, View2, DictBySrcAcc)
+            end
         end, dict:new(), RawViews),
     % number the views
     {Views, _N} = lists:mapfoldl(
         fun({_Src, View}, N) ->
             {View#view{id_num=N},N+1}
         end, 0, lists:sort(dict:to_list(DictBySrc))),
-
-    #group{
-        name = Id,
-        views = Views,
-        def_lang = Language,
-        design_options = DesignOptions,
-        sig = couch_util:md5(term_to_binary({Views, Language, DesignOptions}))
-    }.
+    set_view_sig(#group{name=Id, lib=Lib, views=Views, def_lang=Language, design_options=DesignOptions}).
 
 reset_group(DbName, #group{views=Views}=Group) ->
-    Group#group{
-        fd = nil,
-        dbname = DbName,
-        query_server = nil,
-        current_seq = 0,
-        id_btree = nil,
-        views = [View#view{btree=nil} || View <- Views]
-    }.
+    Views2 = [View#view{btree=nil} || View <- Views],
+    Group#group{dbname=DbName,fd=nil,query_server=nil,current_seq=0,
+            id_btree=nil,views=Views2}.
 
 reset_file(Fd, DbName, #group{sig=Sig,name=Name} = Group) ->
-    ?LOG_INFO("Resetting group index \"~s\" in db ~s", [Name, DbName]),
+    ?LOG_DEBUG("Resetting group index \"~s\" in db ~s", [Name, DbName]),
     ok = couch_file:truncate(Fd, 0),
     ok = couch_file:write_header(Fd, {Sig, nil}),
     init_group(Fd, reset_group(DbName, Group), nil).
@@ -566,7 +593,7 @@ init_group(Fd, #group{dbname=DbName, views=Views}=Group, nil) ->
     case couch_db:open(DbName, []) of
     {ok, Db} ->
         PurgeSeq = try couch_db:get_purge_seq(Db) after couch_db:close(Db) end,
-        Header = #index_header{purge_seq=PurgeSeq, view_states=[nil || _ <- Views]},
+        Header = #index_header{purge_seq=PurgeSeq, view_states=[{nil, 0, 0} || _ <- Views]},
         init_group(Fd, Group, Header);
     {not_found, no_db_file} ->
         ?LOG_ERROR("~p no_db_file ~p", [?MODULE, DbName]),
@@ -575,9 +602,14 @@ init_group(Fd, #group{dbname=DbName, views=Views}=Group, nil) ->
 init_group(Fd, #group{def_lang=Lang,views=Views}=Group, IndexHeader) ->
      #index_header{seq=Seq, purge_seq=PurgeSeq,
             id_btree_state=IdBtreeState, view_states=ViewStates} = IndexHeader,
+    StateUpdate = fun
+        ({_, _, _}=State) -> State;
+        (State) -> {State, 0, 0}
+    end,
+    ViewStates2 = lists:map(StateUpdate, ViewStates),
     {ok, IdBtree} = couch_btree:open(IdBtreeState, Fd),
     Views2 = lists:zipwith(
-        fun(BtreeState, #view{reduce_funs=RedFuns,options=Options}=View) ->
+        fun({BTState, USeq, PSeq}, #view{reduce_funs=RedFuns,options=Options}=View) ->
             FunSrcs = [FunSrc || {_Name, FunSrc} <- RedFuns],
             ReduceFun =
                 fun(reduce, KVs) ->
@@ -601,11 +633,12 @@ init_group(Fd, #group{def_lang=Lang,views=Views}=Group, IndexHeader) ->
             <<"raw">> ->
                 Less = fun(A,B) -> A < B end
             end,
-            {ok, Btree} = couch_btree:open(BtreeState, Fd, [{less, Less},
-                {reduce, ReduceFun}]),
-            View#view{btree=Btree}
+            {ok, Btree} = couch_btree:open(BTState, Fd,
+                    [{less, Less}, {reduce, ReduceFun}]
+            ),
+            View#view{btree=Btree, update_seq=USeq, purge_seq=PSeq}
         end,
-        ViewStates, Views),
+        ViewStates2, Views),
     Group#group{fd=Fd, current_seq=Seq, purge_seq=PurgeSeq, id_btree=IdBtree,
         views=Views2}.
 
diff --git a/apps/couch/src/couch_view_updater.erl b/apps/couch/src/couch_view_updater.erl
index a07e5dd3..90cb20d4 100644
--- a/apps/couch/src/couch_view_updater.erl
+++ b/apps/couch/src/couch_view_updater.erl
@@ -39,8 +39,10 @@ update(Owner, Group) ->
         couch_task_status:update(<<"Resetting view index due to lost purge entries.">>),
         exit(reset)
     end,
-    {ok, MapQueue} = couch_work_queue:new(100000, 500),
-    {ok, WriteQueue} = couch_work_queue:new(100000, 500),
+    {ok, MapQueue} = couch_work_queue:new(
+        [{max_size, 100000}, {max_items, 500}]),
+    {ok, WriteQueue} = couch_work_queue:new(
+        [{max_size, 100000}, {max_items, 500}]),
     Self = self(),
     ViewEmptyKVs = [{View, []} || View <- Group2#group.views],
     spawn_link(?MODULE, do_maps, [Group, MapQueue, WriteQueue, ViewEmptyKVs]),
@@ -92,19 +94,25 @@ purge_index(Db, #group{views=Views, id_btree=IdBtree}=Group) ->
         end, dict:new(), Lookups),
 
     % Now remove the values from the btrees
+    PurgeSeq = couch_db:get_purge_seq(Db),
     Views2 = lists:map(
         fun(#view{id_num=Num,btree=Btree}=View) ->
             case dict:find(Num, ViewKeysToRemoveDict) of
             {ok, RemoveKeys} ->
-                {ok, Btree2} = couch_btree:add_remove(Btree, [], RemoveKeys),
-                View#view{btree=Btree2};
+                {ok, ViewBtree2} = couch_btree:add_remove(Btree, [], RemoveKeys),
+                case ViewBtree2 =/= Btree of
+                    true ->
+                        View#view{btree=ViewBtree2, purge_seq=PurgeSeq};
+                    _ ->
+                        View#view{btree=ViewBtree2}
+                end;
             error -> % no keys to remove in this view
                 View
             end
         end, Views),
     Group#group{id_btree=IdBtree2,
             views=Views2,
-            purge_seq=couch_db:get_purge_seq(Db)}.
+            purge_seq=PurgeSeq}.
 
 -spec load_doc(#db{}, #doc_info{}, pid(), [atom()], boolean()) -> ok.
 load_doc(Db, DI, MapQueue, DocOpts, IncludeDesign) ->
@@ -227,12 +235,12 @@ view_insert_doc_query_results(#doc{id=DocId}=Doc, [ResultKVs|RestResults], [{Vie
 -spec view_compute(#group{}, [#doc{}]) -> {#group{}, any()}.
 view_compute(Group, []) ->
     {Group, []};
-view_compute(#group{def_lang=DefLang, query_server=QueryServerIn}=Group, Docs) ->
+view_compute(#group{def_lang=DefLang, lib=Lib, query_server=QueryServerIn}=Group, Docs) ->
     {ok, QueryServer} =
     case QueryServerIn of
     nil -> % doc map not started
         Definitions = [View#view.def || View <- Group#group.views],
-        couch_query_servers:start_doc_map(DefLang, Definitions);
+        couch_query_servers:start_doc_map(DefLang, Definitions, Lib);
     _ ->
         {ok, QueryServerIn}
     end,
@@ -270,7 +278,12 @@ write_changes(Group, ViewKeyValuesToAdd, DocIdViewIdKeys, NewSeq, InitialBuild)
     Views2 = lists:zipwith(fun(View, {_View, AddKeyValues}) ->
             KeysToRemove = couch_util:dict_find(View#view.id_num, KeysToRemoveByView, []),
             {ok, ViewBtree2} = couch_btree:add_remove(View#view.btree, AddKeyValues, KeysToRemove),
-            View#view{btree = ViewBtree2}
+            case ViewBtree2 =/= View#view.btree of
+                true ->
+                    View#view{btree=ViewBtree2, update_seq=NewSeq};
+                _ ->
+                    View#view{btree=ViewBtree2}
+            end
         end,    Group#group.views, ViewKeyValuesToAdd),
     Group#group{views=Views2, current_seq=NewSeq, id_btree=IdBtree2}.
 
diff --git a/apps/couch/src/couch_work_queue.erl b/apps/couch/src/couch_work_queue.erl
index decfcad8..13ec7335 100644
--- a/apps/couch/src/couch_work_queue.erl
+++ b/apps/couch/src/couch_work_queue.erl
@@ -13,99 +13,139 @@
 -module(couch_work_queue).
 -behaviour(gen_server).
 
--export([new/2,queue/2,dequeue/1,dequeue/2,close/1]).
--export([init/1, terminate/2, handle_call/3, handle_cast/2, code_change/3, handle_info/2]).
+% public API
+-export([new/1, queue/2, dequeue/1, dequeue/2, close/1]).
+
+% gen_server callbacks
+-export([init/1, terminate/2]).
+-export([handle_call/3, handle_cast/2, code_change/3, handle_info/2]).
 
 -record(q, {
-    queue=queue:new(),
-    blocked=[],
+    queue = queue:new(),
+    blocked = [],
     max_size,
     max_items,
-    items=0,
-    size=0,
-    work_waiter=nil,
-    close_on_dequeue=false
+    items = 0,
+    size = 0,
+    work_waiters = [],
+    close_on_dequeue = false,
+    multi_workers = false
 }).
 
-new(MaxSize, MaxItems) ->
-    gen_server:start_link(couch_work_queue, {MaxSize, MaxItems}, []).
+
+new(Options) ->
+    gen_server:start_link(couch_work_queue, Options, []).
+
 
 queue(Wq, Item) ->
     gen_server:call(Wq, {queue, Item}, infinity).
 
+
 dequeue(Wq) ->
     dequeue(Wq, all).
+
     
 dequeue(Wq, MaxItems) ->
-    try gen_server:call(Wq, {dequeue, MaxItems}, infinity)
+    try
+        gen_server:call(Wq, {dequeue, MaxItems}, infinity)
     catch
         _:_ -> closed
     end.
 
+
 close(Wq) ->
     gen_server:cast(Wq, close).
     
 
-init({MaxSize,MaxItems}) ->
-    {ok, #q{max_size=MaxSize, max_items=MaxItems}}.
+init(Options) ->
+    Q = #q{
+        max_size = couch_util:get_value(max_size, Options),
+        max_items = couch_util:get_value(max_items, Options),
+        multi_workers = couch_util:get_value(multi_workers, Options, false)
+    },
+    {ok, Q}.
+
+
+terminate(_Reason, #q{work_waiters=Workers}) ->
+    lists:foreach(fun({W, _}) -> gen_server:reply(W, closed) end, Workers).
 
-terminate(_Reason, #q{work_waiter=nil}) ->
-    ok;
-terminate(_Reason, #q{work_waiter={WWFrom, _}}) ->
-    gen_server:reply(WWFrom, closed).
     
-handle_call({queue, Item}, From, #q{work_waiter=nil}=Q0) ->
-    Q = Q0#q{size=Q0#q.size + byte_size(term_to_binary(Item)),
-                items=Q0#q.items + 1,
-                queue=queue:in(Item, Q0#q.queue)},
+handle_call({queue, Item}, From, #q{work_waiters = []} = Q0) ->
+    Q = Q0#q{size = Q0#q.size + byte_size(term_to_binary(Item)),
+                items = Q0#q.items + 1,
+                queue = queue:in(Item, Q0#q.queue)},
     case (Q#q.size >= Q#q.max_size) orelse
             (Q#q.items >= Q#q.max_items) of
     true ->
-        {noreply, Q#q{blocked=[From | Q#q.blocked]}};
+        {noreply, Q#q{blocked = [From | Q#q.blocked]}};
     false ->
         {reply, ok, Q}
     end;
-handle_call({queue, Item}, _From, #q{work_waiter={WWFrom, _Max}}=Q) ->
-    gen_server:reply(WWFrom, {ok, [Item]}),
-    {reply, ok, Q#q{work_waiter=nil}};
-handle_call({dequeue, _Max}, _From, #q{work_waiter=WW}) when WW /= nil ->
-    exit("Only one caller allowed to wait for work at a time");
-handle_call({dequeue, Max}, From, #q{items=0}=Q) ->
-    {noreply, Q#q{work_waiter={From, Max}}};
-handle_call({dequeue, Max}, _From, #q{queue=Queue, max_size=MaxSize,
-        max_items=MaxItems, items=Items,close_on_dequeue=Close}=Q) ->
-    if Max >= Items orelse Max == all ->
-        [gen_server:reply(From, ok) || From <- Q#q.blocked],
-        Q2 = #q{max_size=MaxSize, max_items=MaxItems},
-        if Close ->
-            {stop, normal, {ok, queue:to_list(Queue)}, Q2};
-        true ->
-            {reply, {ok, queue:to_list(Queue)}, Q2}
-        end;
+
+handle_call({queue, Item}, _From, #q{work_waiters = [{W, _Max} | Rest]} = Q) ->
+    gen_server:reply(W, {ok, [Item]}),
+    {reply, ok, Q#q{work_waiters = Rest}};
+
+handle_call({dequeue, Max}, From, Q) ->
+    #q{work_waiters = Workers, multi_workers = Multi, items = Count} = Q,
+    case {Workers, Multi} of
+    {[_ | _], false} ->
+        exit("Only one caller allowed to wait for this work at a time");
+    {[_ | _], true} ->
+        {noreply, Q#q{work_waiters=Workers ++ [{From, Max}]}};
+    _ ->
+        case Count of
+        0 ->
+            {noreply, Q#q{work_waiters=Workers ++ [{From, Max}]}};
+        C when C > 0 ->
+            deliver_queue_items(Max, Q)
+        end
+    end.
+
+
+deliver_queue_items(Max, Q) ->
+    #q{
+        queue = Queue,
+        items = Count,
+        close_on_dequeue = Close,
+        blocked = Blocked
+    } = Q,
+    case (Max =:= all) orelse (Max >= Count) of
+    false ->
+        {Items, Queue2, Blocked2} = dequeue_items(Max, Queue, Blocked, []),
+        Q2 = Q#q{items = Count - Max, blocked = Blocked2, queue = Queue2},
+        {reply, {ok, Items}, Q2};
     true ->
-        {DequeuedItems, Queue2, Blocked2} =
-                dequeue_items(Max, Queue, Q#q.blocked, []),
-        {reply, {ok, DequeuedItems},
-                Q#q{items=Items-Max,blocked=Blocked2,queue=Queue2}}
+        lists:foreach(fun(F) -> gen_server:reply(F, ok) end, Blocked),
+        Q2 = Q#q{items = 0, size = 0, blocked = [], queue = queue:new()},
+        case Close of
+        false ->
+            {reply, {ok, queue:to_list(Queue)}, Q2};
+        true ->
+            {stop, normal, {ok, queue:to_list(Queue)}, Q2}
+        end
     end.
 
+
 dequeue_items(0, Queue, Blocked, DequeuedAcc) ->
     {lists:reverse(DequeuedAcc), Queue, Blocked};
+
 dequeue_items(NumItems, Queue, Blocked, DequeuedAcc) ->
     {{value, Item}, Queue2} = queue:out(Queue),
     case Blocked of
     [] ->
         Blocked2 = Blocked;
-    [From|Blocked2] ->
+    [From | Blocked2] ->
         gen_server:reply(From, ok)
     end,
-    dequeue_items(NumItems-1, Queue2, Blocked2, [Item | DequeuedAcc]).
+    dequeue_items(NumItems - 1, Queue2, Blocked2, [Item | DequeuedAcc]).
     
 
-handle_cast(close, #q{items=0}=Q) ->
+handle_cast(close, #q{items = 0} = Q) ->
     {stop, normal, Q};
+
 handle_cast(close, Q) ->
-    {noreply, Q#q{close_on_dequeue=true}}.
+    {noreply, Q#q{close_on_dequeue = true}}.
 
 
 code_change(_OldVsn, State, _Extra) ->
diff --git a/apps/couch/src/test_util.erl b/apps/couch/src/test_util.erl
index e43338e7..55b95139 100644
--- a/apps/couch/src/test_util.erl
+++ b/apps/couch/src/test_util.erl
@@ -13,7 +13,7 @@
 -module(test_util).
 
 -export([init_code_path/0]).
--export([source_file/1, build_file/1]).
+-export([source_file/1, build_file/1, config_files/0]).
 
 init_code_path() ->
     code:load_abs("apps/couch/test/etap/etap").
@@ -22,4 +22,12 @@ source_file(Name) ->
     filename:join(["apps/couch", Name]).
 
 build_file(Name) ->
-    filename:join(["apps/couch", Name]).
+    filename:join(["rel/overlay", Name]).
+
+config_files() ->
+    [
+        build_file("etc/default.ini"),
+        build_file("etc/local.ini"),
+        source_file("test/etap/random_port.ini")
+    ].
+
diff --git a/apps/couch/test/etap/010-file-basics.t b/apps/couch/test/etap/010-file-basics.t
index a3599f1a..ed71f5e8 100755
--- a/apps/couch/test/etap/010-file-basics.t
+++ b/apps/couch/test/etap/010-file-basics.t
@@ -84,7 +84,8 @@ test() ->
     % append_binary == append_iolist?
     % Possible bug in pread_iolist or iolist() -> append_binary
     {ok, IOLPos} = couch_file:append_binary(Fd, ["foo", $m, <<"bam">>]),
-    etap:is({ok, [<<"foombam">>]}, couch_file:pread_iolist(Fd, IOLPos),
+    {ok, IoList} = couch_file:pread_iolist(Fd, IOLPos),
+    etap:is(<<"foombam">>, iolist_to_binary(IoList),
         "Reading an results in a binary form of the written iolist()"),
 
     % XXX: How does on test fsync?
diff --git a/apps/couch/test/etap/021-btree-reductions.t b/apps/couch/test/etap/021-btree-reductions.t
index 30ffd530..6362594e 100755
--- a/apps/couch/test/etap/021-btree-reductions.t
+++ b/apps/couch/test/etap/021-btree-reductions.t
@@ -107,7 +107,7 @@ test()->
             (_) -> false
         end,
         couch_btree:fold_reduce(Btree2, FoldFun, [], [{dir, fwd}, {key_group_fun, GroupFun}, {start_key, SK1}, {end_key, EK1}]),
-        "Reducing foward over first half works with a startkey and endkey."
+        "Reducing forward over first half works with a startkey and endkey."
     ),
 
     etap:fun_is(
@@ -116,7 +116,7 @@ test()->
             (_) -> false
         end,
         couch_btree:fold_reduce(Btree2, FoldFun, [], [{dir, fwd}, {key_group_fun, GroupFun}, {start_key, SK2}, {end_key, EK2}]),
-        "Reducing foward over second half works with second startkey and endkey"
+        "Reducing forward over second half works with second startkey and endkey"
     ),
 
     etap:fun_is(
diff --git a/apps/couch/test/etap/030-doc-from-json.t b/apps/couch/test/etap/030-doc-from-json.t
index 8dd5fa1e..0a1e6ab3 100755
--- a/apps/couch/test/etap/030-doc-from-json.t
+++ b/apps/couch/test/etap/030-doc-from-json.t
@@ -33,6 +33,9 @@ main(_) ->
     ok.
 
 test() ->
+    couch_config:start_link(test_util:config_files()),
+    couch_config_event:start_link(),
+    couch_config:set("attachments", "compression_level", "0", false),
     ok = test_from_json_success(),
     ok = test_from_json_errors(),
     ok.
diff --git a/apps/couch/test/etap/031-doc-to-json.t b/apps/couch/test/etap/031-doc-to-json.t
index 6f2ae7a2..6ceae344 100755
--- a/apps/couch/test/etap/031-doc-to-json.t
+++ b/apps/couch/test/etap/031-doc-to-json.t
@@ -33,6 +33,9 @@ main(_) ->
     ok.
 
 test() ->
+    couch_config:start_link(test_util:config_files()),
+    couch_config_event:start_link(),
+    couch_config:set("attachments", "compression_level", "0", false),
     ok = test_to_json_success(),
     ok.
 
diff --git a/apps/couch/test/etap/050-stream.t b/apps/couch/test/etap/050-stream.t
index 03949690..16f4f0c6 100755
--- a/apps/couch/test/etap/050-stream.t
+++ b/apps/couch/test/etap/050-stream.t
@@ -44,7 +44,7 @@ test() ->
         "Writing an empty binary does nothing."),
 
     {Ptrs, Length, _, _, _} = couch_stream:close(Stream),
-    etap:is(Ptrs, [0], "Close returns the file pointers."),
+    etap:is(Ptrs, [{0, 8}], "Close returns the file pointers."),
     etap:is(Length, 8, "Close also returns the number of bytes written."),
     etap:is(<<"foodfoob">>, read_all(Fd, Ptrs), "Returned pointers are valid."),
 
@@ -60,7 +60,7 @@ test() ->
         "Successfully wrote 80 0 bits."),
 
     {Ptrs2, Length2, _, _, _} = couch_stream:close(Stream2),
-    etap:is(Ptrs2, [ExpPtr], "Closing stream returns the file pointers."),
+    etap:is(Ptrs2, [{ExpPtr, 20}], "Closing stream returns the file pointers."),
     etap:is(Length2, 20, "Length written is 160 bytes."),
 
     AllBits = iolist_to_binary([OneBits,ZeroBits]),
@@ -81,7 +81,7 @@ test() ->
     % + 4 bytes for the term_to_binary adding a length header
     % + 1 byte every 4K for tail append headers
     SecondPtr = ExpPtr2 + 4095 + 5 + 4 + 1,
-    etap:is(Ptrs3, [ExpPtr2, SecondPtr], "Pointers every 4K bytes."),
+    etap:is(Ptrs3, [{ExpPtr2, 4100}, {SecondPtr, 1020}], "Pointers every 4K bytes."),
     etap:is(Length3, 5120, "Wrote the expected 5K bytes."),
 
     couch_file:close(Fd),
diff --git a/apps/couch/test/etap/060-kt-merging.t b/apps/couch/test/etap/060-kt-merging.t
index 0e481a52..efbdbf69 100755
--- a/apps/couch/test/etap/060-kt-merging.t
+++ b/apps/couch/test/etap/060-kt-merging.t
@@ -15,7 +15,7 @@
 
 main(_) ->
     test_util:init_code_path(),
-    etap:plan(12),
+    etap:plan(16),
     case (catch test()) of
         ok ->
             etap:end_tests();
@@ -26,25 +26,21 @@ main(_) ->
     ok.
 
 test() ->
-    One = {0, {"1","foo",[]}},
-    TwoSibs = [{0, {"1","foo",[]}},
-               {0, {"2","foo",[]}}],
-    OneChild = {0, {"1","foo",[{"1a", "bar", []}]}},
-    TwoChild = {0, {"1","foo", [{"1a", "bar", [{"1aa", "bar", []}]}]}},
-    TwoChildSibs = {0, {"1","foo", [{"1a", "bar", []},
-                                     {"1b", "bar", []}]}},
-    TwoChildSibs2 = {0, {"1","foo", [{"1a", "bar", []},
-                                     {"1b", "bar", [{"1bb", "boo", []}]}]}},
-    Stemmed1b = {1, {"1a", "bar", []}},
-    Stemmed1a = {1, {"1a", "bar", [{"1aa", "bar", []}]}},
-    Stemmed1aa = {2, {"1aa", "bar", []}},
-    Stemmed1bb = {2, {"1bb", "boo", []}},
+    One = {1, {"1","foo",[]}},
 
     etap:is(
         {[One], no_conflicts},
         couch_key_tree:merge([], One, 10),
         "The empty tree is the identity for merge."
     ),
+    etap:is(
+        {[One], no_conflicts},
+        couch_key_tree:merge([One], One, 10),
+        "Merging is reflexive."
+    ),
+
+    TwoSibs = [{1, {"1","foo",[]}},
+               {1, {"2","foo",[]}}],
 
     etap:is(
         {TwoSibs, no_conflicts},
@@ -52,41 +48,75 @@ test() ->
         "Merging a prefix of a tree with the tree yields the tree."
     ),
 
+    Three = {1, {"3","foo",[]}},
+    ThreeSibs = [{1, {"1","foo",[]}},
+                 {1, {"2","foo",[]}},
+                 {1, {"3","foo",[]}}],
+
     etap:is(
-        {[One], no_conflicts},
-        couch_key_tree:merge([One], One, 10),
-        "Merging is reflexive."
+        {ThreeSibs, conflicts},
+        couch_key_tree:merge(TwoSibs, Three, 10),
+        "Merging a third unrelated branch leads to a conflict."
     ),
 
+
+    TwoChild = {1, {"1","foo", [{"1a", "bar", [{"1aa", "bar", []}]}]}},
+
     etap:is(
         {[TwoChild], no_conflicts},
         couch_key_tree:merge([TwoChild], TwoChild, 10),
         "Merging two children is still reflexive."
     ),
 
+    TwoChildSibs = {1, {"1","foo", [{"1a", "bar", []},
+                                     {"1b", "bar", []}]}},
     etap:is(
         {[TwoChildSibs], no_conflicts},
         couch_key_tree:merge([TwoChildSibs], TwoChildSibs, 10),
         "Merging a tree to itself is itself."),
 
+    TwoChildPlusSibs =
+        {1, {"1","foo", [{"1a", "bar", [{"1aa", "bar", []}]},
+                         {"1b", "bar", []}]}},
+
+    etap:is(
+        {[TwoChildPlusSibs], no_conflicts},
+        couch_key_tree:merge([TwoChild], TwoChildSibs, 10),
+        "Merging tree of uneven length at node 2."),
+
+    Stemmed1b = {2, {"1a", "bar", []}},
     etap:is(
         {[TwoChildSibs], no_conflicts},
         couch_key_tree:merge([TwoChildSibs], Stemmed1b, 10),
         "Merging a tree with a stem."
     ),
 
+    TwoChildSibs2 = {1, {"1","foo", [{"1a", "bar", []},
+                                     {"1b", "bar", [{"1bb", "boo", []}]}]}},
+    Stemmed1bb = {3, {"1bb", "boo", []}},
     etap:is(
         {[TwoChildSibs2], no_conflicts},
         couch_key_tree:merge([TwoChildSibs2], Stemmed1bb, 10),
         "Merging a stem at a deeper level."
     ),
 
+    StemmedTwoChildSibs2 = [{2,{"1a", "bar", []}},
+                            {2,{"1b", "bar", [{"1bb", "boo", []}]}}],
+
+    etap:is(
+        {StemmedTwoChildSibs2, no_conflicts},
+        couch_key_tree:merge(StemmedTwoChildSibs2, Stemmed1bb, 10),
+        "Merging a stem at a deeper level against paths at deeper levels."
+    ),
+
+    Stemmed1aa = {3, {"1aa", "bar", []}},
     etap:is(
         {[TwoChild], no_conflicts},
         couch_key_tree:merge([TwoChild], Stemmed1aa, 10),
         "Merging a single tree with a deeper stem."
     ),
 
+    Stemmed1a = {2, {"1a", "bar", [{"1aa", "bar", []}]}},
     etap:is(
         {[TwoChild], no_conflicts},
         couch_key_tree:merge([TwoChild], Stemmed1a, 10),
@@ -99,6 +129,7 @@ test() ->
         "More merging."
     ),
 
+    OneChild = {1, {"1","foo",[{"1a", "bar", []}]}},
     Expect1 = [OneChild, Stemmed1aa],
     etap:is(
         {Expect1, conflicts},
@@ -112,4 +143,34 @@ test() ->
         "Merge should have no conflicts."
     ),
 
+    %% this test is based on couch-902-test-case2.py
+    %% foo has conflicts from replication at depth two
+    %% foo3 is the current value
+    Foo = {1, {"foo",
+               "val1",
+               [{"foo2","val2",[]},
+                {"foo3", "val3", []}
+               ]}},
+    %% foo now has an attachment added, which leads to foo4 and val4
+    %% off foo3
+    Bar = {1, {"foo",
+               [],
+               [{"foo3",
+                 [],
+                 [{"foo4","val4",[]}
+                  ]}]}},
+    %% this is what the merge returns
+    %% note that it ignore the conflicting branch as there's no match
+    FooBar = {1, {"foo",
+               "val1",
+               [{"foo2","val2",[]},
+                {"foo3", "val3", [{"foo4","val4",[]}]}
+               ]}},
+
+    etap:is(
+      {[FooBar], no_conflicts},
+      couch_key_tree:merge([Foo],Bar,10),
+      "Merging trees with conflicts ought to behave."
+    ),
+
     ok.
diff --git a/apps/couch/test/etap/083-config-no-files.t b/apps/couch/test/etap/083-config-no-files.t
index edf8315d..fe2b75c4 100755
--- a/apps/couch/test/etap/083-config-no-files.t
+++ b/apps/couch/test/etap/083-config-no-files.t
@@ -46,7 +46,7 @@ test() ->
         "Created a new non-persisted k/v pair."
     ),
 
-    ok = couch_config:set("httpd", "bind_address", "127.0.0.1"),
+    ok = couch_config:set("httpd", "bind_address", "127.0.0.1", false),
     etap:is(
         couch_config:get("httpd", "bind_address"),
         "127.0.0.1",
diff --git a/apps/couch/test/etap/random_port.ini b/apps/couch/test/etap/random_port.ini
new file mode 100644
index 00000000..ada3c13d
--- /dev/null
+++ b/apps/couch/test/etap/random_port.ini
@@ -0,0 +1,19 @@
+; Licensed to the Apache Software Foundation (ASF) under one
+; or more contributor license agreements.  See the NOTICE file
+; distributed with this work for additional information
+; regarding copyright ownership.  The ASF licenses this file
+; to you under the Apache License, Version 2.0 (the
+; "License"); you may not use this file except in compliance
+; with the License.  You may obtain a copy of the License at
+; 
+;   http://www.apache.org/licenses/LICENSE-2.0
+;
+; Unless required by applicable law or agreed to in writing,
+; software distributed under the License is distributed on an
+; "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY
+; KIND, either express or implied.  See the License for the
+; specific language governing permissions and limitations
+; under the License.
+
+[httpd]
+port = 0
diff --git a/apps/couch/test/etap/test_cfg_register.c b/apps/couch/test/etap/test_cfg_register.c
new file mode 100644
index 00000000..7161eb55
--- /dev/null
+++ b/apps/couch/test/etap/test_cfg_register.c
@@ -0,0 +1,30 @@
+// Licensed under the Apache License, Version 2.0 (the "License"); you may not
+// use this file except in compliance with the License. You may obtain a copy of
+// the License at
+//
+//   http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
+// WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
+// License for the specific language governing permissions and limitations under
+// the License.
+
+#include <stdio.h>
+
+int
+main(int argc, const char * argv[])
+{
+    char c = '\0';
+    size_t num = 1;
+    
+    fprintf(stdout, "[\"register\", \"s1\"]\n");
+    fprintf(stdout, "[\"register\", \"s2\", \"k\"]\n");
+    fflush(stdout);
+    
+    while(c != '\n' && num > 0) {
+        num = fread(&c, 1, 1, stdin);
+    }
+    
+    exit(0);
+}
diff --git a/apps/couch/test/etap/test_web.erl b/apps/couch/test/etap/test_web.erl
new file mode 100644
index 00000000..ed78651f
--- /dev/null
+++ b/apps/couch/test/etap/test_web.erl
@@ -0,0 +1,99 @@
+% Licensed under the Apache License, Version 2.0 (the "License"); you may not
+% use this file except in compliance with the License. You may obtain a copy of
+% the License at
+%
+%   http://www.apache.org/licenses/LICENSE-2.0
+%
+% Unless required by applicable law or agreed to in writing, software
+% distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
+% WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
+% License for the specific language governing permissions and limitations under
+% the License.
+
+-module(test_web).
+-behaviour(gen_server).
+
+-export([start_link/0, loop/1, get_port/0, set_assert/1, check_last/0]).
+-export([init/1, terminate/2, code_change/3]).
+-export([handle_call/3, handle_cast/2, handle_info/2]).
+
+-define(SERVER, test_web_server).
+-define(HANDLER, test_web_handler).
+
+start_link() ->
+    gen_server:start({local, ?HANDLER}, ?MODULE, [], []),
+    mochiweb_http:start([
+        {name, ?SERVER},
+        {loop, {?MODULE, loop}},
+        {port, 0}
+    ]).
+
+loop(Req) ->
+    %etap:diag("Handling request: ~p", [Req]),
+    case gen_server:call(?HANDLER, {check_request, Req}) of
+        {ok, RespInfo} ->
+            {ok, Req:respond(RespInfo)};
+        {raw, {Status, Headers, BodyChunks}} ->
+            Resp = Req:start_response({Status, Headers}),
+            lists:foreach(fun(C) -> Resp:send(C) end, BodyChunks),
+            erlang:put(mochiweb_request_force_close, true),
+            {ok, Resp};
+        {chunked, {Status, Headers, BodyChunks}} ->
+            Resp = Req:respond({Status, Headers, chunked}),
+            timer:sleep(500),
+            lists:foreach(fun(C) -> Resp:write_chunk(C) end, BodyChunks),
+            Resp:write_chunk([]),
+            {ok, Resp};
+        {error, Reason} ->
+            etap:diag("Error: ~p", [Reason]),
+            Body = lists:flatten(io_lib:format("Error: ~p", [Reason])),
+            {ok, Req:respond({200, [], Body})}
+    end.
+
+get_port() ->
+    mochiweb_socket_server:get(?SERVER, port).
+
+set_assert(Fun) ->
+    ok = gen_server:call(?HANDLER, {set_assert, Fun}).
+
+check_last() ->
+    gen_server:call(?HANDLER, last_status).
+
+init(_) ->
+    {ok, nil}.
+
+terminate(_Reason, _State) ->
+    ok.
+
+handle_call({check_request, Req}, _From, State) when is_function(State, 1) ->
+    Resp2 = case (catch State(Req)) of
+        {ok, Resp} -> {reply, {ok, Resp}, was_ok};
+        {raw, Resp} -> {reply, {raw, Resp}, was_ok};
+        {chunked, Resp} -> {reply, {chunked, Resp}, was_ok};
+        Error -> {reply, {error, Error}, not_ok}
+    end,
+    Req:cleanup(),
+    Resp2;
+handle_call({check_request, _Req}, _From, _State) ->
+    {reply, {error, no_assert_function}, not_ok};
+handle_call(last_status, _From, State) when is_atom(State) ->
+    {reply, State, nil};
+handle_call(last_status, _From, State) ->
+    {reply, {error, not_checked}, State};
+handle_call({set_assert, Fun}, _From, nil) ->
+    {reply, ok, Fun};
+handle_call({set_assert, _}, _From, State) ->
+    {reply, {error, assert_function_set}, State};
+handle_call(Msg, _From, State) ->
+    {reply, {ignored, Msg}, State}.
+
+handle_cast(Msg, State) ->
+    etap:diag("Ignoring cast message: ~p", [Msg]),
+    {noreply, State}.
+
+handle_info(Msg, State) ->
+    etap:diag("Ignoring info message: ~p", [Msg]),
+    {noreply, State}.
+
+code_change(_OldVsn, State, _Extra) ->
+    {ok, State}.
diff --git a/couchjs/js/json2.js b/couchjs/js/json2.js
index 39d8f370..a1a3b170 100644
--- a/couchjs/js/json2.js
+++ b/couchjs/js/json2.js
@@ -1,6 +1,6 @@
 /*
     http://www.JSON.org/json2.js
-    2009-09-29
+    2010-03-20
 
     Public Domain.
 
@@ -433,6 +433,7 @@ if (!this.JSON) {
 // Unicode characters with escape sequences. JavaScript handles many characters
 // incorrectly, either silently deleting them, or treating them as line endings.
 
+            text = String(text);
             cx.lastIndex = 0;
             if (cx.test(text)) {
                 text = text.replace(cx, function (a) {
diff --git a/couchjs/js/loop.js b/couchjs/js/loop.js
index a988684f..d2a07f61 100644
--- a/couchjs/js/loop.js
+++ b/couchjs/js/loop.js
@@ -101,6 +101,7 @@ var Loop = function() {
     // "view"    : Views.handler,
     "reset"    : State.reset,
     "add_fun"  : State.addFun,
+    "add_lib"  : State.addLib,
     "map_doc"  : Views.mapDoc,
     "reduce"   : Views.reduce,
     "rereduce" : Views.rereduce
diff --git a/couchjs/js/render.js b/couchjs/js/render.js
index 9dcfbcd6..d207db41 100644
--- a/couchjs/js/render.js
+++ b/couchjs/js/render.js
@@ -72,7 +72,7 @@ var Mime = (function() {
     Mime.responseContentType = null;  
   };
 
-  function runProvides(req) {
+  function runProvides(req, ddoc) {
     var supportedMimes = [], bestFun, bestKey = null, accept = req.headers["Accept"];
     if (req.query && req.query.format) {
       bestKey = req.query.format;
@@ -103,7 +103,7 @@ var Mime = (function() {
     };
 
     if (bestFun) {
-      return bestFun();
+      return bestFun.call(ddoc);
     } else {
       var supportedTypes = mimeFuns.map(function(mf) {return mimesByKey[mf[0]].join(', ') || mf[0]});
       throw(["error","not_acceptable",
@@ -233,7 +233,7 @@ var Render = (function() {
       }
 
       if (Mime.providesUsed) {
-        resp = Mime.runProvides(args[1]);
+        resp = Mime.runProvides(args[1], ddoc);
         resp = applyContentType(maybeWrapResponse(resp), Mime.responseContentType);
       }
 
@@ -287,7 +287,7 @@ var Render = (function() {
       var tail = listFun.apply(ddoc, args);
 
       if (Mime.providesUsed) {
-        tail = Mime.runProvides(req);
+        tail = Mime.runProvides(req, ddoc);
       }    
       if (!gotRow) getRow();
       if (typeof tail != "undefined") {
diff --git a/couchjs/js/state.js b/couchjs/js/state.js
index 9af9e475..e6416382 100644
--- a/couchjs/js/state.js
+++ b/couchjs/js/state.js
@@ -14,6 +14,7 @@ var State = {
   reset : function(config) {
     // clear the globals and run gc
     State.funs = [];
+    State.lib = null;
     State.query_config = config || {};
     init_sandbox();
     gc();
@@ -21,7 +22,11 @@ var State = {
   },
   addFun : function(newFun) {
     // Compile to a function and add it to funs array
-    State.funs.push(Couch.compileFunction(newFun));
+    State.funs.push(Couch.compileFunction(newFun, {views : {lib : State.lib}}));
+    print("true");
+  },
+  addLib : function(lib) {
+    State.lib = lib;
     print("true");
   }
 }
diff --git a/couchjs/js/util.js b/couchjs/js/util.js
index b55480b9..e4386701 100644
--- a/couchjs/js/util.js
+++ b/couchjs/js/util.js
@@ -31,16 +31,16 @@ var resolveModule = function(names, mod, root) {
     }
     return resolveModule(names, {
       id : mod.id.slice(0, mod.id.lastIndexOf('/')),
-      parent : mod.parent.parent.parent,
-      current : mod.parent.parent.current
+      parent : mod.parent.parent,
+      current : mod.parent.current
     });
   } else if (n == '.') {
     if (!mod.parent) {
       throw ["error", "invalid_require_path", 'Object has no parent '+JSON.stringify(mod.current)];
     }
     return resolveModule(names, {
-      parent : mod.parent.parent,
-      current : mod.parent.current,
+      parent : mod.parent,
+      current : mod.current,
       id : mod.id
     });
   } else if (root) {
@@ -66,17 +66,28 @@ var Couch = {
     try {
       if (sandbox) {
         if (ddoc) {
+          if (!ddoc._module_cache) {
+            ddoc._module_cache = {};
+          }
           var require = function(name, module) {
             module = module || {};
-            var newModule = resolveModule(name.split('/'), module, ddoc);
-            var s = "function (module, exports, require) { " + newModule.current + " }";
-            try {
-              var func = sandbox ? evalcx(s, sandbox) : eval(s);
-              func.apply(sandbox, [newModule, newModule.exports, function(name) {return require(name, newModule)}]);
-            } catch(e) { 
-              throw ["error","compilation_error","Module require('"+name+"') raised error "+e.toSource()]; 
+            var newModule = resolveModule(name.split('/'), module.parent, ddoc);
+            if (!ddoc._module_cache.hasOwnProperty(newModule.id)) {
+              // create empty exports object before executing the module,
+              // stops circular requires from filling the stack
+              ddoc._module_cache[newModule.id] = {};
+              var s = "function (module, exports, require) { " + newModule.current + " }";
+              try {
+                var func = sandbox ? evalcx(s, sandbox) : eval(s);
+                func.apply(sandbox, [newModule, newModule.exports, function(name) {
+                  return require(name, newModule);
+                }]);
+              } catch(e) { 
+                throw ["error","compilation_error","Module require('"+name+"') raised error "+e.toSource()]; 
+              }
+              ddoc._module_cache[newModule.id] = newModule.exports;
             }
-            return newModule.exports;
+            return ddoc._module_cache[newModule.id];
           }
           sandbox.require = require;
         }
diff --git a/rebar.config b/rebar.config
index 8aa55d7e..6fb5113f 100644
--- a/rebar.config
+++ b/rebar.config
@@ -16,9 +16,9 @@
     {oauth, ".*", {git, "https://github.com/cloudant/erlang-oauth.git",
         {branch, "couch"}}},
     {ibrowse, ".*", {git, "https://github.com/cloudant/ibrowse.git",
-        {branch, "couch2"}}},
+        {branch, "couch_1.1"}}},
     {mochiweb, ".*", {git, "https://github.com/cloudant/mochiweb.git",
-        {branch, "couch"}}},
+        {branch, "couch_1.1"}}},
     {rexi, ".*", {git, "https://github.com/cloudant/rexi.git",
         master}},
     {fabric, ".*", {git, "https://github.com/cloudant/fabric.git",
diff --git a/rel/overlay/etc/default.ini b/rel/overlay/etc/default.ini
index cf06a1ec..81c363da 100644
--- a/rel/overlay/etc/default.ini
+++ b/rel/overlay/etc/default.ini
@@ -26,6 +26,13 @@ default_handler = {couch_httpd_db, handle_request}
 secure_rewrites = true
 vhost_global_handlers = _utils, _uuids, _session, _oauth, _users
 allow_jsonp = false
+; Options for the MochiWeb HTTP server.
+;server_options = [{backlog, 128}, {acceptor_pool_size, 16}]
+; For more socket options, consult Erlang's module 'inet' man page.
+;socket_options = [{recbuf, 262144}, {sndbuf, 262144}, {nodelay, true}]
+
+[ssl]
+port = 6984
 
 [log]
 file = {{prefix}}/var/log/bigcouch.log
@@ -36,7 +43,7 @@ include_sasl = true
 authentication_db = _users
 authentication_redirect = /_utils/session.html
 require_valid_user = false
-timeout = 600 ; number of seconds before automatic logout
+timeout = 43200 ; (default to 12 hours) number of seconds before automatic logout
 auth_cache_size = 50 ; size is number of cache entries
 
 [query_servers]
@@ -44,6 +51,7 @@ javascript = {{prefix}}/bin/couchjs {{prefix}}/share/couchjs/main.js
 
 [query_server_config]
 reduce_limit = true
+os_process_limit = 25
 
 [daemons]
 view_manager={couch_view, start_link, []}
@@ -54,6 +62,9 @@ stats_aggregator={couch_stats_aggregator, start, []}
 stats_collector={couch_stats_collector, start, []}
 uuids={couch_uuids, start, []}
 auth_cache={couch_auth_cache, start_link, []}
+replication_manager={couch_replication_manager, start_link, []}
+vhosts={couch_httpd_vhost, start_link, []}
+os_daemons={couch_os_daemons, start_link, []}
 
 [httpd_global_handlers]
 / = {couch_httpd_misc_handlers, handle_welcome_req, <<"Welcome">>}
@@ -87,6 +98,18 @@ _info = {couch_httpd_db,   handle_design_info_req}
 _rewrite = {couch_httpd_rewrite, handle_rewrite_req}
 _update = {couch_httpd_show, handle_doc_update_req}
 
+; enable external as an httpd handler, then link it with commands here.
+; note, this api is still under consideration.
+; [external]
+; mykey = /path/to/mycommand
+
+; Here you can setup commands for CouchDB to manage
+; while it is alive. It will attempt to keep each command
+; alive if it exits.
+; [os_daemons]
+; some_daemon_name = /path/to/script -with args
+
+
 [uuids]
 ; Known algorithms:
 ;   random - 128 bits of random awesome
@@ -107,9 +130,12 @@ samples = [0, 60, 300, 900]
 
 [attachments]
 compression_level = 8 ; from 1 (lowest, fastest) to 9 (highest, slowest), 0 to disable compression
-compressible_types = text/*, application/javascript, application/json,  application/xml
+compressible_types = text/*, application/javascript, application/json, application/xml
 
 [replicator]
+db = _replicator
+; Maximum replicaton retry count can be a non-negative integer or "infinity".
+max_replication_retry_count = 10
 max_http_sessions = 20
 max_http_pipeline_size = 50
 ; set to true to validate peer certificates
diff --git a/rel/overlay/share/www/_sidebar.html b/rel/overlay/share/www/_sidebar.html
index 13727cbd..563a85c8 100644
--- a/rel/overlay/share/www/_sidebar.html
+++ b/rel/overlay/share/www/_sidebar.html
@@ -35,16 +35,15 @@ specific language governing permissions and limitations under the License.
         <a href="#" class="signup">Signup</a> or <a href="#" class="login">Login</a>
       </span>
       <span class="loggedin">
-        Welcome <a class="name">?</a>! 
+        Welcome <a class="name">?</a>!
         <br/>
+        <span class="loggedinadmin">
+          <a href="#" class="createadmin">Setup more admins</a> or
+          <br/>
+        </span>
+        <a href="#" class="changepass">Change password</a> or
         <a href="#" class="logout">Logout</a>
       </span>
-      <span class="loggedinadmin">
-        Welcome <a class="name">?</a>! 
-        <br/>
-        <a href="#" class="createadmin">Setup more admins</a> or
-        <a href="#" class="logout">Logout</a> 
-      </span>
       <span class="adminparty">
         Welcome to Admin Party! 
         <br/>
diff --git a/rel/overlay/share/www/couch_tests.html b/rel/overlay/share/www/couch_tests.html
index 46893d71..f10bad23 100644
--- a/rel/overlay/share/www/couch_tests.html
+++ b/rel/overlay/share/www/couch_tests.html
@@ -68,7 +68,10 @@ specific language governing permissions and limitations under the License.
         <strong>Note:</strong> Each of the tests will block the browser. If the
         connection to your CouchDB server is slow, running the tests will take
         some time, and you'll not be able to do much with your browser while
-        a test is being executed.
+        a test is being executed. <strong>Also:</strong> The test suite is designed
+        to work with Firefox (with Firebug disabled). Patches are welcome for 
+        convenience compatibility with other browsers, but official support is
+        for Firefox (latest stable version) only.
       </p>
 
       <table class="listing" id="tests" cellspacing="0">
diff --git a/rel/overlay/share/www/custom_test.html b/rel/overlay/share/www/custom_test.html
index 9292068a..2566a000 100644
--- a/rel/overlay/share/www/custom_test.html
+++ b/rel/overlay/share/www/custom_test.html
@@ -27,7 +27,7 @@ specific language governing permissions and limitations under the License.
     <script src="script/jquery.resizer.js?0.11.0"></script>
     <script src="script/couch.js?0.11.0"></script>
     <script src="script/couch_test_runner.js?0.11.0"></script>
-    
+    <script src="script/couch_tests.js"></script>
     <script>
       function T(arg, desc) {
         if(!arg) {
diff --git a/rel/overlay/share/www/dialog/_change_password.html b/rel/overlay/share/www/dialog/_change_password.html
new file mode 100644
index 00000000..40601d9a
--- /dev/null
+++ b/rel/overlay/share/www/dialog/_change_password.html
@@ -0,0 +1,31 @@
+<!--
+
+Licensed under the Apache License, Version 2.0 (the "License"); you may not use
+this file except in compliance with the License. You may obtain a copy of the
+License at
+
+   http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software distributed
+under the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR
+CONDITIONS OF ANY KIND, either express or implied. See the License for the
+specific language governing permissions and limitations under the License.
+
+-->
+<form action="" method="post">
+  <h2>Change Password</h2>
+  <fieldset>
+    <table summary=""><tbody><tr>
+      <th><label>New Password:</label></th>
+      <td><input type="password" name="password" size="24" /></td>
+    </tr><tr>
+      <th><label>Verify New Password:</label></th>
+      <td><input type="password" name="verify_password" size="24" /></td>
+    </tr>
+    </tbody></table>
+  </fieldset>
+  <div class="buttons">
+    <button type="submit">Login</button>
+    <button type="button" class="cancel">Cancel</button>
+  </div>
+</form>
diff --git a/rel/overlay/share/www/image/spinner_33.gif b/rel/overlay/share/www/image/spinner_33.gif
new file mode 100644
index 00000000..5ad51927
--- /dev/null
+++ b/rel/overlay/share/www/image/spinner_33.gif
diff --git a/rel/overlay/share/www/image/spinner_6b.gif b/rel/overlay/share/www/image/spinner_6b.gif
new file mode 100644
index 00000000..4e3d9725
--- /dev/null
+++ b/rel/overlay/share/www/image/spinner_6b.gif
diff --git a/rel/overlay/share/www/replicator.html b/rel/overlay/share/www/replicator.html
index 70c0a86c..dced6f9c 100644
--- a/rel/overlay/share/www/replicator.html
+++ b/rel/overlay/share/www/replicator.html
@@ -18,14 +18,18 @@ specific language governing permissions and limitations under the License.
     <title>Replicator</title>
     <meta http-equiv="Content-Type" content="text/html;charset=utf-8">
     <link rel="stylesheet" href="style/layout.css?0.11.0" type="text/css">
+    <link rel="stylesheet" href="style/jquery-ui-1.8.11.custom.css" type="text/css">
     <script src="script/json2.js"></script>
     <script src="script/sha1.js"></script>
     <script src="script/jquery.js?1.4.2"></script>
     <script src="script/jquery.couch.js?0.11.0"></script>
     <script src="script/jquery.dialog.js?0.11.0"></script>
     <script src="script/futon.js?0.11.0"></script>
+    <script src="script/jquery-ui-1.8.11.custom.min.js"></script>
     <script>
       $(document).ready(function() {
+        var allDatabases;
+
         $("fieldset input[type=radio]").click(function() {
           var radio = this;
           var fieldset = $(this).parents("fieldset").get(0);
@@ -33,15 +37,17 @@ specific language governing permissions and limitations under the License.
             this.disabled = radio.value == "local";
             if (!this.disabled) this.focus();
           });
-          $("select", fieldset).each(function() {
+          $('.local', fieldset).each(function() {
             this.disabled = radio.value == "remote";
             if (!this.disabled) this.focus();
           });
         });
 
+        var getDatabases = function() {
         $.couch.allDbs({
           success: function(dbs) {
-            dbs.sort();
+              allDatabases = dbs.sort();
+
             $("fieldset select").each(function() {
               var select = this;
               $.each(dbs, function(idx, dbName) {
@@ -49,8 +55,12 @@ specific language governing permissions and limitations under the License.
               });
               select.selectedIndex = 0;
             });
+
+              $('#to_name').autocomplete({ source: dbs });
           }
         });
+        };
+        getDatabases();
 
         $("button#swap").click(function() {
           var fromName = $("#source select").val();
@@ -76,9 +86,20 @@ specific language governing permissions and limitations under the License.
 
         $("button#replicate").click(function() {
           $("#records tbody.content").empty();
+          var targetIsLocal = $('#to_local:checked').length > 0;
           var source = $("#from_local")[0].checked ? $("#from_name").val() : $("#from_url").val();
-          var target = $("#to_local")[0].checked ? $("#to_name").val() : $("#to_url").val();
+          var target = targetIsLocal ? $("#to_name").val() : $("#to_url").val();
           var repOpts = {};
+
+          if (targetIsLocal && $.inArray(target, allDatabases) < 0) {
+            if(!confirm('This will create a database named '+target+'. Ok?')) {
+              return;
+            }
+            else {
+              repOpts.create_target = true;
+            }
+          }
+
           if ($("#continuous")[0].checked) {
             repOpts.continuous = true;
           }
@@ -97,6 +118,10 @@ specific language governing permissions and limitations under the License.
                 });
                 $("#records tbody tr").removeClass("odd").filter(":odd").addClass("odd");
                 $("#records tbody.footer td").text("Replication session " + resp.session_id);
+
+                if (repOpts.create_target) {
+                  getDatabases();
+                }
               }
             }
           }, repOpts);
@@ -115,22 +140,26 @@ specific language governing permissions and limitations under the License.
         <fieldset id="source">
           <legend>Replicate changes from:</legend>
           <p>
-            <label><input type="radio" id="from_local" name="from_type" value="local" checked> Local</label>
-            <label>database: <select id="from_name" name="from_name"></select></label>
+            <input type="radio" id="from_local" name="from_type" value="local" checked> 
+            <label for="from_local">Local Database: </label>
+            <select id="from_name" name="from_name" class="local"></select>
           </p><p>
-            <label><input type="radio" id="from_to_remote" name="from_type" value="remote"> Remote</label>
-            <label>database: <input type="text" id="from_url" name="from_url" size="30" value="http://" disabled></label>
+            <input type="radio" id="from_to_remote" name="from_type" value="remote"> 
+            <label for="from_to_remote">Remote database: </label>
+            <input type="text" id="from_url" name="from_url" size="30" value="http://" disabled>
           </p>
         </fieldset>
         <p class="swap"><button id="swap" tabindex="99">⇄</button></p>
         <fieldset id="target">
           <legend>to:</legend>
           <p>
-            <label><input type="radio" id="to_local" name="to_type" value="local" checked> Local</label>
-            <label>database: <select id="to_name" name="to_name"></select></label>
+            <input type="radio" id="to_local" name="to_type" value="local" checked> 
+            <label for="to_local">Local database: </label>
+            <input type="text" id="to_name" name="to_name" class="local"></select>
           </p><p>
-            <label><input type="radio" id="to_remote" name="to_type" value="remote"> Remote</label>
-            <label>database: <input type="text" id="to_url" name="to_url" size="30" value="http://" disabled></label>
+            <input type="radio" id="to_remote" name="to_type" value="remote"> 
+            <label for="to_remote">Remote database: </label>
+            <input type="text" id="to_url" name="to_url" size="30" value="http://" disabled>
           </p>
         </fieldset>
         <p class="actions">
diff --git a/rel/overlay/share/www/script/couch.js b/rel/overlay/share/www/script/couch.js
index ca860bd5..6a997cff 100644
--- a/rel/overlay/share/www/script/couch.js
+++ b/rel/overlay/share/www/script/couch.js
@@ -272,7 +272,7 @@ function CouchDB(name, httpHeaders) {
       for (var name in options) {
         if (!options.hasOwnProperty(name)) { continue; };
         var value = options[name];
-        if (name == "key" || name == "startkey" || name == "endkey") {
+        if (name == "key" || name == "keys" || name == "startkey" || name == "endkey") {
           value = toJSON(value);
         }
         buf.push(encodeURIComponent(name) + "=" + encodeURIComponent(value));
@@ -402,7 +402,7 @@ CouchDB.request = function(method, uri, options) {
   options.headers["Content-Type"] = options.headers["Content-Type"] || options.headers["content-type"] || "application/json";
   options.headers["Accept"] = options.headers["Accept"] || options.headers["accept"] || "application/json";
   var req = CouchDB.newXhr();
-  if(uri.substr(0, "http://".length) != "http://") {
+  if(uri.substr(0, CouchDB.protocol.length) != CouchDB.protocol) {
     uri = CouchDB.urlPrefix + uri;
   }
   req.open(method, uri, false);
diff --git a/rel/overlay/share/www/script/couch_tests.js b/rel/overlay/share/www/script/couch_tests.js
index 896b3538..eb573526 100644
--- a/rel/overlay/share/www/script/couch_tests.js
+++ b/rel/overlay/share/www/script/couch_tests.js
@@ -13,10 +13,12 @@
 // Used by replication test
 if (typeof window == 'undefined' || !window) {
   CouchDB.host = "127.0.0.1:5984";
+  CouchDB.protocol = "http://";
   CouchDB.inBrowser = false;
 } else {
   CouchDB.host = window.location.host;
   CouchDB.inBrowser = true;
+  CouchDB.protocol = window.location.protocol + "//";
 }
 
 CouchDB.urlPrefix = "..";
@@ -35,6 +37,7 @@ loadTest("attachments_multipart.js");
 loadTest("attachment_conflicts.js");
 loadTest("attachment_names.js");
 loadTest("attachment_paths.js");
+loadTest("attachment_ranges.js");
 loadTest("attachment_views.js");
 loadTest("auth_cache.js");
 loadTest("batch_save.js");
@@ -74,6 +77,7 @@ loadTest("reduce_builtin.js");
 loadTest("reduce_false.js");
 loadTest("reduce_false_temp.js");
 loadTest("replication.js");
+loadTest("replicator_db.js");
 loadTest("rev_stemming.js");
 loadTest("rewrite.js");
 loadTest("security_validation.js");
diff --git a/rel/overlay/share/www/script/futon.browse.js b/rel/overlay/share/www/script/futon.browse.js
index a3f6e8cb..b981feec 100644
--- a/rel/overlay/share/www/script/futon.browse.js
+++ b/rel/overlay/share/www/script/futon.browse.js
@@ -682,10 +682,12 @@
               key = $.futon.formatJSON(row.key, {indent: 0, linesep: ""});
             }
             if (row.id) {
-              $("<td class='key'><a href='document.html?" + encodeURIComponent(db.name) +
-                "/" + $.couch.encodeDocId(row.id) + "'><strong></strong><br>" +
-                "<span class='docid'>ID:&nbsp;" + $.futon.escape(row.id) + "</span></a></td>")
-                .find("strong").text(key).end()
+              key = key.replace(/\\"/, '"');
+              var rowlink = encodeURIComponent(db.name) +
+                "/" + $.couch.encodeDocId(row.id);
+              $("<td class='key'><a href=\"document.html?" + rowlink + "\"><strong>"
+                 + $.futon.escape(key) + "</strong><br>"
+                 + "<span class='docid'>ID:&nbsp;" + $.futon.escape(row.id) + "</span></a></td>")
                 .appendTo(tr);
             } else {
               $("<td class='key'><strong></strong></td>")
diff --git a/rel/overlay/share/www/script/futon.format.js b/rel/overlay/share/www/script/futon.format.js
index 8d9b7f5c..0eb9b104 100644
--- a/rel/overlay/share/www/script/futon.format.js
+++ b/rel/overlay/share/www/script/futon.format.js
@@ -17,8 +17,8 @@
       return string.replace(/&/g, "&amp;")
                    .replace(/</g, "&lt;")
                    .replace(/>/g, "&gt;")
-                   .replace(/"/, "&quot;")
-                   .replace(/'/, "&#39;")
+                   .replace(/"/g, "&quot;")
+                   .replace(/'/g, "&#39;")
                    ;
     },
 
diff --git a/rel/overlay/share/www/script/futon.js b/rel/overlay/share/www/script/futon.js
index c4647ed1..fb73e3c9 100644
--- a/rel/overlay/share/www/script/futon.js
+++ b/rel/overlay/share/www/script/futon.js
@@ -68,6 +68,10 @@ function $$(node) {
         callback({name: "Please enter a name."});
         return false;
       };
+      return validatePassword(data, callback);
+    };
+
+    function validatePassword(data, callback) {
       if (!data.password || data.password.length == 0) {
         callback({password: "Please enter a password."});
         return false;
@@ -129,11 +133,61 @@ function $$(node) {
       return false;
     };
 
+    function changePassword () {
+      $.showDialog("dialog/_change_password.html", {
+        submit: function(data, callback) {
+          if (validatePassword(data, callback)) {
+            if (data.password != data.verify_password) {
+              callback({verify_password: "Passwords don't match."});
+              return false;
+            }
+          } else {
+            return false;
+          }
+          $.couch.session({success: function (resp) {
+            if (resp.userCtx.roles.indexOf("_admin") > -1) {
+              $.couch.config({
+                success : function () {
+                  doLogin(resp.userCtx.name, data.password, function(errors) {
+                    if(!$.isEmptyObject(errors)) {
+                      callback(errors);
+                      return;
+                    } else {
+                      location.reload();
+                    }
+                  });
+                }
+              }, "admins", resp.userCtx.name, data.password);
+            } else {
+              $.couch.db(resp.info.authentication_db).openDoc("org.couchdb.user:"+resp.userCtx.name, {
+                success: function (user) {
+                    $.couch.db(resp.info.authentication_db).saveDoc($.couch.prepareUserDoc(user, data.password), {
+                      success: function() {
+                          doLogin(user.name, data.password, function(errors) {
+                              if(!$.isEmptyObject(errors)) {
+                                callback(errors);
+                                return;
+                              } else {
+                                location.reload();
+                              }
+                            });
+                          }
+                      });
+                  }
+              });
+            }
+          }});
+        }
+      });
+      return false;
+    };
+
     this.setupSidebar = function() {
       $("#userCtx .login").click(login);
       $("#userCtx .logout").click(logout);
       $("#userCtx .signup").click(signup);
       $("#userCtx .createadmin").click(createAdmin);
+      $("#userCtx .changepass").click(changePassword);
     };
     
     this.sidebar = function() {
@@ -146,6 +200,7 @@ function $$(node) {
           if (userCtx.name) {
             $("#userCtx .name").text(userCtx.name).attr({href : $.couch.urlPrefix + "/_utils/document.html?"+encodeURIComponent(r.info.authentication_db)+"/org.couchdb.user%3A"+encodeURIComponent(userCtx.name)});
             if (userCtx.roles.indexOf("_admin") != -1) {
+              $("#userCtx .loggedin").show();
               $("#userCtx .loggedinadmin").show();
             } else {
               $("#userCtx .loggedin").show();
diff --git a/rel/overlay/share/www/script/jquery-ui-1.8.11.custom.min.js b/rel/overlay/share/www/script/jquery-ui-1.8.11.custom.min.js
new file mode 100644
index 00000000..45b927e0
--- /dev/null
+++ b/rel/overlay/share/www/script/jquery-ui-1.8.11.custom.min.js
@@ -0,0 +1,81 @@
+/*!
+ * jQuery UI 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI
+ */
+(function(c,j){function k(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.11",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,
+NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d=this;setTimeout(function(){c(d).focus();b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this,
+"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position");
+if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,l,m){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(l)g-=parseFloat(c.curCSS(f,
+"border"+this+"Width",true))||0;if(m)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight,outerWidth:c.fn.outerWidth,outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h,
+d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){var b=a.nodeName.toLowerCase(),d=c.attr(a,"tabindex");if("area"===b){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&k(a)}return(/input|select|textarea|button|object/.test(b)?!a.disabled:"a"==b?a.href||!isNaN(d):!isNaN(d))&&k(a)},tabbable:function(a){var b=c.attr(a,"tabindex");return(isNaN(b)||b>=0)&&c(a).is(":focusable")}});
+c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&&a.element[0].parentNode)for(var e=0;e<b.length;e++)a.options[b[e][0]]&&
+b[e][1].apply(a.element,d)}},contains:function(a,b){return document.compareDocumentPosition?a.compareDocumentPosition(b)&16:a!==b&&a.contains(b)},hasScroll:function(a,b){if(c(a).css("overflow")==="hidden")return false;b=b&&b==="left"?"scrollLeft":"scrollTop";var d=false;if(a[b]>0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a<b+d},isOver:function(a,b,d,e,h,i){return c.ui.isOverAxis(a,d,h)&&c.ui.isOverAxis(b,e,i)}})}})(jQuery);
+;/*!
+ * jQuery UI Widget 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Widget
+ */
+(function(b,j){if(b.cleanData){var k=b.cleanData;b.cleanData=function(a){for(var c=0,d;(d=a[c])!=null;c++)b(d).triggerHandler("remove");k(a)}}else{var l=b.fn.remove;b.fn.remove=function(a,c){return this.each(function(){if(!c)if(!a||b.filter(a,[this]).length)b("*",this).add([this]).each(function(){b(this).triggerHandler("remove")});return l.call(b(this),a,c)})}}b.widget=function(a,c,d){var e=a.split(".")[0],f;a=a.split(".")[1];f=e+"-"+a;if(!d){d=c;c=b.Widget}b.expr[":"][f]=function(h){return!!b.data(h,
+a)};b[e]=b[e]||{};b[e][a]=function(h,g){arguments.length&&this._createWidget(h,g)};c=new c;c.options=b.extend(true,{},c.options);b[e][a].prototype=b.extend(true,c,{namespace:e,widgetName:a,widgetEventPrefix:b[e][a].prototype.widgetEventPrefix||a,widgetBaseClass:f},d);b.widget.bridge(a,b[e][a])};b.widget.bridge=function(a,c){b.fn[a]=function(d){var e=typeof d==="string",f=Array.prototype.slice.call(arguments,1),h=this;d=!e&&f.length?b.extend.apply(null,[true,d].concat(f)):d;if(e&&d.charAt(0)==="_")return h;
+e?this.each(function(){var g=b.data(this,a),i=g&&b.isFunction(g[d])?g[d].apply(g,f):g;if(i!==g&&i!==j){h=i;return false}}):this.each(function(){var g=b.data(this,a);g?g.option(d||{})._init():b.data(this,a,new c(d,this))});return h}};b.Widget=function(a,c){arguments.length&&this._createWidget(a,c)};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(a,c){b.data(c,this.widgetName,this);this.element=b(c);this.options=b.extend(true,{},this.options,
+this._getCreateOptions(),a);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")},
+widget:function(){return this.element},option:function(a,c){var d=a;if(arguments.length===0)return b.extend({},this.options);if(typeof a==="string"){if(c===j)return this.options[a];d={};d[a]=c}this._setOptions(d);return this},_setOptions:function(a){var c=this;b.each(a,function(d,e){c._setOption(d,e)});return this},_setOption:function(a,c){this.options[a]=c;if(a==="disabled")this.widget()[c?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",c);return this},
+enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(a,c,d){var e=this.options[a];c=b.Event(c);c.type=(a===this.widgetEventPrefix?a:this.widgetEventPrefix+a).toLowerCase();d=d||{};if(c.originalEvent){a=b.event.props.length;for(var f;a;){f=b.event.props[--a];c[f]=c.originalEvent[f]}}this.element.trigger(c,d);return!(b.isFunction(e)&&e.call(this.element[0],c,d)===false||c.isDefaultPrevented())}}})(jQuery);
+;/*
+ * jQuery UI Position 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Position
+ */
+(function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY,
+left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+=
+k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+(parseInt(c.curCSS(this,"marginRight",true))||0),w=m+q+(parseInt(c.curCSS(this,"marginBottom",true))||0),i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-=
+m/2;i.left=Math.round(i.left);i.top=Math.round(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left=
+d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+=
+a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b),
+g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery);
+;/*
+ * jQuery UI Autocomplete 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Autocomplete
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.widget.js
+ *	jquery.ui.position.js
+ */
+(function(d){var e=0;d.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:false,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var a=this,b=this.element[0].ownerDocument,g;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(!(a.options.disabled||a.element.attr("readonly"))){g=
+false;var f=d.ui.keyCode;switch(c.keyCode){case f.PAGE_UP:a._move("previousPage",c);break;case f.PAGE_DOWN:a._move("nextPage",c);break;case f.UP:a._move("previous",c);c.preventDefault();break;case f.DOWN:a._move("next",c);c.preventDefault();break;case f.ENTER:case f.NUMPAD_ENTER:if(a.menu.active){g=true;c.preventDefault()}case f.TAB:if(!a.menu.active)return;a.menu.select(c);break;case f.ESCAPE:a.element.val(a.term);a.close(c);break;default:clearTimeout(a.searching);a.searching=setTimeout(function(){if(a.term!=
+a.element.val()){a.selectedItem=null;a.search(null,c)}},a.options.delay);break}}}).bind("keypress.autocomplete",function(c){if(g){g=false;c.preventDefault()}}).bind("focus.autocomplete",function(){if(!a.options.disabled){a.selectedItem=null;a.previous=a.element.val()}}).bind("blur.autocomplete",function(c){if(!a.options.disabled){clearTimeout(a.searching);a.closing=setTimeout(function(){a.close(c);a._change(c)},150)}});this._initSource();this.response=function(){return a._response.apply(a,arguments)};
+this.menu=d("<ul></ul>").addClass("ui-autocomplete").appendTo(d(this.options.appendTo||"body",b)[0]).mousedown(function(c){var f=a.menu.element[0];d(c.target).closest(".ui-menu-item").length||setTimeout(function(){d(document).one("mousedown",function(h){h.target!==a.element[0]&&h.target!==f&&!d.ui.contains(f,h.target)&&a.close()})},1);setTimeout(function(){clearTimeout(a.closing)},13)}).menu({focus:function(c,f){f=f.item.data("item.autocomplete");false!==a._trigger("focus",c,{item:f})&&/^key/.test(c.originalEvent.type)&&
+a.element.val(f.value)},selected:function(c,f){var h=f.item.data("item.autocomplete"),i=a.previous;if(a.element[0]!==b.activeElement){a.element.focus();a.previous=i;setTimeout(function(){a.previous=i;a.selectedItem=h},1)}false!==a._trigger("select",c,{item:h})&&a.element.val(h.value);a.term=a.element.val();a.close(c);a.selectedItem=h},blur:function(){a.menu.element.is(":visible")&&a.element.val()!==a.term&&a.element.val(a.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu");
+d.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");this.menu.element.remove();d.Widget.prototype.destroy.call(this)},_setOption:function(a,b){d.Widget.prototype._setOption.apply(this,arguments);a==="source"&&this._initSource();if(a==="appendTo")this.menu.element.appendTo(d(b||"body",this.element[0].ownerDocument)[0]);a==="disabled"&&
+b&&this.xhr&&this.xhr.abort()},_initSource:function(){var a=this,b,g;if(d.isArray(this.options.source)){b=this.options.source;this.source=function(c,f){f(d.ui.autocomplete.filter(b,c.term))}}else if(typeof this.options.source==="string"){g=this.options.source;this.source=function(c,f){a.xhr&&a.xhr.abort();a.xhr=d.ajax({url:g,data:c,dataType:"json",autocompleteRequest:++e,success:function(h){this.autocompleteRequest===e&&f(h)},error:function(){this.autocompleteRequest===e&&f([])}})}}else this.source=
+this.options.source},search:function(a,b){a=a!=null?a:this.element.val();this.term=this.element.val();if(a.length<this.options.minLength)return this.close(b);clearTimeout(this.closing);if(this._trigger("search",b)!==false)return this._search(a)},_search:function(a){this.pending++;this.element.addClass("ui-autocomplete-loading");this.source({term:a},this.response)},_response:function(a){if(!this.options.disabled&&a&&a.length){a=this._normalize(a);this._suggest(a);this._trigger("open")}else this.close();
+this.pending--;this.pending||this.element.removeClass("ui-autocomplete-loading")},close:function(a){clearTimeout(this.closing);if(this.menu.element.is(":visible")){this.menu.element.hide();this.menu.deactivate();this._trigger("close",a)}},_change:function(a){this.previous!==this.element.val()&&this._trigger("change",a,{item:this.selectedItem})},_normalize:function(a){if(a.length&&a[0].label&&a[0].value)return a;return d.map(a,function(b){if(typeof b==="string")return{label:b,value:b};return d.extend({label:b.label||
+b.value,value:b.value||b.label},b)})},_suggest:function(a){var b=this.menu.element.empty().zIndex(this.element.zIndex()+1);this._renderMenu(b,a);this.menu.deactivate();this.menu.refresh();b.show();this._resizeMenu();b.position(d.extend({of:this.element},this.options.position));this.options.autoFocus&&this.menu.next(new d.Event("mouseover"))},_resizeMenu:function(){var a=this.menu.element;a.outerWidth(Math.max(a.width("").outerWidth(),this.element.outerWidth()))},_renderMenu:function(a,b){var g=this;
+d.each(b,function(c,f){g._renderItem(a,f)})},_renderItem:function(a,b){return d("<li></li>").data("item.autocomplete",b).append(d("<a></a>").text(b.label)).appendTo(a)},_move:function(a,b){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term);this.menu.deactivate()}else this.menu[a](b);else this.search(null,b)},widget:function(){return this.menu.element}});d.extend(d.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g,
+"\\$&")},filter:function(a,b){var g=new RegExp(d.ui.autocomplete.escapeRegex(b),"i");return d.grep(a,function(c){return g.test(c.label||c.value||c)})}})})(jQuery);
+(function(d){d.widget("ui.menu",{_create:function(){var e=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(a){if(d(a.target).closest(".ui-menu-item a").length){a.preventDefault();e.select(a)}});this.refresh()},refresh:function(){var e=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex",
+-1).mouseenter(function(a){e.activate(a,d(this).parent())}).mouseleave(function(){e.deactivate()})},activate:function(e,a){this.deactivate();if(this.hasScroll()){var b=a.offset().top-this.element.offset().top,g=this.element.attr("scrollTop"),c=this.element.height();if(b<0)this.element.attr("scrollTop",g+b);else b>=c&&this.element.attr("scrollTop",g+b-c+a.height())}this.active=a.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",e,{item:a})},
+deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id");this._trigger("blur");this.active=null}},next:function(e){this.move("next",".ui-menu-item:first",e)},previous:function(e){this.move("prev",".ui-menu-item:last",e)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(e,a,b){if(this.active){e=this.active[e+"All"](".ui-menu-item").eq(0);
+e.length?this.activate(b,e):this.activate(b,this.element.children(a))}else this.activate(b,this.element.children(a))},nextPage:function(e){if(this.hasScroll())if(!this.active||this.last())this.activate(e,this.element.children(".ui-menu-item:first"));else{var a=this.active.offset().top,b=this.element.height(),g=this.element.children(".ui-menu-item").filter(function(){var c=d(this).offset().top-a-b+d(this).height();return c<10&&c>-10});g.length||(g=this.element.children(".ui-menu-item:last"));this.activate(e,
+g)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active||this.last()?":first":":last"))},previousPage:function(e){if(this.hasScroll())if(!this.active||this.first())this.activate(e,this.element.children(".ui-menu-item:last"));else{var a=this.active.offset().top,b=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var g=d(this).offset().top-a+b-d(this).height();return g<10&&g>-10});result.length||(result=this.element.children(".ui-menu-item:first"));
+this.activate(e,result)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active||this.first()?":last":":first"))},hasScroll:function(){return this.element.height()<this.element.attr("scrollHeight")},select:function(e){this._trigger("selected",e,{item:this.active})}})})(jQuery);
+;
\ No newline at end of file
diff --git a/rel/overlay/share/www/script/jquery.couch.js b/rel/overlay/share/www/script/jquery.couch.js
index 114e5801..634a03fe 100644
--- a/rel/overlay/share/www/script/jquery.couch.js
+++ b/rel/overlay/share/www/script/jquery.couch.js
@@ -22,25 +22,6 @@
     return encodeURIComponent(docID);
   };
 
-  function prepareUserDoc(user_doc, new_password) {    
-    if (typeof hex_sha1 == "undefined") {
-      alert("creating a user doc requires sha1.js to be loaded in the page");
-      return;
-    }
-    var user_prefix = "org.couchdb.user:";
-    user_doc._id = user_doc._id || user_prefix + user_doc.name;
-    if (new_password) {
-      // handle the password crypto
-      user_doc.salt = $.couch.newUUID();
-      user_doc.password_sha = hex_sha1(new_password + user_doc.salt);
-    }
-    user_doc.type = "user";
-    if (!user_doc.roles) {
-      user_doc.roles = [];
-    }
-    return user_doc;
-  };
-
   var uuidCache = [];
 
   $.extend($.couch, {
@@ -87,8 +68,11 @@
       options = options || {};
       $.ajax({
         type: "GET", url: this.urlPrefix + "/_session",
+        beforeSend: function(xhr) {
+            xhr.setRequestHeader('Accept', 'application/json');
+        },
         complete: function(req) {
-          var resp = $.httpData(req, "json");
+          var resp = httpData(req, "json");
           if (req.status == 200) {
             if (options.success) options.success(resp);
           } else if (options.error) {
@@ -112,19 +96,41 @@
     signup: function(user_doc, password, options) {      
       options = options || {};
       // prepare user doc based on name and password
-      user_doc = prepareUserDoc(user_doc, password);
+      user_doc = this.prepareUserDoc(user_doc, password);
       $.couch.userDb(function(db) {
         db.saveDoc(user_doc, options);
       });
     },
-    
+
+    prepareUserDoc: function(user_doc, new_password) {
+      if (typeof hex_sha1 == "undefined") {
+        alert("creating a user doc requires sha1.js to be loaded in the page");
+        return;
+      }
+      var user_prefix = "org.couchdb.user:";
+      user_doc._id = user_doc._id || user_prefix + user_doc.name;
+      if (new_password) {
+        // handle the password crypto
+        user_doc.salt = $.couch.newUUID();
+        user_doc.password_sha = hex_sha1(new_password + user_doc.salt);
+      }
+      user_doc.type = "user";
+      if (!user_doc.roles) {
+        user_doc.roles = [];
+      }
+      return user_doc;
+    },
+
     login: function(options) {
       options = options || {};
       $.ajax({
         type: "POST", url: this.urlPrefix + "/_session", dataType: "json",
         data: {name: options.name, password: options.password},
+        beforeSend: function(xhr) {
+            xhr.setRequestHeader('Accept', 'application/json');
+        },
         complete: function(req) {
-          var resp = $.httpData(req, "json");
+          var resp = httpData(req, "json");
           if (req.status == 200) {
             if (options.success) options.success(resp);
           } else if (options.error) {
@@ -140,8 +146,11 @@
       $.ajax({
         type: "DELETE", url: this.urlPrefix + "/_session", dataType: "json",
         username : "_", password : "_",
+        beforeSend: function(xhr) {
+            xhr.setRequestHeader('Accept', 'application/json');
+        },
         complete: function(req) {
-          var resp = $.httpData(req, "json");
+          var resp = httpData(req, "json");
           if (req.status == 200) {
             if (options.success) options.success(resp);
           } else if (options.error) {
@@ -385,7 +394,7 @@
             dataType: "json", data: toJSON(doc),
             beforeSend : beforeSend,
             complete: function(req) {
-              var resp = $.httpData(req, "json");
+              var resp = httpData(req, "json");
               if (req.status == 200 || req.status == 201 || req.status == 202) {
                 doc._id = resp.id;
                 doc._rev = resp.rev;
@@ -450,7 +459,7 @@
         copyDoc: function(docId, options, ajaxOptions) {
           ajaxOptions = $.extend(ajaxOptions, {
             complete: function(req) {
-              var resp = $.httpData(req, "json");
+              var resp = httpData(req, "json");
               if (req.status == 201) {
                 if (options.success) options.success(resp);
               } else if (options.error) {
@@ -563,7 +572,7 @@
 
     replicate: function(source, target, ajaxOptions, repOpts) {
       repOpts = $.extend({source: source, target: target}, repOpts);
-      if (repOpts.continuous) {
+      if (repOpts.continuous && !repOpts.cancel) {
         ajaxOptions.successStatus = 202;
       }
       ajax({
@@ -593,9 +602,36 @@
     }
   });
 
+  var httpData = $.httpData || function( xhr, type, s ) { // lifted from jq1.4.4
+    var ct = xhr.getResponseHeader("content-type") || "",
+      xml = type === "xml" || !type && ct.indexOf("xml") >= 0,
+      data = xml ? xhr.responseXML : xhr.responseText;
+
+    if ( xml && data.documentElement.nodeName === "parsererror" ) {
+      $.error( "parsererror" );
+    }
+    if ( s && s.dataFilter ) {
+      data = s.dataFilter( data, type );
+    }
+    if ( typeof data === "string" ) {
+      if ( type === "json" || !type && ct.indexOf("json") >= 0 ) {
+        data = $.parseJSON( data );
+      } else if ( type === "script" || !type && ct.indexOf("javascript") >= 0 ) {
+        $.globalEval( data );
+      }
+    }
+    return data;
+  };
+
   function ajax(obj, options, errorMessage, ajaxOptions) {
+
+    var defaultAjaxOpts = {
+      contentType: "application/json",
+      headers:{"Accept": "application/json"}
+    };
+
     options = $.extend({successStatus: 200}, options);
-    ajaxOptions = $.extend({contentType: "application/json"}, ajaxOptions);
+    ajaxOptions = $.extend(defaultAjaxOpts, ajaxOptions);
     errorMessage = errorMessage || "Unknown error";
     $.ajax($.extend($.extend({
       type: "GET", dataType: "json", cache : !$.browser.msie,
@@ -608,7 +644,7 @@
       },
       complete: function(req) {
         try {
-          var resp = $.httpData(req, "json");
+          var resp = httpData(req, "json");
         } catch(e) {
           if (options.error) {
             options.error(req.status, req, e);
@@ -638,6 +674,7 @@
       var commit = options.ensure_full_commit;
       delete options.ensure_full_commit;
       return function(xhr) {
+        xhr.setRequestHeader('Accept', 'application/json');
         xhr.setRequestHeader("X-Couch-Full-Commit", commit.toString());
       };
     }
diff --git a/rel/overlay/share/www/script/json2.js b/rel/overlay/share/www/script/json2.js
index 39d8f370..a1a3b170 100644
--- a/rel/overlay/share/www/script/json2.js
+++ b/rel/overlay/share/www/script/json2.js
@@ -1,6 +1,6 @@
 /*
     http://www.JSON.org/json2.js
-    2009-09-29
+    2010-03-20
 
     Public Domain.
 
@@ -433,6 +433,7 @@ if (!this.JSON) {
 // Unicode characters with escape sequences. JavaScript handles many characters
 // incorrectly, either silently deleting them, or treating them as line endings.
 
+            text = String(text);
             cx.lastIndex = 0;
             if (cx.test(text)) {
                 text = text.replace(cx, function (a) {
diff --git a/rel/overlay/share/www/script/jspec/jspec.js b/rel/overlay/share/www/script/jspec/jspec.js
index d6daf5ef..b2ea4768 100644
--- a/rel/overlay/share/www/script/jspec/jspec.js
+++ b/rel/overlay/share/www/script/jspec/jspec.js
@@ -87,7 +87,7 @@
        */
       
       Server : function(results, options) {
-        var uri = options.uri || 'http://' + window.location.host + '/results'
+        var uri = options.uri || window.location.protocol + "//" + window.location.host + '/results'
         JSpec.post(uri, {
           stats: JSpec.stats,
           options: options,
diff --git a/rel/overlay/share/www/script/test/all_docs.js b/rel/overlay/share/www/script/test/all_docs.js
index ab443605..1d83aa95 100644
--- a/rel/overlay/share/www/script/test/all_docs.js
+++ b/rel/overlay/share/www/script/test/all_docs.js
@@ -86,10 +86,51 @@ couchTests.all_docs = function(debug) {
   T(changes.results[2].doc);
   T(changes.results[2].doc._deleted);
 
+  rows = db.allDocs({include_docs: true}, ["1"]).rows;
+  TEquals(1, rows.length);
+  TEquals("1", rows[0].key);
+  TEquals("1", rows[0].id);
+  TEquals(true, rows[0].value.deleted);
+  TEquals(null, rows[0].doc);
+
+  // add conflicts
+  var conflictDoc1 = {
+    _id: "3", _rev: "2-aa01552213fafa022e6167113ed01087", value: "X"
+  };
+  var conflictDoc2 = {
+    _id: "3", _rev: "2-ff01552213fafa022e6167113ed01087", value: "Z"
+  };
+  T(db.save(conflictDoc1, {new_edits: false}));
+  T(db.save(conflictDoc2, {new_edits: false}));
+
+  var winRev = db.open("3");
+
+  changes = db.changes({include_docs: true, conflicts: true, style: "all_docs"});
+  TEquals("3", changes.results[3].id);
+  TEquals(3, changes.results[3].changes.length);
+  TEquals(winRev._rev, changes.results[3].changes[0].rev);
+  TEquals("3", changes.results[3].doc._id);
+  TEquals(winRev._rev, changes.results[3].doc._rev);
+  TEquals(true, changes.results[3].doc._conflicts instanceof Array);
+  TEquals(2, changes.results[3].doc._conflicts.length);
+
+  rows = db.allDocs({include_docs: true, conflicts: true}).rows;
+  TEquals(3, rows.length);
+  TEquals("3", rows[2].key);
+  TEquals("3", rows[2].id);
+  TEquals(winRev._rev, rows[2].value.rev);
+  TEquals(winRev._rev, rows[2].doc._rev);
+  TEquals("3", rows[2].doc._id);
+  TEquals(true, rows[2].doc._conflicts instanceof Array);
+  TEquals(2, rows[2].doc._conflicts.length);
+
   // test the all docs collates sanely
   db.save({_id: "Z", foo: "Z"});
   db.save({_id: "a", foo: "a"});
 
   var rows = db.allDocs({startkey: "Z", endkey: "Z"}).rows;
   T(rows.length == 1);
+
+  // cleanup
+  db.deleteDb();
 };
diff --git a/rel/overlay/share/www/script/test/attachment_names.js b/rel/overlay/share/www/script/test/attachment_names.js
index 988dd2d2..777b5ece 100644
--- a/rel/overlay/share/www/script/test/attachment_names.js
+++ b/rel/overlay/share/www/script/test/attachment_names.js
@@ -16,6 +16,24 @@ couchTests.attachment_names = function(debug) {
   db.createDb();
   if (debug) debugger;
 
+  var goodDoc = {
+    _id: "good_doc",
+    _attachments: {
+      "Колян.txt": {
+       content_type:"text/plain",
+       data: "VGhpcyBpcyBhIGJhc2U2NCBlbmNvZGVkIHRleHQ="
+      }
+    }
+  };
+
+  var save_response = db.save(goodDoc);
+  T(save_response.ok);
+
+  var xhr = CouchDB.request("GET", "/test_suite_db/good_doc/Колян.txt");
+  T(xhr.responseText == "This is a base64 encoded text");
+  T(xhr.getResponseHeader("Content-Type") == "text/plain");
+  T(xhr.getResponseHeader("Etag") == '"' + save_response.rev + '"');
+
   var binAttDoc = {
     _id: "bin_doc",
     _attachments:{
@@ -27,28 +45,23 @@ couchTests.attachment_names = function(debug) {
   };
 
   // inline attachments
-  try {
-    db.save(binAttDoc);
-    TEquals(1, 2, "Attachment name with non UTF-8 encoding saved. Should never show!");
-  } catch (e) {
-    TEquals("bad_request", e.error, "attachment_name: inline attachments");
-    TEquals("Attachment name is not UTF-8 encoded", e.reason, "attachment_name: inline attachments");
-  }
+  resp = db.save(binAttDoc);
+  TEquals(true, resp.ok, "attachment_name: inline attachment");
 
 
   // standalone docs
   var bin_data = "JHAPDO*AU£PN ){(3u[d 93DQ9¡€])}    ææøo'∂ƒæ≤çæππ•¥∫¶®#†π¶®¥π€ª®˙π8np";
 
+
   var xhr = (CouchDB.request("PUT", "/test_suite_db/bin_doc3/attachment\x80txt", {
     headers:{"Content-Type":"text/plain;charset=utf-8"},
     body:bin_data
   }));
 
   var resp = JSON.parse(xhr.responseText);
-  TEquals(400, xhr.status, "attachment_name: standalone API");
-  TEquals("bad_request", resp.error, "attachment_name: standalone API");
-  TEquals("Attachment name is not UTF-8 encoded", resp.reason, "attachment_name: standalone API");
-
+  TEquals(201, xhr.status, "attachment_name: standalone API");
+  TEquals("Created",  xhr.statusText, "attachment_name: standalone API");
+  TEquals(true, resp.ok, "attachment_name: standalone API");
 
   // bulk docs
   var docs = { docs: [binAttDoc] };
@@ -57,10 +70,8 @@ couchTests.attachment_names = function(debug) {
     body: JSON.stringify(docs)
   });
 
-  var resp = JSON.parse(xhr.responseText);
-  TEquals(400, xhr.status, "attachment_name: bulk docs");
-  TEquals("bad_request", resp.error, "attachment_name: bulk docs");
-  TEquals("Attachment name is not UTF-8 encoded", resp.reason, "attachment_name: bulk docs");
+  TEquals(201, xhr.status, "attachment_name: bulk docs");
+  TEquals("Created", xhr.statusText, "attachment_name: bulk docs");
 
 
   // leading underscores
diff --git a/rel/overlay/share/www/script/test/attachment_ranges.js b/rel/overlay/share/www/script/test/attachment_ranges.js
new file mode 100644
index 00000000..e1d40eae
--- /dev/null
+++ b/rel/overlay/share/www/script/test/attachment_ranges.js
@@ -0,0 +1,134 @@
+// Licensed under the Apache License, Version 2.0 (the "License"); you may not
+// use this file except in compliance with the License. You may obtain a copy of
+// the License at
+//
+//   http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
+// WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
+// License for the specific language governing permissions and limitations under
+// the License.
+couchTests.attachment_ranges = function(debug) {
+    var db = new CouchDB("test_suite_db", {
+        "X-Couch-Full-Commit": "false"
+    });
+    db.deleteDb();
+    db.createDb();
+
+    if (debug) debugger;
+
+    var binAttDoc = {
+        _id: "bin_doc",
+        _attachments: {
+            "foo.txt": {
+                content_type: "application/octet-stream",
+                data: "VGhpcyBpcyBhIGJhc2U2NCBlbmNvZGVkIHRleHQ="
+            }
+        }
+    };
+
+    var save_response = db.save(binAttDoc);
+    T(save_response.ok);
+
+    // Fetching the whole entity is a 206.
+    var xhr = CouchDB.request("GET", "/test_suite_db/bin_doc/foo.txt", {
+        headers: {
+            "Range": "bytes=0-28"
+        }
+    });
+    TEquals(206, xhr.status, "fetch 0-28");
+    TEquals("This is a base64 encoded text", xhr.responseText);
+    TEquals("bytes 0-28/29", xhr.getResponseHeader("Content-Range"));
+    TEquals("29", xhr.getResponseHeader("Content-Length"));
+
+    // Fetch the whole entity without an end offset is a 206.
+    var xhr = CouchDB.request("GET", "/test_suite_db/bin_doc/foo.txt", {
+        headers: {
+            "Range": "bytes=0-"
+        }
+    });
+    TEquals(206, xhr.status, "fetch 0-");
+    TEquals("This is a base64 encoded text", xhr.responseText);
+    TEquals("bytes 0-28/29", xhr.getResponseHeader("Content-Range"));
+    TEquals("29", xhr.getResponseHeader("Content-Length"));
+
+    // Badly formed range header is a 200.
+    var xhr = CouchDB.request("GET", "/test_suite_db/bin_doc/foo.txt", {
+        headers: {
+            "Range": "bytes:0-"
+        }
+    });
+    TEquals(200, xhr.status, "fetch with bad range header");
+
+    // Fetch the end of an entity without an end offset is a 206.
+    var xhr = CouchDB.request("GET", "/test_suite_db/bin_doc/foo.txt", {
+        headers: {
+            "Range": "bytes=2-"
+        }
+    });
+    TEquals(206, xhr.status, "fetch 2-");
+    TEquals("is is a base64 encoded text", xhr.responseText);
+    TEquals("bytes 2-28/29", xhr.getResponseHeader("Content-Range"));
+    TEquals("27", xhr.getResponseHeader("Content-Length"));
+
+    // Fetch past the end of the entity is a 206
+    var xhr = CouchDB.request("GET", "/test_suite_db/bin_doc/foo.txt", {
+        headers: {
+            "Range": "bytes=0-29"
+        }
+    });
+    TEquals(206, xhr.status, "fetch 0-29");
+    TEquals("bytes 0-28/29", xhr.getResponseHeader("Content-Range"));
+    TEquals("29", xhr.getResponseHeader("Content-Length"));
+
+    // Fetch first part of entity is a 206
+    var xhr = CouchDB.request("GET", "/test_suite_db/bin_doc/foo.txt", {
+        headers: {
+            "Range": "bytes=0-3"
+        }
+    });
+    TEquals(206, xhr.status, "fetch 0-3");
+    TEquals("This", xhr.responseText);
+    TEquals("4", xhr.getResponseHeader("Content-Length"));
+    TEquals("bytes 0-3/29", xhr.getResponseHeader("Content-Range"));
+
+    // Fetch middle of entity is also a 206
+    var xhr = CouchDB.request("GET", "/test_suite_db/bin_doc/foo.txt", {
+        headers: {
+            "Range": "bytes=10-15"
+        }
+    });
+    TEquals(206, xhr.status, "fetch 10-15");
+    TEquals("base64", xhr.responseText);
+    TEquals("6", xhr.getResponseHeader("Content-Length"));
+    TEquals("bytes 10-15/29", xhr.getResponseHeader("Content-Range"));
+
+    // Fetch end of entity is also a 206
+    var xhr = CouchDB.request("GET", "/test_suite_db/bin_doc/foo.txt", {
+        headers: {
+            "Range": "bytes=-3"
+        }
+    });
+    TEquals(206, xhr.status, "fetch -3");
+    TEquals("ext", xhr.responseText);
+    TEquals("3", xhr.getResponseHeader("Content-Length"));
+    TEquals("bytes 26-28/29", xhr.getResponseHeader("Content-Range"));
+    
+    // backward range is 416
+    var xhr = CouchDB.request("GET", "/test_suite_db/bin_doc/foo.txt", {
+       headers: {
+           "Range": "bytes=5-3"
+       }
+    });
+    TEquals(416, xhr.status, "fetch 5-3");
+
+    // range completely outside of entity is 416
+    var xhr = CouchDB.request("GET", "/test_suite_db/bin_doc/foo.txt", {
+        headers: {
+            "Range": "bytes=300-310"
+        }
+    });
+    TEquals(416, xhr.status, "fetch 300-310");
+
+};
diff --git a/rel/overlay/share/www/script/test/attachments.js b/rel/overlay/share/www/script/test/attachments.js
index e16c384f..826373dc 100644
--- a/rel/overlay/share/www/script/test/attachments.js
+++ b/rel/overlay/share/www/script/test/attachments.js
@@ -93,6 +93,7 @@ couchTests.attachments= function(debug) {
   });
   T(xhr.status == 201);
   var rev = JSON.parse(xhr.responseText).rev;
+  TEquals('"' + rev + '"', xhr.getResponseHeader("Etag"));
 
   var xhr = CouchDB.request("GET", "/test_suite_db/bin_doc3/attachment.txt");
   T(xhr.responseText == bin_data);
@@ -110,6 +111,7 @@ couchTests.attachments= function(debug) {
   });
   T(xhr.status == 201);
   var rev = JSON.parse(xhr.responseText).rev;
+  TEquals('"' + rev + '"', xhr.getResponseHeader("Etag"));
 
   var xhr = CouchDB.request("GET", "/test_suite_db/bin_doc3/attachment.txt");
   T(xhr.responseText == bin_data);
diff --git a/rel/overlay/share/www/script/test/attachments_multipart.js b/rel/overlay/share/www/script/test/attachments_multipart.js
index f173d2bb..2fc8e3bd 100644
--- a/rel/overlay/share/www/script/test/attachments_multipart.js
+++ b/rel/overlay/share/www/script/test/attachments_multipart.js
@@ -78,15 +78,19 @@ couchTests.attachments_multipart= function(debug) {
   
   // now edit an attachment
   
-  var doc = db.open("multipart");
+  var doc = db.open("multipart", {att_encoding_info: true});
   var firstrev = doc._rev;
   
   T(doc._attachments["foo.txt"].stub == true);
   T(doc._attachments["bar.txt"].stub == true);
   T(doc._attachments["baz.txt"].stub == true);
+  TEquals("undefined", typeof doc._attachments["foo.txt"].encoding);
+  TEquals("undefined", typeof doc._attachments["bar.txt"].encoding);
+  TEquals("gzip", doc._attachments["baz.txt"].encoding);
   
   //lets change attachment bar
   delete doc._attachments["bar.txt"].stub; // remove stub member (or could set to false)
+  delete doc._attachments["bar.txt"].digest; // remove the digest (it's for the gzip form)
   doc._attachments["bar.txt"].length = 18;
   doc._attachments["bar.txt"].follows = true;
   //lets delete attachment baz:
@@ -104,6 +108,7 @@ couchTests.attachments_multipart= function(debug) {
       "this is 18 chars l" +
       "\r\n--abc123--"
     });
+  TEquals(201, xhr.status);
   
   xhr = CouchDB.request("GET", "/test_suite_db/multipart/bar.txt");
   
@@ -115,8 +120,11 @@ couchTests.attachments_multipart= function(debug) {
   // now test receiving multipart docs
   
   function getBoundary(xhr) {
+    if (xhr instanceof XMLHttpRequest) {
     var ctype = xhr.getResponseHeader("Content-Type");
-  
+    } else {
+      var ctype = xhr.headers['Content-Type'];
+    }
     var ctypeArgs = ctype.split("; ").slice(1);
     var boundary = null;
     for(var i=0; i<ctypeArgs.length; i++) {
@@ -134,7 +142,11 @@ couchTests.attachments_multipart= function(debug) {
   
   function parseMultipart(xhr) {
     var boundary = getBoundary(xhr);
+    if (xhr instanceof XMLHttpRequest) {
     var mimetext = xhr.responseText;
+    } else {
+      var mimetext = xhr.body;
+    }
     // strip off leading boundary
     var leading = "--" + boundary + "\r\n";
     var last = "\r\n--" + boundary + "--";
@@ -208,6 +220,33 @@ couchTests.attachments_multipart= function(debug) {
   
   T(sections[1].body == "this is 18 chars l");
   
+  // try the atts_since parameter together with the open_revs parameter
+  xhr = CouchDB.request(
+    "GET",
+    '/test_suite_db/multipart?open_revs=["' +
+      doc._rev + '"]&atts_since=["' + firstrev + '"]',
+    {headers: {"accept": "multipart/mixed"}}
+  );
+
+  T(xhr.status === 200);
+
+  sections = parseMultipart(xhr);
+  // 1 section, with a multipart/related Content-Type
+  T(sections.length === 1);
+  T(sections[0].headers['Content-Type'].indexOf('multipart/related;') === 0);
+
+  var innerSections = parseMultipart(sections[0]);
+  // 2 inner sections: a document body section plus an attachment data section
+  T(innerSections.length === 2);
+  T(innerSections[0].headers['content-type'] === 'application/json');
+
+  doc = JSON.parse(innerSections[0].body);
+
+  T(doc._attachments['foo.txt'].stub === true);
+  T(doc._attachments['bar.txt'].follows === true);
+
+  T(innerSections[1].body === "this is 18 chars l");
+
   // try it with a rev that doesn't exist (should get all attachments)
   
   xhr = CouchDB.request("GET", "/test_suite_db/multipart?atts_since=[\"1-2897589\"]",
@@ -245,4 +284,130 @@ couchTests.attachments_multipart= function(debug) {
   
   T(sections[1].body == "this is 18 chars l");
   
+
+  // check that with the document multipart/mixed API it's possible to receive
+  // attachments in compressed form (if they're stored in compressed form)
+
+  var server_config = [
+    {
+      section: "attachments",
+      key: "compression_level",
+      value: "8"
+    },
+    {
+      section: "attachments",
+      key: "compressible_types",
+      value: "text/plain"
+    }
+  ];
+
+  function testMultipartAttCompression() {
+    var doc = { _id: "foobar" };
+    var lorem =
+      CouchDB.request("GET", "/_utils/script/test/lorem.txt").responseText;
+    var helloData = "hello world";
+
+    TEquals(true, db.save(doc).ok);
+
+    var firstRev = doc._rev;
+    var xhr = CouchDB.request(
+      "PUT",
+      "/" + db.name + "/" + doc._id + "/data.bin?rev=" + firstRev,
+      {
+        body: helloData,
+        headers: {"Content-Type": "application/binary"}
+      }
+    );
+    TEquals(201, xhr.status);
+
+    var secondRev = db.open(doc._id)._rev;
+    xhr = CouchDB.request(
+      "PUT",
+      "/" + db.name + "/" + doc._id + "/lorem.txt?rev=" + secondRev,
+      {
+        body: lorem,
+        headers: {"Content-Type": "text/plain"}
+      }
+    );
+    TEquals(201, xhr.status);
+
+    var thirdRev = db.open(doc._id)._rev;
+
+    xhr = CouchDB.request(
+      "GET",
+      '/' + db.name + '/' + doc._id + '?open_revs=["' + thirdRev + '"]',
+      {
+        headers: {
+          "Accept": "multipart/mixed",
+          "X-CouchDB-Send-Encoded-Atts": "true"
+        }
+      }
+    );
+    TEquals(200, xhr.status);
+
+    var sections = parseMultipart(xhr);
+    // 1 section, with a multipart/related Content-Type
+    TEquals(1, sections.length);
+    TEquals(0,
+      sections[0].headers['Content-Type'].indexOf('multipart/related;'));
+
+    var innerSections = parseMultipart(sections[0]);
+    // 3 inner sections: a document body section plus 2 attachment data sections
+    TEquals(3, innerSections.length);
+    TEquals('application/json', innerSections[0].headers['content-type']);
+
+    doc = JSON.parse(innerSections[0].body);
+
+    TEquals(true, doc._attachments['lorem.txt'].follows);
+    TEquals("gzip", doc._attachments['lorem.txt'].encoding);
+    TEquals(true, doc._attachments['data.bin'].follows);
+    T(doc._attachments['data.bin'] !== "gzip");
+
+    if (innerSections[1].body === helloData) {
+      T(innerSections[2].body !== lorem);
+    } else if (innerSections[2].body === helloData) {
+      T(innerSections[1].body !== lorem);
+    } else {
+      T(false, "Could not found data.bin attachment data");
+    }
+
+    // now test that it works together with the atts_since parameter
+
+    xhr = CouchDB.request(
+      "GET",
+      '/' + db.name + '/' + doc._id + '?open_revs=["' + thirdRev + '"]' +
+        '&atts_since=["' + secondRev + '"]',
+      {
+        headers: {
+          "Accept": "multipart/mixed",
+          "X-CouchDB-Send-Encoded-Atts": "true"
+        }
+      }
+    );
+    TEquals(200, xhr.status);
+
+    sections = parseMultipart(xhr);
+    // 1 section, with a multipart/related Content-Type
+    TEquals(1, sections.length);
+    TEquals(0,
+      sections[0].headers['Content-Type'].indexOf('multipart/related;'));
+
+    innerSections = parseMultipart(sections[0]);
+    // 2 inner sections: a document body section plus 1 attachment data section
+    TEquals(2, innerSections.length);
+    TEquals('application/json', innerSections[0].headers['content-type']);
+
+    doc = JSON.parse(innerSections[0].body);
+
+    TEquals(true, doc._attachments['lorem.txt'].follows);
+    TEquals("gzip", doc._attachments['lorem.txt'].encoding);
+    TEquals("undefined", typeof doc._attachments['data.bin'].follows);
+    TEquals(true, doc._attachments['data.bin'].stub);
+    T(innerSections[1].body !== lorem);
+  }
+
+  run_on_modified_server(server_config, testMultipartAttCompression);
+
+  // cleanup
+  db.deleteDb();
 };
diff --git a/rel/overlay/share/www/script/test/basics.js b/rel/overlay/share/www/script/test/basics.js
index 8885ba6e..30c27c11 100644
--- a/rel/overlay/share/www/script/test/basics.js
+++ b/rel/overlay/share/www/script/test/basics.js
@@ -37,9 +37,8 @@ couchTests.basics = function(debug) {
     TEquals(dbname,
       xhr.getResponseHeader("Location").substr(-dbname.length),
       "should return Location header to newly created document");
-
-    TEquals("http://",
-      xhr.getResponseHeader("Location").substr(0, 7),
+    TEquals(CouchDB.protocol,
+      xhr.getResponseHeader("Location").substr(0, CouchDB.protocol.length),
       "should return absolute Location header to newly created document");
   });
 
@@ -160,8 +159,8 @@ couchTests.basics = function(debug) {
   var loc = xhr.getResponseHeader("Location");
   T(loc, "should have a Location header");
   var locs = loc.split('/');
-  T(locs[4] == resp.id);
-  T(locs[3] == "test_suite_db");
+  T(locs[locs.length-1] == resp.id);
+  T(locs[locs.length-2] == "test_suite_db");
 
   // test that that POST's with an _id aren't overriden with a UUID.
   var xhr = CouchDB.request("POST", "/test_suite_db", {
@@ -181,9 +180,8 @@ couchTests.basics = function(debug) {
   TEquals("/test_suite_db/newdoc",
     xhr.getResponseHeader("Location").substr(-21),
     "should return Location header to newly created document");
-
-  TEquals("http://",
-    xhr.getResponseHeader("Location").substr(0, 7),
+  TEquals(CouchDB.protocol,
+    xhr.getResponseHeader("Location").substr(0, CouchDB.protocol.length),
     "should return absolute Location header to newly created document");
 
   // deleting a non-existent doc should be 404
diff --git a/rel/overlay/share/www/script/test/changes.js b/rel/overlay/share/www/script/test/changes.js
index 50649508..ea22bfb3 100644
--- a/rel/overlay/share/www/script/test/changes.js
+++ b/rel/overlay/share/www/script/test/changes.js
@@ -12,7 +12,7 @@
 
 function jsonp(obj) {
   T(jsonp_flag == 0);
-  T(obj.results.length == 1 && obj.last_seq==1, "jsonp")
+  T(obj.results.length == 1 && obj.last_seq == 1, "jsonp");
   jsonp_flag = 1;
 }
 
@@ -25,7 +25,7 @@ couchTests.changes = function(debug) {
   var req = CouchDB.request("GET", "/test_suite_db/_changes");
   var resp = JSON.parse(req.responseText);
 
-  T(resp.results.length == 0 && resp.last_seq==0, "empty db")
+  T(resp.results.length == 0 && resp.last_seq == 0, "empty db");
   var docFoo = {_id:"foo", bar:1};
   T(db.save(docFoo).ok);
   T(db.ensureFullCommit().ok);
@@ -35,8 +35,8 @@ couchTests.changes = function(debug) {
   var resp = JSON.parse(req.responseText);
 
   T(resp.last_seq == 1);
-  T(resp.results.length == 1, "one doc db")
-  T(resp.results[0].changes[0].rev == docFoo._rev)
+  T(resp.results.length == 1, "one doc db");
+  T(resp.results[0].changes[0].rev == docFoo._rev);
 
   // test with callback
   
@@ -90,16 +90,16 @@ couchTests.changes = function(debug) {
       change1 = JSON.parse(lines[0]);
       change2 = JSON.parse(lines[1]);
       if (change2.seq != 2) {
-          throw "bad seq, try again"
+          throw "bad seq, try again";
       }
     }, "bar-only");
 
-    T(change1.seq == 1)
-    T(change1.id == "foo")
+    T(change1.seq == 1);
+    T(change1.id == "foo");
     
-    T(change2.seq == 2)
-    T(change2.id == "bar")
-    T(change2.changes[0].rev == docBar._rev)
+    T(change2.seq == 2);
+    T(change2.id == "bar");
+    T(change2.changes[0].rev == docBar._rev);
     
     
     var docBaz = {_id:"baz", baz:1};
@@ -110,7 +110,7 @@ couchTests.changes = function(debug) {
       lines = xhr.responseText.split("\n");
       change3 = JSON.parse(lines[2]);
       if (change3.seq != 3) {
-        throw "bad seq, try again"
+        throw "bad seq, try again";
       }
     });
     
@@ -133,8 +133,8 @@ couchTests.changes = function(debug) {
       }
     }, "heartbeat");
 
-    T(str.charAt(str.length - 1) == "\n")
-    T(str.charAt(str.length - 2) == "\n")
+    T(str.charAt(str.length - 1) == "\n");
+    T(str.charAt(str.length - 2) == "\n");
 
     // otherwise we'll continue to receive heartbeats forever
     xhr.abort();
@@ -164,10 +164,10 @@ couchTests.changes = function(debug) {
       if (line.charAt(line.length-1) == ",") {
         var linetrimmed = line.substring(0, line.length-1);
       } else {
-        var linetrimmed = line
+        var linetrimmed = line;
       }
       return JSON.parse(linetrimmed);
-    }
+    };
     
     waitForSuccess(function() {
       lines = xhr.responseText.split("\n");
@@ -181,6 +181,8 @@ couchTests.changes = function(debug) {
     T(change.id == "barz");
     T(change.changes[0].rev == docBarz._rev);
     T(lines[3]=='"last_seq":4}');
+
+
   }
   
   // test the filtered changes
@@ -195,7 +197,7 @@ couchTests.changes = function(debug) {
       "userCtx" : stringFun(function(doc, req) {
         return doc.user && (doc.user == req.userCtx.name);
       }),
-      "conflicted" : "function(doc, req) { return (doc._conflicts);}",
+      "conflicted" : "function(doc, req) { return (doc._conflicts);}"
     },
     options : {
       local_seq : true
@@ -205,7 +207,7 @@ couchTests.changes = function(debug) {
         map : "function(doc) {emit(doc._local_seq, null)}"
       }
     }
-  }
+  };
 
   db.save(ddoc);
 
@@ -251,8 +253,8 @@ couchTests.changes = function(debug) {
     T(resp.results && resp.results.length > 0 && resp.results[0]["id"] == "bingo", "filter the correct update");
     xhr.abort();
     
-    timeout = 500;
-    last_seq = 10
+    var timeout = 500;
+    var last_seq = 10;
     while (true) {
 
       // filter with continuous
@@ -267,15 +269,15 @@ couchTests.changes = function(debug) {
 
       waitForSuccess(function() { // throws an error after 5 seconds
         if (xhr.readyState != 4) {
-          throw("still waiting")
+          throw("still waiting");
         }
       }, "continuous-rusty");
       lines = xhr.responseText.split("\n");
+      var good = false;
       try {
-        JSON.parse(lines[3])
+        JSON.parse(lines[3]);
         good = true;
       } catch(e) {
-        good = false;
       }
       if (good) {
         T(JSON.parse(lines[1]).id == "bingo", lines[1]);
@@ -350,7 +352,7 @@ couchTests.changes = function(debug) {
 
   req = CouchDB.request("GET", "/test_suite_db/_changes?limit=1");
   resp = JSON.parse(req.responseText);
-  TEquals(1, resp.results.length)
+  TEquals(1, resp.results.length);
 
   //filter includes _conflicts
   var id = db.save({'food' : 'pizza'}).id;
@@ -396,7 +398,116 @@ couchTests.changes = function(debug) {
     T(resp.results.length === 2);
     T(resp.results[0].id === "doc2");
     T(resp.results[1].id === "doc4");
+
+    // test filtering on docids
+    //
+
+    var options = {
+        headers: {"Content-Type": "application/json"},
+        body: JSON.stringify({"doc_ids": ["something", "anotherthing", "andmore"]})         
+    };
+
+    var req = CouchDB.request("POST", "/test_suite_db/_changes?filter=_doc_ids", options);
+    var resp = JSON.parse(req.responseText);
+    T(resp.results.length === 0);
+
+    T(db.save({"_id":"something", "bop" : "plankton"}).ok);
+    var req = CouchDB.request("POST", "/test_suite_db/_changes?filter=_doc_ids", options);
+    var resp = JSON.parse(req.responseText);
+    T(resp.results.length === 1);
+    T(resp.results[0].id === "something");
+
+    T(db.save({"_id":"anotherthing", "bop" : "plankton"}).ok);
+    var req = CouchDB.request("POST", "/test_suite_db/_changes?filter=_doc_ids", options);
+    var resp = JSON.parse(req.responseText);
+    T(resp.results.length === 2);
+    T(resp.results[0].id === "something");
+    T(resp.results[1].id === "anotherthing");
+    
+    var docids = JSON.stringify(["something", "anotherthing", "andmore"]),
+        req = CouchDB.request("GET", "/test_suite_db/_changes?filter=_doc_ids&doc_ids="+docids, options);
+    var resp = JSON.parse(req.responseText);
+    T(resp.results.length === 2);
+    T(resp.results[0].id === "something");
+    T(resp.results[1].id === "anotherthing");
+
+    var req = CouchDB.request("GET", "/test_suite_db/_changes?filter=_design");
+    var resp = JSON.parse(req.responseText);
+    T(resp.results.length === 1);
+    T(resp.results[0].id === "_design/erlang");
+
+
+    if (!is_safari && xhr) {
+        // filter docids with continuous
+        xhr = CouchDB.newXhr();
+        xhr.open("POST", "/test_suite_db/_changes?feed=continuous&timeout=500&since=7&filter=_doc_ids", true);
+        xhr.setRequestHeader("Content-Type", "application/json");
+        
+        xhr.send(options.body);
+        
+        T(db.save({"_id":"andmore", "bop" : "plankton"}).ok);
+
+        
+        waitForSuccess(function() {
+            if (xhr.readyState != 4) {
+              throw("still waiting");
+            }
+        }, "andmore-only");
+
+        var line = JSON.parse(xhr.responseText.split("\n")[0]);
+        T(line.seq == 8);
+        T(line.id == "andmore");
+    }
+    
   });
 
+  // COUCHDB-1037 - empty result for ?limit=1&filter=foo/bar in some cases
+  T(db.deleteDb());
+  T(db.createDb());
+
+  ddoc = {
+    _id: "_design/testdocs",
+    filters: {
+      testdocsonly: (function(doc, req) {
+        return (typeof doc.integer === "number");
+      }).toString()
+    }
+  };
+  T(db.save(ddoc));
+
+  ddoc = {
+    _id: "_design/foobar",
+    foo: "bar"
+  };
+  T(db.save(ddoc));
+
+  db.bulkSave(makeDocs(0, 5));
+
+  req = CouchDB.request("GET", "/" + db.name + "/_changes");
+  resp = JSON.parse(req.responseText);
+  TEquals(7, resp.last_seq);
+  TEquals(7, resp.results.length);
+
+  req = CouchDB.request(
+    "GET", "/"+ db.name + "/_changes?limit=1&filter=testdocs/testdocsonly");
+  resp = JSON.parse(req.responseText);
+  TEquals(3, resp.last_seq);
+  TEquals(1, resp.results.length);
+  TEquals("0", resp.results[0].id);
+
+  req = CouchDB.request(
+    "GET", "/" + db.name + "/_changes?limit=2&filter=testdocs/testdocsonly");
+  resp = JSON.parse(req.responseText);
+  TEquals(4, resp.last_seq);
+  TEquals(2, resp.results.length);
+  TEquals("0", resp.results[0].id);
+  TEquals("1", resp.results[1].id);
+
+  TEquals(0, CouchDB.requestStats('httpd', 'clients_requesting_changes').current);
+  CouchDB.request("GET", "/" + db.name + "/_changes");
+  TEquals(0, CouchDB.requestStats('httpd', 'clients_requesting_changes').current);
+
+  // cleanup
+  db.deleteDb();
 };
 
diff --git a/rel/overlay/share/www/script/test/config.js b/rel/overlay/share/www/script/test/config.js
index ef74934b..e83ecfd9 100644
--- a/rel/overlay/share/www/script/test/config.js
+++ b/rel/overlay/share/www/script/test/config.js
@@ -29,19 +29,25 @@ couchTests.config = function(debug) {
   */
   var server_port = CouchDB.host.split(':');
   if(server_port.length == 1 && CouchDB.inBrowser) {
-    var proto = window.location.protocol;
-    if(proto == "http:") {
+    if(CouchDB.protocol == "http://") {
       port = 80;
     }
-    if(proto == "https:") {
+    if(CouchDB.protocol == "https://") {
       port = 443;
     }
   } else {
     port = server_port.pop();
   }
 
+  if(CouchDB.protocol == "http://") {
+    config_port = config.httpd.port;
+  }
+  if(CouchDB.protocol == "https://") {
+    config_port = config.ssl.port;
+  }
+
   if(port) {
-    T(config.httpd.port == port);
+    TEquals(config_port, port, "ports should match");
   }
 
   T(config.couchdb.database_dir);
@@ -50,7 +56,8 @@ couchTests.config = function(debug) {
   T(config.log.level);
   T(config.query_servers.javascript);
 
-  // test that settings can be altered
+  // test that settings can be altered, and that an undefined whitelist allows any change
+  TEquals(undefined, config.httpd.config_whitelist, "Default whitelist is empty");
   xhr = CouchDB.request("PUT", "/_config/test/foo",{
     body : JSON.stringify("bar"),
     headers: {"X-Couch-Persist": "false"}
@@ -64,4 +71,93 @@ couchTests.config = function(debug) {
   xhr = CouchDB.request("GET", "/_config/test/foo");
   config = JSON.parse(xhr.responseText);
   T(config == "bar");
+
+  // Non-term whitelist values allow further modification of the whitelist.
+  xhr = CouchDB.request("PUT", "/_config/httpd/config_whitelist",{
+    body : JSON.stringify("!This is an invalid Erlang term!"),
+    headers: {"X-Couch-Persist": "false"}
+  });
+  TEquals(200, xhr.status, "Set config whitelist to an invalid Erlang term");
+  xhr = CouchDB.request("DELETE", "/_config/httpd/config_whitelist",{
+    headers: {"X-Couch-Persist": "false"}
+  });
+  TEquals(200, xhr.status, "Modify whitelist despite it being invalid syntax");
+
+  // Non-list whitelist values allow further modification of the whitelist.
+  xhr = CouchDB.request("PUT", "/_config/httpd/config_whitelist",{
+    body : JSON.stringify("{[yes, a_valid_erlang_term, but_unfortunately, not_a_list]}"),
+    headers: {"X-Couch-Persist": "false"}
+  });
+  TEquals(200, xhr.status, "Set config whitelist to an non-list term");
+  xhr = CouchDB.request("DELETE", "/_config/httpd/config_whitelist",{
+    headers: {"X-Couch-Persist": "false"}
+  });
+  TEquals(200, xhr.status, "Modify whitelist despite it not being a list");
+
+  // Keys not in the whitelist may not be modified.
+  xhr = CouchDB.request("PUT", "/_config/httpd/config_whitelist",{
+    body : JSON.stringify("[{httpd,config_whitelist}, {test,foo}]"),
+    headers: {"X-Couch-Persist": "false"}
+  });
+  TEquals(200, xhr.status, "Set config whitelist to something valid");
+
+  ["PUT", "DELETE"].forEach(function(method) {
+    ["test/not_foo", "not_test/foo", "neither_test/nor_foo"].forEach(function(pair) {
+      var path = "/_config/" + pair;
+      var test_name = method + " to " + path + " disallowed: not whitelisted";
+
+      xhr = CouchDB.request(method, path, {
+        body : JSON.stringify("Bummer! " + test_name),
+        headers: {"X-Couch-Persist": "false"}
+      });
+      TEquals(400, xhr.status, test_name);
+    });
+  });
+
+  // Keys in the whitelist may be modified.
+  ["PUT", "DELETE"].forEach(function(method) {
+    xhr = CouchDB.request(method, "/_config/test/foo",{
+      body : JSON.stringify(method + " to whitelisted config variable"),
+      headers: {"X-Couch-Persist": "false"}
+    });
+    TEquals(200, xhr.status, "Keys in the whitelist may be modified");
+  });
+
+  // Non-2-tuples in the whitelist are ignored
+  xhr = CouchDB.request("PUT", "/_config/httpd/config_whitelist",{
+    body : JSON.stringify("[{httpd,config_whitelist}, these, {are}, {nOt, 2, tuples}," +
+                          " [so], [they, will], [all, become, noops], {test,foo}]"),
+    headers: {"X-Couch-Persist": "false"}
+  });
+  TEquals(200, xhr.status, "Set config whitelist with some inert values");
+  ["PUT", "DELETE"].forEach(function(method) {
+    xhr = CouchDB.request(method, "/_config/test/foo",{
+      body : JSON.stringify(method + " to whitelisted config variable"),
+      headers: {"X-Couch-Persist": "false"}
+    });
+    TEquals(200, xhr.status, "Update whitelisted variable despite invalid entries");
+  });
+
+  // Atoms, binaries, and strings suffice as whitelist sections and keys.
+  ["{test,foo}", '{"test","foo"}', '{<<"test">>,<<"foo">>}'].forEach(function(pair) {
+    xhr = CouchDB.request("PUT", "/_config/httpd/config_whitelist",{
+      body : JSON.stringify("[{httpd,config_whitelist}, " + pair + "]"),
+      headers: {"X-Couch-Persist": "false"}
+    });
+    TEquals(200, xhr.status, "Set config whitelist to include " + pair);
+
+    var pair_format = {"t":"tuple", '"':"string", "<":"binary"}[pair[1]];
+    ["PUT", "DELETE"].forEach(function(method) {
+      xhr = CouchDB.request(method, "/_config/test/foo",{
+        body : JSON.stringify(method + " with " + pair_format),
+        headers: {"X-Couch-Persist": "false"}
+      });
+      TEquals(200, xhr.status, "Whitelist works with " + pair_format);
+    });
+  });
+
+  xhr = CouchDB.request("DELETE", "/_config/httpd/config_whitelist",{
+    headers: {"X-Couch-Persist": "false"}
+  });
+  TEquals(200, xhr.status, "Reset config whitelist to undefined");
 };
diff --git a/rel/overlay/share/www/script/test/conflicts.js b/rel/overlay/share/www/script/test/conflicts.js
index 7258bc31..65122581 100644
--- a/rel/overlay/share/www/script/test/conflicts.js
+++ b/rel/overlay/share/www/script/test/conflicts.js
@@ -61,4 +61,29 @@ couchTests.conflicts = function(debug) {
 
   T(db.save(doc2).ok);  // we can save a new document over a deletion without
                         // knowing the deletion rev.
+
+  // Verify COUCHDB-1178
+  var r1 = {"_id":"doc","foo":"bar"};
+  var r2 = {"_id":"doc","foo":"baz","_rev":"1-4c6114c65e295552ab1019e2b046b10e"};
+  var r3 = {"_id":"doc","foo":"bam","_rev":"2-cfcd6781f13994bde69a1c3320bfdadb"};
+  var r4 = {"_id":"doc","foo":"bat","_rev":"3-cc2f3210d779aef595cd4738be0ef8ff"};
+
+  T(db.save({"_id":"_design/couchdb-1178","validate_doc_update":"function(){}"}).ok);
+  T(db.save(r1).ok);
+  T(db.save(r2).ok);
+  T(db.save(r3).ok);
+
+  T(db.compact().ok);
+  while (db.info().compact_running) {};
+
+  TEquals({"_id":"doc",
+        "_rev":"3-cc2f3210d779aef595cd4738be0ef8ff",
+        "foo":"bam",
+        "_revisions":{"start":3,
+          "ids":["cc2f3210d779aef595cd4738be0ef8ff",
+                 "cfcd6781f13994bde69a1c3320bfdadb",
+                                      "4c6114c65e295552ab1019e2b046b10e"]}},
+    db.open("doc", {"revs": true}));
+  TEquals([], db.bulkSave([r4, r3, r2], {"new_edits":false}), "no failures");
+
 };
diff --git a/rel/overlay/share/www/script/test/cookie_auth.js b/rel/overlay/share/www/script/test/cookie_auth.js
index ef915602..e3548640 100644
--- a/rel/overlay/share/www/script/test/cookie_auth.js
+++ b/rel/overlay/share/www/script/test/cookie_auth.js
@@ -104,6 +104,18 @@ couchTests.cookie_auth = function(debug) {
       T(CouchDB.login('Jason Davies', password).ok);
       T(CouchDB.session().userCtx.name == 'Jason Davies');
       
+      // JSON login works
+      var xhr = CouchDB.request("POST", "/_session", {
+        headers: {"Content-Type": "application/json"},
+        body: JSON.stringify({
+          name: 'Jason Davies',
+          password: password
+        })
+      });
+
+      T(JSON.parse(xhr.responseText).ok);
+      T(CouchDB.session().userCtx.name == 'Jason Davies');
+
       // update one's own credentials document
       jasonUserDoc.foo=2;
       T(usersDb.save(jasonUserDoc).ok);
diff --git a/rel/overlay/share/www/script/test/copy_doc.js b/rel/overlay/share/www/script/test/copy_doc.js
index a6de1892..99e3c7fe 100644
--- a/rel/overlay/share/www/script/test/copy_doc.js
+++ b/rel/overlay/share/www/script/test/copy_doc.js
@@ -36,6 +36,9 @@ couchTests.copy_doc = function(debug) {
   });
   T(xhr.status == 409); // conflict
 
+  var xhr = CouchDB.request("COPY", "/test_suite_db/doc_to_be_copied2");
+  T(xhr.status == 400); // bad request (no Destination header)
+
   var rev = db.open("doc_to_be_overwritten")._rev;
   var xhr = CouchDB.request("COPY", "/test_suite_db/doc_to_be_copied2", {
     headers: {"Destination":"doc_to_be_overwritten?rev=" + rev}
diff --git a/rel/overlay/share/www/script/test/design_docs.js b/rel/overlay/share/www/script/test/design_docs.js
index a24167b2..702f0441 100644
--- a/rel/overlay/share/www/script/test/design_docs.js
+++ b/rel/overlay/share/www/script/test/design_docs.js
@@ -13,180 +13,415 @@
 couchTests.design_docs = function(debug) {
   var db = new CouchDB("test_suite_db", {"X-Couch-Full-Commit":"false"});
   var db2 = new CouchDB("test_suite_db_a", {"X-Couch-Full-Commit":"false"});
+
+  if (debug) debugger;
+
   db.deleteDb();
   db.createDb();
   db2.deleteDb();
   db2.createDb();
-  if (debug) debugger;
 
-  run_on_modified_server(
-    [{section: "query_server_config",
+  var server_config = [
+    {
+      section: "query_server_config",
       key: "reduce_limit",
-      value: "false"}],
-function() {
+      value: "false"
+    }
+  ];
 
-  var numDocs = 500;
+  var testFun = function() {
+    var numDocs = 500;
 
-  function makebigstring(power) {
-    var str = "a";
-    while(power-- > 0) {
-      str = str + str;
-    }
-    return str;
-  }
-
-  var designDoc = {
-    _id:"_design/test", // turn off couch.js id escaping?
-    language: "javascript",
-    whatever : {
-      stringzone : "exports.string = 'plankton';",
-      commonjs : {
-        whynot : "exports.test = require('../stringzone'); exports.foo = require('whatever/stringzone');",
-        upper : "exports.testing = require('./whynot').test.string.toUpperCase()+module.id+require('./whynot').foo.string"
+    function makebigstring(power) {
+      var str = "a";
+      while(power-- > 0) {
+        str = str + str;
       }
-    },
-    views: {
-      all_docs_twice: {map: "function(doc) { emit(doc.integer, null); emit(doc.integer, null) }"},
-      no_docs: {map: "function(doc) {}"},
-      single_doc: {map: "function(doc) { if (doc._id == \"1\") { emit(1, null) }}"},
-      summate: {map:"function (doc) {emit(doc.integer, doc.integer)};",
-                reduce:"function (keys, values) { return sum(values); };"},
-      summate2: {map:"function (doc) {emit(doc.integer, doc.integer)};",
-                reduce:"function (keys, values) { return sum(values); };"},
-      huge_src_and_results: {map: "function(doc) { if (doc._id == \"1\") { emit(\"" + makebigstring(16) + "\", null) }}",
-                reduce:"function (keys, values) { return \"" + makebigstring(16) + "\"; };"}
-    },
-    shows: {
-      simple: "function() {return 'ok'};",
-      requirey : "function() { var lib = require('whatever/commonjs/upper'); return lib.testing; };",
-      circular : "function() { var lib = require('whatever/commonjs/upper'); return JSON.stringify(this); };"
+      return str;
     }
-  }; 
-
-  var xhr = CouchDB.request("PUT", "/test_suite_db_a/_design/test", {body: JSON.stringify(designDoc)});
-  var resp = JSON.parse(xhr.responseText);
-  
-  TEquals(resp.rev, db.save(designDoc).rev);
-
-  // test that editing a show fun on the ddoc results in a change in output
-  var xhr = CouchDB.request("GET", "/test_suite_db/_design/test/_show/simple");
-  T(xhr.status == 200);
-  TEquals(xhr.responseText, "ok");
-
-  designDoc.shows.simple = "function() {return 'ko'};"
-  T(db.save(designDoc).ok);
-
-  var xhr = CouchDB.request("GET", "/test_suite_db/_design/test/_show/simple");
-  T(xhr.status == 200);
-  TEquals(xhr.responseText, "ko");
-
-  var xhr = CouchDB.request("GET", "/test_suite_db_a/_design/test/_show/simple?cache=buster");
-  T(xhr.status == 200);
-  TEquals("ok", xhr.responseText, 'query server used wrong ddoc');
-
-  // test commonjs require
-  var xhr = CouchDB.request("GET", "/test_suite_db/_design/test/_show/requirey");
-  T(xhr.status == 200);
-  TEquals("PLANKTONwhatever/commonjs/upperplankton", xhr.responseText);
-
-  var xhr = CouchDB.request("GET", "/test_suite_db/_design/test/_show/circular");
-  T(xhr.status == 200);
-  TEquals("javascript", JSON.parse(xhr.responseText).language);
-
-  var prev_view_sig = db.designInfo("_design/test").view_index.signature;
-
-  db.bulkSave(makeDocs(1, numDocs + 1));
-
-  // test that we get design doc info back
-  var dinfo = db.designInfo("_design/test");
-  TEquals("test", dinfo.name);
-  var vinfo = dinfo.view_index;
-  TEquals(51, vinfo.disk_size);
-  TEquals(false, vinfo.compact_running);
-  // test that GET /db/_design/test/_info
-  // hasn't triggered an update of the views
-  TEquals(prev_view_sig, vinfo.signature, 'ddoc sig');
-  for (var loop = 0; loop < 2; loop++) {
-    T(db.view("test/all_docs_twice", {stale: "ok"}).total_rows === 0);
-    T(db.view("test/single_doc", {stale: "ok"}).total_rows === 0);
-    T(db.view("test/summate", {stale: "ok"}).rows.length === 0);
+
+    var designDoc = {
+      _id: "_design/test",
+      language: "javascript",
+      whatever : {
+        stringzone : "exports.string = 'plankton';",
+        commonjs : {
+          whynot : "exports.test = require('../stringzone'); " +
+            "exports.foo = require('whatever/stringzone');",
+          upper : "exports.testing = require('./whynot').test.string.toUpperCase()+" +
+            "module.id+require('./whynot').foo.string",
+          circular_one: "require('./circular_two'); exports.name = 'One';",
+          circular_two: "require('./circular_one'); exports.name = 'Two';"
+        },
+        // paths relative to parent
+        idtest1: {
+          a: {
+            b: {d: "module.exports = require('../c/e').id;"},
+            c: {e: "exports.id = module.id;"}
+          }
+        },
+        // multiple paths relative to parent
+        idtest2: {
+          a: {
+            b: {d: "module.exports = require('../../a/c/e').id;"},
+            c: {e: "exports.id = module.id;"}
+          }
+        },
+        // paths relative to module
+        idtest3: {
+          a: {
+            b: "module.exports = require('./c/d').id;",
+            c: {
+              d: "module.exports = require('./e');",
+              e: "exports.id = module.id;"
+            }
+          }
+        },
+        // paths relative to module and parent
+        idtest4: {
+          a: {
+            b: "module.exports = require('../a/./c/d').id;",
+            c: {
+              d: "module.exports = require('./e');",
+              e: "exports.id = module.id;"
+            }
+          }
+        },
+        // paths relative to root
+        idtest5: {
+          a: "module.exports = require('whatever/idtest5/b').id;",
+          b: "exports.id = module.id;"
+        }
+      },
+      views: {
+        all_docs_twice: {
+          map:
+            (function(doc) {
+              emit(doc.integer, null);
+              emit(doc.integer, null);
+            }).toString()
+        },
+        no_docs: {
+          map:
+            (function(doc) {
+            }).toString()
+        },
+        single_doc: {
+          map:
+            (function(doc) {
+              if (doc._id === "1") {
+                emit(1, null);
+              }
+            }).toString()
+        },
+        summate: {
+          map:
+            (function(doc) {
+              emit(doc.integer, doc.integer);
+            }).toString(),
+          reduce:
+            (function(keys, values) {
+              return sum(values);
+            }).toString()
+        },
+        summate2: {
+          map:
+            (function(doc) {
+              emit(doc.integer, doc.integer);
+            }).toString(),
+          reduce:
+            (function(keys, values) {
+              return sum(values);
+            }).toString()
+        },
+        huge_src_and_results: {
+          map:
+            (function(doc) {
+              if (doc._id === "1") {
+                emit(makebigstring(16), null);
+              }
+            }).toString(),
+          reduce:
+            (function(keys, values) {
+              return makebigstring(16);
+            }).toString()
+        },
+        lib : {
+          baz : "exports.baz = 'bam';",
+          foo : {
+            foo : "exports.foo = 'bar';",
+            boom : "exports.boom = 'ok';",
+            zoom : "exports.zoom = 'yeah';"
+          }
+        },
+        commonjs : {
+          map :
+            (function(doc) {
+              emit(null, require('views/lib/foo/boom').boom);
+            }).toString()
+        }
+      },
+      shows: {
+        simple:
+          (function() {
+            return 'ok';
+          }).toString(),
+        requirey:
+          (function() {
+            var lib = require('whatever/commonjs/upper');
+            return lib.testing;
+          }).toString(),
+        circular:
+          (function() {
+            var lib = require('whatever/commonjs/upper');
+            return JSON.stringify(this);
+          }).toString(),
+        circular_require:
+          (function() {
+            return require('whatever/commonjs/circular_one').name;
+          }).toString(),
+        idtest1: (function() {
+            return require('whatever/idtest1/a/b/d');
+          }).toString(),
+        idtest2: (function() {
+            return require('whatever/idtest2/a/b/d');
+          }).toString(),
+        idtest3: (function() {
+            return require('whatever/idtest3/a/b');
+          }).toString(),
+        idtest4: (function() {
+            return require('whatever/idtest4/a/b');
+          }).toString(),
+        idtest5: (function() {
+            return require('whatever/idtest5/a');
+          }).toString()
+      }
+    }; // designDoc
+
+    var xhr = CouchDB.request(
+      "PUT", "/test_suite_db_a/_design/test", {body: JSON.stringify(designDoc)}
+    );
+    var resp = JSON.parse(xhr.responseText);
+
+    TEquals(resp.rev, db.save(designDoc).rev);
+
+    // test that editing a show fun on the ddoc results in a change in output
+    xhr = CouchDB.request("GET", "/test_suite_db/_design/test/_show/simple");
+    T(xhr.status == 200);
+    TEquals(xhr.responseText, "ok");
+
+    designDoc.shows.simple = (function() {
+      return 'ko';
+    }).toString();
+    T(db.save(designDoc).ok);
+
+    xhr = CouchDB.request("GET", "/test_suite_db/_design/test/_show/simple");
+    T(xhr.status == 200);
+    TEquals(xhr.responseText, "ko");
+
+    xhr = CouchDB.request(
+      "GET", "/test_suite_db_a/_design/test/_show/simple?cache=buster"
+    );
+    T(xhr.status == 200);
+    TEquals("ok", xhr.responseText, 'query server used wrong ddoc');
+
+    // test commonjs require
+    xhr = CouchDB.request("GET", "/test_suite_db/_design/test/_show/requirey");
+    T(xhr.status == 200);
+    TEquals("PLANKTONwhatever/commonjs/upperplankton", xhr.responseText);
+
+    xhr = CouchDB.request("GET", "/test_suite_db/_design/test/_show/circular");
+    T(xhr.status == 200);
+    TEquals("javascript", JSON.parse(xhr.responseText).language);
+
+    // test circular commonjs dependencies
+    xhr = CouchDB.request(
+      "GET",
+      "/test_suite_db/_design/test/_show/circular_require"
+    );
+    TEquals(200, xhr.status);
+    TEquals("One", xhr.responseText);
+
+    // Test that changes to the design doc properly invalidate cached modules:
+
+    // update the designDoc and replace
+    designDoc.whatever.commonjs.circular_one = "exports.name = 'Updated';"
+    T(db.save(designDoc).ok);
+
+    // request circular_require show function again and check the response has
+    // changed
+    xhr = CouchDB.request(
+      "GET",
+      "/test_suite_db/_design/test/_show/circular_require"
+    );
+    TEquals(200, xhr.status);
+    TEquals("Updated", xhr.responseText);
+
+
+    // test module id values are as expected:
+    xhr = CouchDB.request("GET", "/test_suite_db/_design/test/_show/idtest1");
+    TEquals(200, xhr.status);
+    TEquals("whatever/idtest1/a/c/e", xhr.responseText);
+
+    xhr = CouchDB.request("GET", "/test_suite_db/_design/test/_show/idtest2");
+    TEquals(200, xhr.status);
+    TEquals("whatever/idtest2/a/c/e", xhr.responseText);
+
+    xhr = CouchDB.request("GET", "/test_suite_db/_design/test/_show/idtest3");
+    TEquals(200, xhr.status);
+    TEquals("whatever/idtest3/a/c/e", xhr.responseText);
+
+    xhr = CouchDB.request("GET", "/test_suite_db/_design/test/_show/idtest4");
+    TEquals(200, xhr.status);
+    TEquals("whatever/idtest4/a/c/e", xhr.responseText);
+
+    xhr = CouchDB.request("GET", "/test_suite_db/_design/test/_show/idtest5");
+    TEquals(200, xhr.status);
+    TEquals("whatever/idtest5/b", xhr.responseText);
+
+
+    var prev_view_sig = db.designInfo("_design/test").view_index.signature;
+    var prev_view_size = db.designInfo("_design/test").view_index.disk_size;
+
+    db.bulkSave(makeDocs(1, numDocs + 1));
     T(db.ensureFullCommit().ok);
-    restartServer();
-  };
-
-  // test that POST /db/_view_cleanup
-  // doesn't trigger an update of the views
-  T(db.viewCleanup().ok);
-  for (var loop = 0; loop < 2; loop++) {
-    T(db.view("test/all_docs_twice", {stale: "ok"}).total_rows == 0);
-    T(db.view("test/single_doc", {stale: "ok"}).total_rows == 0);
-    T(db.view("test/summate", {stale: "ok"}).rows.length == 0);
+
+    // test that we get correct design doc info back,
+    // and also that GET /db/_design/test/_info
+    // hasn't triggered an update of the views
+    db.view("test/summate", {stale: "ok"}); // make sure view group's open
+    for (var i = 0; i < 2; i++) {
+      var dinfo = db.designInfo("_design/test");
+      TEquals("test", dinfo.name);
+      var vinfo = dinfo.view_index;
+      TEquals(prev_view_size, vinfo.disk_size, "view group disk size didn't change");
+      TEquals(false, vinfo.compact_running);
+      TEquals(prev_view_sig, vinfo.signature, 'ddoc sig');
+      // wait some time (there were issues where an update
+      // of the views had been triggered in the background)
+      var start = new Date().getTime();
+      while (new Date().getTime() < start + 2000);
+      TEquals(0, db.view("test/all_docs_twice", {stale: "ok"}).total_rows, 'view info');
+      TEquals(0, db.view("test/single_doc", {stale: "ok"}).total_rows, 'view info');
+      TEquals(0, db.view("test/summate", {stale: "ok"}).rows.length, 'view info');
+      T(db.ensureFullCommit().ok);
+      restartServer();
+    };
+
+    db.bulkSave(makeDocs(numDocs + 1, numDocs * 2 + 1));
     T(db.ensureFullCommit().ok);
-    restartServer();
-  };
 
-  // test that the _all_docs view returns correctly with keys
-  var results = db.allDocs({startkey:"_design", endkey:"_design0"});
-  T(results.rows.length == 1);
+    // open view group
+    db.view("test/summate", {stale: "ok"});
+    // wait so the views can get initialized
+    var start = new Date().getTime();
+    while (new Date().getTime() < start + 2000);
 
-  for (var loop = 0; loop < 2; loop++) {
-    var rows = db.view("test/all_docs_twice").rows;
-    for (var i = 0; i < numDocs; i++) {
-      T(rows[2*i].key == i+1);
-      T(rows[(2*i)+1].key == i+1);
+    // test that POST /db/_view_cleanup
+    // doesn't trigger an update of the views
+    var len1 = db.view("test/all_docs_twice", {stale: "ok"}).total_rows;
+    var len2 = db.view("test/single_doc", {stale: "ok"}).total_rows;
+    var len3 = db.view("test/summate", {stale: "ok"}).rows.length;
+    for (i = 0; i < 2; i++) {
+      T(db.viewCleanup().ok);
+      // wait some time (there were issues where an update
+      // of the views had been triggered in the background)
+      start = new Date().getTime();
+      while (new Date().getTime() < start + 2000);
+      TEquals(len1, db.view("test/all_docs_twice", {stale: "ok"}).total_rows, 'view cleanup');
+      TEquals(len2, db.view("test/single_doc", {stale: "ok"}).total_rows, 'view cleanup');
+      TEquals(len3, db.view("test/summate", {stale: "ok"}).rows.length, 'view cleanup');
+      T(db.ensureFullCommit().ok);
+      restartServer();
+      // we'll test whether the view group stays closed
+      // and the views stay uninitialized (they should!)
+      len1 = len2 = len3 = 0;
     };
-    T(db.view("test/no_docs").total_rows == 0);
-    T(db.view("test/single_doc").total_rows == 1);
-    T(db.ensureFullCommit().ok);
-    restartServer();
-  };
-
-  // test when language not specified, Javascript is implied
-  var designDoc2 = {
-    _id:"_design/test2",
-    // language: "javascript",
-    views: {
-      single_doc: {map: "function(doc) { if (doc._id == \"1\") { emit(1, null) }}"}
-    }
-  };
 
-  T(db.save(designDoc2).ok);
-  T(db.view("test2/single_doc").total_rows == 1);
+    // test commonjs in map functions
+    resp = db.view("test/commonjs", {limit:1});
+    T(resp.rows[0].value == 'ok');
+
+    // test that the _all_docs view returns correctly with keys
+    var results = db.allDocs({startkey:"_design", endkey:"_design0"});
+    T(results.rows.length == 1);
+
+    for (i = 0; i < 2; i++) {
+      var rows = db.view("test/all_docs_twice").rows;
+      for (var j = 0; j < numDocs; j++) {
+        T(rows[2 * j].key == (j + 1));
+        T(rows[(2 * j) + 1].key == (j + 1));
+      };
+      T(db.view("test/no_docs").total_rows == 0);
+      T(db.view("test/single_doc").total_rows == 1);
+      T(db.ensureFullCommit().ok);
+      restartServer();
+    };
 
-  var summate = function(N) {return (N+1)*N/2;};
-  var result = db.view("test/summate");
-  T(result.rows[0].value == summate(numDocs));
+    // test when language not specified, Javascript is implied
+    var designDoc2 = {
+      _id: "_design/test2",
+      // language: "javascript",
+      views: {
+        single_doc: {
+          map:
+            (function(doc) {
+              if (doc._id === "1") {
+                emit(1, null);
+              }
+            }).toString()
+        }
+      }
+    };
 
-  result = db.view("test/summate", {startkey:4,endkey:4});
-  T(result.rows[0].value == 4);
+    T(db.save(designDoc2).ok);
+    T(db.view("test2/single_doc").total_rows == 1);
 
-  result = db.view("test/summate", {startkey:4,endkey:5});
-  T(result.rows[0].value == 9);
+    var summate = function(N) {
+      return (N + 1) * (N / 2);
+    };
+    var result = db.view("test/summate");
+    T(result.rows[0].value == summate(numDocs * 2));
 
-  result = db.view("test/summate", {startkey:4,endkey:6});
-  T(result.rows[0].value == 15);
+    result = db.view("test/summate", {startkey: 4, endkey: 4});
+    T(result.rows[0].value == 4);
 
-  // Verify that a shared index (view def is an exact copy of "summate")
-  // does not confuse the reduce stage
-  result = db.view("test/summate2", {startkey:4,endkey:6});
-  T(result.rows[0].value == 15);
+    result = db.view("test/summate", {startkey: 4, endkey: 5});
+    T(result.rows[0].value == 9);
 
-  for(var i=1; i<numDocs/2; i+=30) {
-    result = db.view("test/summate", {startkey:i,endkey:numDocs-i});
-    T(result.rows[0].value == summate(numDocs-i) - summate(i-1));
-  }
+    result = db.view("test/summate", {startkey: 4, endkey: 6});
+    T(result.rows[0].value == 15);
 
-  T(db.deleteDoc(designDoc).ok);
-  T(db.open(designDoc._id) == null);
-  T(db.view("test/no_docs") == null);
+    // test start_key and end_key aliases
+    result = db.view("test/summate", {start_key: 4, end_key: 6});
+    T(result.rows[0].value == 15);
 
-  T(db.ensureFullCommit().ok);
-  restartServer();
-  T(db.open(designDoc._id) == null);
-  T(db.view("test/no_docs") == null);
+    // Verify that a shared index (view def is an exact copy of "summate")
+    // does not confuse the reduce stage
+    result = db.view("test/summate2", {startkey: 4, endkey: 6});
+    T(result.rows[0].value == 15);
 
-  // trigger ddoc cleanup
-  T(db.viewCleanup().ok);
+    for(i = 1; i < (numDocs / 2); i += 30) {
+      result = db.view("test/summate", {startkey: i, endkey: (numDocs - i)});
+      T(result.rows[0].value == summate(numDocs - i) - summate(i - 1));
+    }
+
+    T(db.deleteDoc(designDoc).ok);
+    T(db.open(designDoc._id) == null);
+    T(db.view("test/no_docs") == null);
 
-});
+    T(db.ensureFullCommit().ok);
+    restartServer();
+    T(db.open(designDoc._id) == null);
+    T(db.view("test/no_docs") == null);
+
+    // trigger ddoc cleanup
+    T(db.viewCleanup().ok);
+  }; // enf of testFun
+
+  run_on_modified_server(server_config, testFun);
+
+  // cleanup
+  db.deleteDb();
+  db2.deleteDb();
 };
diff --git a/rel/overlay/share/www/script/test/etags_views.js b/rel/overlay/share/www/script/test/etags_views.js
index 7e1537bd..34116f71 100644
--- a/rel/overlay/share/www/script/test/etags_views.js
+++ b/rel/overlay/share/www/script/test/etags_views.js
@@ -11,23 +11,34 @@
 // the License.
 
 couchTests.etags_views = function(debug) {
-  var db = new CouchDB("test_suite_db", {"X-Couch-Full-Commit":"false"});
+  var db = new CouchDB("test_suite_db", {"X-Couch-Full-Commit":"true"});
   db.deleteDb();
   db.createDb();
   if (debug) debugger;
 
   var designDoc = {
-    _id:"_design/etags",
+    _id: "_design/etags",
     language: "javascript",
     views : {
+      fooView: {
+        map: stringFun(function(doc) {
+          if (doc.foo) {
+            emit("bar", 1);
+          }
+        }),
+      },
       basicView : {
         map : stringFun(function(doc) {
+          if(doc.integer && doc.string) {
           emit(doc.integer, doc.string);
+          }
         })
       },
       withReduce : {
         map : stringFun(function(doc) {
+          if(doc.integer && doc.string) {
           emit(doc.integer, doc.string);
+          }
         }),
         reduce : stringFun(function(keys, values, rereduce) {
           if (rereduce) {
@@ -40,9 +51,9 @@ couchTests.etags_views = function(debug) {
     }
   };
   T(db.save(designDoc).ok);
+  db.bulkSave(makeDocs(0, 10));
+
   var xhr;
-  var docs = makeDocs(0, 10);
-  db.bulkSave(docs);
 
   // verify get w/Etag on map view
   xhr = CouchDB.request("GET", "/test_suite_db/_design/etags/_view/basicView");
@@ -52,17 +63,92 @@ couchTests.etags_views = function(debug) {
     headers: {"if-none-match": etag}
   });
   T(xhr.status == 304);
-  // TODO GET with keys (when that is available)
+
+  // verify ETag doesn't change when an update
+  // doesn't change the view group's index
+  T(db.save({"_id":"doc1", "foo":"bar"}).ok);
+  xhr = CouchDB.request("GET", "/test_suite_db/_design/etags/_view/basicView");
+  var etag1 = xhr.getResponseHeader("etag");
+  T(etag1 == etag);
+ 
+  // Verify that purges affect etags
+  xhr = CouchDB.request("GET", "/test_suite_db/_design/etags/_view/fooView");
+  var foo_etag = xhr.getResponseHeader("etag");
+  var doc1 = db.open("doc1");
+  xhr = CouchDB.request("POST", "/test_suite_db/_purge", {
+    body: JSON.stringify({"doc1":[doc1._rev]})
+  });
+  xhr = CouchDB.request("GET", "/test_suite_db/_design/etags/_view/fooView");
+  var etag1 = xhr.getResponseHeader("etag");
+  T(etag1 != foo_etag);
+
+  // Test that _purge didn't affect the other view etags.
+  xhr = CouchDB.request("GET", "/test_suite_db/_design/etags/_view/basicView");
+  var etag1 = xhr.getResponseHeader("etag");
+  T(etag1 == etag);
+
+  // verify different views in the same view group may have different ETags
+  xhr = CouchDB.request("GET", "/test_suite_db/_design/etags/_view/fooView");
+  var etag1 = xhr.getResponseHeader("etag");
+  xhr = CouchDB.request("GET", "/test_suite_db/_design/etags/_view/basicView");
+  var etag2 = xhr.getResponseHeader("etag");
+  T(etag1 != etag2);
+
+  // verify ETag changes when an update changes the view group's index.
+  db.bulkSave(makeDocs(10, 20));
+  xhr = CouchDB.request("GET", "/test_suite_db/_design/etags/_view/basicView");
+  var etag1 = xhr.getResponseHeader("etag");
+  T(etag1 != etag);
+
+  // verify ETag is the same after a restart
+  restartServer();
+  xhr = CouchDB.request("GET", "/test_suite_db/_design/etags/_view/basicView");
+  var etag2 = xhr.getResponseHeader("etag");
+  T(etag1 == etag2);
 
   // reduce view
   xhr = CouchDB.request("GET", "/test_suite_db/_design/etags/_view/withReduce");
   T(xhr.status == 200);
   var etag = xhr.getResponseHeader("etag");
-  xhr = CouchDB.request("GET", "/test_suite_db/_design/etags/_view/withReduce", {
+  xhr = CouchDB.request("GET", "/test_suite_db/_design/etags/_view/withReduce",{
     headers: {"if-none-match": etag}
   });
   T(xhr.status == 304);
 
+  // verify ETag doesn't change when an update
+  // doesn't change the view group's index
+  T(db.save({"_id":"doc3", "foo":"bar"}).ok);
+  xhr = CouchDB.request("GET", "/test_suite_db/_design/etags/_view/withReduce");
+  var etag1 = xhr.getResponseHeader("etag");
+  T(etag1 == etag);
+  // purge
+  var doc3 = db.open("doc3");
+  xhr = CouchDB.request("POST", "/test_suite_db/_purge", {
+    body: JSON.stringify({"doc3":[doc3._rev]})
+  });
+  xhr = CouchDB.request("GET", "/test_suite_db/_design/etags/_view/withReduce");
+  var etag1 = xhr.getResponseHeader("etag");
+  T(etag1 == etag);
+
+  // verify different views in the same view group may have different ETags
+  xhr = CouchDB.request("GET", "/test_suite_db/_design/etags/_view/fooView");
+  var etag1 = xhr.getResponseHeader("etag");
+  xhr = CouchDB.request("GET", "/test_suite_db/_design/etags/_view/withReduce");
+  var etag2 = xhr.getResponseHeader("etag");
+  T(etag1 != etag2);
+
+  // verify ETag changes when an update changes the view group's index
+  db.bulkSave(makeDocs(20, 30));
+  xhr = CouchDB.request("GET", "/test_suite_db/_design/etags/_view/withReduce");
+  var etag1 = xhr.getResponseHeader("etag");
+  T(etag1 != etag);
+
+  // verify ETag is the same after a restart
+  restartServer();
+  xhr = CouchDB.request("GET", "/test_suite_db/_design/etags/_view/withReduce");
+  var etag2 = xhr.getResponseHeader("etag");
+  T(etag1 == etag2);
+
   // confirm ETag changes with different POST bodies
   xhr = CouchDB.request("POST", "/test_suite_db/_design/etags/_view/basicView",
     {body: JSON.stringify({keys:[1]})}
diff --git a/rel/overlay/share/www/script/test/http.js b/rel/overlay/share/www/script/test/http.js
index 8a2e09b8..5f46af52 100644
--- a/rel/overlay/share/www/script/test/http.js
+++ b/rel/overlay/share/www/script/test/http.js
@@ -25,7 +25,7 @@ couchTests.http = function(debug) {
   var xhr = CouchDB.request("PUT", "/test_suite_db/test", {body: "{}"});
   var host = CouchDB.host;
 
-  TEquals("http://" + host + "/test_suite_db/test", 
+  TEquals(CouchDB.protocol + host + "/test_suite_db/test", 
     xhr.getResponseHeader("Location"),
     "should include ip address");
 
@@ -34,7 +34,7 @@ couchTests.http = function(debug) {
     headers: {"X-Forwarded-Host": "mysite.com"}
   });
 
-  TEquals("http://mysite.com/test_suite_db/test2",
+  TEquals(CouchDB.protocol + "mysite.com/test_suite_db/test2",
     xhr.getResponseHeader("Location"),
     "should include X-Forwarded-Host");
 
@@ -47,7 +47,7 @@ couchTests.http = function(debug) {
         body: "{}",
         headers: {"X-Host": "mysite2.com"}
       });
-      TEquals("http://mysite2.com/test_suite_db/test3",
+      TEquals(CouchDB.protocol + "mysite2.com/test_suite_db/test3",
         xhr.getResponseHeader("Location"),
         "should include X-Host");
     });
diff --git a/rel/overlay/share/www/script/test/jsonp.js b/rel/overlay/share/www/script/test/jsonp.js
index 6bec63ab..9aba7189 100644
--- a/rel/overlay/share/www/script/test/jsonp.js
+++ b/rel/overlay/share/www/script/test/jsonp.js
@@ -65,7 +65,7 @@ couchTests.jsonp = function(debug) {
       views: {
         all_docs: {map: "function(doc) {if(doc.a) emit(null, doc.a);}"}
       }
-    }
+    };
     T(db.save(designDoc).ok);
 
     var url = "/test_suite_db/_design/test/_view/all_docs?callback=jsonp_chunk";
diff --git a/rel/overlay/share/www/script/test/list_views.js b/rel/overlay/share/www/script/test/list_views.js
index 44afa899..2c1ac321 100644
--- a/rel/overlay/share/www/script/test/list_views.js
+++ b/rel/overlay/share/www/script/test/list_views.js
@@ -156,6 +156,9 @@ couchTests.list_views = function(debug) {
         var row = getRow();
         send(row.doc.integer);
         return "tail";
+      }),
+      secObj: stringFun(function(head, req) {
+        return toJSON(req.secObj);
       })
     }
   };
@@ -201,6 +204,7 @@ couchTests.list_views = function(debug) {
   T(xhr.status == 200, "standard get should be 200");
   T(/head0123456789tail/.test(xhr.responseText));
 
+
   // test that etags are available
   var etag = xhr.getResponseHeader("etag");
   xhr = CouchDB.request("GET", "/test_suite_db/_design/lists/_list/basicBasic/basicView", {
@@ -323,6 +327,16 @@ couchTests.list_views = function(debug) {
   T(/FirstKey: 2/.test(xhr.responseText));
   T(/LastKey: 7/.test(xhr.responseText));
 
+  // multi-key fetch with GET
+  var xhr = CouchDB.request("GET", "/test_suite_db/_design/lists/_list/simpleForm/basicView" +
+    "?keys=[2,4,5,7]");
+
+  T(xhr.status == 200, "multi key");
+  T(!(/Key: 1 /.test(xhr.responseText)));
+  T(/Key: 2/.test(xhr.responseText));
+  T(/FirstKey: 2/.test(xhr.responseText));
+  T(/LastKey: 7/.test(xhr.responseText));
+
   // no multi-key fetch allowed when group=false
   xhr = CouchDB.request("POST", "/test_suite_db/_design/lists/_list/simpleForm/withReduce?group=false", {
     body: '{"keys":[2,4,5,7]}'
@@ -405,6 +419,12 @@ couchTests.list_views = function(debug) {
   T(/FirstKey: -2/.test(xhr.responseText));
   T(/LastKey: -7/.test(xhr.responseText));
 
+    // Test if secObj is available
+  var xhr = CouchDB.request("GET", "/test_suite_db/_design/lists/_list/secObj/basicView");
+  T(xhr.status == 200, "standard get should be 200");
+  var resp = JSON.parse(xhr.responseText);
+  T(typeof(resp) == "object");
+
   var erlViewTest = function() {
     T(db.save(erlListDoc).ok);
     var url = "/test_suite_db/_design/erlang/_list/simple/views/basicView" +
@@ -419,10 +439,37 @@ couchTests.list_views = function(debug) {
     }
   };
 
+  
+
   run_on_modified_server([{
     section: "native_query_servers",
     key: "erlang",
     value: "{couch_native_process, start_link, []}"
   }], erlViewTest);
 
+  // COUCHDB-1113
+  var ddoc = {
+    _id: "_design/test",
+    views: {
+      me: {
+        map: (function(doc) { emit(null,null)}).toString()
+      }
+    },
+    lists: {
+      you: (function(head, req) {
+        var row;
+        while(row = getRow()) {
+          send(row);
+        }
+      }).toString()
+    }
+  };
+  db.save(ddoc);
+
+  var resp = CouchDB.request("GET", "/" + db.name + "/_design/test/_list/you/me", {
+    headers: {
+      "Content-Type": "application/x-www-form-urlencoded"
+    }
+  });
+  TEquals(200, resp.status, "should return a 200 response");
 };
diff --git a/rel/overlay/share/www/script/test/oauth.js b/rel/overlay/share/www/script/test/oauth.js
index b439b4db..82ebe8a4 100644
--- a/rel/overlay/share/www/script/test/oauth.js
+++ b/rel/overlay/share/www/script/test/oauth.js
@@ -71,7 +71,7 @@ couchTests.oauth = function(debug) {
   var host = CouchDB.host;
   var dbPair = {
     source: {
-      url: "http://" + host + "/test_suite_db_a",
+      url: CouchDB.protocol + host + "/test_suite_db_a",
       auth: {
         oauth: {
           consumer_key: "key",
@@ -82,7 +82,7 @@ couchTests.oauth = function(debug) {
       }
     },
     target: {
-      url: "http://" + host + "/test_suite_db_b",
+      url: CouchDB.protocol + host + "/test_suite_db_b",
       headers: {"Authorization": adminBasicAuthHeaderValue()}
     }
   };
@@ -90,7 +90,7 @@ couchTests.oauth = function(debug) {
   // this function will be called on the modified server
   var testFun = function () {
     try {
-      CouchDB.request("PUT", "http://" + host + "/_config/admins/testadmin", {
+      CouchDB.request("PUT", CouchDB.protocol + host + "/_config/admins/testadmin", {
         headers: {"X-Couch-Persist": "false"},
         body: JSON.stringify(testadminPassword)
       });
@@ -98,7 +98,7 @@ couchTests.oauth = function(debug) {
       waitForSuccess(function() {
         //loop until the couch server has processed the password
         i += 1;
-        var xhr = CouchDB.request("GET", "http://" + host + "/_config/admins/testadmin?foo="+i,{
+        var xhr = CouchDB.request("GET", CouchDB.protocol + host + "/_config/admins/testadmin?foo="+i,{
             headers: {
               "Authorization": adminBasicAuthHeaderValue()
             }});
@@ -109,7 +109,7 @@ couchTests.oauth = function(debug) {
 
       CouchDB.newUuids(2); // so we have one to make the salt
 
-      CouchDB.request("PUT", "http://" + host + "/_config/couch_httpd_auth/require_valid_user", {
+      CouchDB.request("PUT", CouchDB.protocol + host + "/_config/couch_httpd_auth/require_valid_user", {
         headers: {
           "X-Couch-Persist": "false",
           "Authorization": adminBasicAuthHeaderValue()
@@ -157,11 +157,11 @@ couchTests.oauth = function(debug) {
           };
 
           // Get request token via Authorization header
-          xhr = oauthRequest("GET", "http://" + host + "/_oauth/request_token", message, accessor);
+          xhr = oauthRequest("GET", CouchDB.protocol + host + "/_oauth/request_token", message, accessor);
           T(xhr.status == expectedCode);
 
           // GET request token via query parameters
-          xhr = oauthRequest("GET", "http://" + host + "/_oauth/request_token", message, accessor);
+          xhr = oauthRequest("GET", CouchDB.protocol + host + "/_oauth/request_token", message, accessor);
           T(xhr.status == expectedCode);
 
           responseMessage = OAuth.decodeForm(xhr.responseText);
@@ -171,7 +171,7 @@ couchTests.oauth = function(debug) {
           //xhr = CouchDB.request("GET", authorization_url + '?oauth_token=' + responseMessage.oauth_token);
           //T(xhr.status == expectedCode);
 
-          xhr = oauthRequest("GET", "http://" + host + "/_session", message, accessor);
+          xhr = oauthRequest("GET", CouchDB.protocol + host + "/_session", message, accessor);
           T(xhr.status == expectedCode);
           if (xhr.status == expectedCode == 200) {
             data = JSON.parse(xhr.responseText);
@@ -179,11 +179,11 @@ couchTests.oauth = function(debug) {
             T(data.roles[0] == "test");
           }
 
-          xhr = oauthRequest("GET", "http://" + host + "/_session?foo=bar", message, accessor);
+          xhr = oauthRequest("GET", CouchDB.protocol + host + "/_session?foo=bar", message, accessor);
           T(xhr.status == expectedCode);
 
           // Test HEAD method
-          xhr = oauthRequest("HEAD", "http://" + host + "/_session?foo=bar", message, accessor);
+          xhr = oauthRequest("HEAD", CouchDB.protocol + host + "/_session?foo=bar", message, accessor);
           T(xhr.status == expectedCode);
 
           // Replication
@@ -207,7 +207,7 @@ couchTests.oauth = function(debug) {
               oauth_version: "1.0"
             }
           };
-          xhr = oauthRequest("GET", "http://" + host + "/_session?foo=bar", message, adminAccessor);
+          xhr = oauthRequest("GET", CouchDB.protocol + host + "/_session?foo=bar", message, adminAccessor);
           if (xhr.status == expectedCode == 200) {
             data = JSON.parse(xhr.responseText);
             T(data.name == "testadmin");
@@ -216,13 +216,13 @@ couchTests.oauth = function(debug) {
 
           // Test when the user's token doesn't exist.
           message.parameters.oauth_token = "not a token!";
-          xhr = oauthRequest("GET", "http://" + host + "/_session?foo=bar",
+          xhr = oauthRequest("GET", CouchDB.protocol + host + "/_session?foo=bar",
                   message, adminAccessor);
           T(xhr.status == 400, "Request should be invalid.");
         }
       }
     } finally {
-      var xhr = CouchDB.request("PUT", "http://" + host + "/_config/couch_httpd_auth/require_valid_user", {
+      var xhr = CouchDB.request("PUT", CouchDB.protocol + host + "/_config/couch_httpd_auth/require_valid_user", {
         headers: {
           "Authorization": adminBasicAuthHeaderValue(),
           "X-Couch-Persist": "false"
@@ -231,7 +231,7 @@ couchTests.oauth = function(debug) {
       });
       T(xhr.status == 200);
 
-      var xhr = CouchDB.request("DELETE", "http://" + host + "/_config/admins/testadmin", {
+      var xhr = CouchDB.request("DELETE", CouchDB.protocol + host + "/_config/admins/testadmin", {
         headers: {
           "Authorization": adminBasicAuthHeaderValue(),
           "X-Couch-Persist": "false"
diff --git a/rel/overlay/share/www/script/test/proxyauth.js b/rel/overlay/share/www/script/test/proxyauth.js
index 91e2f221..dff39415 100644
--- a/rel/overlay/share/www/script/test/proxyauth.js
+++ b/rel/overlay/share/www/script/test/proxyauth.js
@@ -127,4 +127,4 @@ couchTests.proxyauth = function(debug) {
     TestFun
   );
   
-}
\ No newline at end of file
+};
diff --git a/rel/overlay/share/www/script/test/purge.js b/rel/overlay/share/www/script/test/purge.js
index f8f45138..29689137 100644
--- a/rel/overlay/share/www/script/test/purge.js
+++ b/rel/overlay/share/www/script/test/purge.js
@@ -110,4 +110,36 @@ couchTests.purge = function(debug) {
     T(rows[(2*(i-4))+1].key == i+1);
   }
   T(db.view("test/single_doc").total_rows == 0);
+
+  // COUCHDB-1065
+  var dbA = new CouchDB("test_suite_db_a");
+  var dbB = new CouchDB("test_suite_db_b");
+  dbA.deleteDb();
+  dbA.createDb();
+  dbB.deleteDb();
+  dbB.createDb();
+  var docA = {_id:"test", a:1};
+  var docB = {_id:"test", a:2};
+  dbA.save(docA);
+  dbB.save(docB);
+  CouchDB.replicate(dbA.name, dbB.name);
+  var xhr = CouchDB.request("POST", "/" + dbB.name + "/_purge", {
+    body: JSON.stringify({"test":[docA._rev]})
+  });
+  TEquals(200, xhr.status, "single rev purge after replication succeeds");
+
+  var xhr = CouchDB.request("GET", "/" + dbB.name + "/test?rev=" + docA._rev);
+  TEquals(404, xhr.status, "single rev purge removes revision");
+
+  var xhr = CouchDB.request("POST", "/" + dbB.name + "/_purge", {
+    body: JSON.stringify({"test":[docB._rev]})
+  });
+  TEquals(200, xhr.status, "single rev purge after replication succeeds");
+  var xhr = CouchDB.request("GET", "/" + dbB.name + "/test?rev=" + docB._rev);
+  TEquals(404, xhr.status, "single rev purge removes revision");
+
+  var xhr = CouchDB.request("POST", "/" + dbB.name + "/_purge", {
+    body: JSON.stringify({"test":[docA._rev, docB._rev]})
+  });
+  TEquals(200, xhr.status, "all rev purge after replication succeeds");
 };
diff --git a/rel/overlay/share/www/script/test/reduce_builtin.js b/rel/overlay/share/www/script/test/reduce_builtin.js
index c9d41fa4..b3cc3cc7 100644
--- a/rel/overlay/share/www/script/test/reduce_builtin.js
+++ b/rel/overlay/share/www/script/test/reduce_builtin.js
@@ -150,5 +150,30 @@ couchTests.reduce_builtin = function(debug) {
       T(equals(results.rows[5], {key:["d","b"],value:10*i}));
       T(equals(results.rows[6], {key:["d","c"],value:10*i}));
     };
+
+    map = function (doc) { emit(doc.keys, [1, 1]); };
+
+    var results = db.query(map, "_sum", {group:true});
+    T(equals(results.rows[0], {key:["a"],value:[20*i,20*i]}));
+    T(equals(results.rows[1], {key:["a","b"],value:[20*i,20*i]}));
+    T(equals(results.rows[2], {key:["a", "b", "c"],value:[10*i,10*i]}));
+    T(equals(results.rows[3], {key:["a", "b", "d"],value:[10*i,10*i]}));
+
+    var results = db.query(map, "_sum", {group: true, limit: 2});
+    T(equals(results.rows[0], {key: ["a"], value: [20*i,20*i]}));
+    T(equals(results.rows.length, 2));
+
+    var results = db.query(map, "_sum", {group_level:1});
+    T(equals(results.rows[0], {key:["a"],value:[70*i,70*i]}));
+    T(equals(results.rows[1], {key:["d"],value:[40*i,40*i]}));
+
+    var results = db.query(map, "_sum", {group_level:2});
+    T(equals(results.rows[0], {key:["a"],value:[20*i,20*i]}));
+    T(equals(results.rows[1], {key:["a","b"],value:[40*i,40*i]}));
+    T(equals(results.rows[2], {key:["a","c"],value:[10*i,10*i]}));
+    T(equals(results.rows[3], {key:["d"],value:[10*i,10*i]}));
+    T(equals(results.rows[4], {key:["d","a"],value:[10*i,10*i]}));
+    T(equals(results.rows[5], {key:["d","b"],value:[10*i,10*i]}));
+    T(equals(results.rows[6], {key:["d","c"],value:[10*i,10*i]}));
   }
 }
diff --git a/rel/overlay/share/www/script/test/replication.js b/rel/overlay/share/www/script/test/replication.js
index 7cc1f823..25746625 100644
--- a/rel/overlay/share/www/script/test/replication.js
+++ b/rel/overlay/share/www/script/test/replication.js
@@ -12,16 +12,30 @@
 
 couchTests.replication = function(debug) {
   if (debug) debugger;
+
+  function waitForSeq(sourceDb, targetDb) {
+    var targetSeq,
+        sourceSeq = sourceDb.info().update_seq,
+        t0 = new Date(),
+        t1,
+        ms = 3000;
+
+    do {
+      targetSeq = targetDb.info().update_seq;
+      t1 = new Date();
+    } while (((t1 - t0) <= ms) && targetSeq < sourceSeq);
+  }
+
   var host = CouchDB.host;
   var dbPairs = [
     {source:"test_suite_db_a",
       target:"test_suite_db_b"},
     {source:"test_suite_db_a",
-      target:"http://" + host + "/test_suite_db_b"},
-    {source:"http://" + host + "/test_suite_db_a",
+      target:CouchDB.protocol + host + "/test_suite_db_b"},
+    {source:CouchDB.protocol + host + "/test_suite_db_a",
       target:"test_suite_db_b"},
-    {source:"http://" + host + "/test_suite_db_a",
-      target:"http://" + host + "/test_suite_db_b"}
+    {source:CouchDB.protocol + host + "/test_suite_db_a",
+      target:CouchDB.protocol + host + "/test_suite_db_b"}
   ];
   var dbA = new CouchDB("test_suite_db_a", {"X-Couch-Full-Commit":"false"});
   var dbB = new CouchDB("test_suite_db_b", {"X-Couch-Full-Commit":"false"});
@@ -296,7 +310,7 @@ couchTests.replication = function(debug) {
 
   // remote
   dbB.deleteDb();
-  CouchDB.replicate(dbA.name, "http://" + CouchDB.host + "/test_suite_db_b", {
+  CouchDB.replicate(dbA.name, CouchDB.protocol + CouchDB.host + "/test_suite_db_b", {
     body: {"create_target": true}
   });
   TEquals("test_suite_db_b", dbB.info().db_name,
@@ -310,14 +324,14 @@ couchTests.replication = function(debug) {
   T(continuousResult._local_id);
 
   var cancelResult = CouchDB.replicate(dbA.name, "test_suite_db_b", {
-    body: {"cancel": true}
+    body: {"continuous":true, "cancel": true}
   });
   T(cancelResult.ok);
   T(continuousResult._local_id == cancelResult._local_id);
 
   try {
    var cancelResult2 = CouchDB.replicate(dbA.name, "test_suite_db_b", {
-     body: {"cancel": true}
+     body: {"continuous":true, "cancel": true}
    });
   } catch (e) {
     T(e.error == "not_found");
@@ -372,11 +386,11 @@ couchTests.replication = function(debug) {
     {source:"test_suite_rep_docs_db_a",
       target:"test_suite_rep_docs_db_b"},
     {source:"test_suite_rep_docs_db_a",
-      target:"http://" + host + "/test_suite_rep_docs_db_b"},
-    {source:"http://" + host + "/test_suite_rep_docs_db_a",
+      target:CouchDB.protocol + host + "/test_suite_rep_docs_db_b"},
+    {source:CouchDB.protocol + host + "/test_suite_rep_docs_db_a",
       target:"test_suite_rep_docs_db_b"},
-    {source:"http://" + host + "/test_suite_rep_docs_db_a",
-      target:"http://" + host + "/test_suite_rep_docs_db_b"}
+    {source:CouchDB.protocol + host + "/test_suite_rep_docs_db_a",
+      target:CouchDB.protocol + host + "/test_suite_rep_docs_db_b"}
   ];
 
   var target_doc_ids = [
@@ -399,24 +413,25 @@ couchTests.replication = function(debug) {
       var valid_doc_ids = [];
       var invalid_doc_ids = [];
 
-      $.each(doc_ids, function(index, id) {
-        var found = false;
+        for (var p = 0; p < doc_ids.length; p++) {
+            var id = doc_ids[p];
+            var found = false;
 
-        for (var k = 0; k < all_docs.length; k++) {
-          var doc = all_docs[k];
+            for (var k = 0; k < all_docs.length; k++) {
+                var doc = all_docs[k];
 
-          if (id === doc._id) {
-            found = true;
-            break;
-          }
-        }
+                if (id === doc._id) {
+                    found = true;
+                    break;
+                }
+            }
 
-        if (found) {
-          valid_doc_ids.push(id);
-        } else {
-          invalid_doc_ids.push(id);
-        }
-      });
+            if (found) {
+                valid_doc_ids.push(id);
+            } else {
+                invalid_doc_ids.push(id);
+            }
+        };
 
       dbB.deleteDb();
       dbB.createDb();
@@ -434,7 +449,7 @@ couchTests.replication = function(debug) {
         var doc = all_docs[k];
         var tgt_doc = dbB.open(doc._id);
 
-        if ($.inArray(doc._id, doc_ids) >= 0) {
+        if (doc_ids.indexOf(doc._id) >= 0) {
           T(tgt_doc !== null);
           T(tgt_doc.value === doc.value);
         } else {
@@ -451,45 +466,50 @@ couchTests.replication = function(debug) {
   }
 
   // test filtered replication
-
-  var sourceDb = new CouchDB(
-    "test_suite_filtered_rep_db_a", {"X-Couch-Full-Commit":"false"}
-  );
-
-  sourceDb.deleteDb();
-  sourceDb.createDb();
-
-  T(sourceDb.save({_id:"foo1",value:1}).ok);
-  T(sourceDb.save({_id:"foo2",value:2}).ok);
-  T(sourceDb.save({_id:"foo3",value:3}).ok);
-  T(sourceDb.save({_id:"foo4",value:4}).ok);
-  T(sourceDb.save({
-    "_id": "_design/mydesign",
-    "language" : "javascript",
-    "filters" : {
-      "myfilter" : (function(doc, req) {
-        if (doc.value < Number(req.query.maxvalue)) {
-          return true;
-        } else {
-          return false;
-        }
-      }).toString()
+  var filterFun1 = (function(doc, req) {
+    if (doc.value < Number(req.query.maxvalue)) {
+      return true;
+    } else {
+      return false;
     }
-  }).ok);
+  }).toString();
+
+  var filterFun2 = (function(doc, req) {
+    return true;
+  }).toString();
 
   var dbPairs = [
     {source:"test_suite_filtered_rep_db_a",
       target:"test_suite_filtered_rep_db_b"},
     {source:"test_suite_filtered_rep_db_a",
-      target:"http://" + host + "/test_suite_filtered_rep_db_b"},
-    {source:"http://" + host + "/test_suite_filtered_rep_db_a",
+      target:CouchDB.protocol + host + "/test_suite_filtered_rep_db_b"},
+    {source:CouchDB.protocol + host + "/test_suite_filtered_rep_db_a",
       target:"test_suite_filtered_rep_db_b"},
-    {source:"http://" + host + "/test_suite_filtered_rep_db_a",
-      target:"http://" + host + "/test_suite_filtered_rep_db_b"}
+    {source:CouchDB.protocol + host + "/test_suite_filtered_rep_db_a",
+      target:CouchDB.protocol + host + "/test_suite_filtered_rep_db_b"}
   ];
+  var sourceDb = new CouchDB("test_suite_filtered_rep_db_a");
+  var targetDb = new CouchDB("test_suite_filtered_rep_db_b");
 
   for (var i = 0; i < dbPairs.length; i++) {
-    var targetDb = new CouchDB("test_suite_filtered_rep_db_b");
+    sourceDb.deleteDb();
+    sourceDb.createDb();
+
+    T(sourceDb.save({_id: "foo1", value: 1}).ok);
+    T(sourceDb.save({_id: "foo2", value: 2}).ok);
+    T(sourceDb.save({_id: "foo3", value: 3}).ok);
+    T(sourceDb.save({_id: "foo4", value: 4}).ok);
+
+    var ddoc = {
+      "_id": "_design/mydesign",
+      "language": "javascript",
+      "filters": {
+        "myfilter": filterFun1
+       }
+    };
+
+    T(sourceDb.save(ddoc).ok);
+
     targetDb.deleteDb();
     targetDb.createDb();
 
@@ -506,7 +526,7 @@ couchTests.replication = function(debug) {
     });
 
     T(repResult.ok);
-    T($.isArray(repResult.history));
+    T(repResult.history instanceof Array);
     T(repResult.history.length === 1);
     T(repResult.history[0].docs_written === 2);
     T(repResult.history[0].docs_read === 2);
@@ -525,6 +545,45 @@ couchTests.replication = function(debug) {
 
     var docFoo4 = targetDb.open("foo4");
     T(docFoo4 === null);
+
+    // replication should start from scratch after the filter's code changed
+
+    ddoc.filters.myfilter = filterFun2;
+    T(sourceDb.save(ddoc).ok);
+
+    repResult = CouchDB.replicate(dbA, dbB, {
+      body: {
+        "filter" : "mydesign/myfilter",
+        "query_params" : {
+          "maxvalue": "3"
+        }
+      }
+    });
+
+    T(repResult.ok);
+    T(repResult.history instanceof Array);
+    T(repResult.history.length === 1);
+    T(repResult.history[0].docs_written === 3);
+    T(repResult.history[0].docs_read === 3);
+    T(repResult.history[0].doc_write_failures === 0);
+
+    docFoo1 = targetDb.open("foo1");
+    T(docFoo1 !== null);
+    T(docFoo1.value === 1);
+
+    docFoo2 = targetDb.open("foo2");
+    T(docFoo2 !== null);
+    T(docFoo2.value === 2);
+
+    docFoo3 = targetDb.open("foo3");
+    T(docFoo3 !== null);
+    T(docFoo3.value === 3);
+
+    docFoo4 = targetDb.open("foo4");
+    T(docFoo4 !== null);
+    T(docFoo4.value === 4);
+
+    T(targetDb.open("_design/mydesign") !== null);
   }
 
   // test for COUCHDB-868 - design docs' attachments not getting replicated
@@ -610,7 +669,7 @@ couchTests.replication = function(debug) {
     T(CouchDB.session().userCtx.roles.indexOf("_admin") === -1);
 
     var repResult = CouchDB.replicate(
-      "http://fdmanana:qwerty@" + host + "/" + dbA.name,
+      CouchDB.protocol + "fdmanana:qwerty@" + host + "/" + dbA.name,
       dbB.name
     );
     T(repResult.ok === true);
@@ -662,7 +721,7 @@ couchTests.replication = function(debug) {
     T(CouchDB.session().userCtx.roles.indexOf("_admin") === -1);
     try {
       repResult = CouchDB.replicate(
-        "http://fdmanana:qwerty@" + host + "/" + dbA.name,
+        CouchDB.protocol + "fdmanana:qwerty@" + host + "/" + dbA.name,
         dbB.name
       );
       T(false, "replication should have failed");
@@ -679,6 +738,132 @@ couchTests.replication = function(debug) {
 
   run_on_modified_server(server_config, test_fun);
 
+  // COUCHDB-1093 - filtered and continuous _changes feed dies when the
+  // database is compacted
+  dbA = new CouchDB("test_suite_db_a");
+  dbB = new CouchDB("test_suite_db_b");
+
+  dbA.deleteDb();
+  dbA.createDb();
+  dbB.deleteDb();
+  dbB.createDb();
+
+  var docs = makeDocs(1, 10);
+  docs.push({
+    _id: "_design/foo",
+    language: "javascript",
+    filters: {
+      myfilter: (function(doc, req) { return true; }).toString()
+    }
+  });
+  dbA.bulkSave(docs).ok;
+
+  var repResult = CouchDB.replicate(
+    CouchDB.protocol + host + "/" + dbA.name,
+    dbB.name,
+    {
+      body: {
+        continuous: true,
+        filter: "foo/myfilter"
+      }
+    }
+  );
+  TEquals(true, repResult.ok);
+  TEquals('string', typeof repResult._local_id);
+
+  var xhr = CouchDB.request("GET", "/_active_tasks");
+  var tasks = JSON.parse(xhr.responseText);
+
+  TEquals(true, dbA.compact().ok);
+  while (dbA.info().compact_running) {};
+
+  TEquals(true, dbA.save(makeDocs(30, 31)[0]).ok);
+  xhr = CouchDB.request("GET", "/_active_tasks");
+
+  var tasksAfter = JSON.parse(xhr.responseText);
+  TEquals(tasks.length, tasksAfter.length);
+  waitForSeq(dbA, dbB);
+  T(dbB.open("30") !== null);
+
+  repResult = CouchDB.replicate(
+    CouchDB.protocol + host + "/" + dbA.name,
+    dbB.name,
+    {
+      body: {
+        continuous: true,
+        filter: "foo/myfilter",
+        cancel: true
+      }
+    }
+  );
+  TEquals(true, repResult.ok);
+  TEquals('string', typeof repResult._local_id);
+
+
+  // COUCHDB-885 - push replication of a doc with attachment causes a
+ //  conflict in the target.
+  dbA = new CouchDB("test_suite_db_a");
+  dbB = new CouchDB("test_suite_db_b");
+
+  dbA.deleteDb();
+  dbA.createDb();
+  dbB.deleteDb();
+  dbB.createDb();
+
+  var doc = {
+    _id: "doc1"
+  };
+  TEquals(true, dbA.save(doc).ok);
+
+  repResult = CouchDB.replicate(
+    dbA.name,
+    CouchDB.protocol + host + "/" + dbB.name
+  );
+  TEquals(true, repResult.ok);
+  TEquals(true, repResult.history instanceof Array);
+  TEquals(1, repResult.history.length);
+  TEquals(1, repResult.history[0].docs_written);
+  TEquals(1, repResult.history[0].docs_read);
+  TEquals(0, repResult.history[0].doc_write_failures);
+
+  doc["_attachments"] = {
+    "hello.txt": {
+      "content_type": "text/plain",
+      "data": "aGVsbG8gd29ybGQ="  // base64:encode("hello world")
+    },
+    "foo.dat": {
+      "content_type": "not/compressible",
+      "data": "aSBhbSBub3QgZ3ppcGVk"  // base64:encode("i am not gziped")
+    }
+  };
+
+  TEquals(true, dbA.save(doc).ok);
+  repResult = CouchDB.replicate(
+    dbA.name,
+    CouchDB.protocol + host + "/" + dbB.name
+  );
+  TEquals(true, repResult.ok);
+  TEquals(true, repResult.history instanceof Array);
+  TEquals(2, repResult.history.length);
+  TEquals(1, repResult.history[0].docs_written);
+  TEquals(1, repResult.history[0].docs_read);
+  TEquals(0, repResult.history[0].doc_write_failures);
+
+  var copy = dbB.open(doc._id, {
+    conflicts: true, deleted_conflicts: true, attachments: true,
+    att_encoding_info: true});
+  T(copy !== null);
+  TEquals("undefined", typeof copy._conflicts);
+  TEquals("undefined", typeof copy._deleted_conflicts);
+  TEquals("text/plain", copy._attachments["hello.txt"]["content_type"]);
+  TEquals("aGVsbG8gd29ybGQ=", copy._attachments["hello.txt"]["data"]);
+  TEquals("gzip", copy._attachments["hello.txt"]["encoding"]);
+  TEquals("not/compressible", copy._attachments["foo.dat"]["content_type"]);
+  TEquals("aSBhbSBub3QgZ3ppcGVk", copy._attachments["foo.dat"]["data"]);
+  TEquals("undefined", typeof copy._attachments["foo.dat"]["encoding"]);
+  // end of test for COUCHDB-885
+
+
   // cleanup
   dbA.deleteDb();
   dbB.deleteDb();
diff --git a/rel/overlay/share/www/script/test/replicator_db.js b/rel/overlay/share/www/script/test/replicator_db.js
new file mode 100644
index 00000000..058b6a7a
--- /dev/null
+++ b/rel/overlay/share/www/script/test/replicator_db.js
@@ -0,0 +1,1447 @@
+// Licensed under the Apache License, Version 2.0 (the "License"); you may not
+// use this file except in compliance with the License. You may obtain a copy of
+// the License at
+//
+//   http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
+// WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
+// License for the specific language governing permissions and limitations under
+// the License.
+
+couchTests.replicator_db = function(debug) {
+
+  if (debug) debugger;
+
+  var wait_rep_doc = 500; // number of millisecs to wait after saving a Rep Doc
+  var host = CouchDB.host;
+  var dbA = new CouchDB("test_suite_rep_db_a", {"X-Couch-Full-Commit":"false"});
+  var dbB = new CouchDB("test_suite_rep_db_b", {"X-Couch-Full-Commit":"false"});
+  var repDb = new CouchDB("test_suite_rep_db", {"X-Couch-Full-Commit":"false"});
+  var usersDb = new CouchDB("test_suite_auth", {"X-Couch-Full-Commit":"false"});
+
+  var docs1 = [
+    {
+      _id: "foo1",
+      value: 11
+    },
+    {
+      _id: "foo2",
+      value: 22
+    },
+    {
+      _id: "foo3",
+      value: 33
+    }
+  ];
+
+  function waitForRep(repDb, repDoc, state) {
+    var newRep,
+        t0 = new Date(),
+        t1,
+        ms = 3000;
+
+    do {
+      newRep = repDb.open(repDoc._id);
+      t1 = new Date();
+    } while (((t1 - t0) <= ms) && newRep._replication_state !== state);
+  }
+
+  function waitForSeq(sourceDb, targetDb) {
+    var targetSeq,
+        sourceSeq = sourceDb.info().update_seq,
+        t0 = new Date(),
+        t1,
+        ms = 3000;
+
+    do {
+      targetSeq = targetDb.info().update_seq;
+      t1 = new Date();
+    } while (((t1 - t0) <= ms) && targetSeq < sourceSeq);
+  }
+
+  function waitForDocPos(db, docId, pos) {
+    var doc, curPos, t0, t1,
+        maxWait = 3000;
+
+    doc = db.open(docId);
+    curPos = Number(doc._rev.split("-", 1));
+    t0 = t1 = new Date();
+
+    while ((curPos < pos) && ((t1 - t0) <= maxWait)) {
+       doc = db.open(docId);
+       curPos = Number(doc._rev.split("-", 1));
+       t1 = new Date();
+    }
+
+    return doc;
+  }
+
+  function wait(ms) {
+    var t0 = new Date(), t1;
+    do {
+      CouchDB.request("GET", "/");
+      t1 = new Date();
+    } while ((t1 - t0) <= ms);
+  }
+
+
+  function populate_db(db, docs) {
+    db.deleteDb();
+    db.createDb();
+    for (var i = 0; i < docs.length; i++) {
+      var d = docs[i];
+      delete d._rev;
+      T(db.save(d).ok);
+    }
+  }
+
+  function simple_replication() {
+    populate_db(dbA, docs1);
+    populate_db(dbB, []);
+
+    var repDoc = {
+      _id: "foo_simple_rep",
+      source: dbA.name,
+      target: dbB.name
+    };
+    T(repDb.save(repDoc).ok);
+
+    waitForRep(repDb, repDoc, "completed");
+    for (var i = 0; i < docs1.length; i++) {
+      var doc = docs1[i];
+      var copy = dbB.open(doc._id);
+      T(copy !== null);
+      T(copy.value === doc.value);
+    }
+
+    var repDoc1 = repDb.open(repDoc._id);
+    T(repDoc1 !== null);
+    T(repDoc1.source === repDoc.source);
+    T(repDoc1.target === repDoc.target);
+    T(repDoc1._replication_state === "completed", "simple");
+    T(typeof repDoc1._replication_state_time === "string");
+    T(typeof repDoc1._replication_id  === "string");
+  }
+
+
+  function filtered_replication() {
+    var docs2 = docs1.concat([
+      {
+        _id: "_design/mydesign",
+        language : "javascript",
+        filters : {
+          myfilter : (function(doc, req) {
+            return (doc.value % 2) !== Number(req.query.myparam);
+          }).toString()
+        }
+      }
+    ]);
+
+    populate_db(dbA, docs2);
+    populate_db(dbB, []);
+
+    var repDoc = {
+      _id: "foo_filt_rep_doc",
+      source: "http://" + host + "/" + dbA.name,
+      target: dbB.name,
+      filter: "mydesign/myfilter",
+      query_params: {
+        myparam: 1
+      }
+    };
+    T(repDb.save(repDoc).ok);
+
+    waitForRep(repDb, repDoc, "completed");
+    for (var i = 0; i < docs2.length; i++) {
+      var doc = docs2[i];
+      var copy = dbB.open(doc._id);
+
+      if (typeof doc.value === "number") {
+        if ((doc.value % 2) !== 1) {
+          T(copy !== null);
+          T(copy.value === doc.value);
+        } else {
+          T(copy === null);
+        }
+      }
+    }
+
+    var repDoc1 = repDb.open(repDoc._id);
+    T(repDoc1 !== null);
+    T(repDoc1.source === repDoc.source);
+    T(repDoc1.target === repDoc.target);
+    T(repDoc1._replication_state === "completed", "filtered");
+    T(typeof repDoc1._replication_state_time === "string");
+    T(typeof repDoc1._replication_id  === "string");
+  }
+
+
+  function continuous_replication() {
+    populate_db(dbA, docs1);
+    populate_db(dbB, []);
+
+    var repDoc = {
+      _id: "foo_cont_rep_doc",
+      source: "http://" + host + "/" + dbA.name,
+      target: dbB.name,
+      continuous: true,
+      user_ctx: {
+        roles: ["_admin"]
+      }
+    };
+
+    T(repDb.save(repDoc).ok);
+
+    waitForSeq(dbA, dbB);
+    for (var i = 0; i < docs1.length; i++) {
+      var doc = docs1[i];
+      var copy = dbB.open(doc._id);
+      T(copy !== null);
+      T(copy.value === doc.value);
+    }
+
+    // add another doc to source, it will be replicated to target
+    var docX = {
+      _id: "foo1000",
+      value: 1001
+    };
+
+    T(dbA.save(docX).ok);
+
+    waitForSeq(dbA, dbB);
+    var copy = dbB.open("foo1000");
+    T(copy !== null);
+    T(copy.value === 1001);
+
+    var repDoc1 = repDb.open(repDoc._id);
+    T(repDoc1 !== null);
+    T(repDoc1.source === repDoc.source);
+    T(repDoc1.target === repDoc.target);
+    T(repDoc1._replication_state === "triggered");
+    T(typeof repDoc1._replication_state_time === "string");
+    T(typeof repDoc1._replication_id  === "string");
+
+    // Design documents are only replicated to local targets if the respective
+    // replication document has a user_ctx filed with the "_admin" role in it.
+    var ddoc = {
+      _id: "_design/foobar",
+      language: "javascript"
+    };
+
+    T(dbA.save(ddoc).ok);
+
+    waitForSeq(dbA, dbB);
+    var ddoc_copy = dbB.open("_design/foobar");
+    T(ddoc_copy !== null);
+    T(ddoc.language === "javascript");
+
+    // update the design doc on source, test that the new revision is replicated
+    ddoc.language = "erlang";
+    T(dbA.save(ddoc).ok);
+    T(ddoc._rev.indexOf("2-") === 0);
+
+    waitForSeq(dbA, dbB);
+    ddoc_copy = dbB.open("_design/foobar");
+    T(ddoc_copy !== null);
+    T(ddoc_copy._rev === ddoc._rev);
+    T(ddoc.language === "erlang");
+
+    // stop replication by deleting the replication document
+    T(repDb.deleteDoc(repDoc1).ok);
+
+    // add another doc to source, it will NOT be replicated to target
+    var docY = {
+      _id: "foo666",
+      value: 999
+    };
+
+    T(dbA.save(docY).ok);
+
+    wait(200); // is there a way to avoid wait here?
+    var copy = dbB.open("foo666");
+    T(copy === null);
+  }
+
+
+  function by_doc_ids_replication() {
+    // to test that we can replicate docs with slashes in their IDs
+    var docs2 = docs1.concat([
+      {
+        _id: "_design/mydesign",
+        language : "javascript"
+      }
+    ]);
+
+    populate_db(dbA, docs2);
+    populate_db(dbB, []);
+
+    var repDoc = {
+      _id: "foo_cont_rep_doc",
+      source: "http://" + host + "/" + dbA.name,
+      target: dbB.name,
+      doc_ids: ["foo666", "foo3", "_design/mydesign", "foo999", "foo1"]
+    };
+    T(repDb.save(repDoc).ok);
+
+    waitForRep(repDb, repDoc, "completed");
+    var copy = dbB.open("foo1");
+    T(copy !== null);
+    T(copy.value === 11);
+
+    copy = dbB.open("foo2");
+    T(copy === null);
+
+    copy = dbB.open("foo3");
+    T(copy !== null);
+    T(copy.value === 33);
+
+    copy = dbB.open("foo666");
+    T(copy === null);
+
+    copy = dbB.open("foo999");
+    T(copy === null);
+
+    copy = dbB.open("_design/mydesign");
+    T(copy === null);
+  }
+
+
+  function successive_identical_replications() {
+    populate_db(dbA, docs1);
+    populate_db(dbB, []);
+
+    var repDoc1 = {
+      _id: "foo_ident_rep_1",
+      source: dbA.name,
+      target: dbB.name
+    };
+    T(repDb.save(repDoc1).ok);
+
+    waitForRep(repDb, repDoc1, "completed");
+    for (var i = 0; i < docs1.length; i++) {
+      var doc = docs1[i];
+      var copy = dbB.open(doc._id);
+      T(copy !== null);
+      T(copy.value === doc.value);
+    }
+
+    var repDoc1_copy = repDb.open(repDoc1._id);
+    T(repDoc1_copy !== null);
+    T(repDoc1_copy.source === repDoc1.source);
+    T(repDoc1_copy.target === repDoc1.target);
+    T(repDoc1_copy._replication_state === "completed");
+    T(typeof repDoc1_copy._replication_state_time === "string");
+    T(typeof repDoc1_copy._replication_id  === "string");
+
+    var newDoc = {
+      _id: "doc666",
+      value: 666
+    };
+    T(dbA.save(newDoc).ok);
+
+    wait(200);
+    var newDoc_copy = dbB.open(newDoc._id);
+    // not replicated because first replication is complete (not continuous)
+    T(newDoc_copy === null);
+
+    var repDoc2 = {
+      _id: "foo_ident_rep_2",
+      source: dbA.name,
+      target: dbB.name
+    };
+    T(repDb.save(repDoc2).ok);
+
+    waitForRep(repDb, repDoc2, "completed");
+    var newDoc_copy = dbB.open(newDoc._id);
+    T(newDoc_copy !== null);
+    T(newDoc_copy.value === newDoc.value);
+
+    var repDoc2_copy = repDb.open(repDoc2._id);
+    T(repDoc2_copy !== null);
+    T(repDoc2_copy.source === repDoc1.source);
+    T(repDoc2_copy.target === repDoc1.target);
+    T(repDoc2_copy._replication_state === "completed");
+    T(typeof repDoc2_copy._replication_state_time === "string");
+    T(typeof repDoc2_copy._replication_id === "string");
+    T(repDoc2_copy._replication_id === repDoc1_copy._replication_id);
+  }
+
+
+  // test the case where multiple replication docs (different IDs)
+  // describe in fact the same replication (source, target, etc)
+  function identical_rep_docs() {
+    populate_db(dbA, docs1);
+    populate_db(dbB, []);
+
+    var repDoc1 = {
+      _id: "foo_dup_rep_doc_1",
+      source: "http://" + host + "/" + dbA.name,
+      target: dbB.name
+    };
+    var repDoc2 = {
+      _id: "foo_dup_rep_doc_2",
+      source: "http://" + host + "/" + dbA.name,
+      target: dbB.name
+    };
+
+    T(repDb.save(repDoc1).ok);
+    T(repDb.save(repDoc2).ok);
+
+    waitForRep(repDb, repDoc1, "completed");
+    for (var i = 0; i < docs1.length; i++) {
+      var doc = docs1[i];
+      var copy = dbB.open(doc._id);
+      T(copy !== null);
+      T(copy.value === doc.value);
+    }
+
+    repDoc1 = repDb.open("foo_dup_rep_doc_1");
+    T(repDoc1 !== null);
+    T(repDoc1._replication_state === "completed", "identical");
+    T(typeof repDoc1._replication_state_time === "string");
+    T(typeof repDoc1._replication_id  === "string");
+
+    repDoc2 = repDb.open("foo_dup_rep_doc_2");
+    T(repDoc2 !== null);
+    T(typeof repDoc2._replication_state === "undefined");
+    T(typeof repDoc2._replication_state_time === "undefined");
+    T(repDoc2._replication_id === repDoc1._replication_id);
+  }
+
+
+  // test the case where multiple replication docs (different IDs)
+  // describe in fact the same continuous replication (source, target, etc)
+  function identical_continuous_rep_docs() {
+    populate_db(dbA, docs1);
+    populate_db(dbB, []);
+
+    var repDoc1 = {
+      _id: "foo_dup_cont_rep_doc_1",
+      source: "http://" + host + "/" + dbA.name,
+      target: dbB.name,
+      continuous: true
+    };
+    var repDoc2 = {
+      _id: "foo_dup_cont_rep_doc_2",
+      source: "http://" + host + "/" + dbA.name,
+      target: dbB.name,
+      continuous: true
+    };
+
+    T(repDb.save(repDoc1).ok);
+    T(repDb.save(repDoc2).ok);
+
+    waitForSeq(dbA, dbB);
+    for (var i = 0; i < docs1.length; i++) {
+      var doc = docs1[i];
+      var copy = dbB.open(doc._id);
+      T(copy !== null);
+      T(copy.value === doc.value);
+    }
+
+    repDoc1 = repDb.open("foo_dup_cont_rep_doc_1");
+    T(repDoc1 !== null);
+    T(repDoc1._replication_state === "triggered");
+    T(typeof repDoc1._replication_state_time === "string");
+    T(typeof repDoc1._replication_id  === "string");
+
+    repDoc2 = repDb.open("foo_dup_cont_rep_doc_2");
+    T(repDoc2 !== null);
+    T(typeof repDoc2._replication_state === "undefined");
+    T(typeof repDoc2._replication_state_time === "undefined");
+    T(repDoc2._replication_id === repDoc1._replication_id);
+
+    var newDoc = {
+      _id: "foo666",
+      value: 999
+    };
+    T(dbA.save(newDoc).ok);
+
+    waitForSeq(dbA, dbB);
+    var copy = dbB.open("foo666");
+    T(copy !== null);
+    T(copy.value === 999);
+
+    // deleting second replication doc, doesn't affect the 1st one and
+    // neither it stops the replication
+    T(repDb.deleteDoc(repDoc2).ok);
+    repDoc1 = repDb.open("foo_dup_cont_rep_doc_1");
+    T(repDoc1 !== null);
+    T(repDoc1._replication_state === "triggered");
+    T(typeof repDoc1._replication_state_time === "string");
+
+    var newDoc2 = {
+        _id: "foo5000",
+        value: 5000
+    };
+    T(dbA.save(newDoc2).ok);
+
+    waitForSeq(dbA, dbB);
+    var copy = dbB.open("foo5000");
+    T(copy !== null);
+    T(copy.value === 5000);
+
+    // deleting the 1st replication document stops the replication
+    T(repDb.deleteDoc(repDoc1).ok);
+    var newDoc3 = {
+        _id: "foo1983",
+        value: 1983
+    };
+    T(dbA.save(newDoc3).ok);
+
+    wait(wait_rep_doc); //how to remove wait?
+    var copy = dbB.open("foo1983");
+    T(copy === null);
+  }
+
+
+  function test_replication_credentials_delegation() {
+    populate_db(usersDb, []);
+
+    var joeUserDoc = CouchDB.prepareUserDoc({
+      name: "joe",
+      roles: ["god", "erlanger"]
+    }, "erly");
+    T(usersDb.save(joeUserDoc).ok);
+
+    var ddoc = {
+      _id: "_design/beer",
+      language: "javascript"
+    };
+    populate_db(dbA, docs1.concat([ddoc]));
+    populate_db(dbB, []);
+
+    T(dbB.setSecObj({
+      admins: {
+        names: [],
+        roles: ["god"]
+      }
+    }).ok);
+
+    var server_admins_config = [
+      {
+        section: "admins",
+        key: "fdmanana",
+        value: "qwerty"
+      }
+    ];
+
+    run_on_modified_server(server_admins_config, function() {
+
+      T(CouchDB.login("fdmanana", "qwerty").ok);
+      T(CouchDB.session().userCtx.name === "fdmanana");
+      T(CouchDB.session().userCtx.roles.indexOf("_admin") !== -1);
+
+      var repDoc = {
+        _id: "foo_rep_del_doc_1",
+        source: dbA.name,
+        target: dbB.name,
+        user_ctx: {
+          name: "joe",
+          roles: ["erlanger"]
+        }
+      };
+
+      T(repDb.save(repDoc).ok);
+
+      waitForRep(repDb, repDoc, "completed");
+      for (var i = 0; i < docs1.length; i++) {
+        var doc = docs1[i];
+        var copy = dbB.open(doc._id);
+        T(copy !== null);
+        T(copy.value === doc.value);
+      }
+
+      // design doc was not replicated, because joe is not an admin of db B
+      var doc = dbB.open(ddoc._id);
+      T(doc === null);
+
+      // now test the same replication but putting the role "god" in the
+      // delegation user context property
+      var repDoc2 = {
+        _id: "foo_rep_del_doc_2",
+        source: dbA.name,
+        target: dbB.name,
+        user_ctx: {
+          name: "joe",
+          roles: ["erlanger", "god"]
+        }
+      };
+      T(repDb.save(repDoc2).ok);
+
+      waitForRep(repDb, repDoc2, "completed");
+      for (var i = 0; i < docs1.length; i++) {
+        var doc = docs1[i];
+        var copy = dbB.open(doc._id);
+        T(copy !== null);
+        T(copy.value === doc.value);
+      }
+
+      // because anyone with a 'god' role is an admin of db B, a replication
+      // that is delegated to a 'god' role can write design docs to db B
+      doc = dbB.open(ddoc._id);
+      T(doc !== null);
+      T(doc.language === ddoc.language);
+    });
+  }
+
+
+  function continuous_replication_survives_restart() {
+    var origRepDbName = CouchDB.request(
+      "GET", "/_config/replicator/db").responseText;
+
+    repDb.deleteDb();
+
+    var xhr = CouchDB.request("PUT", "/_config/replicator/db", {
+      body : JSON.stringify(repDb.name),
+      headers: {"X-Couch-Persist": "false"}
+    });
+    T(xhr.status === 200);
+
+    populate_db(dbA, docs1);
+    populate_db(dbB, []);
+
+    var repDoc = {
+      _id: "foo_cont_rep_survives_doc",
+      source: "http://" + host + "/" + dbA.name,
+      target: dbB.name,
+      continuous: true
+    };
+
+    T(repDb.save(repDoc).ok);
+
+    waitForSeq(dbA, dbB);
+    for (var i = 0; i < docs1.length; i++) {
+      var doc = docs1[i];
+      var copy = dbB.open(doc._id);
+      T(copy !== null);
+      T(copy.value === doc.value);
+    }
+
+    repDb.ensureFullCommit();
+    dbA.ensureFullCommit();
+
+    restartServer();
+
+    xhr = CouchDB.request("PUT", "/_config/replicator/db", {
+      body : JSON.stringify(repDb.name),
+      headers: {"X-Couch-Persist": "false"}
+    });
+
+    T(xhr.status === 200);
+
+    // add another doc to source, it will be replicated to target
+    var docX = {
+      _id: "foo1000",
+      value: 1001
+    };
+
+    T(dbA.save(docX).ok);
+
+    waitForSeq(dbA, dbB);
+    var copy = dbB.open("foo1000");
+    T(copy !== null);
+    T(copy.value === 1001);
+
+    repDoc = waitForDocPos(repDb, "foo_cont_rep_survives_doc", 3);
+    T(repDoc !== null);
+    T(repDoc.continuous === true);
+
+    // stop replication
+    T(repDb.deleteDoc(repDoc).ok);
+
+    xhr = CouchDB.request("PUT", "/_config/replicator/db", {
+      body : origRepDbName,
+      headers: {"X-Couch-Persist": "false"}
+    });
+    T(xhr.status === 200);
+  }
+
+
+  function rep_db_write_authorization() {
+    populate_db(dbA, docs1);
+    populate_db(dbB, []);
+
+    var server_admins_config = [
+      {
+        section: "admins",
+        key: "fdmanana",
+        value: "qwerty"
+      }
+    ];
+
+    run_on_modified_server(server_admins_config, function() {
+      var repDoc = {
+        _id: "foo_rep_doc",
+        source: dbA.name,
+        target: dbB.name,
+        continuous: true
+      };
+
+      T(CouchDB.login("fdmanana", "qwerty").ok);
+      T(CouchDB.session().userCtx.name === "fdmanana");
+      T(CouchDB.session().userCtx.roles.indexOf("_admin") !== -1);
+
+      T(repDb.save(repDoc).ok);
+
+      waitForRep(repDb, repDoc, "completed");
+
+      for (var i = 0; i < docs1.length; i++) {
+        var doc = docs1[i];
+        var copy = dbB.open(doc._id);
+
+        T(copy !== null);
+        T(copy.value === doc.value);
+      }
+
+      repDoc = repDb.open("foo_rep_doc");
+      T(repDoc !== null);
+      repDoc.target = "test_suite_foo_db";
+      repDoc.create_target = true;
+
+      // Only the replicator can update replication documents.
+      // Admins can only add and delete replication documents.
+      try {
+        repDb.save(repDoc);
+        T(false && "Should have thrown an exception");
+      } catch (x) {
+        T(x["error"] === "forbidden");
+      }
+    });
+  }
+
+
+  function test_user_ctx_validation() {
+    populate_db(dbA, docs1);
+    populate_db(dbB, []);
+    populate_db(usersDb, []);
+
+    var joeUserDoc = CouchDB.prepareUserDoc({
+      name: "joe",
+      roles: ["erlanger", "bar"]
+    }, "erly");
+    var fdmananaUserDoc = CouchDB.prepareUserDoc({
+      name: "fdmanana",
+      roles: ["a", "b", "c"]
+    }, "qwerty");
+
+    TEquals(true, usersDb.save(joeUserDoc).ok);
+    TEquals(true, usersDb.save(fdmananaUserDoc).ok);
+
+    T(dbB.setSecObj({
+      admins: {
+        names: [],
+        roles: ["god"]
+      },
+      readers: {
+        names: [],
+        roles: ["foo"]
+      }
+    }).ok);
+
+    TEquals(true, CouchDB.login("joe", "erly").ok);
+    TEquals("joe", CouchDB.session().userCtx.name);
+    TEquals(-1, CouchDB.session().userCtx.roles.indexOf("_admin"));
+
+    var repDoc = {
+      _id: "foo_rep",
+      source: CouchDB.protocol + host + "/" + dbA.name,
+      target: dbB.name
+    };
+
+    try {
+      repDb.save(repDoc);
+      T(false, "Should have failed, user_ctx missing.");
+    } catch (x) {
+      TEquals("forbidden", x.error);
+    }
+
+    repDoc.user_ctx = {
+      name: "john",
+      roles: ["erlanger"]
+    };
+
+    try {
+      repDb.save(repDoc);
+      T(false, "Should have failed, wrong user_ctx.name.");
+    } catch (x) {
+      TEquals("forbidden", x.error);
+    }
+
+    repDoc.user_ctx = {
+      name: "joe",
+      roles: ["bar", "god", "erlanger"]
+    };
+
+    try {
+      repDb.save(repDoc);
+      T(false, "Should have failed, a bad role in user_ctx.roles.");
+    } catch (x) {
+      TEquals("forbidden", x.error);
+    }
+
+    // user_ctx.roles might contain only a subset of the user's roles
+    repDoc.user_ctx = {
+      name: "joe",
+      roles: ["erlanger"]
+    };
+
+    TEquals(true, repDb.save(repDoc).ok);
+    CouchDB.logout();
+
+    waitForRep(repDb, repDoc, "error");
+    var repDoc1 = repDb.open(repDoc._id);
+    T(repDoc1 !== null);
+    TEquals(repDoc.source, repDoc1.source);
+    TEquals(repDoc.target, repDoc1.target);
+    TEquals("error", repDoc1._replication_state);
+    TEquals("string", typeof repDoc1._replication_id);
+    TEquals("string", typeof repDoc1._replication_state_time);
+
+    TEquals(true, CouchDB.login("fdmanana", "qwerty").ok);
+    TEquals("fdmanana", CouchDB.session().userCtx.name);
+    TEquals(-1, CouchDB.session().userCtx.roles.indexOf("_admin"));
+
+    try {
+      T(repDb.deleteDoc(repDoc1).ok);
+      T(false, "Shouldn't be able to delete replication document.");
+    } catch (x) {
+      TEquals("forbidden", x.error);
+    }
+
+    CouchDB.logout();
+    TEquals(true, CouchDB.login("joe", "erly").ok);
+    TEquals("joe", CouchDB.session().userCtx.name);
+    TEquals(-1, CouchDB.session().userCtx.roles.indexOf("_admin"));
+
+    T(repDb.deleteDoc(repDoc1).ok);
+    CouchDB.logout();
+
+    for (var i = 0; i < docs1.length; i++) {
+      var doc = docs1[i];
+      var copy = dbB.open(doc._id);
+
+      TEquals(null, copy);
+    }
+
+    T(dbB.setSecObj({
+      admins: {
+        names: [],
+        roles: ["god", "erlanger"]
+      },
+      readers: {
+        names: [],
+        roles: ["foo"]
+      }
+    }).ok);
+
+    TEquals(true, CouchDB.login("joe", "erly").ok);
+    TEquals("joe", CouchDB.session().userCtx.name);
+    TEquals(-1, CouchDB.session().userCtx.roles.indexOf("_admin"));
+
+    repDoc = {
+      _id: "foo_rep_2",
+      source: CouchDB.protocol + host + "/" + dbA.name,
+      target: dbB.name,
+      user_ctx: {
+        name: "joe",
+        roles: ["erlanger"]
+      }
+    };
+
+    TEquals(true, repDb.save(repDoc).ok);
+    CouchDB.logout();
+
+    waitForRep(repDb, repDoc, "complete");
+    repDoc1 = repDb.open(repDoc._id);
+    T(repDoc1 !== null);
+    TEquals(repDoc.source, repDoc1.source);
+    TEquals(repDoc.target, repDoc1.target);
+    TEquals("completed", repDoc1._replication_state);
+    TEquals("string", typeof repDoc1._replication_id);
+    TEquals("string", typeof repDoc1._replication_state_time);
+
+    for (var i = 0; i < docs1.length; i++) {
+      var doc = docs1[i];
+      var copy = dbB.open(doc._id);
+
+      T(copy !== null);
+      TEquals(doc.value, copy.value);
+    }
+
+    // Admins don't need to supply a user_ctx property in replication docs.
+    // If they do not, the implicit user_ctx "user_ctx": {name: null, roles: []}
+    // is used, meaning that design documents will not be replicated into
+    // local targets
+    T(dbB.setSecObj({
+      admins: {
+        names: [],
+        roles: []
+      },
+      readers: {
+        names: [],
+        roles: []
+      }
+    }).ok);
+
+    var ddoc = { _id: "_design/foo" };
+    TEquals(true, dbA.save(ddoc).ok);
+
+    repDoc = {
+      _id: "foo_rep_3",
+      source: CouchDB.protocol + host + "/" + dbA.name,
+      target: dbB.name
+    };
+
+    TEquals(true, repDb.save(repDoc).ok);
+    waitForRep(repDb, repDoc, "complete");
+    repDoc1 = repDb.open(repDoc._id);
+    T(repDoc1 !== null);
+    TEquals(repDoc.source, repDoc1.source);
+    TEquals(repDoc.target, repDoc1.target);
+    TEquals("completed", repDoc1._replication_state);
+    TEquals("string", typeof repDoc1._replication_id);
+    TEquals("string", typeof repDoc1._replication_state_time);
+
+    var ddoc_copy = dbB.open(ddoc._id);
+    T(ddoc_copy === null);
+
+    repDoc = {
+      _id: "foo_rep_4",
+      source: CouchDB.protocol + host + "/" + dbA.name,
+      target: dbB.name,
+      user_ctx: {
+        roles: ["_admin"]
+      }
+    };
+
+    TEquals(true, repDb.save(repDoc).ok);
+    waitForRep(repDb, repDoc, "complete");
+    repDoc1 = repDb.open(repDoc._id);
+    T(repDoc1 !== null);
+    TEquals(repDoc.source, repDoc1.source);
+    TEquals(repDoc.target, repDoc1.target);
+    TEquals("completed", repDoc1._replication_state);
+    TEquals("string", typeof repDoc1._replication_id);
+    TEquals("string", typeof repDoc1._replication_state_time);
+
+    ddoc_copy = dbB.open(ddoc._id);
+    T(ddoc_copy !== null);
+  }
+
+
+  function rep_doc_with_bad_rep_id() {
+    populate_db(dbA, docs1);
+    populate_db(dbB, []);
+
+    var repDoc = {
+      _id: "foo_rep",
+      source: dbA.name,
+      target: dbB.name,
+      replication_id: "1234abc"
+    };
+    T(repDb.save(repDoc).ok);
+
+    waitForRep(repDb, repDoc, "completed");
+    for (var i = 0; i < docs1.length; i++) {
+      var doc = docs1[i];
+      var copy = dbB.open(doc._id);
+      T(copy !== null);
+      T(copy.value === doc.value);
+    }
+
+    var repDoc1 = repDb.open(repDoc._id);
+    T(repDoc1 !== null);
+    T(repDoc1.source === repDoc.source);
+    T(repDoc1.target === repDoc.target);
+    T(repDoc1._replication_state === "completed",
+      "replication document with bad replication id failed");
+    T(typeof repDoc1._replication_state_time === "string");
+    T(typeof repDoc1._replication_id  === "string");
+    T(repDoc1._replication_id !== "1234abc");
+  }
+
+
+  function swap_rep_db() {
+    var repDb2 = new CouchDB("test_suite_rep_db_2");
+    var dbA = new CouchDB("test_suite_rep_db_a");
+    var dbA_copy = new CouchDB("test_suite_rep_db_a_copy");
+    var dbB = new CouchDB("test_suite_rep_db_b");
+    var dbB_copy = new CouchDB("test_suite_rep_db_b_copy");
+    var dbC = new CouchDB("test_suite_rep_db_c");
+    var dbC_copy = new CouchDB("test_suite_rep_db_c_copy");
+    var repDoc1, repDoc2, repDoc3;
+    var xhr, i, doc, copy, new_doc;
+
+    populate_db(dbA, docs1);
+    populate_db(dbB, docs1);
+    populate_db(dbC, docs1);
+    populate_db(dbA_copy, []);
+    populate_db(dbB_copy, []);
+    populate_db(dbC_copy, []);
+    populate_db(repDb2, []);
+
+    repDoc1 = {
+      _id: "rep1",
+      source: CouchDB.protocol + host + "/" + dbA.name,
+      target: dbA_copy.name,
+      continuous: true
+    };
+    repDoc2 = {
+      _id: "rep2",
+      source: CouchDB.protocol + host + "/" + dbB.name,
+      target: dbB_copy.name,
+      continuous: true
+    };
+    repDoc3 = {
+      _id: "rep3",
+      source: CouchDB.protocol + host + "/" + dbC.name,
+      target: dbC_copy.name,
+      continuous: true
+    };
+
+    TEquals(true, repDb.save(repDoc1).ok);
+    TEquals(true, repDb.save(repDoc2).ok);
+
+    waitForSeq(dbA, dbA_copy);
+    waitForSeq(dbB, dbB_copy);
+
+    xhr = CouchDB.request("PUT", "/_config/replicator/db",{
+      body : JSON.stringify(repDb2.name),
+      headers: {"X-Couch-Persist": "false"}
+    });
+    TEquals(200, xhr.status);
+
+    new_doc = {
+      _id: "foo666",
+      value: 666
+    };
+
+    TEquals(true, dbA.save(new_doc).ok);
+    TEquals(true, dbB.save(new_doc).ok);
+    waitForSeq(dbA, dbA_copy);
+    waitForSeq(dbB, dbB_copy);
+
+    TEquals(true, repDb2.save(repDoc3).ok);
+    waitForSeq(dbC, dbC_copy);
+
+    for (i = 0; i < docs1.length; i++) {
+      doc = docs1[i];
+      copy = dbA_copy.open(doc._id);
+      T(copy !== null);
+      TEquals(doc.value, copy.value);
+      copy = dbB_copy.open(doc._id);
+      T(copy !== null);
+      TEquals(doc.value, copy.value);
+      copy = dbC_copy.open(doc._id);
+      T(copy !== null);
+      TEquals(doc.value, copy.value);
+    }
+
+    // replications rep1 and rep2 should have been stopped when the replicator
+    // database was swapped
+    copy = dbA_copy.open(new_doc._id);
+    TEquals(null, copy);
+    copy = dbB_copy.open(new_doc._id);
+    TEquals(null, copy);
+
+    xhr = CouchDB.request("PUT", "/_config/replicator/db",{
+      body : JSON.stringify(repDb.name),
+      headers: {"X-Couch-Persist": "false"}
+    });
+    TEquals(200, xhr.status);
+
+    // after setting the replicator database to the former, replications rep1
+    // and rep2 should have been resumed, while rep3 was stopped
+    TEquals(true, dbC.save(new_doc).ok);
+    wait(1000);
+
+    waitForSeq(dbA, dbA_copy);
+    waitForSeq(dbB, dbB_copy);
+
+    copy = dbA_copy.open(new_doc._id);
+    T(copy !== null);
+    TEquals(new_doc.value, copy.value);
+    copy = dbB_copy.open(new_doc._id);
+    T(copy !== null);
+    TEquals(new_doc.value, copy.value);
+    copy = dbC_copy.open(new_doc._id);
+    TEquals(null, copy);
+  }
+
+
+  function compact_rep_db() {
+    var dbA_copy = new CouchDB("test_suite_rep_db_a_copy");
+    var dbB_copy = new CouchDB("test_suite_rep_db_b_copy");
+    var repDoc1, repDoc2;
+    var xhr, i, doc, copy, new_doc;
+    var docs = makeDocs(1, 50);
+
+    populate_db(dbA, docs);
+    populate_db(dbB, docs);
+    populate_db(dbA_copy, []);
+    populate_db(dbB_copy, []);
+
+    repDoc1 = {
+      _id: "rep1",
+      source: CouchDB.protocol + host + "/" + dbA.name,
+      target: dbA_copy.name,
+      continuous: true
+    };
+    repDoc2 = {
+      _id: "rep2",
+      source: CouchDB.protocol + host + "/" + dbB.name,
+      target: dbB_copy.name,
+      continuous: true
+    };
+
+    TEquals(true, repDb.save(repDoc1).ok);
+    TEquals(true, repDb.save(repDoc2).ok);
+
+    TEquals(true, repDb.compact().ok);
+    TEquals(202, repDb.last_req.status);
+
+    waitForSeq(dbA, dbA_copy);
+    waitForSeq(dbB, dbB_copy);
+
+    while (repDb.info().compact_running) {};
+
+    for (i = 0; i < docs.length; i++) {
+      copy = dbA_copy.open(docs[i]._id);
+      T(copy !== null);
+      copy = dbB_copy.open(docs[i]._id);
+      T(copy !== null);
+    }
+
+    new_doc = {
+      _id: "foo666",
+      value: 666
+    };
+
+    TEquals(true, dbA.save(new_doc).ok);
+    TEquals(true, dbB.save(new_doc).ok);
+
+    waitForSeq(dbA, dbA_copy);
+    waitForSeq(dbB, dbB_copy);
+
+    copy = dbA.open(new_doc._id);
+    T(copy !== null);
+    TEquals(666, copy.value);
+    copy = dbB.open(new_doc._id);
+    T(copy !== null);
+    TEquals(666, copy.value);
+  }
+
+
+  function error_state_replication() {
+    populate_db(dbA, docs1);
+
+    var repDoc = {
+      _id: "foo_error_rep",
+      source: dbA.name,
+      target: "nonexistent_test_db"
+    };
+    T(repDb.save(repDoc).ok);
+
+    waitForRep(repDb, repDoc, "error");
+    var repDoc1 = repDb.open(repDoc._id);
+    T(repDoc1 !== null);
+    T(repDoc1._replication_state === "error");
+    T(typeof repDoc1._replication_state_time === "string");
+    T(typeof repDoc1._replication_id  === "string");
+  }
+
+
+  function rep_doc_field_validation() {
+    var docs = makeDocs(1, 5);
+
+    populate_db(dbA, docs);
+    populate_db(dbB, []);
+
+    var repDoc = {
+       _id: "rep1",
+       target: dbB.name
+    };
+
+    try {
+      repDb.save(repDoc);
+      T(false, "should have failed because source field is missing");
+    } catch (x) {
+      TEquals("forbidden", x.error);
+    }
+
+    repDoc = {
+       _id: "rep1",
+       source: 123,
+       target: dbB.name
+    };
+
+    try {
+      repDb.save(repDoc);
+      T(false, "should have failed because source field is a number");
+    } catch (x) {
+      TEquals("forbidden", x.error);
+    }
+
+    repDoc = {
+       _id: "rep1",
+       source: dbA.name
+    };
+
+    try {
+      repDb.save(repDoc);
+      T(false, "should have failed because target field is missing");
+    } catch (x) {
+      TEquals("forbidden", x.error);
+    }
+
+    repDoc = {
+       _id: "rep1",
+       source: dbA.name,
+       target: null
+    };
+
+    try {
+      repDb.save(repDoc);
+      T(false, "should have failed because target field is null");
+    } catch (x) {
+      TEquals("forbidden", x.error);
+    }
+
+    repDoc = {
+       _id: "rep1",
+       source: dbA.name,
+       target: { url: 123 }
+    };
+
+    try {
+      repDb.save(repDoc);
+      T(false, "should have failed because target.url field is not a string");
+    } catch (x) {
+      TEquals("forbidden", x.error);
+    }
+
+    repDoc = {
+       _id: "rep1",
+       source: dbA.name,
+       target: { url: dbB.name, auth: null }
+    };
+
+    try {
+      repDb.save(repDoc);
+      T(false, "should have failed because target.auth field is null");
+    } catch (x) {
+      TEquals("forbidden", x.error);
+    }
+
+    repDoc = {
+       _id: "rep1",
+       source: dbA.name,
+       target: { url: dbB.name, auth: "foo:bar" }
+    };
+
+    try {
+      repDb.save(repDoc);
+      T(false, "should have failed because target.auth field is not an object");
+    } catch (x) {
+      TEquals("forbidden", x.error);
+    }
+
+    repDoc = {
+       _id: "rep1",
+       source: dbA.name,
+       target: dbB.name,
+       continuous: "true"
+    };
+
+    try {
+      repDb.save(repDoc);
+      T(false, "should have failed because continuous is not a boolean");
+    } catch (x) {
+      TEquals("forbidden", x.error);
+    }
+
+    repDoc = {
+       _id: "rep1",
+       source: dbA.name,
+       target: dbB.name,
+       filter: 123
+    };
+
+    try {
+      repDb.save(repDoc);
+      T(false, "should have failed because filter is not a string");
+    } catch (x) {
+      TEquals("forbidden", x.error);
+    }
+  }
+
+
+  function test_invalid_filter() {
+    // COUCHDB-1199 - replication document with a filter field that was invalid
+    // crashed the CouchDB server.
+    var repDoc1 = {
+       _id: "rep1",
+       source: "couch_foo_test_db",
+       target: "couch_bar_test_db",
+       filter: "test/foofilter"
+    };
+
+    TEquals(true, repDb.save(repDoc1).ok);
+
+    waitForRep(repDb, repDoc1, "error");
+    repDoc1 = repDb.open(repDoc1._id);
+    TEquals("undefined", typeof repDoc1._replication_id);
+    TEquals("error", repDoc1._replication_state);
+
+    populate_db(dbA, docs1);
+    populate_db(dbB, []);
+
+    var repDoc2 = {
+       _id: "rep2",
+       source: dbA.name,
+       target: dbB.name,
+       filter: "test/foofilter"
+    };
+
+    TEquals(true, repDb.save(repDoc2).ok);
+
+    waitForRep(repDb, repDoc2, "error");
+    repDoc2 = repDb.open(repDoc2._id);
+    TEquals("undefined", typeof repDoc2._replication_id);
+    TEquals("error", repDoc2._replication_state);
+
+    var ddoc = {
+      _id: "_design/mydesign",
+      language : "javascript",
+      filters : {
+        myfilter : (function(doc, req) {
+          return true;
+        }).toString()
+      }
+    };
+
+    TEquals(true, dbA.save(ddoc).ok);
+
+    var repDoc3 = {
+       _id: "rep3",
+       source: dbA.name,
+       target: dbB.name,
+       filter: "mydesign/myfilter"
+    };
+
+    TEquals(true, repDb.save(repDoc3).ok);
+
+    waitForRep(repDb, repDoc3, "completed");
+    repDoc3 = repDb.open(repDoc3._id);
+    TEquals("string", typeof repDoc3._replication_id);
+    TEquals("completed", repDoc3._replication_state);
+  }
+
+
+  // run all the tests
+  var server_config = [
+    {
+      section: "replicator",
+      key: "db",
+      value: repDb.name
+    }
+  ];
+
+  repDb.deleteDb();
+  run_on_modified_server(server_config, simple_replication);
+
+  repDb.deleteDb();
+  restartServer();
+  run_on_modified_server(server_config, filtered_replication);
+
+  repDb.deleteDb();
+  restartServer();
+  run_on_modified_server(server_config, continuous_replication);
+
+  repDb.deleteDb();
+  restartServer();
+  run_on_modified_server(server_config, by_doc_ids_replication);
+
+  repDb.deleteDb();
+  restartServer();
+  run_on_modified_server(server_config, successive_identical_replications);
+
+  repDb.deleteDb();
+  restartServer();
+  run_on_modified_server(server_config, identical_rep_docs);
+
+  repDb.deleteDb();
+  restartServer();
+  run_on_modified_server(server_config, identical_continuous_rep_docs);
+
+  repDb.deleteDb();
+  restartServer();
+  run_on_modified_server(server_config, rep_db_write_authorization);
+
+  repDb.deleteDb();
+  restartServer();
+  run_on_modified_server(server_config, rep_doc_with_bad_rep_id);
+
+  var server_config_2 = server_config.concat([
+    {
+      section: "couch_httpd_auth",
+      key: "authentication_db",
+      value: usersDb.name
+    }
+  ]);
+
+  repDb.deleteDb();
+  restartServer();
+  run_on_modified_server(server_config_2, test_user_ctx_validation);
+
+  repDb.deleteDb();
+  restartServer();
+  run_on_modified_server(server_config_2, test_replication_credentials_delegation);
+
+  repDb.deleteDb();
+  restartServer();
+  continuous_replication_survives_restart();
+
+  repDb.deleteDb();
+  restartServer();
+  run_on_modified_server(server_config, swap_rep_db);
+
+  repDb.deleteDb();
+  restartServer();
+  run_on_modified_server(server_config, compact_rep_db);
+
+  repDb.deleteDb();
+  restartServer();
+  run_on_modified_server(server_config, rep_doc_field_validation);
+
+
+  repDb.deleteDb();
+  restartServer();
+  run_on_modified_server(server_config, test_invalid_filter);
+
+/*
+ * Disabled, since error state would be set on the document only after
+ * the exponential backoff retry done by the replicator database listener
+ * terminates, which takes too much time for a unit test.
+ */
+/*
+ * repDb.deleteDb();
+ * restartServer();
+ * run_on_modified_server(server_config, error_state_replication);
+ */
+
+
+  // cleanup
+  repDb.deleteDb();
+  usersDb.deleteDb();
+  dbA.deleteDb();
+  dbB.deleteDb();
+  (new CouchDB("test_suite_rep_db_2")).deleteDb();
+  (new CouchDB("test_suite_rep_db_c")).deleteDb();
+  (new CouchDB("test_suite_rep_db_a_copy")).deleteDb();
+  (new CouchDB("test_suite_rep_db_b_copy")).deleteDb();
+  (new CouchDB("test_suite_rep_db_c_copy")).deleteDb();
+};
diff --git a/rel/overlay/share/www/script/test/rewrite.js b/rel/overlay/share/www/script/test/rewrite.js
index ff2d3822..ac5257da 100644
--- a/rel/overlay/share/www/script/test/rewrite.js
+++ b/rel/overlay/share/www/script/test/rewrite.js
@@ -84,6 +84,24 @@ couchTests.rewrite = function(debug) {
               "method": "GET"
             },
             {
+             "from": "/welcome4/*",
+             "to" : "_show/welcome3",
+             "query": {
+               "name": "*"
+             }
+            },
+            {
+             "from": "/welcome5/*",
+             "to" : "_show/*",
+             "query": {
+               "name": "*"
+             }
+            },
+            {
+              "from": "basicView",
+              "to": "_view/basicView",
+            },
+            {
               "from": "simpleForm/basicView",
               "to": "_list/simpleForm/basicView",
             },
@@ -101,6 +119,10 @@ couchTests.rewrite = function(debug) {
               "query": {
                 "startkey": ":start",
                 "endkey": ":end"
+              },
+              "formats": {
+                "start": "int",
+                "end": "int"
               }
             },
             {
@@ -144,6 +166,22 @@ couchTests.rewrite = function(debug) {
               "query": {
                 "key": [":a", ":b"]
               }
+            },
+            {
+              "from": "simpleForm/complexView7/:a/:b",
+              "to": "_view/complexView3",
+              "query": {
+                "key": [":a", ":b"],
+                "include_docs": ":doc"
+              },
+              "format": {
+                "doc": "bool"
+              }
+
+            },
+            {
+              "from": "/",
+              "to": "_view/basicView",
             }
           ],
           lists: {
@@ -169,6 +207,9 @@ couchTests.rewrite = function(debug) {
             "welcome2": stringFun(function(doc, req) {
               return "Welcome " + doc.name;
             }),
+            "welcome3": stringFun(function(doc,req) {
+              return "Welcome " + req.query["name"];
+            })
           },
           updates: {
             "hello" : stringFun(function(doc, req) {
@@ -289,6 +330,20 @@ couchTests.rewrite = function(debug) {
         xhr = CouchDB.request("GET", "/test_suite_db/_design/test/_rewrite/welcome3/test");
         T(xhr.responseText == "Welcome test");
         
+        req = CouchDB.request("GET", "/test_suite_db/_design/test/_rewrite/welcome4/user");
+        T(req.responseText == "Welcome user");
+
+        req = CouchDB.request("GET", "/test_suite_db/_design/test/_rewrite/welcome5/welcome3");
+        T(req.responseText == "Welcome welcome3");
+       
+        xhr = CouchDB.request("GET", "/test_suite_db/_design/test/_rewrite/basicView");
+        T(xhr.status == 200, "view call");
+        T(/{"total_rows":9/.test(xhr.responseText)); 
+
+        xhr = CouchDB.request("GET", "/test_suite_db/_design/test/_rewrite/");
+        T(xhr.status == 200, "view call");
+        T(/{"total_rows":9/.test(xhr.responseText)); 
+
         
         // get with query params
         xhr = CouchDB.request("GET", "/test_suite_db/_design/test/_rewrite/simpleForm/basicView?startkey=3&endkey=8");
@@ -342,6 +397,11 @@ couchTests.rewrite = function(debug) {
         T(xhr.status == 200, "with query params");
         T(/Value: doc 4/.test(xhr.responseText));
         
+        xhr = CouchDB.request("GET", "/test_suite_db/_design/test/_rewrite/simpleForm/complexView7/test/essai?doc=true");
+        T(xhr.status == 200, "with query params");
+        var result = JSON.parse(xhr.responseText);
+        T(typeof(result.rows[0].doc) === "object");
+        
         // test path relative to server
         designDoc.rewrites.push({
            "from": "uuids",
diff --git a/rel/overlay/share/www/script/test/security_validation.js b/rel/overlay/share/www/script/test/security_validation.js
index dd3b202e..42aa11c9 100644
--- a/rel/overlay/share/www/script/test/security_validation.js
+++ b/rel/overlay/share/www/script/test/security_validation.js
@@ -250,16 +250,16 @@ couchTests.security_validation = function(debug) {
           target:"test_suite_db_b"},
 
         {source:"test_suite_db_a",
-          target:{url: "http://" + host + "/test_suite_db_b",
+          target:{url: CouchDB.protocol + host + "/test_suite_db_b",
                   headers: AuthHeaders}},
 
-        {source:{url:"http://" + host + "/test_suite_db_a",
+        {source:{url:CouchDB.protocol + host + "/test_suite_db_a",
                  headers: AuthHeaders},
           target:"test_suite_db_b"},
 
-        {source:{url:"http://" + host + "/test_suite_db_a",
+        {source:{url:CouchDB.protocol + host + "/test_suite_db_a",
                  headers: AuthHeaders},
-         target:{url:"http://" + host + "/test_suite_db_b",
+         target:{url:CouchDB.protocol + host + "/test_suite_db_b",
                  headers: AuthHeaders}},
       ]
       var adminDbA = new CouchDB("test_suite_db_a", {"X-Couch-Full-Commit":"false"});
diff --git a/rel/overlay/share/www/script/test/show_documents.js b/rel/overlay/share/www/script/test/show_documents.js
index e06bcadc..55ed9698 100644
--- a/rel/overlay/share/www/script/test/show_documents.js
+++ b/rel/overlay/share/www/script/test/show_documents.js
@@ -157,6 +157,9 @@ couchTests.show_documents = function(debug) {
       }),
       "withSlash": stringFun(function(doc, req) {
         return { json: doc }
+      }),
+      "secObj": stringFun(function(doc, req) {
+        return { json: req.secObj };
       })
     }
   };
@@ -410,5 +413,24 @@ couchTests.show_documents = function(debug) {
   db.deleteDoc(doc);
   var xhr = CouchDB.request("GET", "/test_suite_db/_design/template/_show/show-deleted/testdoc");
   TEquals("No doc testdoc", xhr.responseText, "should return 'no doc testdoc'");
+
+
+  run_on_modified_server(
+    [{section: "httpd",
+      key: "authentication_handlers",
+      value: "{couch_httpd_auth, special_test_authentication_handler}"},
+     {section:"httpd",
+      key: "WWW-Authenticate",
+      value:  "X-Couch-Test-Auth"}],
+
+      function() {
+        T(db.setDbProperty("_security", {foo: true}).ok);
+        T(db.save(doc).ok);
+
+        xhr = CouchDB.request("GET", "/test_suite_db/_design/template/_show/secObj");
+        var resp = JSON.parse(xhr.responseText);
+        T(resp.foo == true);
+      }
+  );
   
 };
diff --git a/rel/overlay/share/www/script/test/update_documents.js b/rel/overlay/share/www/script/test/update_documents.js
index da68d621..49d3b68a 100644
--- a/rel/overlay/share/www/script/test/update_documents.js
+++ b/rel/overlay/share/www/script/test/update_documents.js
@@ -113,9 +113,13 @@ couchTests.update_documents = function(debug) {
   T(JSON.parse(xhr.responseText).error == "method_not_allowed");
 
   // // hello update world (non-existing docid)
+  xhr = CouchDB.request("GET", "/test_suite_db/nonExistingDoc");
+  T(xhr.status == 404);
   xhr = CouchDB.request("PUT", "/test_suite_db/_design/update/_update/hello/nonExistingDoc");
   T(xhr.status == 201);
   T(xhr.responseText == "<p>New World</p>");
+  xhr = CouchDB.request("GET", "/test_suite_db/nonExistingDoc");
+  T(xhr.status == 200);
 
   // in place update 
   xhr = CouchDB.request("PUT", "/test_suite_db/_design/update/_update/in-place/"+docid+'?field=title&value=test');
diff --git a/rel/overlay/share/www/script/test/view_errors.js b/rel/overlay/share/www/script/test/view_errors.js
index c05000b7..e8bd08e4 100644
--- a/rel/overlay/share/www/script/test/view_errors.js
+++ b/rel/overlay/share/www/script/test/view_errors.js
@@ -177,5 +177,13 @@ couchTests.view_errors = function(debug) {
       T(xhr.status == 500);
       result = JSON.parse(xhr.responseText);
       T(result.error == "reduce_overflow_error");
+
+      try {
+          db.query(function() {emit(null, null)}, null, {startkey: 2, endkey:1});
+          T(0 == 1);
+      } catch(e) {
+          T(e.error == "query_parse_error");
+          T(e.reason.match(/no rows can match/i));
+      }
     });
 };
diff --git a/rel/overlay/share/www/script/test/view_include_docs.js b/rel/overlay/share/www/script/test/view_include_docs.js
index 06aafc56..944c9103 100644
--- a/rel/overlay/share/www/script/test/view_include_docs.js
+++ b/rel/overlay/share/www/script/test/view_include_docs.js
@@ -135,4 +135,58 @@ couchTests.view_include_docs = function(debug) {
   T(!resp.rows[0].doc);
   T(resp.rows[0].doc == null);
   T(resp.rows[1].doc.integer == 23);
+
+  // COUCHDB-549 - include_docs=true with conflicts=true
+
+  var dbA = new CouchDB("test_suite_db_a", {"X-Couch-Full-Commit":"false"});
+  var dbB = new CouchDB("test_suite_db_b", {"X-Couch-Full-Commit":"false"});
+
+  dbA.deleteDb();
+  dbA.createDb();
+  dbB.deleteDb();
+  dbB.createDb();
+
+  var ddoc = {
+    _id: "_design/mydesign",
+    language : "javascript",
+    views : {
+      myview : {
+        map: (function(doc) {
+          emit(doc.value, 1);
+        }).toString()
+      }
+    }
+  };
+  TEquals(true, dbA.save(ddoc).ok);
+
+  var doc1a = {_id: "foo", value: 1, str: "1"};
+  TEquals(true, dbA.save(doc1a).ok);
+
+  var doc1b = {_id: "foo", value: 1, str: "666"};
+  TEquals(true, dbB.save(doc1b).ok);
+
+  var doc2 = {_id: "bar", value: 2, str: "2"};
+  TEquals(true, dbA.save(doc2).ok);
+
+  TEquals(true, CouchDB.replicate(dbA.name, dbB.name).ok);
+
+  doc1b = dbB.open("foo", {conflicts: true});
+  TEquals(true, doc1b._conflicts instanceof Array);
+  TEquals(1, doc1b._conflicts.length);
+  var conflictRev = doc1b._conflicts[0];
+
+  doc2 = dbB.open("bar", {conflicts: true});
+  TEquals("undefined", typeof doc2._conflicts);
+
+  resp = dbB.view("mydesign/myview", {include_docs: true, conflicts: true});
+
+  TEquals(2, resp.rows.length);
+  TEquals(true, resp.rows[0].doc._conflicts instanceof Array);
+  TEquals(1, resp.rows[0].doc._conflicts.length);
+  TEquals(conflictRev, resp.rows[0].doc._conflicts[0]);
+  TEquals("undefined", typeof resp.rows[1].doc._conflicts);
+
+  // cleanup
+  dbA.deleteDb();
+  dbB.deleteDb();
 };
diff --git a/rel/overlay/share/www/script/test/view_multi_key_all_docs.js b/rel/overlay/share/www/script/test/view_multi_key_all_docs.js
index 62e49665..1113be4d 100644
--- a/rel/overlay/share/www/script/test/view_multi_key_all_docs.js
+++ b/rel/overlay/share/www/script/test/view_multi_key_all_docs.js
@@ -25,24 +25,52 @@ couchTests.view_multi_key_all_docs = function(debug) {
   for(var i=0; i<rows.length; i++)
     T(rows[i].id == keys[i]);
 
+  // keys in GET parameters
+  rows = db.allDocs({keys:keys}, null).rows;
+  T(rows.length == keys.length);
+  for(var i=0; i<rows.length; i++)
+    T(rows[i].id == keys[i]);
+
   rows = db.allDocs({limit: 1}, keys).rows;
   T(rows.length == 1);
   T(rows[0].id == keys[0]);
 
+  // keys in GET parameters
+  rows = db.allDocs({limit: 1, keys: keys}, null).rows;
+  T(rows.length == 1);
+  T(rows[0].id == keys[0]);
+
   rows = db.allDocs({skip: 2}, keys).rows;
   T(rows.length == 3);
   for(var i=0; i<rows.length; i++)
       T(rows[i].id == keys[i+2]);
 
+  // keys in GET parameters
+  rows = db.allDocs({skip: 2, keys: keys}, null).rows;
+  T(rows.length == 3);
+  for(var i=0; i<rows.length; i++)
+      T(rows[i].id == keys[i+2]);
+
   rows = db.allDocs({descending: "true"}, keys).rows;
   T(rows.length == keys.length);
   for(var i=0; i<rows.length; i++)
       T(rows[i].id == keys[keys.length-i-1]);
 
+  // keys in GET parameters
+  rows = db.allDocs({descending: "true", keys: keys}, null).rows;
+  T(rows.length == keys.length);
+  for(var i=0; i<rows.length; i++)
+      T(rows[i].id == keys[keys.length-i-1]);
+
   rows = db.allDocs({descending: "true", skip: 3, limit:1}, keys).rows;
   T(rows.length == 1);
   T(rows[0].id == keys[1]);
 
+  // keys in GET parameters
+  rows = db.allDocs({descending: "true", skip: 3, limit:1, keys: keys}, null).rows;
+  T(rows.length == 1);
+  T(rows[0].id == keys[1]);
+
   // Check we get invalid rows when the key doesn't exist
   rows = db.allDocs({}, [1, "i_dont_exist", "0"]).rows;
   T(rows.length == 3);
@@ -51,4 +79,13 @@ couchTests.view_multi_key_all_docs = function(debug) {
   T(rows[1].error == "not_found");
   T(!rows[1].id);
   T(rows[2].id == rows[2].key && rows[2].key == "0");
+
+  // keys in GET parameters
+  rows = db.allDocs({keys: [1, "i_dont_exist", "0"]}, null).rows;
+  T(rows.length == 3);
+  T(rows[0].error == "not_found");
+  T(!rows[0].id);
+  T(rows[1].error == "not_found");
+  T(!rows[1].id);
+  T(rows[2].id == rows[2].key && rows[2].key == "0");
 };
diff --git a/rel/overlay/share/www/script/test/view_multi_key_design.js b/rel/overlay/share/www/script/test/view_multi_key_design.js
index c39e73d9..38396955 100644
--- a/rel/overlay/share/www/script/test/view_multi_key_design.js
+++ b/rel/overlay/share/www/script/test/view_multi_key_design.js
@@ -54,6 +54,13 @@ couchTests.view_multi_key_design = function(debug) {
     T(rows[i].key == rows[i].value);
   }
 
+  // with GET keys
+  rows = db.view("test/all_docs",{keys:keys},null).rows;
+  for(var i=0;i<rows.length; i++) {
+    T(keys.indexOf(rows[i].key) != -1);
+    T(rows[i].key == rows[i].value);
+  }
+
   var reduce = db.view("test/summate",{group:true},keys).rows;
   T(reduce.length == keys.length);
   for(var i=0; i<reduce.length; i++) {
@@ -61,8 +68,18 @@ couchTests.view_multi_key_design = function(debug) {
     T(reduce[i].key == reduce[i].value);
   }
 
+  // with GET keys
+  reduce = db.view("test/summate",{group:true,keys:keys},null).rows;
+  T(reduce.length == keys.length);
+  for(var i=0; i<reduce.length; i++) {
+    T(keys.indexOf(reduce[i].key) != -1);
+    T(reduce[i].key == reduce[i].value);
+  }
+
   // Test that invalid parameter combinations get rejected
   var badargs = [{startkey:0}, {endkey:0}, {key: 0}, {group_level: 2}];
+  var getbadargs = [{startkey:0, keys:keys}, {endkey:0, keys:keys}, 
+      {key:0, keys:keys}, {group_level: 2, keys:keys}];
   for(var i in badargs)
   {
       try {
@@ -71,6 +88,13 @@ couchTests.view_multi_key_design = function(debug) {
       } catch (e) {
           T(e.error == "query_parse_error");
       }
+
+      try {
+          db.view("test/all_docs",getbadargs[i],null);
+          T(0==1);
+      } catch (e) {
+          T(e.error = "query_parse_error");
+      }
   }
 
   try {
@@ -80,10 +104,20 @@ couchTests.view_multi_key_design = function(debug) {
       T(e.error == "query_parse_error");
   }
 
+  try {
+      db.view("test/summate",{keys:keys},null);
+      T(0==1);
+  } catch (e) {
+      T(e.error == "query_parse_error");
+  }
+
   // Test that a map & reduce containing func support keys when reduce=false
   var resp = db.view("test/summate", {reduce: false}, keys);
   T(resp.rows.length == 5);
 
+  resp = db.view("test/summate", {reduce: false, keys: keys}, null);
+  T(resp.rows.length == 5);
+
   // Check that limiting by startkey_docid and endkey_docid get applied
   // as expected.
   var curr = db.view("test/multi_emit", {startkey_docid: 21, endkey_docid: 23}, [0, 2]).rows;
@@ -96,34 +130,66 @@ couchTests.view_multi_key_design = function(debug) {
       T(curr[i].value == exp_val[i]);
   }
 
+  curr = db.view("test/multi_emit", {startkey_docid: 21, endkey_docid: 23, keys: [0, 2]}, null).rows;
+  T(curr.length == 6);
+  for( var i = 0 ; i < 6 ; i++)
+  {
+      T(curr[i].key == exp_key[i]);
+      T(curr[i].value == exp_val[i]);
+  }
+
   // Check limit works
   curr = db.view("test/all_docs", {limit: 1}, keys).rows;
   T(curr.length == 1);
   T(curr[0].key == 10);
 
+  curr = db.view("test/all_docs", {limit: 1, keys: keys}, null).rows;
+  T(curr.length == 1);
+  T(curr[0].key == 10);
+
   // Check offset works
   curr = db.view("test/multi_emit", {skip: 1}, [0]).rows;
   T(curr.length == 99);
   T(curr[0].value == 1);
 
+  curr = db.view("test/multi_emit", {skip: 1, keys: [0]}, null).rows;
+  T(curr.length == 99);
+  T(curr[0].value == 1);
+
   // Check that dir works
   curr = db.view("test/multi_emit", {descending: "true"}, [1]).rows;
   T(curr.length == 100);
   T(curr[0].value == 99);
   T(curr[99].value == 0);
 
+  curr = db.view("test/multi_emit", {descending: "true", keys: [1]}, null).rows;
+  T(curr.length == 100);
+  T(curr[0].value == 99);
+  T(curr[99].value == 0);
+
   // Check a couple combinations
   curr = db.view("test/multi_emit", {descending: "true", skip: 3, limit: 2}, [2]).rows;
   T(curr.length, 2);
   T(curr[0].value == 96);
   T(curr[1].value == 95);
 
+  curr = db.view("test/multi_emit", {descending: "true", skip: 3, limit: 2, keys: [2]}, null).rows;
+  T(curr.length, 2);
+  T(curr[0].value == 96);
+  T(curr[1].value == 95);
+
   curr = db.view("test/multi_emit", {skip: 2, limit: 3, startkey_docid: "13"}, [0]).rows;
   T(curr.length == 3);
   T(curr[0].value == 15);
   T(curr[1].value == 16);
   T(curr[2].value == 17);
 
+  curr = db.view("test/multi_emit", {skip: 2, limit: 3, startkey_docid: "13", keys: [0]}, null).rows;
+  T(curr.length == 3);
+  T(curr[0].value == 15);
+  T(curr[1].value == 16);
+  T(curr[2].value == 17);
+
   curr = db.view("test/multi_emit",
           {skip: 1, limit: 5, startkey_docid: "25", endkey_docid: "27"}, [1]).rows;
   T(curr.length == 2);
@@ -131,8 +197,20 @@ couchTests.view_multi_key_design = function(debug) {
   T(curr[1].value == 27);
 
   curr = db.view("test/multi_emit",
+          {skip: 1, limit: 5, startkey_docid: "25", endkey_docid: "27", keys: [1]}, null).rows;
+  T(curr.length == 2);
+  T(curr[0].value == 26);
+  T(curr[1].value == 27);
+
+  curr = db.view("test/multi_emit",
           {skip: 1, limit: 5, startkey_docid: "28", endkey_docid: "26", descending: "true"}, [1]).rows;
   T(curr.length == 2);
   T(curr[0].value == 27);
   T(curr[1].value == 26);
+
+  curr = db.view("test/multi_emit",
+          {skip: 1, limit: 5, startkey_docid: "28", endkey_docid: "26", descending: "true", keys: [1]}, null).rows;
+  T(curr.length == 2);
+  T(curr[0].value == 27);
+  T(curr[1].value == 26);
 };
diff --git a/rel/overlay/share/www/script/test/view_pagination.js b/rel/overlay/share/www/script/test/view_pagination.js
index 1af2df35..ed3a7ee1 100644
--- a/rel/overlay/share/www/script/test/view_pagination.js
+++ b/rel/overlay/share/www/script/test/view_pagination.js
@@ -19,7 +19,7 @@ couchTests.view_pagination = function(debug) {
     var docs = makeDocs(0, 100);
     db.bulkSave(docs);
 
-    var queryFun = function(doc) { emit(doc.integer, null) };
+    var queryFun = function(doc) { emit(doc.integer, null); };
     var i;
 
     // page through the view ascending
@@ -29,13 +29,26 @@ couchTests.view_pagination = function(debug) {
         startkey_docid: i,
         limit: 10
       });
-      T(queryResults.rows.length == 10)
-      T(queryResults.total_rows == docs.length)
-      T(queryResults.offset == i)
+      T(queryResults.rows.length == 10);
+      T(queryResults.total_rows == docs.length);
+      T(queryResults.offset == i);
       var j;
       for (j = 0; j < 10;j++) {
         T(queryResults.rows[j].key == i + j);
       }
+
+      // test aliases start_key and start_key_doc_id
+      queryResults = db.query(queryFun, null, {
+        start_key: i,
+        start_key_doc_id: i,
+        limit: 10
+      });
+      T(queryResults.rows.length == 10);
+      T(queryResults.total_rows == docs.length);
+      T(queryResults.offset == i);
+      for (j = 0; j < 10;j++) {
+        T(queryResults.rows[j].key == i + j);
+      }
     }
 
     // page through the view descending
@@ -46,9 +59,9 @@ couchTests.view_pagination = function(debug) {
         descending: true,
         limit: 10
       });
-      T(queryResults.rows.length == 10)
-      T(queryResults.total_rows == docs.length)
-      T(queryResults.offset == docs.length - i - 1)
+      T(queryResults.rows.length == 10);
+      T(queryResults.total_rows == docs.length);
+      T(queryResults.offset == docs.length - i - 1);
       var j;
       for (j = 0; j < 10; j++) {
         T(queryResults.rows[j].key == i - j);
@@ -63,60 +76,72 @@ couchTests.view_pagination = function(debug) {
         descending: false,
         limit: 10
       });
-      T(queryResults.rows.length == 10)
-      T(queryResults.total_rows == docs.length)
-      T(queryResults.offset == i)
+      T(queryResults.rows.length == 10);
+      T(queryResults.total_rows == docs.length);
+      T(queryResults.offset == i);
       var j;
       for (j = 0; j < 10;j++) {
         T(queryResults.rows[j].key == i + j);
       }
     }
 
+    function testEndkeyDocId(queryResults) {
+      T(queryResults.rows.length == 35);
+      T(queryResults.total_rows == docs.length);
+      T(queryResults.offset == 1);
+      T(queryResults.rows[0].id == "1");
+      T(queryResults.rows[1].id == "10");
+      T(queryResults.rows[2].id == "11");
+      T(queryResults.rows[3].id == "12");
+      T(queryResults.rows[4].id == "13");
+      T(queryResults.rows[5].id == "14");
+      T(queryResults.rows[6].id == "15");
+      T(queryResults.rows[7].id == "16");
+      T(queryResults.rows[8].id == "17");
+      T(queryResults.rows[9].id == "18");
+      T(queryResults.rows[10].id == "19");
+      T(queryResults.rows[11].id == "2");
+      T(queryResults.rows[12].id == "20");
+      T(queryResults.rows[13].id == "21");
+      T(queryResults.rows[14].id == "22");
+      T(queryResults.rows[15].id == "23");
+      T(queryResults.rows[16].id == "24");
+      T(queryResults.rows[17].id == "25");
+      T(queryResults.rows[18].id == "26");
+      T(queryResults.rows[19].id == "27");
+      T(queryResults.rows[20].id == "28");
+      T(queryResults.rows[21].id == "29");
+      T(queryResults.rows[22].id == "3");
+      T(queryResults.rows[23].id == "30");
+      T(queryResults.rows[24].id == "31");
+      T(queryResults.rows[25].id == "32");
+      T(queryResults.rows[26].id == "33");
+      T(queryResults.rows[27].id == "34");
+      T(queryResults.rows[28].id == "35");
+      T(queryResults.rows[29].id == "36");
+      T(queryResults.rows[30].id == "37");
+      T(queryResults.rows[31].id == "38");
+      T(queryResults.rows[32].id == "39");
+      T(queryResults.rows[33].id == "4");
+      T(queryResults.rows[34].id == "40");
+    }
+
     // test endkey_docid
-    var queryResults = db.query(function(doc) { emit(null, null);}, null, {
+    var queryResults = db.query(function(doc) { emit(null, null); }, null, {
       startkey: null,
       startkey_docid: 1,
       endkey: null,
       endkey_docid: 40
     });
+    testEndkeyDocId(queryResults);
 
-    T(queryResults.rows.length == 35)
-    T(queryResults.total_rows == docs.length)
-    T(queryResults.offset == 1)
-    T(queryResults.rows[0].id == "1");
-    T(queryResults.rows[1].id == "10");
-    T(queryResults.rows[2].id == "11");
-    T(queryResults.rows[3].id == "12");
-    T(queryResults.rows[4].id == "13");
-    T(queryResults.rows[5].id == "14");
-    T(queryResults.rows[6].id == "15");
-    T(queryResults.rows[7].id == "16");
-    T(queryResults.rows[8].id == "17");
-    T(queryResults.rows[9].id == "18");
-    T(queryResults.rows[10].id == "19");
-    T(queryResults.rows[11].id == "2");
-    T(queryResults.rows[12].id == "20");
-    T(queryResults.rows[13].id == "21");
-    T(queryResults.rows[14].id == "22");
-    T(queryResults.rows[15].id == "23");
-    T(queryResults.rows[16].id == "24");
-    T(queryResults.rows[17].id == "25");
-    T(queryResults.rows[18].id == "26");
-    T(queryResults.rows[19].id == "27");
-    T(queryResults.rows[20].id == "28");
-    T(queryResults.rows[21].id == "29");
-    T(queryResults.rows[22].id == "3");
-    T(queryResults.rows[23].id == "30");
-    T(queryResults.rows[24].id == "31");
-    T(queryResults.rows[25].id == "32");
-    T(queryResults.rows[26].id == "33");
-    T(queryResults.rows[27].id == "34");
-    T(queryResults.rows[28].id == "35");
-    T(queryResults.rows[29].id == "36");
-    T(queryResults.rows[30].id == "37");
-    T(queryResults.rows[31].id == "38");
-    T(queryResults.rows[32].id == "39");
-    T(queryResults.rows[33].id == "4");
-    T(queryResults.rows[34].id == "40");
+    // test aliases end_key_doc_id and end_key
+    queryResults = db.query(function(doc) { emit(null, null); }, null, {
+      start_key: null,
+      start_key_doc_id: 1,
+      end_key: null,
+      end_key_doc_id: 40
+    });
+    testEndkeyDocId(queryResults);
 
   };
diff --git a/rel/overlay/share/www/script/test/view_update_seq.js b/rel/overlay/share/www/script/test/view_update_seq.js
index 9757caa1..69b8c42d 100644
--- a/rel/overlay/share/www/script/test/view_update_seq.js
+++ b/rel/overlay/share/www/script/test/view_update_seq.js
@@ -73,17 +73,34 @@ couchTests.view_update_seq = function(debug) {
   T(resp.rows.length == 1);
   T(resp.update_seq == 101);
 
+  db.save({"id":"00"});
+  resp = db.view('test/all_docs',
+    {limit: 1, stale: "update_after", update_seq: true});
+  T(resp.rows.length == 1);
+  T(resp.update_seq == 101);
+
+  // wait 5 seconds for the next assertions to pass in very slow machines
+  var t0 = new Date(), t1;
+  do {
+    CouchDB.request("GET", "/");
+    t1 = new Date();
+  } while ((t1 - t0) < 5000);
+
+  resp = db.view('test/all_docs', {limit: 1, stale: "ok", update_seq: true});
+  T(resp.rows.length == 1);
+  T(resp.update_seq == 103);
+
   resp = db.view('test/all_docs', {limit: 1, update_seq:true});
   T(resp.rows.length == 1);
-  T(resp.update_seq == 102);
+  T(resp.update_seq == 103);
 
   resp = db.view('test/all_docs',{update_seq:true},["0","1"]);
-  T(resp.update_seq == 102);
+  T(resp.update_seq == 103);
 
   resp = db.view('test/all_docs',{update_seq:true},["0","1"]);
-  T(resp.update_seq == 102);
+  T(resp.update_seq == 103);
 
   resp = db.view('test/summate',{group:true, update_seq:true},["0","1"]);
-  T(resp.update_seq == 102);
+  T(resp.update_seq == 103);
 
 };
diff --git a/rel/overlay/share/www/style/jquery-ui-1.8.11.custom.css b/rel/overlay/share/www/style/jquery-ui-1.8.11.custom.css
new file mode 100644
index 00000000..a6b2f744
--- /dev/null
+++ b/rel/overlay/share/www/style/jquery-ui-1.8.11.custom.css
@@ -0,0 +1,347 @@
+/*
+ * jQuery UI CSS Framework 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Theming/API
+ */
+
+/* Layout helpers
+----------------------------------*/
+.ui-helper-hidden { display: none; }
+.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); }
+.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; }
+.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; }
+.ui-helper-clearfix { display: inline-block; }
+/* required comment for clearfix to work in Opera \*/
+* html .ui-helper-clearfix { height:1%; }
+.ui-helper-clearfix { display:block; }
+/* end clearfix */
+.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); }
+
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-disabled { cursor: default !important; }
+
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Overlays */
+.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; }
+
+
+/*
+ * jQuery UI CSS Framework 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Theming/API
+ *
+ * To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Trebuchet%20MS,%20Tahoma,%20Verdana,%20Arial,%20sans-serif&fwDefault=bold&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=f6a828&bgTextureHeader=12_gloss_wave.png&bgImgOpacityHeader=35&borderColorHeader=e78f08&fcHeader=ffffff&iconColorHeader=ffffff&bgColorContent=eeeeee&bgTextureContent=03_highlight_soft.png&bgImgOpacityContent=100&borderColorContent=dddddd&fcContent=333333&iconColorContent=222222&bgColorDefault=f6f6f6&bgTextureDefault=02_glass.png&bgImgOpacityDefault=100&borderColorDefault=cccccc&fcDefault=1c94c4&iconColorDefault=ef8c08&bgColorHover=fdf5ce&bgTextureHover=02_glass.png&bgImgOpacityHover=100&borderColorHover=fbcb09&fcHover=c77405&iconColorHover=ef8c08&bgColorActive=ffffff&bgTextureActive=02_glass.png&bgImgOpacityActive=65&borderColorActive=fbd850&fcActive=eb8f00&iconColorActive=ef8c08&bgColorHighlight=ffe45c&bgTextureHighlight=03_highlight_soft.png&bgImgOpacityHighlight=75&borderColorHighlight=fed22f&fcHighlight=363636&iconColorHighlight=228ef1&bgColorError=b81900&bgTextureError=08_diagonals_thick.png&bgImgOpacityError=18&borderColorError=cd0a0a&fcError=ffffff&iconColorError=ffd27a&bgColorOverlay=666666&bgTextureOverlay=08_diagonals_thick.png&bgImgOpacityOverlay=20&opacityOverlay=50&bgColorShadow=000000&bgTextureShadow=01_flat.png&bgImgOpacityShadow=10&opacityShadow=20&thicknessShadow=5px&offsetTopShadow=-5px&offsetLeftShadow=-5px&cornerRadiusShadow=5px
+ */
+
+
+/* Component containers
+----------------------------------*/
+.ui-widget { font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif; font-size: 1.1em; }
+.ui-widget .ui-widget { font-size: 1em; }
+.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif; font-size: 1em; }
+.ui-widget-content { border: 1px solid #dddddd; background: #eeeeee 50% top repeat-x; color: #333333; }
+.ui-widget-content a { color: #333333; }
+.ui-widget-header { border: 1px solid #e78f08; background: #f6a828 50% 50% repeat-x; color: #ffffff; font-weight: bold; }
+.ui-widget-header a { color: #ffffff; }
+
+/* Interaction states
+----------------------------------*/
+.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #cccccc; background: #f6f6f6 50% 50% repeat-x; font-weight: bold; color: #1c94c4; }
+.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #1c94c4; text-decoration: none; }
+.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #fbcb09; background: #fdf5ce 50% 50% repeat-x; font-weight: bold; color: #c77405; }
+.ui-state-hover a, .ui-state-hover a:hover { color: #c77405; text-decoration: none; }
+.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #fbd850; background: #ffffff 50% 50% repeat-x; font-weight: bold; color: #eb8f00; }
+.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #eb8f00; text-decoration: none; }
+.ui-widget :active { outline: none; }
+
+/* Interaction Cues
+----------------------------------*/
+.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight  {border: 1px solid #fed22f; background: #ffe45c 50% top repeat-x; color: #363636; }
+.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; }
+.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a; background: #b81900 50% 50% repeat; color: #ffffff; }
+.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #ffffff; }
+.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #ffffff; }
+.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; }
+.ui-priority-secondary, .ui-widget-content .ui-priority-secondary,  .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; }
+.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; }
+
+/* Icons
+----------------------------------*/
+
+/* states and images */
+.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); }
+.ui-widget-header .ui-icon {background-image: url(images/ui-icons_ffffff_256x240.png); }
+.ui-state-default .ui-icon { background-image: url(images/ui-icons_ef8c08_256x240.png); }
+.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_ef8c08_256x240.png); }
+.ui-state-active .ui-icon {background-image: url(images/ui-icons_ef8c08_256x240.png); }
+.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_228ef1_256x240.png); }
+.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_ffd27a_256x240.png); }
+
+/* positioning */
+.ui-icon-carat-1-n { background-position: 0 0; }
+.ui-icon-carat-1-ne { background-position: -16px 0; }
+.ui-icon-carat-1-e { background-position: -32px 0; }
+.ui-icon-carat-1-se { background-position: -48px 0; }
+.ui-icon-carat-1-s { background-position: -64px 0; }
+.ui-icon-carat-1-sw { background-position: -80px 0; }
+.ui-icon-carat-1-w { background-position: -96px 0; }
+.ui-icon-carat-1-nw { background-position: -112px 0; }
+.ui-icon-carat-2-n-s { background-position: -128px 0; }
+.ui-icon-carat-2-e-w { background-position: -144px 0; }
+.ui-icon-triangle-1-n { background-position: 0 -16px; }
+.ui-icon-triangle-1-ne { background-position: -16px -16px; }
+.ui-icon-triangle-1-e { background-position: -32px -16px; }
+.ui-icon-triangle-1-se { background-position: -48px -16px; }
+.ui-icon-triangle-1-s { background-position: -64px -16px; }
+.ui-icon-triangle-1-sw { background-position: -80px -16px; }
+.ui-icon-triangle-1-w { background-position: -96px -16px; }
+.ui-icon-triangle-1-nw { background-position: -112px -16px; }
+.ui-icon-triangle-2-n-s { background-position: -128px -16px; }
+.ui-icon-triangle-2-e-w { background-position: -144px -16px; }
+.ui-icon-arrow-1-n { background-position: 0 -32px; }
+.ui-icon-arrow-1-ne { background-position: -16px -32px; }
+.ui-icon-arrow-1-e { background-position: -32px -32px; }
+.ui-icon-arrow-1-se { background-position: -48px -32px; }
+.ui-icon-arrow-1-s { background-position: -64px -32px; }
+.ui-icon-arrow-1-sw { background-position: -80px -32px; }
+.ui-icon-arrow-1-w { background-position: -96px -32px; }
+.ui-icon-arrow-1-nw { background-position: -112px -32px; }
+.ui-icon-arrow-2-n-s { background-position: -128px -32px; }
+.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; }
+.ui-icon-arrow-2-e-w { background-position: -160px -32px; }
+.ui-icon-arrow-2-se-nw { background-position: -176px -32px; }
+.ui-icon-arrowstop-1-n { background-position: -192px -32px; }
+.ui-icon-arrowstop-1-e { background-position: -208px -32px; }
+.ui-icon-arrowstop-1-s { background-position: -224px -32px; }
+.ui-icon-arrowstop-1-w { background-position: -240px -32px; }
+.ui-icon-arrowthick-1-n { background-position: 0 -48px; }
+.ui-icon-arrowthick-1-ne { background-position: -16px -48px; }
+.ui-icon-arrowthick-1-e { background-position: -32px -48px; }
+.ui-icon-arrowthick-1-se { background-position: -48px -48px; }
+.ui-icon-arrowthick-1-s { background-position: -64px -48px; }
+.ui-icon-arrowthick-1-sw { background-position: -80px -48px; }
+.ui-icon-arrowthick-1-w { background-position: -96px -48px; }
+.ui-icon-arrowthick-1-nw { background-position: -112px -48px; }
+.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; }
+.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; }
+.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; }
+.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; }
+.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; }
+.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; }
+.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; }
+.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; }
+.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; }
+.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; }
+.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; }
+.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; }
+.ui-icon-arrowreturn-1-w { background-position: -64px -64px; }
+.ui-icon-arrowreturn-1-n { background-position: -80px -64px; }
+.ui-icon-arrowreturn-1-e { background-position: -96px -64px; }
+.ui-icon-arrowreturn-1-s { background-position: -112px -64px; }
+.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; }
+.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; }
+.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; }
+.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; }
+.ui-icon-arrow-4 { background-position: 0 -80px; }
+.ui-icon-arrow-4-diag { background-position: -16px -80px; }
+.ui-icon-extlink { background-position: -32px -80px; }
+.ui-icon-newwin { background-position: -48px -80px; }
+.ui-icon-refresh { background-position: -64px -80px; }
+.ui-icon-shuffle { background-position: -80px -80px; }
+.ui-icon-transfer-e-w { background-position: -96px -80px; }
+.ui-icon-transferthick-e-w { background-position: -112px -80px; }
+.ui-icon-folder-collapsed { background-position: 0 -96px; }
+.ui-icon-folder-open { background-position: -16px -96px; }
+.ui-icon-document { background-position: -32px -96px; }
+.ui-icon-document-b { background-position: -48px -96px; }
+.ui-icon-note { background-position: -64px -96px; }
+.ui-icon-mail-closed { background-position: -80px -96px; }
+.ui-icon-mail-open { background-position: -96px -96px; }
+.ui-icon-suitcase { background-position: -112px -96px; }
+.ui-icon-comment { background-position: -128px -96px; }
+.ui-icon-person { background-position: -144px -96px; }
+.ui-icon-print { background-position: -160px -96px; }
+.ui-icon-trash { background-position: -176px -96px; }
+.ui-icon-locked { background-position: -192px -96px; }
+.ui-icon-unlocked { background-position: -208px -96px; }
+.ui-icon-bookmark { background-position: -224px -96px; }
+.ui-icon-tag { background-position: -240px -96px; }
+.ui-icon-home { background-position: 0 -112px; }
+.ui-icon-flag { background-position: -16px -112px; }
+.ui-icon-calendar { background-position: -32px -112px; }
+.ui-icon-cart { background-position: -48px -112px; }
+.ui-icon-pencil { background-position: -64px -112px; }
+.ui-icon-clock { background-position: -80px -112px; }
+.ui-icon-disk { background-position: -96px -112px; }
+.ui-icon-calculator { background-position: -112px -112px; }
+.ui-icon-zoomin { background-position: -128px -112px; }
+.ui-icon-zoomout { background-position: -144px -112px; }
+.ui-icon-search { background-position: -160px -112px; }
+.ui-icon-wrench { background-position: -176px -112px; }
+.ui-icon-gear { background-position: -192px -112px; }
+.ui-icon-heart { background-position: -208px -112px; }
+.ui-icon-star { background-position: -224px -112px; }
+.ui-icon-link { background-position: -240px -112px; }
+.ui-icon-cancel { background-position: 0 -128px; }
+.ui-icon-plus { background-position: -16px -128px; }
+.ui-icon-plusthick { background-position: -32px -128px; }
+.ui-icon-minus { background-position: -48px -128px; }
+.ui-icon-minusthick { background-position: -64px -128px; }
+.ui-icon-close { background-position: -80px -128px; }
+.ui-icon-closethick { background-position: -96px -128px; }
+.ui-icon-key { background-position: -112px -128px; }
+.ui-icon-lightbulb { background-position: -128px -128px; }
+.ui-icon-scissors { background-position: -144px -128px; }
+.ui-icon-clipboard { background-position: -160px -128px; }
+.ui-icon-copy { background-position: -176px -128px; }
+.ui-icon-contact { background-position: -192px -128px; }
+.ui-icon-image { background-position: -208px -128px; }
+.ui-icon-video { background-position: -224px -128px; }
+.ui-icon-script { background-position: -240px -128px; }
+.ui-icon-alert { background-position: 0 -144px; }
+.ui-icon-info { background-position: -16px -144px; }
+.ui-icon-notice { background-position: -32px -144px; }
+.ui-icon-help { background-position: -48px -144px; }
+.ui-icon-check { background-position: -64px -144px; }
+.ui-icon-bullet { background-position: -80px -144px; }
+.ui-icon-radio-off { background-position: -96px -144px; }
+.ui-icon-radio-on { background-position: -112px -144px; }
+.ui-icon-pin-w { background-position: -128px -144px; }
+.ui-icon-pin-s { background-position: -144px -144px; }
+.ui-icon-play { background-position: 0 -160px; }
+.ui-icon-pause { background-position: -16px -160px; }
+.ui-icon-seek-next { background-position: -32px -160px; }
+.ui-icon-seek-prev { background-position: -48px -160px; }
+.ui-icon-seek-end { background-position: -64px -160px; }
+.ui-icon-seek-start { background-position: -80px -160px; }
+/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */
+.ui-icon-seek-first { background-position: -80px -160px; }
+.ui-icon-stop { background-position: -96px -160px; }
+.ui-icon-eject { background-position: -112px -160px; }
+.ui-icon-volume-off { background-position: -128px -160px; }
+.ui-icon-volume-on { background-position: -144px -160px; }
+.ui-icon-power { background-position: 0 -176px; }
+.ui-icon-signal-diag { background-position: -16px -176px; }
+.ui-icon-signal { background-position: -32px -176px; }
+.ui-icon-battery-0 { background-position: -48px -176px; }
+.ui-icon-battery-1 { background-position: -64px -176px; }
+.ui-icon-battery-2 { background-position: -80px -176px; }
+.ui-icon-battery-3 { background-position: -96px -176px; }
+.ui-icon-circle-plus { background-position: 0 -192px; }
+.ui-icon-circle-minus { background-position: -16px -192px; }
+.ui-icon-circle-close { background-position: -32px -192px; }
+.ui-icon-circle-triangle-e { background-position: -48px -192px; }
+.ui-icon-circle-triangle-s { background-position: -64px -192px; }
+.ui-icon-circle-triangle-w { background-position: -80px -192px; }
+.ui-icon-circle-triangle-n { background-position: -96px -192px; }
+.ui-icon-circle-arrow-e { background-position: -112px -192px; }
+.ui-icon-circle-arrow-s { background-position: -128px -192px; }
+.ui-icon-circle-arrow-w { background-position: -144px -192px; }
+.ui-icon-circle-arrow-n { background-position: -160px -192px; }
+.ui-icon-circle-zoomin { background-position: -176px -192px; }
+.ui-icon-circle-zoomout { background-position: -192px -192px; }
+.ui-icon-circle-check { background-position: -208px -192px; }
+.ui-icon-circlesmall-plus { background-position: 0 -208px; }
+.ui-icon-circlesmall-minus { background-position: -16px -208px; }
+.ui-icon-circlesmall-close { background-position: -32px -208px; }
+.ui-icon-squaresmall-plus { background-position: -48px -208px; }
+.ui-icon-squaresmall-minus { background-position: -64px -208px; }
+.ui-icon-squaresmall-close { background-position: -80px -208px; }
+.ui-icon-grip-dotted-vertical { background-position: 0 -224px; }
+.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; }
+.ui-icon-grip-solid-vertical { background-position: -32px -224px; }
+.ui-icon-grip-solid-horizontal { background-position: -48px -224px; }
+.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; }
+.ui-icon-grip-diagonal-se { background-position: -80px -224px; }
+
+
+/* Misc visuals
+----------------------------------*/
+
+/* Corner radius */
+.ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; }
+.ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; }
+.ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; }
+.ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-top { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; }
+.ui-corner-bottom { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-right {  -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; }
+.ui-corner-left { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; }
+.ui-corner-all { -moz-border-radius: 4px; -webkit-border-radius: 4px; border-radius: 4px; }
+
+/* Overlays */
+.ui-widget-overlay { background: #666666 50% 50% repeat; opacity: .50;filter:Alpha(Opacity=50); }
+.ui-widget-shadow { margin: -5px 0 0 -5px; padding: 5px; background: #000000 50% 50% repeat-x; opacity: .20;filter:Alpha(Opacity=20); -moz-border-radius: 5px; -webkit-border-radius: 5px; border-radius: 5px; }/*
+ * jQuery UI Autocomplete 1.8.11
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Autocomplete#theming
+ */
+.ui-autocomplete { position: absolute; cursor: default; }	
+
+/* workarounds */
+* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */
+
+/*
+ * jQuery UI Menu 1.8.11
+ *
+ * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Menu#theming
+ */
+.ui-menu {
+	list-style:none;
+	padding: 2px;
+	margin: 0;
+	display:block;
+	float: left;
+}
+.ui-menu .ui-menu {
+	margin-top: -3px;
+}
+.ui-menu .ui-menu-item {
+	margin:0;
+	padding: 0;
+	zoom: 1;
+	float: left;
+	clear: left;
+	width: 100%;
+}
+.ui-menu .ui-menu-item a {
+	text-decoration:none;
+	display:block;
+	padding:.2em .4em;
+	line-height:1.5;
+	zoom:1;
+}
+.ui-menu .ui-menu-item a.ui-state-hover,
+.ui-menu .ui-menu-item a.ui-state-active {
+	font-weight: normal;
+	margin: -1px;
+}
diff --git a/rel/overlay/share/www/style/layout.css b/rel/overlay/share/www/style/layout.css
index a8abd491..331e0369 100644
--- a/rel/overlay/share/www/style/layout.css
+++ b/rel/overlay/share/www/style/layout.css
@@ -39,7 +39,7 @@ h1 :link.raw, h1 :visited.raw {
   right: 20px; width: 35px; height: 100%; padding: 0; margin: 0;
 }
 body.loading h1 strong {
-  background: url(../image/spinner.gif) right center no-repeat;
+  background: url(../image/spinner_33.gif) right center no-repeat;
 }
 
 hr { border: 1px solid #999; border-width: 1px 0 0; }
@@ -55,7 +55,7 @@ code.null { color: #666; }
 button { font-size: 100%; -webkit-appearance: square-button; }
 button[disabled] { color: #999; }
 input, select, textarea { background: #fff; border: 1px solid;
-  border-color: #999 #ddd #ddd #999; margin: 0; padding: 1px;
+  border-color: #999 #ddd #ddd #999; color: #000; margin: 0; padding: 1px;
 }
 input.placeholder { color: #999; }
 textarea {
@@ -268,7 +268,7 @@ body.fullwidth #wrap { margin-right: 0; }
   font-size: 110%; font-weight: bold; margin: 0 -1em; padding: .35em 1em;
 }
 body.loading #dialog h2 {
-  background-image: url(../image/spinner.gif);
+  background-image: url(../image/spinner_6b.gif);
 }
 #dialog h3 { color: #ccc; font-size: 100%; font-weight: bold; margin: 0 -2em;
   padding: .35em 2em 0;
diff --git a/test/etap/072-cleanup.t b/test/etap/072-cleanup.t
new file mode 100755
index 00000000..61790bc6
--- /dev/null
+++ b/test/etap/072-cleanup.t
@@ -0,0 +1,130 @@
+#!/usr/bin/env escript
+%% -*- erlang -*-
+
+% Licensed under the Apache License, Version 2.0 (the "License"); you may not
+% use this file except in compliance with the License. You may obtain a copy of
+% the License at
+%
+%   http://www.apache.org/licenses/LICENSE-2.0
+%
+% Unless required by applicable law or agreed to in writing, software
+% distributed under the License is distributed on an "AS IS" BASIS, WITHOUT
+% WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the
+% License for the specific language governing permissions and limitations under
+% the License.
+
+-define(TEST_DB, <<"etap-test-db">>).
+
+-record(user_ctx, {
+    name = null,
+    roles = [],
+    handler
+}).
+
+-define(ADMIN_USER, #user_ctx{roles=[<<"_admin">>]}).
+
+main(_) ->
+    test_util:init_code_path(),
+
+    etap:plan(7),
+    try test() of
+        ok ->
+            etap:end_tests()
+    catch
+        Other ->
+            etap:diag(io_lib:format("Test died abnormally: ~p", [Other])),
+            timer:sleep(1000),
+            etap:bail(Other)
+    end,
+    ok.
+
+test() ->
+
+    {ok, _} = couch_server_sup:start_link(test_util:config_files()),
+    ok = application:start(inets),
+    couch_server:delete(?TEST_DB, []),
+    timer:sleep(1000),
+
+    couch_db:create(?TEST_DB, []),
+
+    {ok, AllDbs} = couch_server:all_databases(),
+    etap:ok(lists:member(?TEST_DB, AllDbs), "Database was created."),
+
+    FooRev = create_design_doc(<<"_design/foo">>, <<"bar">>),
+    query_view("foo", "bar"),
+
+    BoozRev = create_design_doc(<<"_design/booz">>, <<"baz">>),
+    query_view("booz", "baz"),
+
+    {ok, Db} = couch_db:open(?TEST_DB, [{user_ctx, ?ADMIN_USER}]),
+    view_cleanup(),
+    etap:is(count_index_files(), 2,
+        "Two index files before any deletions."),
+
+    delete_design_doc(<<"_design/foo">>, FooRev),
+    view_cleanup(),
+    etap:is(count_index_files(), 1,
+        "One index file after first deletion and cleanup."),
+
+    delete_design_doc(<<"_design/booz">>, BoozRev),
+    view_cleanup(),
+    etap:is(count_index_files(), 0,
+        "No index files after second deletion and cleanup."),
+
+    couch_server:delete(?TEST_DB, []),
+    {ok, AllDbs2} = couch_server:all_databases(),
+    etap:ok(not lists:member(?TEST_DB, AllDbs2),
+        "Database was deleted."),
+    ok.
+
+create_design_doc(DDName, ViewName) ->
+    {ok, Db} = couch_db:open(?TEST_DB, [{user_ctx, ?ADMIN_USER}]),
+    DDoc = couch_doc:from_json_obj({[
+        {<<"_id">>, DDName},
+        {<<"language">>, <<"javascript">>},
+        {<<"views">>, {[
+            {ViewName, {[
+                {<<"map">>, <<"function(doc) { emit(doc.value, 1); }">>}
+            ]}}
+        ]}}
+    ]}),
+    {ok, Rev} = couch_db:update_doc(Db, DDoc, []),
+    couch_db:ensure_full_commit(Db),
+    couch_db:close(Db),
+    Rev.
+
+delete_design_doc(DDName, Rev) ->
+    {ok, Db} = couch_db:open(?TEST_DB, [{user_ctx, ?ADMIN_USER}]),
+    DDoc = couch_doc:from_json_obj({[
+        {<<"_id">>, DDName},
+        {<<"_rev">>, couch_doc:rev_to_str(Rev)},
+        {<<"_deleted">>, true}
+    ]}),
+    {ok, _} = couch_db:update_doc(Db, DDoc, [Rev]),
+    couch_db:close(Db).
+
+db_url() ->
+    Addr = couch_config:get("httpd", "bind_address", "127.0.0.1"),
+    Port = integer_to_list(mochiweb_socket_server:get(couch_httpd, port)),
+    "http://" ++ Addr ++ ":" ++ Port ++ "/" ++
+        binary_to_list(?TEST_DB).
+
+query_view(DDoc, View) ->
+    {ok, {{_, Code, _}, _Headers, _Body}} = http:request(
+        get,
+        {db_url() ++ "/_design/" ++ DDoc ++ "/_view/" ++ View, []},
+        [],
+        [{sync, true}]),
+    etap:is(Code, 200, "Built view index for " ++ DDoc ++ "."),
+    ok.
+
+view_cleanup() ->
+    {ok, Db} = couch_db:open(?TEST_DB, [{user_ctx, ?ADMIN_USER}]),
+    couch_view:cleanup_index_files(Db),
+    couch_db:close(Db).
+
+count_index_files() ->
+    % call server to fetch the index files
+    RootDir = couch_config:get("couchdb", "view_index_dir"),
+    length(filelib:wildcard(RootDir ++ "/." ++
+        binary_to_list(?TEST_DB) ++ "_design"++"/*")).